{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0530b860-0371-410e-ad63-44dca0448c92", "code": "203313-25-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=203313-25-1", "code_system": "CAS", "references": [ "6bea7ae5-80fc-4920-8243-e8d725ba3e65", "aaa5e8d6-25c3-44e9-bc7f-30353b0ab867" ] }, { "uuid": "4d965b95-fa18-4090-893b-713bcfe3ffa7", "code": "392201", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3927", "code_system": "EPA PESTICIDE CODE", "references": [ "6bea7ae5-80fc-4920-8243-e8d725ba3e65" ] }, { "uuid": "db033985-1a42-4eaa-abe5-e6bc481a0db8", "code": "m10158", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m10158?q=authorize", "code_system": "MERCK INDEX", "references": [ "6bea7ae5-80fc-4920-8243-e8d725ba3e65" ] }, { "uuid": "46fcb0af-8d0e-4276-9bd3-2eae86d7ed7b", "code": "9969573", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9969573", "code_system": "PUBCHEM", "references": [ "6bea7ae5-80fc-4920-8243-e8d725ba3e65" ] }, { "uuid": "b707e688-5d17-7951-5503-a6554dc30d8f", "code": "DTXSID7044342", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7044342", "code_system": "EPA CompTox", "references": [ "14ac18db-6a60-76ab-c689-edd33b8a413b" ] }, { "uuid": "d5b5f2dd-c0de-4cef-8d95-e3dc2226e975", "code": "4G7KR034OX", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "01a81c02-da60-0e5a-f77f-70080d9d633d", "code": "Spirotetramat", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Spirotetramat", "code_system": "WIKIPEDIA", "references": [ "003db558-328a-96a8-49af-5c8ca6d276be" ] }, { "uuid": "9c85afe2-ed87-dc32-2137-27fbbe4f2d63", "code": "spirotetramat", "type": "PRIMARY", "url": "https://pesticidecompendium.bcpc.org/spirotetramat.html", "code_system": "ALANWOOD", "references": [ "0e7c7100-508b-6a25-a002-1b870efef1ff" ] } ], "substance_class": "chemical", "names": [ { "uuid": "811b9e4d-d622-48c3-8143-e766e1f880d6", "name": "CIS-3-(2,5-DIMETHYLPHENYL)-8-METHOXY-2-OXO-1-AZASPIRO(4.5)DEC-3-EN-4-YL ETHYL CARBONATE", "stdName": "CIS-3-(2,5-DIMETHYLPHENYL)-8-METHOXY-2-OXO-1-AZASPIRO(4.5)DEC-3-EN-4-YL ETHYL CARBONATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4d646560-4702-434e-b4a0-81cfc9856212", "fb18d82b-13a5-44af-b388-318e558c6160" ], "display_name": false }, { "uuid": "56a2f13d-bb73-48c8-9838-f624e804fd39", "name": "CIS-4-(ETHOXYCARBONYLOXY)-8-METHOXY-3-(2,5-XYLYL)-1-AZASPIRO(4.5)DEC-3-EN-2-ONE", "stdName": "CIS-4-(ETHOXYCARBONYLOXY)-8-METHOXY-3-(2,5-XYLYL)-1-AZASPIRO(4.5)DEC-3-EN-2-ONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4d646560-4702-434e-b4a0-81cfc9856212", "d35bfcd4-04a8-4988-839d-2fe7f01a650e" ], "display_name": false }, { "uuid": "b08dbd21-2c9d-4811-9eac-908d434b007e", "name": "SPIROTETRAMAT", "stdName": "SPIROTETRAMAT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "eaca7e0d-9311-4a4f-abc5-91e9b0beb8cf", "ffaf0c1f-5e61-431a-a8e6-72668b3c9256", "5732b05a-b3ff-44e8-a4bc-9bfbf6452197", "f73cf2cd-cdde-40f2-9008-b8bf615737e8", "2f861d30-29d1-45ed-bd96-b01fb339ac24", "8f0759d4-b1c8-47dc-8d9f-1baa95a87762" ], "display_name": true }, { "uuid": "515453f0-0470-49b1-b10f-3479e4c29d83", "name": "SPIROTETRAMAT [ISO]", "stdName": "SPIROTETRAMAT [ISO]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2f861d30-29d1-45ed-bd96-b01fb339ac24", "8f0759d4-b1c8-47dc-8d9f-1baa95a87762" ], "display_name": false }, { "uuid": "327674fc-b9f6-4a7d-94b1-4c683240dc8e", "name": "SPIROTETRAMAT [MI]", "stdName": "SPIROTETRAMAT [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5732b05a-b3ff-44e8-a4bc-9bfbf6452197", "8f0759d4-b1c8-47dc-8d9f-1baa95a87762" ], "display_name": false } ], "references": [ { "uuid": "f73cf2cd-cdde-40f2-9008-b8bf615737e8", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4d646560-4702-434e-b4a0-81cfc9856212", "citation": "ALANWOOD.NET", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d35bfcd4-04a8-4988-839d-2fe7f01a650e", "citation": "ALANWOOD IUPAC", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fb18d82b-13a5-44af-b388-318e558c6160", "citation": "ALANWOOD CAS", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2f861d30-29d1-45ed-bd96-b01fb339ac24", "citation": "http://www.alanwood.net/pesticides/spirotetramat.html", "url": "http://www.alanwood.net/pesticides/spirotetramat.html", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8f0759d4-b1c8-47dc-8d9f-1baa95a87762", "citation": "ISO", "doc_type": "ISO", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5732b05a-b3ff-44e8-a4bc-9bfbf6452197", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6bea7ae5-80fc-4920-8243-e8d725ba3e65", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390914000, "tags": [ "NOMEN" ] }, { "uuid": "cf7c2ecf-f247-4152-835c-ab7fe094947b", "citation": "SRS import [4G7KR034OX]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4G7KR034OX", "doc_type": "SRS", "public_domain": true, "document_date": 1493390914000, "tags": [ "NOMEN" ] }, { "uuid": "f1bebc73-d7fd-43ce-bcf7-efed84edd7f3", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ffaf0c1f-5e61-431a-a8e6-72668b3c9256", "citation": "SPIROTETRAMAT [ISO]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "eaca7e0d-9311-4a4f-abc5-91e9b0beb8cf", "citation": "SPIROTETRAMAT [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "14ac18db-6a60-76ab-c689-edd33b8a413b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=203313-25-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "003db558-328a-96a8-49af-5c8ca6d276be", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "0e7c7100-508b-6a25-a002-1b870efef1ff", "citation": "BCPC", "doc_type": "ALANWOOD", "public_domain": true }, { "uuid": "aaa5e8d6-25c3-44e9-bc7f-30353b0ab867", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "acc99489-bb08-45cd-a5d8-a4795c814d16", "id": "acc99489-bb08-45cd-a5d8-a4795c814d16", "molfile": "\n Marvin 01132108582D \n\n 27 29 0 0 0 0 999 V2000\n 3.7439 -5.