{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c4cb6eaf-9e7c-408c-804c-b3cbef57499d",
          "code": "853758-16-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=853758-16-4",
          "code_system": "CAS",
          "references": [
            "b5b15bf7-2786-4f6c-b157-b3f467fe83fa",
            "3f6e0f7d-f705-4b78-82a2-b79dc6774ab7"
          ]
        },
        {
          "uuid": "754e46ac-f293-4734-8df9-e0b542b399a7",
          "code": "5064727",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5064727",
          "code_system": "PUBCHEM",
          "references": [
            "b5b15bf7-2786-4f6c-b157-b3f467fe83fa"
          ]
        },
        {
          "uuid": "c9a4a62e-8a03-4d79-9894-45c41854ab7b",
          "code": "4C224NT7AL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1d90a271-6fbe-4ad5-bdf5-17493f145a18",
          "name": "BENZENESULFONAMIDE, N-(2-METHYLPROPYL)-N-((4-((METHYLSULFONYL)OXY)PHENYL)METHYL)-",
          "stdName": "BENZENESULFONAMIDE, N-(2-METHYLPROPYL)-N-((4-((METHYLSULFONYL)OXY)PHENYL)METHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c62df265-e092-4099-9015-40edd3299b82",
            "cf74c298-5778-46bb-846a-a7332a66d890"
          ],
          "display_name": false
        },
        {
          "uuid": "fb403c97-4af8-4bd1-bcf2-b8fea9915e35",
          "name": "MESYLOXYBENZYL ISOBUTYLBENZENESULFONAMIDE",
          "stdName": "MESYLOXYBENZYL ISOBUTYLBENZENESULFONAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c62df265-e092-4099-9015-40edd3299b82",
            "f4ebb10b-40b9-4217-901a-4f92cfa6b00f",
            "1b2db053-d078-4b89-b377-881feb747692"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3f0b4f9a-c144-4323-835a-f173394a8cd9",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c4be2da8-783d-475f-b6d5-527f317b361c",
          "name": "N-(4-MESYLOXYBENZYL)-N-ISOBUTYLBENZENESULFONAMIDE, MIBSA",
          "stdName": "N-(4-MESYLOXYBENZYL)-N-ISOBUTYLBENZENESULFONAMIDE, MIBSA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c62df265-e092-4099-9015-40edd3299b82",
            "1b2db053-d078-4b89-b377-881feb747692"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1b2db053-d078-4b89-b377-881feb747692",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c62df265-e092-4099-9015-40edd3299b82",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf74c298-5778-46bb-846a-a7332a66d890",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5b15bf7-2786-4f6c-b157-b3f467fe83fa",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393369000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb4ff3fb-c9ec-421d-b095-fb9c3ace5d9f",
          "citation": "SRS import [4C224NT7AL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4C224NT7AL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393369000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4ebb10b-40b9-4217-901a-4f92cfa6b00f",
          "citation": "MESYLOXYBENZYL ISOBUTYLBENZENESULFONAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3f6e0f7d-f705-4b78-82a2-b79dc6774ab7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "25a99ee8-7672-4a90-9381-35f18bf11372",
          "id": "25a99ee8-7672-4a90-9381-35f18bf11372",
          "molfile": "\n  Marvin  01132102052D          \n\n 26 27  0  0  0  0            999 V2000\n   12.4008   -6.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1153   -6.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8298   -6.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1153   -7.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4008   -7.6815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4008   -8.5066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1153   -8.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8298   -8.5066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5443   -8.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5443   -9.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2588  -10.1566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9733   -9.7441    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3858  -10.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5607   -9.0297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6878   -9.3316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8298  -10.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1153   -9.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6863   -7.2691    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0988   -6.5546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9719   -6.8565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2738   -7.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6863   -8.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2738   -9.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4488   -9.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0363   -8.6981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4488   -7.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 18  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 17  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 16 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  2  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 26  2  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CN(Cc1ccc(cc1)OS(=O)(=O)C)S(=O)(=O)c2ccccc2",
          "formula": "C18H23NO5S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3f1776bd-d447-4d29-b60a-45cbeee86355"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "397.5118",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "caef0e1f-3cb6-497b-a2e8-ced83ed25642",
      "version": "3",
      "structure": {
        "id": "97ae2469-98fd-4a28-bde8-42d6f935d7e2",
        "molfile": "\n  Marvin  01132107532D          \n\n 26 27  0  0  0  0            999 V2000\n   12.4008   -7.6815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1153   -7.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1153   -6.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4008   -6.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8298   -6.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4008   -8.5066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1153   -8.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8298   -8.5066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5443   -8.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5443   -9.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2588  -10.1566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9733   -9.7441    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5607   -9.0297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6878   -9.3316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3858  -10.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8298  -10.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1153   -9.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6863   -7.2691    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2738   -7.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6863   -8.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2738   -9.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4488   -9.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0363   -8.6981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4488   -7.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0988   -6.5546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9719   -6.8565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 16 10  2  0  0  0  0\n 17 16  1  0  0  0  0\n  7 17  2  0  0  0  0\n  1 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 19 24  2  0  0  0  0\n 18 25  2  0  0  0  0\n 18 26  2  0  0  0  0\nM  END",
        "smiles": "CC(C)CN(Cc1ccc(cc1)OS(=O)(=O)C)S(=O)(=O)c2ccccc2",
        "formula": "C18H23NO5S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "397.5118",
        "optical_activity": "NONE",
        "references": [
          "cf74c298-5778-46bb-846a-a7332a66d890",
          "cb4ff3fb-c9ec-421d-b095-fb9c3ace5d9f"
        ],
        "stereo_centers": 0
      },
      "unii": "4C224NT7AL"
    }
  ]
}