{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ccaaa62a-0b3e-45f9-95c4-7cb9dd42b6cb",
          "code": "75168-11-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=75168-11-5",
          "code_system": "CAS",
          "references": [
            "30f5b3bd-8c2b-41a1-a687-ea496be15450",
            "a28dcf20-e6a9-4327-960e-094bf065d8e6"
          ]
        },
        {
          "uuid": "da0d7ade-f39a-43f8-9d81-a89c5a2f2fbc",
          "code": "2762576",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2762576",
          "code_system": "PUBCHEM",
          "references": [
            "30f5b3bd-8c2b-41a1-a687-ea496be15450"
          ]
        },
        {
          "uuid": "645ef224-b7bb-1636-404d-03ae42477566",
          "code": "DTXSID70226159",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70226159",
          "code_system": "EPA CompTox",
          "references": [
            "4b76d338-84ce-7e57-0c30-e45d8cb24f1d"
          ]
        },
        {
          "uuid": "3cfe7051-29c6-48f9-be1b-1c9735c8672c",
          "code": "4C467Q911Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "162fd6d6-3a0c-4473-9b88-5c50942ec148",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d12d7477-716b-4d03-a810-fce7eb3a2c47",
            "refuuid": "32aef549-06f0-49ba-97fc-369805ef9b0a",
            "name": "NONYLACRIDINE ORANGE CATION",
            "unii": "SD9ROX569A",
            "linking_id": "SD9ROX569A",
            "ref_pname": "NONYLACRIDINE ORANGE CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "26a784fd-d6c5-4704-9342-4336d59102bc",
          "name": "10-NONYL ACRIDINE ORANGE",
          "stdName": "10-NONYL ACRIDINE ORANGE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35c88f1f-d6a7-4130-b9f3-6613b31d6bbe",
            "1e382220-0272-408c-bb16-01e0d5731a44"
          ],
          "display_name": false
        },
        {
          "uuid": "5de39410-54e4-4888-8449-813b67fa4ee8",
          "name": "A-1372",
          "stdName": "A-1372",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35c88f1f-d6a7-4130-b9f3-6613b31d6bbe",
            "1e382220-0272-408c-bb16-01e0d5731a44"
          ],
          "display_name": false
        },
        {
          "uuid": "52ec7f61-896b-406b-9bde-8dc0136182ab",
          "name": "ACRIDINE ORANGE 10-NONYL BROMIDE",
          "stdName": "ACRIDINE ORANGE 10-NONYL BROMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35c88f1f-d6a7-4130-b9f3-6613b31d6bbe",
            "1e382220-0272-408c-bb16-01e0d5731a44"
          ],
          "display_name": false
        },
        {
          "uuid": "a7aecebf-e46a-48c8-947b-8db282f0248d",
          "name": "ACRIDINIUM, 3,6-BIS(DIMETHYLAMINO)-10-NONYL-, BROMIDE",
          "stdName": "ACRIDINIUM, 3,6-BIS(DIMETHYLAMINO)-10-NONYL-, BROMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35c88f1f-d6a7-4130-b9f3-6613b31d6bbe",
            "1e382220-0272-408c-bb16-01e0d5731a44"
          ],
          "display_name": false
        },
        {
          "uuid": "c2b30c91-20e8-4bb2-b3f2-ac1591f854b7",
          "name": "ACRIDINIUM, 3,6-BIS(DIMETHYLAMINO)-10-NONYL-, BROMIDE (1:1)",
          "stdName": "ACRIDINIUM, 3,6-BIS(DIMETHYLAMINO)-10-NONYL-, BROMIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35c88f1f-d6a7-4130-b9f3-6613b31d6bbe",
            "1e382220-0272-408c-bb16-01e0d5731a44"
          ],
          "display_name": false
        },
        {
          "uuid": "0519c634-908b-4e80-a932-0f7722b1d364",
          "name": "NONYLACRIDINE ORANGE",
          "stdName": "NONYLACRIDINE ORANGE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35c88f1f-d6a7-4130-b9f3-6613b31d6bbe",
            "1e382220-0272-408c-bb16-01e0d5731a44"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "35c88f1f-d6a7-4130-b9f3-6613b31d6bbe",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1e382220-0272-408c-bb16-01e0d5731a44",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30f5b3bd-8c2b-41a1-a687-ea496be15450",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391957000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2045724d-f7be-482d-912f-3a6110e20f35",
          "citation": "SRS import [4C467Q911Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4C467Q911Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391957000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b76d338-84ce-7e57-0c30-e45d8cb24f1d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=75168-11-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a28dcf20-e6a9-4327-960e-094bf065d8e6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9db5bd27-0bbd-43a2-9a22-496b43acc052",
          "id": "9db5bd27-0bbd-43a2-9a22-496b43acc052",
          "molfile": "\n  Marvin  01132108122D          \n\n  1  0  0  0  0  0            999 V2000\n   13.0696   -3.9279    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Br",
          "formula": "BrH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0cf2ad0b-562e-4812-9ed0-ed1ab887f550"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "80.9115",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "1a375208-a391-4601-a9ea-a1e41331a486",
          "id": "1a375208-a391-4601-a9ea-a1e41331a486",
