{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d5463b95-33c4-465f-815f-625beddfeb33", "code": "61954-97-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=61954-97-0", "code_system": "CAS", "references": [ "05a6e45c-6cab-486e-b5d0-22b6a8eea84d", "1c4ad24b-f82d-4c4c-bcc4-ac19389592ac" ] }, { "uuid": "fa28e7d8-36c5-4c3c-b0ed-a0fd536a6392", "code": "m4773", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m4773?q=authorize", "code_system": "MERCK INDEX", "references": [ "05a6e45c-6cab-486e-b5d0-22b6a8eea84d" ] }, { "uuid": "cf6b207b-4f88-4bd4-ba1a-61837a657bf0", "code": "124905", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/124905", "code_system": "PUBCHEM", "references": [ "05a6e45c-6cab-486e-b5d0-22b6a8eea84d" ] }, { "uuid": "68272f1e-a944-469f-ac16-7f3893cd2d48", "code": "4AN25F4W2P", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8875d9b5-e01b-10d3-2137-63889551188f", "code": "DTXSID10977496", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10977496", "code_system": "EPA CompTox" } ], "relationships": [ { "uuid": "37c88ad3-01a4-451e-b152-1df8b83a149a", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "b4a80369-6fc8-4e1e-b939-ed3dca2814c3", "refuuid": "9061441f-0a3f-4558-bc05-8a50d8cf5f72", "name": "ACEFYLLINE", "unii": "M494UE2YEP", "linking_id": "M494UE2YEP", "ref_pname": "ACEFYLLINE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "472d61fa-d45a-4527-92c5-5d00436f2185", "name": "7H-PURINE-7-ACETIC ACID, 1,2,3,6-TETRAHYDRO-1,3-DIMETHYL-2,6-DIOXO-, COMPD. WITH 1-((3,4-DIETHOXYPHENYL)METHYL)-6,7-DIETHOXY-3,4-DIHYDROISOQUINOLINE (1:1)", "stdName": "7H-PURINE-7-ACETIC ACID, 1,2,3,6-TETRAHYDRO-1,3-DIMETHYL-2,6-DIOXO-, COMPD. WITH 1-((3,4-DIETHOXYPHENYL)METHYL)-6,7-DIETHOXY-3,4-DIHYDROISOQUINOLINE (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "392cc6e0-634f-4bde-8955-3b2e6e3dc4f5", "a7a52579-bdad-44ef-beb8-3b85ed616069" ], "display_name": false }, { "uuid": "a837821c-02ea-4eb3-9c50-7804644b4dcc", "name": "DRA", "stdName": "DRA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a7a52579-bdad-44ef-beb8-3b85ed616069", "12070698-20c2-4484-8ee8-2bd4c83769d4" ], "display_name": false }, { "uuid": "d3179955-b965-48ab-a635-af6232d2eab9", "name": "DROTAVERINE ACEPHYLLINATE", "stdName": "DROTAVERINE ACEPHYLLINATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "84d06423-e0c4-46a6-a6d1-dfd9575ce034", "cfce137e-1c4a-4de9-a33a-f73ab4c389d8", "a7a52579-bdad-44ef-beb8-3b85ed616069", "12070698-20c2-4484-8ee8-2bd4c83769d4", "56b8e935-310b-46d4-be85-358e663d24d9" ], "display_name": true }, { "uuid": "438ad7da-e5f2-4042-8b52-b8b16ddd2617", "name": "DROTAVERINE ACEPHYLLINATE [MI]", "stdName": "DROTAVERINE ACEPHYLLINATE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a7a52579-bdad-44ef-beb8-3b85ed616069", "12070698-20c2-4484-8ee8-2bd4c83769d4" ], "display_name": false } ], "references": [ { "uuid": "84d06423-e0c4-46a6-a6d1-dfd9575ce034", "citation": "CHEMID 2011 Drugportal", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "cfce137e-1c4a-4de9-a33a-f73ab4c389d8", "citation": "DRUGPORTAL 2011", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "392cc6e0-634f-4bde-8955-3b2e6e3dc4f5", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a7a52579-bdad-44ef-beb8-3b85ed616069", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "12070698-20c2-4484-8ee8-2bd4c83769d4", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "05a6e45c-6cab-486e-b5d0-22b6a8eea84d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391088000, "tags": [ "NOMEN" ] }, { "uuid": "dde551db-dc4d-43e8-8e4b-c26521c1f6d0", "citation": "SRS import [4AN25F4W2P]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4AN25F4W2P", "doc_type": "SRS", "public_domain": true, "document_date": 1493391088000, "tags": [ "NOMEN" ] }, { "uuid": "ecb61961-189b-4617-b748-c67889a8b5f0", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "56b8e935-310b-46d4-be85-358e663d24d9", "citation": "DROTAVERINE ACEPHYLLINATE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1c4ad24b-f82d-4c4c-bcc4-ac19389592ac", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a92ff388-5d4a-4124-96a4-d860e0c0c435", "id": "a92ff388-5d4a-4124-96a4-d860e0c0c435", "molfile": "\n Marvin 01132108472D \n\n 17 18 0 0 0 0 999 V2000\n 7.8996 -1.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8996 -2.1667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6116 -2.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3915 -2.3253 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8780 -2.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3988 -3.6545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6580 -4.4377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4659 -4.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7251 -5.3880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0146 -3.9886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6161 -3.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8996 -3.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9000 -4.6417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1876 -3.4083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4737 -3.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1876 -2.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4719 -2.1730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 16 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 11 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 11 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 12 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 1 0 0 0 0\n 16 17 2 0 0 0 0\nM END", "smiles": "Cn1c2c(c(=O)n(C)c1=O)n(CC(=O)O)cn2", "formula": "C9H10N4O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "652d2faf-b3a6-4d79-8f7b-dd60e2c65997" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "238.2005", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "8a6eae01-9c07-4c18-b2f7-8d98e25ec59b", "id": "8a6eae01-9c07-4c18-b2f7-8d98e25ec59b", "molfile": "\n Marvin 01132107112D \n\n 29 31 0 0 0 0 999 V2000\n 1.2814 0.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6958 -0.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2803 -1.1230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6946 -1.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5193 -1.8343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9325 -2.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5178 -3.