{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "506b3945-99e0-46e2-b4fd-48c601b9698f",
          "code": "145650-60-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=145650-60-8",
          "code_system": "CAS",
          "references": [
            "97a78608-e9ba-426d-9c22-222daeda2e48",
            "8f42cca9-5e35-4b5d-ae2d-4716bf4bd45c"
          ]
        },
        {
          "uuid": "ee1b3de4-f69c-407f-a652-ea0d0664b03e",
          "code": "FCN NO. 232",
          "comments": "FCN|STABILIZER|OLEFIN POLYMERS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=232",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "97a78608-e9ba-426d-9c22-222daeda2e48"
          ]
        },
        {
          "uuid": "d3eaf5fb-3a74-4e59-8e17-55f363d601f7",
          "code": "FCN NO. 51",
          "type": "ALTERNATIVE",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=51",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "97a78608-e9ba-426d-9c22-222daeda2e48"
          ]
        },
        {
          "uuid": "c1dae2e7-0e1e-4cc2-8d32-9892d5e03f32",
          "code": "FCN NO. 328",
          "comments": "FCN|ANTIOXIDANT|ADHESIVES",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=328",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "97a78608-e9ba-426d-9c22-222daeda2e48"
          ]
        },
        {
          "uuid": "8eedae7f-e826-4006-8af8-d6285db193e9",
          "code": "6850817",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6850817",
          "code_system": "PUBCHEM",
          "references": [
            "97a78608-e9ba-426d-9c22-222daeda2e48"
          ]
        },
        {
          "uuid": "dfbe1685-95ea-3acc-6bb4-b4bd1031c7b8",
          "code": "DTXSID6051728",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6051728",
          "code_system": "EPA CompTox",
          "references": [
            "ada3f314-1236-dc2a-3485-99df505e592a"
          ]
        },
        {
          "uuid": "84ec0ee6-7f98-4dcd-b61a-56dce458b259",
          "code": "4EL3Y5QX1X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0c5c2666-29c9-410f-8ef5-8d94c179679b",
          "name": "BIS(2,4-DI-TERT-BUTYL-6-METHYL PHENYL) ETHYL PHOSPHITE",
          "stdName": "BIS(2,4-DI-TERT-BUTYL-6-METHYL PHENYL) ETHYL PHOSPHITE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8906f492-2a71-4e40-9607-30159fca2b22"
          ],
          "display_name": true
        },
        {
          "uuid": "548e29c0-ea7a-4a9f-ba4b-441a56a08b0a",
          "name": "BIS(2,4-DI-TERT-BUTYL-6-METHYLPHENYL) ETHYL PHOSPHITE",
          "stdName": "BIS(2,4-DI-TERT-BUTYL-6-METHYLPHENYL) ETHYL PHOSPHITE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18526fca-c1e8-47b5-a9c9-e406de5c530f"
          ],
          "display_name": false
        },
        {
          "uuid": "e9545443-3276-43ad-a5eb-e867af8f78bf",
          "name": "ETHYL BIS(2-METHYL-4,6-DI(TERT-BUTYLPHENYNOL) PHOSPHATE",
          "stdName": "ETHYL BIS(2-METHYL-4,6-DI(TERT-BUTYLPHENYNOL) PHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dff86c48-83d5-4732-aede-ef350c4dc6ef"
          ],
          "display_name": false
        },
        {
          "uuid": "76bf1722-b225-473a-ba4e-9d26eb1ac0c5",
          "name": "IRGAFOS 38",
          "stdName": "IRGAFOS 38",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dff86c48-83d5-4732-aede-ef350c4dc6ef"
          ],
          "display_name": false
        },
        {
          "uuid": "40d7366b-7661-4a0b-9ac6-b01da72222fd",
          "name": "PHOSPHOROUS ACID, BIS(2,4-BIS(1,1-DIMETHYLETHYL)-6-METHYLPHENYL)ETHYL ESTER",
          "stdName": "PHOSPHOROUS ACID, BIS(2,4-BIS(1,1-DIMETHYLETHYL)-6-METHYLPHENYL)ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c52954ff-d0ca-415e-a334-7415ebd69f25"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c52954ff-d0ca-415e-a334-7415ebd69f25",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "18526fca-c1e8-47b5-a9c9-e406de5c530f",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dff86c48-83d5-4732-aede-ef350c4dc6ef",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8906f492-2a71-4e40-9607-30159fca2b22",
          "citation": "CEDI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97a78608-e9ba-426d-9c22-222daeda2e48",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a74ff94-587b-40b9-8542-693f00db5371",
          "citation": "SRS import [4EL3Y5QX1X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4EL3Y5QX1X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c76ea768-6044-49ce-bcd2-16267cd83aa5",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ada3f314-1236-dc2a-3485-99df505e592a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=145650-60-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8f42cca9-5e35-4b5d-ae2d-4716bf4bd45c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "87b0ae67-3b8c-45b6-97c6-27787ee50a8d",
          "id": "87b0ae67-3b8c-45b6-97c6-27787ee50a8d",
