{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "391717dd-244a-4cb3-9557-d79613b1e3cd",
          "code": "77872-43-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=77872-43-6",
          "code_system": "CAS",
          "references": [
            "3ada0908-2a00-4725-b361-505360f69dba",
            "4e197c42-8da4-4c2b-8b7a-5b74ce6da0fc"
          ]
        },
        {
          "uuid": "e580fb86-0df0-4ff4-a9f6-9f4da183dfd3",
          "code": "4-HO-MIPT",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/4-HO-MiPT",
          "code_system": "WIKIPEDIA",
          "references": [
            "3ada0908-2a00-4725-b361-505360f69dba"
          ]
        },
        {
          "uuid": "71e57f5d-93f5-43d2-aa8f-b8708990abca",
          "code": "SUB178326",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3ada0908-2a00-4725-b361-505360f69dba"
          ]
        },
        {
          "uuid": "e8ce8537-8c96-425c-ba95-ba613342d055",
          "code": "10082683",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10082683",
          "code_system": "PUBCHEM",
          "references": [
            "3ada0908-2a00-4725-b361-505360f69dba"
          ]
        },
        {
          "uuid": "aa8c9b65-0ff5-274c-e80a-4166004953e0",
          "code": "TiHKAL",
          "comments": "Wikipedia|TiHKAL|Tryptamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/TiHKAL",
          "code_system": "WIKIPEDIA",
          "references": [
            "33098d78-e764-7f07-45f6-019874dc4202"
          ]
        },
        {
          "uuid": "562e12d7-4c73-0b0a-62fe-03b0351fd32b",
          "code": "DTXSID30228492",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30228492",
          "code_system": "EPA CompTox",
          "references": [
            "b951cd11-b947-5cb6-7869-c2cf27a49a26"
          ]
        },
        {
          "uuid": "4a1fb73a-46e8-4755-bb8e-60a08b89fb48",
          "code": "4GAJ9OJ8YZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3d409d2b-ac10-a50f-ddb1-efc7d9882af2",
          "code": "Designer-drugs-4-HO-MiPT",
          "comments": "Wikipedia|List of designer drugs|Psychedelics|Tryptamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "33098d78-e764-7f07-45f6-019874dc4202"
          ]
        },
        {
          "uuid": "43c6bd24-f4bf-0fdc-d91b-828a6d26ac50",
          "code": "100000163995",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "67fbcf41-9981-7cd5-e041-61f7e9f8bfb2"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0e463f5a-9706-435c-85f9-fbaf711c7437",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "583b2bae-a6de-4023-8a29-a5ee6e36f477",
            "refuuid": "ca3a138b-a7fb-4620-bb67-26eebcd6e6d3",
            "name": "4-HYDROXY-N-METHYL-N-ISOPROPYLTRYPTAMINE",
            "unii": "4GAJ9OJ8YZ",
            "linking_id": "4GAJ9OJ8YZ",
            "ref_pname": "4-HYDROXY-N-METHYL-N-ISOPROPYLTRYPTAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cc136b0f-2a12-4ba1-9037-32c059c028d8",
          "name": "4-HO-MIPT",
          "stdName": "4-HO-MIPT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a2272e8-d626-4e34-8750-7f39ad7344a9",
            "f8ee9313-8ff7-4216-a172-8c3926960199"
          ],
          "display_name": false
        },
        {
          "uuid": "afac2226-022a-4f7a-83dc-c0cd50927833",
          "name": "4-HYDROXY-MIPT",
          "stdName": "4-HYDROXY-MIPT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b511f5c6-37ec-4a52-a471-d083b1f21d56",
            "f8ee9313-8ff7-4216-a172-8c3926960199"
          ],
          "display_name": false
        },
        {
          "uuid": "12b838dd-ff1e-410d-9b89-17bf528aadf7",
          "name": "4-HYDROXY-N-METHYL-N-ISOPROPYLTRYPTAMINE",
          "stdName": "4-HYDROXY-N-METHYL-N-ISOPROPYLTRYPTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8ee9313-8ff7-4216-a172-8c3926960199",
            "e9ce07ba-853f-4905-8e6e-51f1fd9549ca"
          ],
          "display_name": true
        },
        {
          "uuid": "30f0b3e4-1ea9-446e-b558-0f0ce218871e",
          "name": "HATS",
          "stdName": "HATS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7be5bbb-31a1-435e-9987-a423c99fdba9",
            "f8ee9313-8ff7-4216-a172-8c3926960199"
          ],
          "display_name": false
        },
        {
          "uuid": "34b31997-3224-44fb-a01a-3d1f5b11db78",
          "name": "MIPROCIN",
          "stdName": "MIPROCIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7be5bbb-31a1-435e-9987-a423c99fdba9",
            "f8ee9313-8ff7-4216-a172-8c3926960199"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e9ce07ba-853f-4905-8e6e-51f1fd9549ca",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/77872-43-6",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/77872-43-6",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f8ee9313-8ff7-4216-a172-8c3926960199",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7be5bbb-31a1-435e-9987-a423c99fdba9",
