{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "03e5e1a4-573f-410b-8cb8-816d05cf1235",
          "code": "6024-85-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6024-85-7",
          "code_system": "CAS",
          "references": [
            "6e24d999-55ef-c395-9a68-838f23f8e38a"
          ]
        },
        {
          "uuid": "0e48c919-f73d-5f34-5e0d-324d75edf8e2",
          "code": "17265",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17265",
          "code_system": "PUBCHEM",
          "references": [
            "4b00c86c-522a-7067-531b-349197a97d0c"
          ]
        },
        {
          "uuid": "f1d2c955-760c-41ea-8754-4e16ae00008d",
          "code": "4AA8F911N9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "157e0a17-69bf-8ed0-55f1-15ab8660ccab",
          "code": "132057",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=132057",
          "code_system": "NSC",
          "references": [
            "7bfcbb60-b536-c9e8-966d-dce4a8908f28"
          ]
        },
        {
          "uuid": "4c38ec64-09fb-5186-93ec-29f2702ac15b",
          "code": "209411",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=209411",
          "code_system": "NSC",
          "references": [
            "7bfcbb60-b536-c9e8-966d-dce4a8908f28"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "37aa703f-d858-48ba-8fbe-3d4e29dc3ada",
          "name": "(±)-TETRAHYDROPALMATINE HYDROCHLORIDE",
          "stdName": "(+/-)-TETRAHYDROPALMATINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8ed3932-9dcd-4163-8c72-d6b55ad4b7a5",
            "6af97fb0-08b9-4b60-892c-338650b8c26e"
          ],
          "display_name": false
        },
        {
          "uuid": "e7e00507-7f0b-4518-a1f3-891afd753363",
          "name": "6H-DIBENZO(A,G)QUINOLIZINE, 5,8,13,13A-TETRAHYDRO-2,3,9,10-TETRAMETHOXY-, HYDROCHLORIDE (1:1)",
          "stdName": "6H-DIBENZO(A,G)QUINOLIZINE, 5,8,13,13A-TETRAHYDRO-2,3,9,10-TETRAMETHOXY-, HYDROCHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8ed3932-9dcd-4163-8c72-d6b55ad4b7a5",
            "6af97fb0-08b9-4b60-892c-338650b8c26e"
          ],
          "display_name": false
        },
        {
          "uuid": "ca7928c3-3961-4808-8b23-fc2a9f9149ce",
          "name": "BERBINE, 2,3,9,10-TETRAMETHOXY-, HYDROCHLORIDE, (±)-",
          "stdName": "BERBINE, 2,3,9,10-TETRAMETHOXY-, HYDROCHLORIDE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8ed3932-9dcd-4163-8c72-d6b55ad4b7a5",
            "6af97fb0-08b9-4b60-892c-338650b8c26e"
          ],
          "display_name": false
        },
        {
          "uuid": "97ea59eb-2fc6-4347-bfb4-2c8be4cfc5b2",
          "name": "DL-TETRAHYDROPALMATINE HYDROCHLORIDE",
          "stdName": "DL-TETRAHYDROPALMATINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8ed3932-9dcd-4163-8c72-d6b55ad4b7a5",
            "6af97fb0-08b9-4b60-892c-338650b8c26e"
          ],
          "display_name": false
        },
        {
          "uuid": "f043bc9f-66b7-40aa-8ed1-8b7bfbb78914",
          "name": "NSC-132057",
          "stdName": "NSC-132057",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8ed3932-9dcd-4163-8c72-d6b55ad4b7a5",
            "6af97fb0-08b9-4b60-892c-338650b8c26e"
          ],
          "display_name": false
        },
        {
          "uuid": "be02b598-c3a7-49a7-bab9-285b3d09d84e",
          "name": "NSC-209411",
          "stdName": "NSC-209411",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8ed3932-9dcd-4163-8c72-d6b55ad4b7a5",
            "6af97fb0-08b9-4b60-892c-338650b8c26e"
          ],
          "display_name": false
        },
        {
          "uuid": "42a4d347-20f1-4267-b158-be784f0f3d92",
          "name": "TETRAHYDROPALMATINE DL-FORM HYDROCHLORIDE [MI]",
          "stdName": "TETRAHYDROPALMATINE DL-FORM HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1f91e13-1d7a-4135-994e-94f87ba717e0",
            "6af97fb0-08b9-4b60-892c-338650b8c26e"
          ],
          "display_name": false
        },
        {
          "uuid": "92e64626-528e-e6ac-2da7-3bec2b5d979f",
          "name": "TETRAHYDROPALMATINE HCL",
          "stdName": "TETRAHYDROPALMATINE HCL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "f50bfaa8-9872-126d-b297-b6e115fa960a"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d01b99e1-7577-4a88-a3d5-8385b6a6654f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c59796f6-8479-47c4-b367-52109d19932e",
          "name": "TETRAHYDROPALMATINE HYDROCHLORIDE, (±)-",
          "stdName": "TETRAHYDROPALMATINE HYDROCHLORIDE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dea10eac-f044-4305-8759-879659e799ef",
            "6af97fb0-08b9-4b60-892c-338650b8c26e"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "dea10eac-f044-4305-8759-879659e799ef",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6af97fb0-08b9-4b60-892c-338650b8c26e",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1f91e13-1d7a-4135-994e-94f87ba717e0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8ed3932-9dcd-4163-8c72-d6b55ad4b7a5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95b83329-aab2-4879-9f8c-0ee31198ea14",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392014000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecdc1b9b-a884-40d8-bcde-7bc73168244d",
          "citation": "SRS import [4AA8F911N9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4AA8F911N9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392014000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f50bfaa8-9872-126d-b297-b6e115fa960a",
