{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "88d6a099-4ab6-416a-ab29-6a5f33c85e75",
          "code": "15625-89-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15625-89-5",
          "code_system": "CAS",
          "references": [
            "80f79db1-2ade-4e3a-a14b-8af316597d55",
            "cb9e37a2-6826-4cfc-8a1d-6255504f92cc"
          ]
        },
        {
          "uuid": "7d3d6782-c8cd-4e48-b762-b475c9fff190",
          "code": "C027993",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67027993",
          "code_system": "MESH",
          "references": [
            "80f79db1-2ade-4e3a-a14b-8af316597d55"
          ]
        },
        {
          "uuid": "37508af1-83b5-4632-ac55-74bc82a73bc5",
          "code": "FCN NO. 772",
          "comments": "FCN|COATINGS|VARIOUS SUBSTRATES",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=772",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "80f79db1-2ade-4e3a-a14b-8af316597d55"
          ]
        },
        {
          "uuid": "0524d058-c7c5-4251-a8a1-e72a38cdf07a",
          "code": "239-701-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.077",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "80f79db1-2ade-4e3a-a14b-8af316597d55"
          ]
        },
        {
          "uuid": "6f16829f-83e5-4208-b3d7-0f374d975b1d",
          "code": "1426813",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426813/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "80f79db1-2ade-4e3a-a14b-8af316597d55"
          ]
        },
        {
          "uuid": "ae87a181-cb0d-4cfc-bfd8-cf9743ce2611",
          "code": "27423",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/27423",
          "code_system": "PUBCHEM",
          "references": [
            "80f79db1-2ade-4e3a-a14b-8af316597d55"
          ]
        },
        {
          "uuid": "ff7f3f71-4bbf-b0ba-5c1a-17827fe1f67f",
          "code": "Trimethylolpropane triacrylate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Trimethylolpropane_triacrylate",
          "code_system": "WIKIPEDIA",
          "references": [
            "cfda8778-0590-a182-e0da-0335721cc3e4"
          ]
        },
        {
          "uuid": "2d15f2a1-960c-ef9a-ddcc-c5133bdbd478",
          "code": "8054",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8054",
          "code_system": "HSDB",
          "references": [
            "8afcb5c8-d016-e71e-c693-ac0ab44336bf"
          ]
        },
        {
          "uuid": "70e27426-3ae8-db68-de53-f6036055affb",
          "code": "DTXSID0027773",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0027773",
          "code_system": "EPA CompTox",
          "references": [
            "89b9b4e5-0911-65f0-1788-6664931d3f2c"
          ]
        },
        {
          "uuid": "8c05c736-4fe0-4194-a340-eb77793dbea9",
          "code": "4B67KGL96S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9a0a89e2-ff56-dd7e-62d9-a1f325313125",
          "code": "4B67KGL96S",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4B67KGL96S",
          "code_system": "DAILYMED",
          "references": [
            "7ff1c10f-7e60-5814-7931-105d7601e4dc"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7c0ff814-da13-4303-befe-9ec97f1b045c",
          "name": "1,3-PROPANEDIOL, 2-ETHYL-2-(HYDROXYMETHYL)-, TRIACRYLATE",
          "stdName": "1,3-PROPANEDIOL, 2-ETHYL-2-(HYDROXYMETHYL)-, TRIACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c5cea0e-3ae8-4b49-9537-041b3f172272",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        },
        {
          "uuid": "492b89fc-0c5e-4dc5-a402-a807bf41bcd5",
          "name": "2-ETHYL-2-(HYDROXYMETHYL)-1,3-PROPANEDIOL TRIACRYLATE",
          "stdName": "2-ETHYL-2-(HYDROXYMETHYL)-1,3-PROPANEDIOL TRIACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c5cea0e-3ae8-4b49-9537-041b3f172272",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        },
        {
          "uuid": "b1fc3a0d-d548-4ba3-b34f-bd8af19a7d75",
          "name": "2-PROPENOIC ACID, 1,1'-(2-ETHYL-2-(((1-OXO-2-PROPEN-1-YL)OXY)METHYL)-1,3-PROPANEDIYL) ESTER",
          "stdName": "2-PROPENOIC ACID, 1,1'-(2-ETHYL-2-(((1-OXO-2-PROPEN-1-YL)OXY)METHYL)-1,3-PROPANEDIYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c5cea0e-3ae8-4b49-9537-041b3f172272",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        },
        {
          "uuid": "97cb9f4c-e8d8-4be5-95d5-8030a398d626",
          "name": "2-PROPENOIC ACID, 2-ETHYL-2-(((1-OXO-2-PROPENYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER",
          "stdName": "2-PROPENOIC ACID, 2-ETHYL-2-(((1-OXO-2-PROPENYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c5cea0e-3ae8-4b49-9537-041b3f172272",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        },
        {
          "uuid": "74b9094d-8a7d-441c-811a-5ce9371a663e",
          "name": "ACRYLIC ACID, TRIESTER WITH 2-ETHYL-2-(HYDROXYMETHYL)-1,3-PROPANEDIOL",
          "stdName": "ACRYLIC ACID, TRIESTER WITH 2-ETHYL-2-(HYDROXYMETHYL)-1,3-PROPANEDIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c5cea0e-3ae8-4b49-9537-041b3f172272",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        },
        {
          "uuid": "d81876e8-82e1-4c04-aa22-f3da1eda7902",
          "name": "MFM",
          "stdName": "MFM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d59c6b16-b732-4918-867e-9f5ecb4fa0d3",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        },
        {
          "uuid": "43065d9d-a6a9-42f7-8205-ac688f7cdf48",
          "name": "OGUMONT T 200",
          "stdName": "OGUMONT T 200",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d59c6b16-b732-4918-867e-9f5ecb4fa0d3",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        },
        {
          "uuid": "3094ea8f-4f26-4bdf-a193-0857c7d34864",
          "name": "SARET 351",
          "stdName": "SARET 351",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d59c6b16-b732-4918-867e-9f5ecb4fa0d3",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        },
        {
          "uuid": "50be6950-f4b7-4574-9c09-24a8bda01395",
          "name": "SARTOMER SR 351",
          "stdName": "SARTOMER SR 351",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d59c6b16-b732-4918-867e-9f5ecb4fa0d3",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        },
        {
          "uuid": "29b3e5ed-eed8-44f8-b9f2-b80a44b3fc34",
          "name": "SETALUX UV 2241",
          "stdName": "SETALUX UV 2241",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d59c6b16-b732-4918-867e-9f5ecb4fa0d3",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        },
        {
          "uuid": "5e566f29-7ffe-4482-ac86-94c09ca81d51",
          "name": "TMPTA",
          "stdName": "TMPTA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d59c6b16-b732-4918-867e-9f5ecb4fa0d3",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        },
        {
          "uuid": "d72c9186-47af-40b9-99cc-9f8c3a2081de",
          "name": "TRIMETHYLOLPROPANE TRIACRYLATE",