          "citation": "https://psychonautwiki.org/wiki/4-HO-MiPT",
          "url": "https://psychonautwiki.org/wiki/4-HO-MiPT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a2272e8-d626-4e34-8750-7f39ad7344a9",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b511f5c6-37ec-4a52-a471-d083b1f21d56",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ada0908-2a00-4725-b361-505360f69dba",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393214000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71e5073e-72ac-445d-91c8-cb35f961914b",
          "citation": "SRS import [4GAJ9OJ8YZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4GAJ9OJ8YZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393214000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6f19933-4ccf-4580-b400-419ee2314603",
          "citation": "CHEMID RECORD 77872-43-6",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b951cd11-b947-5cb6-7869-c2cf27a49a26",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=77872-43-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "67fbcf41-9981-7cd5-e041-61f7e9f8bfb2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "33098d78-e764-7f07-45f6-019874dc4202",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4e197c42-8da4-4c2b-8b7a-5b74ce6da0fc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "18c36fd2-df0b-4088-b151-f741d5740b49",
          "id": "18c36fd2-df0b-4088-b151-f741d5740b49",
          "molfile": "\n  Marvin  01132101282D          \n\n 17 18  0  0  0  0            999 V2000\n   -3.1100   -2.9382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3031   -3.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0481   -3.8943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7510   -2.4966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9441   -2.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0060   -1.7120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8129   -1.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0679   -0.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5830   -0.0884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0679    0.5790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8525    0.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5670    0.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.2814    0.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.2814   -0.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5670   -0.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5670   -1.7384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8525   -0.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 17  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 17  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\nM  END",
          "smiles": "CC(C)N(C)CCc1c[nH]c2cccc(c12)O",
          "formula": "C14H20N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "864f7e89-b6a5-4322-bb81-8ddf912d2761"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "232.3219",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ca3a138b-a7fb-4620-bb67-26eebcd6e6d3",
      "version": "6",
      "structure": {
        "id": "a275313e-d7a5-4678-a3ba-de928a08d94c",
        "molfile": "\n  Marvin  01132108262D          \n\n 17 18  0  0  0  0            999 V2000\n   -4.5670    0.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.2814    0.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.2814   -0.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5670   -0.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8525   -0.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8525    0.3241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0679    0.5790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0679   -0.7558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5830   -0.0884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5670   -1.7384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8129   -1.5405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0060   -1.7120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7510   -2.4966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9441   -2.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3031   -3.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1100   -2.9382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0481   -3.8943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  2  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8  9  2  0  0  0  0\n  4 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\nM  END",
        "smiles": "CC(C)N(C)CCc1c[nH]c2cccc(c12)O",
        "formula": "C14H20N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "232.3219",
        "optical_activity": "NONE",
        "references": [
          "a6f19933-4ccf-4580-b400-419ee2314603",
          "71e5073e-72ac-445d-91c8-cb35f961914b"
        ],
        "stereo_centers": 0
      },
      "unii": "4GAJ9OJ8YZ"
    }
  ]
}