          "citation": "PCPC-DB",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "6e24d999-55ef-c395-9a68-838f23f8e38a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4b00c86c-522a-7067-531b-349197a97d0c",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "7bfcbb60-b536-c9e8-966d-dce4a8908f28",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "acf1c18a-1fc7-48fa-9a3b-d0d368505c46",
          "id": "acf1c18a-1fc7-48fa-9a3b-d0d368505c46",
          "molfile": "\n  Marvin  01132108582D          \n\n  1  0  0  0  0  0            999 V2000\n    7.0942   -7.5089    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "568df19c-6bfb-4b24-8faa-3f51e0231bb0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "44efc76d-b420-44c8-941f-5b1453ffb166",
          "id": "44efc76d-b420-44c8-941f-5b1453ffb166",
          "molfile": "\n  Marvin  01132103382D          \n\n 26 29  0  0  0  0            999 V2000\n   10.5970   -3.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8825   -3.3084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1680   -3.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1680   -4.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4535   -4.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4535   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7390   -6.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0245   -5.7834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3101   -6.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5956   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5956   -4.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3101   -4.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0245   -4.9584    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.7390   -4.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7390   -3.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4535   -3.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4535   -2.4834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7390   -2.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8811   -4.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1667   -4.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1667   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4522   -6.1958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7378   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8811   -6.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8811   -7.0208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1667   -7.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 16  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n 14  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 13  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 24  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 19  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 24 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "COc1ccc2CC3c4cc(c(cc4CCN3Cc2c1OC)OC)OC",
          "formula": "C21H25NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "773edce7-92e5-4d28-9aae-afbab8f22f7d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "355.4283",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "dc35e453-094a-4e5f-9ec9-23c70b7fa4d6",
      "version": "7",
      "structure": {
        "id": "4f87b863-7b73-4197-93e8-87838e82af2d",
        "molfile": "\n  Marvin  01132104092D          \n\n 27 29  0  0  0  0            999 V2000\n    7.0942   -7.5089    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.4535   -2.4834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7390   -2.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4535   -3.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7390   -3.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7390   -4.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0245   -4.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0245   -5.7834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7390   -6.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4535   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4535   -4.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1680   -4.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1680   -3.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8825   -3.3084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5970   -3.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3101   -6.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5956   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5956   -4.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8811   -4.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1667   -4.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1667   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8811   -6.1958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8811   -7.0208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1667   -7.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4522   -6.1958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7378   -5.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3101   -4.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n  4 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n  8 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 17 22  1  0  0  0  0\n 22 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 21 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 18  1  0  0  0  0\n  7 27  1  0  0  0  0\nM  END",
        "smiles": "COc1ccc2CC3c4cc(c(cc4CCN3Cc2c1OC)OC)OC.Cl",
        "formula": "C21H25NO4.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "391.8892",
        "optical_activity": "( + / - )",
        "references": [
          "c8ed3932-9dcd-4163-8c72-d6b55ad4b7a5",
          "ecdc1b9b-a884-40d8-bcde-7bc73168244d"
        ],
        "stereo_centers": 1
      },
      "unii": "4AA8F911N9"
    }
  ]
}