{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7ba36a55-536b-4fa6-bfcf-5de61fec6709", "code": "88798-74-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=88798-74-7", "code_system": "CAS", "references": [ "c40e7a7f-6aa9-868c-ec1b-5cf3cea63d30" ] }, { "uuid": "79a0e667-bf5c-af5a-9ecb-693eed766b04", "code": "145937", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/145937", "code_system": "PUBCHEM", "references": [ "4c628af1-c65c-bac0-e0fd-bfc4a6d6939e" ] }, { "uuid": "a0919245-6703-4416-b2f6-e6029db5718d", "code": "4A5E8354UB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "9e4ce43f-a4d7-52a6-fb8b-b446ee247188", "code": "DTXSID40237333", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40237333", "code_system": "EPA CompTox" }, { "uuid": "75a5c7df-9697-44a2-2909-41e264be12e3", "code": "Eckol", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Eckol", "code_system": "WIKIPEDIA", "references": [ "033a2786-532b-f235-308c-915d9634e5c2" ] } ], "relationships": [ { "uuid": "1f2752ac-ba79-463c-b332-fdfaea2d4ac0", "amount": { "uuid": "d8eb5f78-79f8-4ecc-84f9-62395900e75c" }, "type": "PARENT->CONSTITUENT ALWAYS PRESENT", "references": [ "3f7887c4-df0b-45af-ad5a-a344c6255305" ], "related_substance": { "uuid": "aa6acfef-9f17-45ad-b76e-cc39cb71b8a2", "refuuid": "0b00c31c-efb9-419a-a420-1bf9f0f96120", "name": "ECKLONIA CAVA", "unii": "UXX2N5V39P", "linking_id": "UXX2N5V39P", "ref_pname": "ECKLONIA CAVA", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "46f77d5f-3782-4b91-ed50-04f8b2f1f4c8", "name": "4-(3,5-DIHYDROXYPHENOXY)DIBENZO(B,E)(1,4)DIOXIN-1,3,6,8-TETROL", "stdName": "4-(3,5-DIHYDROXYPHENOXY)DIBENZO(B,E)(1,4)DIOXIN-1,3,6,8-TETROL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c40e7a7f-6aa9-868c-ec1b-5cf3cea63d30" ], "display_name": false }, { "uuid": "9c9fd0eb-e190-d34e-f716-63a26cc8694d", "name": "DIBENZO(B,E)(1,4)DIOXIN-1,3,6,8-TETROL, 4-(3,5-DIHYDROXYPHENOXY)-", "stdName": "DIBENZO(B,E)(1,4)DIOXIN-1,3,6,8-TETROL, 4-(3,5-DIHYDROXYPHENOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c40e7a7f-6aa9-868c-ec1b-5cf3cea63d30" ], "display_name": false }, { "uuid": "7f97c18d-d336-4d87-f0aa-f0edf03c6f38", "name": "ECKOL", "stdName": "ECKOL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "51890ef5-f227-89e3-f514-31419636bf2e" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "d640f502-b342-4667-8ae2-512d389dc452", "name_org": "INCI" } ] } ], "references": [ { "uuid": "c40e7a7f-6aa9-868c-ec1b-5cf3cea63d30", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "51890ef5-f227-89e3-f514-31419636bf2e", "citation": "Lee, Min-Sup, et al. \"Isolation and identification of phlorotannins from Ecklonia stolonifera with antioxidant and hepatoprotective properties in tacrine-treated HepG2 cells.\" Journal of agricultural and food chemistry 60.21 (2012): 5340-5349.", "url": "https://pubs.acs.org/doi/abs/10.1021/jf300157w", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e6c9b22d-fdaa-4101-b487-846f15fd402e", "citation": "Li, Yong, et al. \"Chemical components and its antioxidant properties in vitro: an edible marine brown alga, Ecklonia cava.\" Bioorganic & Medicinal Chemistry 17.5 (2009): 1963-1973.", "url": "https://www.sciencedirect.com/science/article/pii/S0968089609000613", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "033a2786-532b-f235-308c-915d9634e5c2", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "4c628af1-c65c-bac0-e0fd-bfc4a6d6939e", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "3f7887c4-df0b-45af-ad5a-a344c6255305", "citation": "Li, Yong, et al. \"Chemical components and its antioxidant properties in vitro: an edible marine brown alga, Ecklonia cava.\" Bioorganic & Medicinal Chemistry 17.5 (2009): 1963-1973.", "url": "https://www.sciencedirect.com/science/article/pii/S0968089609000613", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7b0b87a3-0c5a-eaf3-dd30-9e7500224d46", "id": "7b0b87a3-0c5a-eaf3-dd30-9e7500224d46", "molfile": "\n Marvin 01132106232D \n\n 27 30 0 0 0 0 999 V2000\n 18.2419 -3.2665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4667 -2.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3234 -2.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5482 -1.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4049 -1.0773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9162 -2.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0594 -3.2324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4274 -3.7627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4274 -4.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1419 -5.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8564 -4.5877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1419 -5.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4274 -6.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4274 -7.0627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7130 -5.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9985 -6.2377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2840 -5.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5696 -6.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8551 -5.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1407 -6.2377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8551 -5.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5696 -4.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5696 -3.7627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2840 -5.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9985 -4.5877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7130 -5.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8347 -3.5146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 27 2 2 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 1 0 0 0 0\n 7 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 27 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 26 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 10 12 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 13 2 0 0 0 0\n 15 16 1 0 0 0 0\n 15 26 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 24 2 0 0 0 0\n 18 19 2 0 0 0 0\n 20 19 1 0 0 0 0\n 21 19 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 24 22 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 25 1 0 0 0 0\nM END", "smiles": "c1c(cc(cc1O)Oc2c(cc(c3c2Oc4c(cc(cc4O3)O)O)O)O)O", "formula": "C18H12O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e4733e4e-6259-4306-9064-b2cd1e35576b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "372.2832", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "51381027-1cbf-4d05-9156-3605d74d5dbb", "version": "14", "structure": { "id": "339de698-05b1-b1d9-7a89-3e7fa4f1d658", "molfile": "\n Marvin 01132102452D \n\n 27 30 0 0 0 0 999 V2000\n 18.8268 -3.2665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.0516 -2.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9083 -2.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1331 -1.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9898 -1.0773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5012 -2.4200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6443 -3.2324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0124 -3.7627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0124 -4.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2980 -5.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2980 -5.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5835 -6.2377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8690 -5.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8690 -5.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5835 -4.5877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1546 -4.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1546 -3.7627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4401 -5.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4401 -5.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7257 -6.2377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1546 -6.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0124 -6.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0124 -7.0627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7268 -5.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7268 -5.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4413 -4.5877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4196 -3.5146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 10 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 16 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 19 2 0 0 0 0\n 13 21 1 0 0 0 0\n 11 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 25 9 1 0 0 0 0\n 27 7 2 0 0 0 0\n 27 2 1 0 0 0 0\nM END", "smiles": "c1c(cc(cc1O)Oc2c(cc(c3c2Oc4c(cc(cc4O3)O)O)O)O)O", "formula": "C18H12O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "372.2832", "optical_activity": "NONE", "references": [ "51890ef5-f227-89e3-f514-31419636bf2e" ], "stereo_centers": 0 }, "unii": "4A5E8354UB" } ] }