{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "90a12940-1331-4fd9-adcb-6079280a9091",
          "code": "RTI-55",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/RTI-55",
          "code_system": "WIKIPEDIA",
          "references": [
            "f8b5fa5d-291c-45c8-a158-307c70c86b3c"
          ]
        },
        {
          "uuid": "27425b09-3d9f-4468-b2c7-8dd44402fa08",
          "code": "135416-43-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=135416-43-2",
          "code_system": "CAS",
          "references": [
            "f8b5fa5d-291c-45c8-a158-307c70c86b3c",
            "8d47ef99-1cbe-4ecd-b52e-721d1693a794"
          ]
        },
        {
          "uuid": "15e404f5-e057-40e4-b97b-41b72834f380",
          "code": "108220",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/108220",
          "code_system": "PUBCHEM",
          "references": [
            "f8b5fa5d-291c-45c8-a158-307c70c86b3c"
          ]
        },
        {
          "uuid": "68cbc4b6-4d95-4c26-8f59-cf9d15abd52e",
          "code": "4H1Z7121WS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fb543033-f773-ab16-9e92-5aa5becd7faa",
          "code": "DTXSID801126429",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801126429",
          "code_system": "EPA CompTox",
          "references": [
            "8bc51d0a-5038-6ead-fc47-a4a7ac30cf33"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2755e543-e061-4ac1-a418-9beab0b8442e",
          "amount": {
            "uuid": "366bbcbb-a9c4-4f63-9ddc-2950dca251b6"
          },
          "type": "LABELED->NON-LABELED",
          "related_substance": {
            "uuid": "c617a3c6-5f71-48dd-aa84-b486af5aa39b",
            "refuuid": "b6bffa0e-5cc9-4b41-aea7-849259ed459f",
            "name": "IOMETOPANE I-123",
            "unii": "719Y64M4R6",
            "linking_id": "719Y64M4R6",
            "ref_pname": "IOMETOPANE I-123",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "06262885-3eae-4b85-9617-08bfed6c1997",
          "amount": {
            "uuid": "5fca2dea-7fb1-49ce-a8d3-a262bf1918f9"
          },
          "type": "LABELED->NON-LABELED",
          "related_substance": {
            "uuid": "9ef41eeb-0d9e-4502-85d9-a03a63331fda",
            "refuuid": "fc7e38b2-2943-4e4b-9781-f38c508f2bb0",
            "name": "IOMETOPANE I-124",
            "unii": "E3F4W5J90T",
            "linking_id": "E3F4W5J90T",
            "ref_pname": "IOMETOPANE I-124",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "126742f0-09bd-4343-a119-8d27769b5eb1",
          "amount": {
            "uuid": "43b29569-4fae-401d-b54b-ef286d18c78f"
          },
          "type": "LABELED->NON-LABELED",
          "references": [
            "6be9d959-61d8-4336-87ce-a173097a894c"
          ],
          "related_substance": {
            "uuid": "11f1c586-fee5-45ab-bbc6-3cd3d0e863fb",
            "refuuid": "81e5b65f-0cd2-41b3-8000-d3e9e3dae292",
            "name": "Iometopane C-11",
            "unii": "UCG49U24QP",
            "linking_id": "UCG49U24QP",
            "ref_pname": "Iometopane C-11",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a9948347-ebc8-4828-9f49-c4a7889a12d6",
          "name": ".BETA.-CIT",
          "stdName": ".BETA.-CIT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f00fb739-a88a-42d8-b069-5c87eb4a1ee1",
            "12a93af8-d093-4acc-9f59-45cf7c0bad73"
          ],
          "display_name": false
        },
        {
          "uuid": "1f5d51a3-9b86-4244-a01d-b8c3e52c8ac0",
          "name": "8-AZABICYCLO(3.2.1)OCTANE-2-CARBOXYLIC ACID, 3-(4-IODOPHENYL)-8-METHYL-, METHYL ESTER, (1R-(EXO,EXO))-",
          "stdName": "8-AZABICYCLO(3.2.1)OCTANE-2-CARBOXYLIC ACID, 3-(4-IODOPHENYL)-8-METHYL-, METHYL ESTER, (1R-(EXO,EXO))-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f00fb739-a88a-42d8-b069-5c87eb4a1ee1",
            "12a93af8-d093-4acc-9f59-45cf7c0bad73"
          ],
          "display_name": false
        },
        {
          "uuid": "eb53ffed-1280-4caa-a3bf-4dbaae524c00",
          "name": "IOMETOPANE",
          "stdName": "IOMETOPANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f00fb739-a88a-42d8-b069-5c87eb4a1ee1",
            "12a93af8-d093-4acc-9f59-45cf7c0bad73"
          ],
          "display_name": true
        },
        {
          "uuid": "c57f8744-9200-4b5a-abd4-1620c3ae753b",
          "name": "RTI 4229-98",
          "stdName": "RTI 4229-98",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f00fb739-a88a-42d8-b069-5c87eb4a1ee1",
            "12a93af8-d093-4acc-9f59-45cf7c0bad73"
          ],
          "display_name": false
        },
        {
          "uuid": "914d3796-11d9-4167-b001-4ae815166c06",
          "name": "RTI-55",
          "stdName": "RTI-55",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f00fb739-a88a-42d8-b069-5c87eb4a1ee1",
            "12a93af8-d093-4acc-9f59-45cf7c0bad73"
          ],
          "display_name": false
        },
        {
          "uuid": "d9389413-84c7-4137-a49e-d43c7e856dd6",
          "name": "RTI55",
          "stdName": "RTI55",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f00fb739-a88a-42d8-b069-5c87eb4a1ee1",
            "12a93af8-d093-4acc-9f59-45cf7c0bad73"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "12a93af8-d093-4acc-9f59-45cf7c0bad73",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f00fb739-a88a-42d8-b069-5c87eb4a1ee1",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8b5fa5d-291c-45c8-a158-307c70c86b3c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392693000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "599abe64-ee35-4717-96ec-0d870767eebe",
