{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9532ed4d-7905-4741-b9d2-a092ee81f55b",
          "code": "745047-51-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=745047-51-2",
          "code_system": "CAS",
          "references": [
            "4b21c9ac-2827-4994-9865-b988eec6c4d8",
            "5b004c8d-d4e0-43d8-8308-44dd116fcbec"
          ]
        },
        {
          "uuid": "8eb93a89-1296-4b74-b18f-21bada12a7de",
          "code": "22831877",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22831877",
          "code_system": "PUBCHEM",
          "references": [
            "4b21c9ac-2827-4994-9865-b988eec6c4d8"
          ]
        },
        {
          "uuid": "7c521e47-3d8e-ad31-9091-366ed5996d7e",
          "code": "DTXSID90225503",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90225503",
          "code_system": "EPA CompTox",
          "references": [
            "aedb3cfa-41ea-64e6-53c6-546d3575ea08"
          ]
        },
        {
          "uuid": "1e9faa28-9ec5-4ae7-89d2-4cd7d6682f8e",
          "code": "4E1875N4ZT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b7817b64-c672-f447-ae77-08767dff27b6",
          "code": "1745",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1745/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "141e1796-750a-983b-6509-2dd596e59667"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "92a0b6b9-cfd3-4f58-89bd-1b6f31d374e0",
          "name": "1,3-BENZODIOXOLE-5-CARBOXAMIDE, N-(1-PROPYLBUTYL)-",
          "stdName": "1,3-BENZODIOXOLE-5-CARBOXAMIDE, N-(1-PROPYLBUTYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e9ad71a-fc37-4ff3-826f-121fe0340fbe",
            "c8706a80-0a48-4b41-a284-40d431f0ff7a"
          ],
          "display_name": false
        },
        {
          "uuid": "318f2bdb-2975-4d81-98ae-d06437015fe2",
          "name": "FEMA NO. 4232",
          "stdName": "FEMA NO. 4232",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e9ad71a-fc37-4ff3-826f-121fe0340fbe",
            "771a660b-938c-48a9-83a4-79ab51c531ef"
          ],
          "display_name": false
        },
        {
          "uuid": "43fe6865-f8b7-479a-902b-69eaca5440be",
          "name": "N-(1-PROPYLBUTYL)-1,3-BENZODIOXOLE-5-CARBOXAMIDE",
          "stdName": "N-(1-PROPYLBUTYL)-1,3-BENZODIOXOLE-5-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e9ad71a-fc37-4ff3-826f-121fe0340fbe",
            "9aeae10d-aa14-4854-9c7f-2cca6d87d56e"
          ],
          "display_name": true
        },
        {
          "uuid": "a7463862-81da-4d53-9fc5-332cacf9e5f3",
          "name": "N-(HEPTAN-4-YL)BENZO(D)(1,3)DIOXOLE-5-CARBOXAMIDE",
          "stdName": "N-(HEPTAN-4-YL)BENZO(D)(1,3)DIOXOLE-5-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e9ad71a-fc37-4ff3-826f-121fe0340fbe",
            "9aeae10d-aa14-4854-9c7f-2cca6d87d56e",
            "1d69ceb1-b285-46e7-8da1-37d4372f6fb9",
            "771a660b-938c-48a9-83a4-79ab51c531ef"
          ],
          "display_name": false
        },
        {
          "uuid": "7bdd6e4c-191c-4f1f-9fdc-be4b03cd0910",
          "name": "N-(HEPTAN-4-YL)BENZO(D)(1,3)DIOXOLE-5-CARBOXAMIDE [FHFI]",
          "stdName": "N-(HEPTAN-4-YL)BENZO(D)(1,3)DIOXOLE-5-CARBOXAMIDE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e9ad71a-fc37-4ff3-826f-121fe0340fbe",
            "771a660b-938c-48a9-83a4-79ab51c531ef"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9aeae10d-aa14-4854-9c7f-2cca6d87d56e",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1e9ad71a-fc37-4ff3-826f-121fe0340fbe",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8706a80-0a48-4b41-a284-40d431f0ff7a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "771a660b-938c-48a9-83a4-79ab51c531ef",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b21c9ac-2827-4994-9865-b988eec6c4d8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391231000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "195bb761-a70d-45fb-aa8d-53800f8367a4",
          "citation": "SRS import [4E1875N4ZT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4E1875N4ZT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391231000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d69ceb1-b285-46e7-8da1-37d4372f6fb9",
          "citation": "N-(HEPTAN-4-YL)BENZO(D)(1,3)DIOXOLE-5-CARBOXAMIDE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aedb3cfa-41ea-64e6-53c6-546d3575ea08",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=745047-51-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5b004c8d-d4e0-43d8-8308-44dd116fcbec",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "141e1796-750a-983b-6509-2dd596e59667",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a3ae46d2-1446-4571-be6d-e62472a25ae6",
          "id": "a3ae46d2-1446-4571-be6d-e62472a25ae6",
          "molfile": "\n  Marvin  01132108302D          \n\n 19 20  0  0  0  0            999 V2000\n    4.7415   -1.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7415   -2.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4596   -2.5649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4596   -3.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7487   -3.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7487   -4.6294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0355   -5.0441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1776   -3.8003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1776   -4.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4643   -5.0399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8933   -5.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8933   -5.8655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6094   -6.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3254   -5.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1156   -6.1233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6040   -5.4511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1156   -4.7791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3254   -5.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6094   -4.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  8  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 19 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 18 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "CCCC(CCC)NC(=O)c1ccc2c(c1)OCO2",
          "formula": "C15H21NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "43410f4a-66fd-4901-a459-c527d9ef34fc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "263.3327",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "610970fa-1002-4d5a-8da5-a5fadba72485",
      "version": "4",
      "structure": {
        "id": "58e01ebc-03e9-4749-b075-f2f588f5a271",
        "molfile": "\n  Marvin  01132104372D          \n\n 19 20  0  0  0  0            999 V2000\n    6.1776   -3.8003    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4643   -5.0399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1776   -4.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6094   -6.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8933   -5.8655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8933   -5.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6094   -4.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3254   -5.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3254   -5.0357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1156   -4.7791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6040   -5.4511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1156   -6.1233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7415   -1.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7415   -2.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4596   -2.5649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4596   -3.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7487   -3.8045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7487   -4.6294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0355   -5.0441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 16  1  1  0  0  0  0\n  6  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  8  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  9  7  1  0  0  0  0\n 12  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
        "smiles": "CCCC(CCC)NC(=O)c1ccc2c(c1)OCO2",
        "formula": "C15H21NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "263.3327",
        "optical_activity": "NONE",
        "references": [
          "195bb761-a70d-45fb-aa8d-53800f8367a4",
          "c8706a80-0a48-4b41-a284-40d431f0ff7a"
        ],
        "stereo_centers": 0
      },
      "unii": "4E1875N4ZT"
    }
  ]
}