          "stdName": "TRIMETHYLOLPROPANE TRIACRYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0065b1d5-9b10-4b02-b277-03c861289e07",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2",
            "207f9f2b-8fc2-44fb-8b98-2de342491f39",
            "21d95cf3-3bab-42f4-b67a-07e96211ab0a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "546faabe-ae94-43bc-ae06-6d247bdd2517",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f68db2c4-1df8-65be-92d7-4f7d704527ba",
          "name": "TRIMETHYLOLPROPANE TRIACRYLATE [IARC]",
          "stdName": "TRIMETHYLOLPROPANE TRIACRYLATE [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aec6b547-a3d3-9cbc-72b5-757be99a55ee"
          ],
          "display_name": false
        },
        {
          "uuid": "3f70d83f-2d93-4406-aabf-3d17bd8f29f3",
          "name": "VISCOAT 295",
          "stdName": "VISCOAT 295",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d59c6b16-b732-4918-867e-9f5ecb4fa0d3",
            "2e7101f9-a1b0-4c90-9baa-6d73259c94f2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "21d95cf3-3bab-42f4-b67a-07e96211ab0a",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1c5cea0e-3ae8-4b49-9537-041b3f172272",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e7101f9-a1b0-4c90-9baa-6d73259c94f2",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d59c6b16-b732-4918-867e-9f5ecb4fa0d3",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0065b1d5-9b10-4b02-b277-03c861289e07",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80f79db1-2ade-4e3a-a14b-8af316597d55",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390897000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ae0896e-0910-475b-afdd-b31ea20618a0",
          "citation": "SRS import [4B67KGL96S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4B67KGL96S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390897000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0f56e42-79af-45ad-ba84-a5690ca974b3",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "207f9f2b-8fc2-44fb-8b98-2de342491f39",
          "citation": "TRIMETHYLOLPROPANE TRIACRYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cfda8778-0590-a182-e0da-0335721cc3e4",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Trimethylolpropane_triacrylate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8afcb5c8-d016-e71e-c693-ac0ab44336bf",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+15625-89-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "89b9b4e5-0911-65f0-1788-6664931d3f2c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15625-89-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aec6b547-a3d3-9cbc-72b5-757be99a55ee",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "cb9e37a2-6826-4cfc-8a1d-6255504f92cc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7ff1c10f-7e60-5814-7931-105d7601e4dc",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "34ed1739-4dbd-45c3-b140-729cd5b4b74c",
          "id": "34ed1739-4dbd-45c3-b140-729cd5b4b74c",
          "molfile": "\n  Marvin  01132102492D          \n\n 21 20  0  0  0  0            999 V2000\n    6.0110   -6.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6867   -6.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6149   -5.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4399   -5.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8523   -6.1047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6773   -6.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0898   -5.3902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0898   -6.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9149   -6.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4013   -4.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6044   -4.3798    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3909   -3.5829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9742   -2.9995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5940   -3.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3805   -2.5725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8024   -5.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2721   -4.9015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4596   -5.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1775   -5.8200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9293   -4.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1169   -4.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 10  1  0  0  0  0\n  3 16  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  2  0  0  0  0\nM  END",
          "smiles": "C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C",
          "formula": "C15H20O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7ebfdce5-2509-4a1b-bb12-fb9e36fc5630"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "296.3163",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a16c5c1d-3e13-490a-b1d1-25735002a512",
      "version": "9",
      "structure": {
        "id": "1199382a-662c-4f96-94ef-945da222f04e",
        "molfile": "\n  Marvin  01132101082D          \n\n 21 20  0  0  0  0            999 V2000\n    6.6149   -5.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4399   -5.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8523   -6.1047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6773   -6.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0898   -6.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9149   -6.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0898   -5.3902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4013   -4.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6044   -4.3798    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3909   -3.5829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5940   -3.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3805   -2.5725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9742   -2.9995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8024   -5.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2721   -4.9015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4596   -5.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9293   -4.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1169   -4.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1775   -5.8200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6867   -6.2120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0110   -6.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  4  7  2  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 10 13  2  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 16 19  2  0  0  0  0\n  1 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
        "smiles": "C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C",
        "formula": "C15H20O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "296.3163",
        "optical_activity": "NONE",
        "references": [
          "c0f56e42-79af-45ad-ba84-a5690ca974b3",
          "8ae0896e-0910-475b-afdd-b31ea20618a0"
        ],
        "stereo_centers": 0
      },
      "unii": "4B67KGL96S"
    }
  ]
}