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9256 -3.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9280 -4.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6400 -5.2298 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6450 -6.0539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9253 -6.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2101 -6.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4984 -6.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7922 -6.0447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0758 -6.4538 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6388 -6.0415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3552 -6.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7943 -5.2179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0807 -4.7999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0844 -3.9742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6293 -3.5604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5065 -4.8087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2162 -5.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6918 -3.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2794 -2.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4538 -2.5446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0456 -1.8277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7798 -1.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 26 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 25 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 9 24 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 24 2 0 0 0 0\n 15 14 2 0 0 0 0\n 15 16 1 0 0 0 0\n 19 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 23 19 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\nM END", "smiles": "CCOc1ccc(CC2=NCCc3cc(c(cc32)OCC)OCC)cc1OCC", "formula": "C24H31NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1b7fd96a-4fcb-4b4e-be95-9ad8bbadc341" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "397.5081", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e0a8ead8-17db-4335-a9a0-3f68aad1f31f", "version": "3", "structure": { "id": "1ce27efb-f757-4145-8408-3eb123589239", "molfile": "\n Marvin 01132101402D \n\n 46 49 0 0 0 0 999 V2000\n 1.2797 -2.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6922 -3.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5183 -3.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9331 -2.5554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5198 -1.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6950 -1.8350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2806 -1.1232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6962 -0.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2817 0.3082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4539 -2.5452 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0456 -1.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7800 -1.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9262 -3.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6408 -5.2309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9286 -4.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9259 -6.4640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6458 -6.0552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2106 -6.0508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2167 -5.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5068 -4.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7945 -5.2190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7924 -6.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4987 -6.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0807 -4.8009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0758 -6.4552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0844 -3.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6294 -3.5612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6389 -6.0428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3555 -6.4519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1580 -2.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1580 -3.3943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8670 -3.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8670 -2.1578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5761 -2.5727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5806 -3.3908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3601 -3.6394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8373 -2.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3528 -2.3157 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8670 -1.3362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6182 -4.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8674 -4.6226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4470 -3.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4452 -2.1640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4228 -4.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6809 -5.3658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9692 -3.9722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10 11 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 18 1 0 0 0 0\n 5 6 2 0 0 0 0\n 21 24 1 0 0 0 0\n 11 12 1 0 0 0 0\n 22 25 1 0 0 0 0\n 6 1 1 0 0 0 0\n 24 26 1 0 0 0 0\n 3 13 1 0 0 0 0\n 26 27 1 0 0 0 0\n 1 2 2 0 0 0 0\n 25 28 1 0 0 0 0\n 14 15 2 0 0 0 0\n 28 29 1 0 0 0 0\n 15 13 1 0 0 0 0\n 30 31 1 0 0 0 0\n 6 7 1 0 0 0 0\n 3 4 2 0 0 0 0\n 30 33 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 35 1 0 0 0 0\n 34 33 1 0 0 0 0\n 34 35 2 0 0 0 0\n 7 8 1 0 0 0 0\n 14 17 1 0 0 0 0\n 15 19 1 0 0 0 0\n 18 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 2 0 0 0 0\n 38 34 1 0 0 0 0\n 8 9 1 0 0 0 0\n 33 39 1 0 0 0 0\n 18 19 2 0 0 0 0\n 36 40 1 0 0 0 0\n 4 5 1 0 0 0 0\n 32 41 2 0 0 0 0\n 19 20 1 0 0 0 0\n 31 42 1 0 0 0 0\n 1 10 1 0 0 0 0\n 30 43 2 0 0 0 0\n 20 21 2 0 0 0 0\n 40 44 1 0 0 0 0\n 2 3 1 0 0 0 0\n 44 45 1 0 0 0 0\n 21 22 1 0 0 0 0\n 44 46 2 0 0 0 0\nM END", "smiles": "CCOc1ccc(CC2=NCCc3cc(c(cc32)OCC)OCC)cc1OCC.Cn1c2c(c(=O)n(C)c1=O)n(CC(=O)O)cn2", "formula": "C24H31NO4.C9H10N4O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "635.7086", "optical_activity": "NONE", "references": [ "dde551db-dc4d-43e8-8e4b-c26521c1f6d0", "ecb61961-189b-4617-b748-c67889a8b5f0" ], "stereo_centers": 0 }, "unii": "4AN25F4W2P" } ] }