{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "78893664-2975-4bd7-b5e7-c8e60c8c472a",
          "code": "64703-98-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=64703-98-6",
          "code_system": "CAS",
          "references": [
            "77895e58-6f78-48d3-95ef-e3d8a1067bda",
            "6e15fc46-e0d1-43eb-88b2-83c785830831"
          ]
        },
        {
          "uuid": "701bb76e-9cd8-4999-acc3-8ea60a0198bc",
          "code": "44390556",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44390556",
          "code_system": "PUBCHEM",
          "references": [
            "77895e58-6f78-48d3-95ef-e3d8a1067bda"
          ]
        },
        {
          "uuid": "8518b26f-05a8-7cf6-9e9f-d238cdb6a7f0",
          "code": "DTXSID00215036",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00215036",
          "code_system": "EPA CompTox",
          "references": [
            "a2429fd2-1fce-3ed1-63fb-0ccf33c0a02c"
          ]
        },
        {
          "uuid": "d9ff52e6-e2c2-4cd2-828a-342f4e7a6044",
          "code": "4FNB38KJGB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0746ed81-efc1-e85d-8d74-7cc1f22c8dac",
          "code": "1996",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1996/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "44ce46d7-1ebd-6755-e183-68eb47bec8a9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "151ffb4b-01fd-4158-b206-e33a0519fbef",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, 4-(2-PROPEN-1-YL)PHENYL",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, 4-(2-PROPEN-1-YL)PHENYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e0a66e8-ccec-48fa-af9b-46724937d248",
            "16f93a4e-f978-4979-b78b-d2dec4f27c44"
          ],
          "display_name": false
        },
        {
          "uuid": "546b4117-35ad-48f5-bb94-55d0cd9c170f",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, 4-(2-PROPENYL)PHENYL",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, 4-(2-PROPENYL)PHENYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e0a66e8-ccec-48fa-af9b-46724937d248",
            "16f93a4e-f978-4979-b78b-d2dec4f27c44"
          ],
          "display_name": false
        },
        {
          "uuid": "b6e6d24a-34ae-4764-a30a-ffa9c232d369",
          "name": "4-(2-PROPENYL)PHENYL-.BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "4-(2-PROPENYL)PHENYL-.BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0d762f1-8c0e-4609-a32d-69b5ec40ef2a",
            "16f93a4e-f978-4979-b78b-d2dec4f27c44"
          ],
          "display_name": true
        },
        {
          "uuid": "6f55d3a3-88fc-4da3-ba8b-f5f333eecfb6",
          "name": "4-ALLYLPHENYL .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "4-ALLYLPHENYL .BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7087e722-bb8a-4ba9-83c4-d846e1fd5df6",
            "16f93a4e-f978-4979-b78b-d2dec4f27c44"
          ],
          "display_name": false
        },
        {
          "uuid": "b49bff5d-11b7-4186-882b-ffeec25a784d",
          "name": "CHAVICOL .BETA.-D-GLUCOSIDE",
          "stdName": "CHAVICOL .BETA.-D-GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e0a66e8-ccec-48fa-af9b-46724937d248",
            "16f93a4e-f978-4979-b78b-d2dec4f27c44"
          ],
          "display_name": false
        },
        {
          "uuid": "f0e21d9b-e2d7-4946-8a66-f281535469c5",
          "name": "FEMA NO. 4548",
          "stdName": "FEMA NO. 4548",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0d762f1-8c0e-4609-a32d-69b5ec40ef2a",
            "16f93a4e-f978-4979-b78b-d2dec4f27c44"
          ],
          "display_name": false
        },
        {
          "uuid": "06d2d482-b29c-460d-8efe-97b58b25ce18",
          "name": "P-ALLYLPHENYL .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "P-ALLYLPHENYL .BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e0a66e8-ccec-48fa-af9b-46724937d248",
            "16f93a4e-f978-4979-b78b-d2dec4f27c44"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b0d762f1-8c0e-4609-a32d-69b5ec40ef2a",
          "citation": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "url": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "16f93a4e-f978-4979-b78b-d2dec4f27c44",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e0a66e8-ccec-48fa-af9b-46724937d248",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7087e722-bb8a-4ba9-83c4-d846e1fd5df6",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77895e58-6f78-48d3-95ef-e3d8a1067bda",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391421000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9493991a-3bd1-4ea9-802b-5a771429a2b4",
          "citation": "SRS import [4FNB38KJGB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4FNB38KJGB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391421000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2429fd2-1fce-3ed1-63fb-0ccf33c0a02c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=64703-98-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6e15fc46-e0d1-43eb-88b2-83c785830831",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "44ce46d7-1ebd-6755-e183-68eb47bec8a9",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "44158414-b203-4e48-a661-7324fd3010e9",
          "id": "44158414-b203-4e48-a661-7324fd3010e9",
          "molfile": "\n  Marvin  01132103352D          \n\n 21 22  0  0  1  0            999 V2000\n    8.0964   -4.4136    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.3756   -4.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6589   -4.4136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8047   -4.0010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5132   -4.4136    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.2298   -4.0051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9424   -4.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9424   -5.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6424   -5.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3633   -5.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0717   -5.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7925   -5.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7925   -4.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3633   -4.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6549   -4.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5132   -5.2386    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.2257   -5.6552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8047   -5.6511    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.8047   -6.4762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0964   -5.2386    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.3797   -5.6552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 20  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 16  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 15  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 14  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  6  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  6  0  0  0\nM  END",
          "smiles": "C=CCc1ccc(cc1)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
          "formula": "C15H20O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dcf3c2fe-d67e-4128-ab0c-786f6a618e51"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "296.3163",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "13db48bd-8996-4f17-b7ce-c2d2ff6d731c",
      "version": "4",
      "structure": {
        "id": "bdf0a8ac-1b05-417e-b0c2-d972a4bd822f",
        "molfile": "\n  Marvin  01132109492D          \n\n 21 22  0  0  1  0            999 V2000\n   13.0717   -5.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6589   -4.4136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6424   -5.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3633   -4.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6549   -4.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9424   -5.2469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3633   -5.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3756   -4.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7925   -4.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3797   -5.6552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9424   -4.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7925   -5.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8047   -6.4762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2257   -5.6552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2298   -4.0051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0964   -4.4136    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.0964   -5.2386    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.8047   -4.0010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8047   -5.6511    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.5132   -5.2386    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.5132   -4.4136    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n  7  3  1  0  0  0  0\n 19 17  1  0  0  0  0\n  1  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  3  6  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6 11  1  0  0  0  0\n  7  4  2  0  0  0  0\n 16  8  1  1  0  0  0\n  9 12  2  0  0  0  0\n 17 10  1  6  0  0  0\n 11 15  1  0  0  0  0\n 12  1  1  0  0  0  0\n 19 13  1  1  0  0  0\n 20 14  1  6  0  0  0\n 21 15  1  1  0  0  0\n 16 18  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 21  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
        "smiles": "C=CCc1ccc(cc1)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
        "formula": "C15H20O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "296.3163",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7e0a66e8-ccec-48fa-af9b-46724937d248",
          "9493991a-3bd1-4ea9-802b-5a771429a2b4"
        ],
        "stereo_centers": 5
      },
      "unii": "4FNB38KJGB"
    }
  ]
}