{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ec7229c6-7b50-4681-a952-5afe68e67e12",
          "code": "1225570-46-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1225570-46-6",
          "code_system": "CAS",
          "references": [
            "9ba407f3-d298-46f2-b63e-d1646cc23abe",
            "2737b973-e80d-4ef3-8fe4-b5d9a2346d9b"
          ]
        },
        {
          "uuid": "107dc5e7-97c8-40ec-8cb4-53ad079a19b7",
          "code": "46233927",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/46233927",
          "code_system": "PUBCHEM",
          "references": [
            "9ba407f3-d298-46f2-b63e-d1646cc23abe"
          ]
        },
        {
          "uuid": "8e06e0af-388e-4b74-d268-cb643d48e64e",
          "code": "DTXSID20153643",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20153643",
          "code_system": "EPA CompTox",
          "references": [
            "9745a426-2868-b63c-e354-1c8e16399f70"
          ]
        },
        {
          "uuid": "9ab6a0c1-330d-47b5-a127-33ed35b51724",
          "code": "4BS9N8P3JM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e4215117-e0f8-4811-926c-e012de993823",
          "name": "2H-1-BENZOPYRAN-3-CARBOXAMIDE, N-((3-FLUORO-4-((METHYLSULFONYL)AMINO)PHENYL)METHYL)-7-(1-METHYLETHYL)-",
          "stdName": "2H-1-BENZOPYRAN-3-CARBOXAMIDE, N-((3-FLUORO-4-((METHYLSULFONYL)AMINO)PHENYL)METHYL)-7-(1-METHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4d1eedc-ee7d-40cc-bb40-41456fe9dd25",
            "fbdf7c56-f098-4b60-bded-dcace03ee888"
          ],
          "display_name": false
        },
        {
          "uuid": "edca1521-70db-4c48-9275-21ffe0fa69fe",
          "name": "ISOPROPYLCHROMENAMIDO FLUOROBENZYL METHANESULFONAMIDE",
          "stdName": "ISOPROPYLCHROMENAMIDO FLUOROBENZYL METHANESULFONAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ec0776c-6511-44e9-925c-7ee47a4ca274",
            "d4d1eedc-ee7d-40cc-bb40-41456fe9dd25",
            "fbdf7c56-f098-4b60-bded-dcace03ee888"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "986ce15d-608f-4434-8ed9-8b6bc424264b",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "fbdf7c56-f098-4b60-bded-dcace03ee888",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d4d1eedc-ee7d-40cc-bb40-41456fe9dd25",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ba407f3-d298-46f2-b63e-d1646cc23abe",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391532000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecfd42c7-1574-406e-8822-e936b660a5cc",
          "citation": "SRS import [4BS9N8P3JM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4BS9N8P3JM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391532000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ede88afc-e423-4b59-be04-9810d5f98046",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ec0776c-6511-44e9-925c-7ee47a4ca274",
          "citation": "ISOPROPYLCHROMENAMIDO FLUOROBENZYL METHANESULFONAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9745a426-2868-b63c-e354-1c8e16399f70",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1225570-46-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2737b973-e80d-4ef3-8fe4-b5d9a2346d9b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a8913908-054f-4a21-b191-0724615a4902",
          "id": "a8913908-054f-4a21-b191-0724615a4902",
          "molfile": "\n  Marvin  01132108452D          \n\n 29 31  0  0  0  0            999 V2000\n   16.8953  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1808  -17.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1808  -18.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4664  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4664  -16.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7519  -15.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0374  -16.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3229  -15.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6084  -16.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6084  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3229  -17.2381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0374  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7519  -17.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8939  -15.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8939  -14.7631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1795  -16.0006    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1795  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4650  -17.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7505  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0361  -17.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0361  -18.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3216  -18.4756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6072  -18.0632    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8927  -17.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0196  -17.3487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1946  -18.7776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7506  -18.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7506  -19.3006    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4650  -18.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n 13  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 14  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 29  2  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 27 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 23 25  2  0  0  0  0\n 23 26  2  0  0  0  0\n 27 28  1  0  0  0  0\n 29 27  1  0  0  0  0\nM  END",
          "smiles": "CC(C)c1ccc2C=C(COc2c1)C(=O)NCc3ccc(c(c3)F)NS(=O)(=O)C",
          "formula": "C21H23FN2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "df81d6a2-77f2-4d12-9fdb-ce735c2b11fd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "418.4836",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6210e732-d8e3-4769-a5a7-68f5e62bc7f1",
      "version": "4",
      "structure": {
        "id": "2c3f889c-e4fb-47ff-a3b7-e629625335ba",
        "molfile": "\n  Marvin  01132102232D          \n\n 29 31  0  0  0  0            999 V2000\n   12.6084  -16.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3229  -15.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0374  -16.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0374  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3229  -17.2381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6084  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7519  -15.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4664  -16.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4664  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7519  -17.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1808  -17.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8953  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1808  -18.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8939  -14.7631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8939  -15.5881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7506  -19.3006    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8927  -17.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6072  -18.0632    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0196  -17.3487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1946  -18.7776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3216  -18.4756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1795  -16.0006    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7505  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0361  -17.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0361  -18.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7506  -18.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4650  -18.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4650  -17.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1795  -16.8256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n  4 10  1  0  0  0  0\n  3  7  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 22 15  1  0  0  0  0\n 26 16  1  0  0  0  0\n 25 21  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  2  0  0  0  0\n 18 21  1  0  0  0  0\n 29 22  1  0  0  0  0\n 28 23  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  2  0  0  0  0\n 28 29  1  0  0  0  0\n 15  1  1  0  0  0  0\nM  END",
        "smiles": "CC(C)c1ccc2C=C(COc2c1)C(=O)NCc3ccc(c(c3)F)NS(=O)(=O)C",
        "formula": "C21H23FN2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "418.4836",
        "optical_activity": "NONE",
        "references": [
          "ede88afc-e423-4b59-be04-9810d5f98046",
          "ecfd42c7-1574-406e-8822-e936b660a5cc"
        ],
        "stereo_centers": 0
      },
      "unii": "4BS9N8P3JM"
    }
  ]
}