          "molfile": "\n  Marvin  01132107022D          \n\n 36 37  0  0  0  0            999 V2000\n    2.5123   -5.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0957   -4.6790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9207   -4.6790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4574   -4.0190    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0109   -4.7893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1898   -5.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4753   -6.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7609   -5.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4753   -6.9054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1898   -7.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9043   -6.9054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9043   -6.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6188   -5.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6188   -4.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3332   -5.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3332   -6.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1898   -8.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4753   -8.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1898   -8.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9043   -8.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7429   -3.6263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1110   -3.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3357   -3.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1925   -4.1906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7038   -2.8479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8470   -2.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6222   -1.7532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2542   -2.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0295   -2.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0295   -1.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7440   -1.5889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6129   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2150   -1.5051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4398   -1.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3583   -0.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5831   -0.9748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n 21  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 12  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 17  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 28 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 26 33  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 29 32  1  0  0  0  0\n 33 34  1  0  0  0  0\n 33 35  1  0  0  0  0\n 33 36  1  0  0  0  0\nM  END",
          "smiles": "CCOP(Oc1c(C)cc(cc1C(C)(C)C)C(C)(C)C)Oc2c(C)cc(cc2C(C)(C)C)C(C)(C)C",
          "formula": "C32H51O3P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b6c530e3-ed17-461a-b3b8-815e7824dd52"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "514.7205",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5efe4868-4321-4a23-9b02-572dbc1d5f87",
      "version": "3",
      "structure": {
        "id": "8dba014e-a148-4420-aef3-f7b5efa7c4c6",
        "molfile": "\n  Marvin  01132107212D          \n\n 36 37  0  0  0  0            999 V2000\n    1.8470   -2.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2150   -1.5051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4398   -1.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3583   -0.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5831   -0.9748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7038   -2.8479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3357   -3.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1110   -3.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7429   -3.6263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4574   -4.0190    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9207   -4.6790    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0957   -4.6790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5123   -5.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0109   -4.7893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1898   -5.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9043   -6.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9043   -6.9054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1898   -7.3179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4753   -6.9054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4753   -6.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7609   -5.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1898   -8.1430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4753   -8.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1898   -8.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9043   -8.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6188   -5.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6188   -4.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3332   -5.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3332   -6.0805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2542   -2.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6222   -1.7532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0295   -2.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0295   -1.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7440   -1.5889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6129   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1925   -4.1906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 15  1  0  0  0  0\n 20 21  1  0  0  0  0\n 18 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\n 16 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 26 29  1  0  0  0  0\n 30  8  2  0  0  0  0\n 31 30  1  0  0  0  0\n  1 31  2  0  0  0  0\n 30 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 32 34  1  0  0  0  0\n 32 35  1  0  0  0  0\n  7 36  1  0  0  0  0\nM  END",
        "smiles": "CCOP(Oc1c(C)cc(cc1C(C)(C)C)C(C)(C)C)Oc2c(C)cc(cc2C(C)(C)C)C(C)(C)C",
        "formula": "C32H51O3P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "514.7205",
        "optical_activity": "NONE",
        "references": [
          "c76ea768-6044-49ce-bcd2-16267cd83aa5",
          "8a74ff94-587b-40b9-8542-693f00db5371"
        ],
        "stereo_centers": 0
      },
      "unii": "4EL3Y5QX1X"
    }
  ]
}