          "molfile": "\n  Marvin  01132101322D          \n\n 29 31  0  0  0  0            999 V2000\n   10.3209   -0.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3209   -1.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6119   -1.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6119   -2.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9074   -3.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9074   -3.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2028   -4.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2028   -5.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5017   -5.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5017   -6.4136    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2192   -6.8203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9317   -6.4017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6534   -6.8071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6534   -7.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9443   -8.0599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2192   -7.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5080   -8.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7902   -7.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0753   -8.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3603   -7.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3603   -6.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0733   -6.4192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7902   -6.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6442   -6.4197    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.9331   -6.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6442   -5.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3649   -6.3917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3649   -5.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0805   -6.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 23  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 27  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 23 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 24  2  3  0  0  0\n 23 22  2  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\nM  CHG  1  24   1\nM  END",
          "smiles": "CCCCCCCCCn1c-2cc(=[N+](C)C)ccc2cc3ccc(cc31)N(C)C",
          "formula": "C26H38N3",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "96dbaa43-b7ce-401b-8fb7-587b23d473f2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "392.601",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1a318ac6-eb01-4702-8959-522df1c0e85c",
      "version": "4",
      "structure": {
        "id": "e94023ec-161b-4317-a2dd-e61970a780b8",
        "molfile": "\n  Marvin  01132112042D          \n\n 30 31  0  0  0  0            999 V2000\n    5.3603   -6.8320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3603   -7.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0753   -8.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7902   -7.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5080   -8.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2192   -7.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2192   -6.8203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9317   -6.4017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6534   -6.8071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3649   -6.3917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3649   -5.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0805   -6.7965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6534   -7.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9443   -8.0599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5017   -6.4136    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.5017   -5.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2028   -5.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2028   -4.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9074   -3.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9074   -3.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6119   -2.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6119   -1.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3209   -1.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3209   -0.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7902   -6.8280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0733   -6.4192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6442   -6.4197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9331   -6.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6442   -5.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0696   -3.9279    0.0000 Br  0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 13  2  0  0  0  0\n  6 14  1  0  0  0  0\n  7 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 15 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26  1  1  0  0  0  0\n 25  4  1  0  0  0  0\n  1 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\nM  CHG  2  15   1  30  -1\nM  END",
        "smiles": "CCCCCCCCC[n+]1c2cc(ccc2cc3ccc(cc31)N(C)C)N(C)C.[Br-]",
        "formula": "C26H38N3.Br",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "472.5045",
        "optical_activity": "NONE",
        "references": [
          "2045724d-f7be-482d-912f-3a6110e20f35",
          "35c88f1f-d6a7-4130-b9f3-6613b31d6bbe"
        ],
        "stereo_centers": 0
      },
      "unii": "4C467Q911Y"
    }
  ]
}