{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "02382cbd-f839-44bf-854a-f320db88f7fd", "code": "64644-34-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=64644-34-4", "code_system": "CAS", "references": [ "c926630f-9ceb-4596-a359-a9c7f47a8ef0", "d5351b1c-d115-4767-a8cb-b9c046d55665" ] }, { "uuid": "aabd9a04-a038-4c02-9d24-fc4412510059", "code": "264-991-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.059.065", "code_system": "ECHA (EC/EINECS)", "references": [ "c926630f-9ceb-4596-a359-a9c7f47a8ef0" ] }, { "uuid": "a248c84b-fefb-4d7b-8831-a08e2933e155", "code": "121494090", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/121494090", "code_system": "PUBCHEM", "references": [ "c926630f-9ceb-4596-a359-a9c7f47a8ef0" ] }, { "uuid": "549be0c0-1bd8-d0a6-3055-ccfbea4410b0", "code": "DTXSID20867091", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20867091", "code_system": "EPA CompTox", "references": [ "dc89fee5-68e4-63b4-f2e2-7a87e4a50f4a" ] }, { "uuid": "6ce5d0b2-f329-4a65-be31-1c7cc3a9ec3e", "code": "4A8MX1P8CF", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "d1a454cd-551d-4654-add7-3db229090997", "name": "4,7-METHANO-1H-INDENE-2-METHANOL, OCTAHYDRO-, ACETATE", "stdName": "4,7-METHANO-1H-INDENE-2-METHANOL, OCTAHYDRO-, ACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8156e139-64ee-485f-990a-93f0414677bd" ], "display_name": false }, { "uuid": "997547cc-df65-4da7-85e7-08882dfeb670", "name": "OCTAHYDRO-4,7-METHANO-1H-INDENE-2-METHANOL ACETATE", "stdName": "OCTAHYDRO-4,7-METHANO-1H-INDENE-2-METHANOL ACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7754b2f0-0331-4495-b7b2-45688ba6e1b5" ], "display_name": true } ], "references": [ { "uuid": "8156e139-64ee-485f-990a-93f0414677bd", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "7754b2f0-0331-4495-b7b2-45688ba6e1b5", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c926630f-9ceb-4596-a359-a9c7f47a8ef0", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392085000, "tags": [ "NOMEN" ] }, { "uuid": "659a5d73-5714-467d-9a22-bcfdf0f82291", "citation": "SRS import [4A8MX1P8CF]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4A8MX1P8CF", "doc_type": "SRS", "public_domain": true, "document_date": 1493392085000, "tags": [ "NOMEN" ] }, { "uuid": "d5351b1c-d115-4767-a8cb-b9c046d55665", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "dc89fee5-68e4-63b4-f2e2-7a87e4a50f4a", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "30530549-b071-474c-ac75-e010ff9b9fee", "id": "30530549-b071-474c-ac75-e010ff9b9fee", "molfile": "\n Marvin 01132102352D \n\n 15 17 0 0 0 0 999 V2000\n 6.1405 -4.9128 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 5.4260 -4.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4260 -3.6753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1405 -3.2627 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.6168 -4.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8550 -3.6753 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.6396 -3.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1245 -4.0877 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.9495 -4.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3621 -4.8022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1870 -4.8022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5995 -5.5166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5995 -4.0877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6396 -4.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8550 -4.5003 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 2 1 1 0 0 0 0\n 1 5 1 6 0 0 0\n 1 15 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 6 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 15 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 14 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\n 15 14 1 0 0 0 0\nM END", "smiles": "CC(=O)OCC1CC2[C@H]3CC[C@H](C3)C2C1", "formula": "C13H20O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "62539f2d-b989-45c3-8305-416e27b331f5" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "208.2972", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "38512b94-7475-4398-975b-e1685694656f", "version": "6", "structure": { "id": "9c8e2ead-861b-49c4-9d27-615886234cc4", "molfile": "\n Marvin 01132108082D \n\n 15 17 0 0 1 0 999 V2000\n 5.4260 -3.6753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1405 -3.2627 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.6168 -4.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1405 -4.9128 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.8550 -4.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6396 -4.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1245 -4.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9495 -4.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3621 -4.8022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1870 -4.8022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5995 -5.5166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5995 -4.0877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6396 -3.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8550 -3.6753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4260 -4.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 6 0 0 0\n 4 3 1 6 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 2 0 0 0 0\n 7 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 2 14 1 0 0 0 0\n 14 5 1 0 0 0 0\n 15 4 1 0 0 0 0\n 1 15 1 0 0 0 0\nM END", "smiles": "CC(=O)OCC1CC2[C@H]3CC[C@H](C3)C2C1", "formula": "C13H20O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "208.2972", "optical_activity": "UNSPECIFIED", "references": [ "659a5d73-5714-467d-9a22-bcfdf0f82291", "8156e139-64ee-485f-990a-93f0414677bd" ], "stereo_centers": 4 }, "unii": "4A8MX1P8CF" } ] }