          "citation": "SRS import [4H1Z7121WS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4H1Z7121WS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392693000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6be9d959-61d8-4336-87ce-a173097a894c",
          "citation": "Müller, Lars, et al. \"[11C] β-CIT, a cocaine analogue. Preparation, autoradiography and preliminary PET investigations.\" Nuclear medicine and biology 20.3 (1993): 249-255.",
          "url": "https://www.sciencedirect.com/science/article/pii/096980519390045V",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "8d47ef99-1cbe-4ecd-b52e-721d1693a794",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8bc51d0a-5038-6ead-fc47-a4a7ac30cf33",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b8a4f01d-2b84-4be7-9f72-a902e1016f66",
          "id": "b8a4f01d-2b84-4be7-9f72-a902e1016f66",
          "molfile": "\n  Marvin  01132109332D          \n\n 20 22  0  0  1  0            999 V2000\n    6.7570  -11.9930    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.1065  -11.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1065  -10.6448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7617  -10.1286    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.2586  -11.0847    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1530  -11.6012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5696  -10.3146    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.9760   -9.5979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5600   -8.8853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7982   -9.5979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2047   -8.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9282  -11.0655    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.5649  -11.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7505  -11.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1616  -10.3531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9794  -10.3531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3953  -11.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2176  -11.0655    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9794  -11.7779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1568  -11.7779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  1  0  0  0\n  1 13  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  7  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7 12  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 20 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)c3ccc(cc3)I)C(=O)OC",
          "formula": "C16H20INO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c534b3da-2f84-4db1-b45c-ff46fc45109a"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "385.2406",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "72ef646b-09eb-4a1d-8a5f-3a7eaffcea46",
      "version": "5",
      "structure": {
        "id": "76cc226a-e8be-4485-aa30-cb199758915d",
        "molfile": "\n  Marvin  01132106102D          \n\n 20 22  0  0  1  0            999 V2000\n    7.5693  -10.3143    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7567  -11.9926    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9279  -11.0651    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.7614  -10.1282    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.2584  -11.0843    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1527  -11.6007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5646  -11.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7502  -11.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1613  -10.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9790  -10.3527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3949  -11.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2172  -11.0651    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9790  -11.7775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1565  -11.7775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1063  -11.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1063  -10.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9757   -9.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5597   -8.8850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7979   -9.5975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2044   -8.8706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  2  5  1  1  0  0  0\n  4  5  1  1  0  0  0\n  6  5  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  3  1  0  0  0  0\n  3  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14  8  2  0  0  0  0\n  2 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16  4  1  0  0  0  0\n  1 17  1  1  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
        "smiles": "CN1[C@H]2CC[C@@H]1[C@H]([C@H](C2)c3ccc(cc3)I)C(=O)OC",
        "formula": "C16H20INO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "385.2406",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "599abe64-ee35-4717-96ec-0d870767eebe",
          "12a93af8-d093-4acc-9f59-45cf7c0bad73"
        ],
        "stereo_centers": 4
      },
      "unii": "4H1Z7121WS"
    }
  ]
}