{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cec96a34-a9ad-4db5-bf42-9ac70c6510ac",
          "code": "1118-39-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1118-39-4",
          "code_system": "CAS",
          "references": [
            "808023cc-ceb0-4a7a-806a-f4f845aeed0f",
            "4c81dc17-7d4e-4b93-8432-d5e3d045b197"
          ]
        },
        {
          "uuid": "1f2a124d-5bae-4077-beed-7983eef0baa8",
          "code": "214-262-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.966",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "808023cc-ceb0-4a7a-806a-f4f845aeed0f"
          ]
        },
        {
          "uuid": "c13ed1f0-eab3-4ab1-bf46-571c503a82b5",
          "code": "14235",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14235",
          "code_system": "PUBCHEM",
          "references": [
            "808023cc-ceb0-4a7a-806a-f4f845aeed0f"
          ]
        },
        {
          "uuid": "ebf5760f-9c69-c772-f488-80fa400a9ed5",
          "code": "DTXSID4047416",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4047416",
          "code_system": "EPA CompTox",
          "references": [
            "a02daa73-da64-5e29-0be2-ea95b12fef03"
          ]
        },
        {
          "uuid": "7df14b27-a3e7-4fb7-98cd-b8adc6c7df9a",
          "code": "4BS9397SE5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a454c285-7820-c911-bd13-b8af60be99b7",
          "code": "100000177951",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5075ffa5-760b-9a8f-6c66-42542bf2bcff"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "08fc9394-041a-45d0-8020-8d6ac02c5ece",
          "name": "(2-METHYL-6-METHYLENE-7-OCTEN-2-YL) ACETATE",
          "stdName": "(2-METHYL-6-METHYLENE-7-OCTEN-2-YL) ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b25e7416-183d-49dd-acd1-009e46787134"
          ],
          "display_name": false
        },
        {
          "uuid": "30762fcb-ef32-4fca-9e0a-dfea6f86914e",
          "name": "2-METHYL-6-METHYLIDENEOCT-7-EN-2-YL ACETATE",
          "stdName": "2-METHYL-6-METHYLIDENEOCT-7-EN-2-YL ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47533e8b-6e07-45e3-b3eb-53559b939055"
          ],
          "display_name": false
        },
        {
          "uuid": "6cef1222-e0e1-48f1-a886-0280452c98e6",
          "name": "7-OCTEN-2-OL, 2-METHYL-6-METHYLENE-, 2-ACETATE",
          "stdName": "7-OCTEN-2-OL, 2-METHYL-6-METHYLENE-, 2-ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b25e7416-183d-49dd-acd1-009e46787134"
          ],
          "display_name": false
        },
        {
          "uuid": "20688799-04f8-4b45-b337-e10ce6b616cf",
          "name": "7-OCTEN-2-OL, 2-METHYL-6-METHYLENE-, ACETATE",
          "stdName": "7-OCTEN-2-OL, 2-METHYL-6-METHYLENE-, ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b25e7416-183d-49dd-acd1-009e46787134"
          ],
          "display_name": false
        },
        {
          "uuid": "be155b9e-8a27-0813-8e7f-817552dec65c",
          "name": "BERGAMYL ACETATE",
          "stdName": "BERGAMYL ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23b9ca75-4e8c-d737-ff0c-91028a7a0347"
          ],
          "display_name": false
        },
        {
          "uuid": "d434c90f-3e9b-4396-9f67-a3e41e2db49f",
          "name": "MYRCENOL, ACETATE",
          "stdName": "MYRCENOL, ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b25e7416-183d-49dd-acd1-009e46787134"
          ],
          "display_name": false
        },
        {
          "uuid": "cdf650f9-ce84-4806-b3a8-ad909407530a",
          "name": "MYRCENYL ACETATE",
          "stdName": "MYRCENYL ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b25e7416-183d-49dd-acd1-009e46787134"
          ],
          "display_name": true
        },
        {
          "uuid": "69ea5762-e2e2-4ecf-b17a-96085fd41192",
          "name": "NEOBERGAMATE",
          "stdName": "NEOBERGAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b25e7416-183d-49dd-acd1-009e46787134"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "47533e8b-6e07-45e3-b3eb-53559b939055",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b25e7416-183d-49dd-acd1-009e46787134",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "808023cc-ceb0-4a7a-806a-f4f845aeed0f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391986000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4fe2767-20d1-459e-8084-9f77eb0bd959",
          "citation": "SRS import [4BS9397SE5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4BS9397SE5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391986000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a02daa73-da64-5e29-0be2-ea95b12fef03",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1118-39-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "23b9ca75-4e8c-d737-ff0c-91028a7a0347",
          "citation": "http://dir.perfumerflavorist.com/detail/ffmProduct.html?id=21792",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "5075ffa5-760b-9a8f-6c66-42542bf2bcff",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "4c81dc17-7d4e-4b93-8432-d5e3d045b197",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8524b323-bb57-45e6-9f6e-80bc3e988805",
          "id": "8524b323-bb57-45e6-9f6e-80bc3e988805",
          "molfile": "\n  Marvin  01132106552D          \n\n 14 13  0  0  0  0            999 V2000\n    6.4391   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7179   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7179   -1.6548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0031   -0.4121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2884   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8699   -0.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7005   -1.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5737   -1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8654   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1507   -1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4359   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4359    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7147   -1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\nM  END",
          "smiles": "C=CC(=C)CCCC(C)(C)OC(=O)C",
          "formula": "C12H20O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "33d9e079-c6a8-4c41-82ac-4e29ddb93643"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "196.2865",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fcccfa40-0c0a-429e-ba33-ae32d335c1da",
      "version": "5",
      "structure": {
        "id": "525bac0b-42e1-43f2-ae2d-6aa930923ca1",
        "molfile": "\n  Marvin  01132104172D          \n\n 14 13  0  0  0  0            999 V2000\n    3.8699   -0.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2884   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5737   -1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8654   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1507   -1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4359   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7147   -1.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0031   -0.4121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7005   -1.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4359    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7179   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7179   -1.6548    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4391   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  9  1  0  0  0  0\n  2 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
        "smiles": "C=CC(=C)CCCC(C)(C)OC(=O)C",
        "formula": "C12H20O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "196.2865",
        "optical_activity": "NONE",
        "references": [
          "f4fe2767-20d1-459e-8084-9f77eb0bd959",
          "47533e8b-6e07-45e3-b3eb-53559b939055"
        ],
        "stereo_centers": 0
      },
      "unii": "4BS9397SE5"
    }
  ]
}