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3232 -5.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1204 -5.5644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6997 -6.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4835 -6.9462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4969 -5.9353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2818 -6.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5348 -6.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3644 -6.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8473 -7.6436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6176 -6.1907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9473 -5.7048 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.6604 -5.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6604 -4.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9473 -4.0502 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.2341 -4.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2341 -5.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9473 -3.2252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6632 -2.8127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0500 -7.6423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2297 -7.5499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7406 -8.2166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9208 -8.1282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0756 -8.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9004 -9.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3856 -8.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2057 -8.4753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 12 7 1 6 0 0 0\n 8 9 1 0 0 0 0\n 8 20 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 12 11 1 1 0 0 0\n 12 13 1 0 0 0 0\n 17 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 18 1 1 0 0 0\n 16 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 26 20 2 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "CCOC(=O)OC1=C(c2cc(C)ccc2C)C(=O)N[C@]31CC[C@@H](CC3)OC", "formula": "C21H27NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a51f9315-f297-4672-ad3d-2fb7dfc346ac" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "373.4436", "optical_activity": "UNSPECIFIED", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "86366243-869d-41af-b810-b3ed4768db06", "version": "6", "structure": { "id": "49b6525f-1a89-41b0-b94f-8f2faa0cf418", "molfile": "\n Marvin 01132103522D \n\n 27 29 0 0 1 0 999 V2000\n 6.4969 -5.9353 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6997 -6.1485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1204 -5.5644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3232 -5.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7439 -5.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4835 -6.9462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2818 -6.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9473 -5.7048 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.2341 -5.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2341 -4.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9473 -4.0502 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.6604 -4.4673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6604 -5.2923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9473 -3.2252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6632 -2.8127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6176 -6.1907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3644 -6.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8473 -7.6436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5348 -6.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0500 -7.6423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2297 -7.5499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7406 -8.2166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0756 -8.9730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9004 -9.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3856 -8.3907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2057 -8.4753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9208 -8.1282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 2 6 2 0 0 0 0\n 7 1 1 0 0 0 0\n 8 7 1 6 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 8 13 1 0 0 0 0\n 11 14 1 1 0 0 0\n 14 15 1 0 0 0 0\n 8 16 1 1 0 0 0\n 17 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 19 17 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 20 1 0 0 0 0\n 25 26 1 0 0 0 0\n 22 27 1 0 0 0 0\n 7 19 2 0 0 0 0\nM END", "smiles": "CCOC(=O)OC1=C(c2cc(C)ccc2C)C(=O)N[C@]31CC[C@@H](CC3)OC", "formula": "C21H27NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "373.4436", "optical_activity": "UNSPECIFIED", "references": [ "cf7c2ecf-f247-4152-835c-ab7fe094947b", "f1bebc73-d7fd-43ce-bcf7-efed84edd7f3" ], "stereo_centers": 0 }, "unii": "4G7KR034OX" } ] }