{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e955e117-5f5d-4130-91a7-9f3162cda687",
          "code": "A08AA08",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|ANTIOBESITY PREPARATIONS, EXCL. DIET PRODUCTS|ANTIOBESITY PREPARATIONS, EXCL. DIET PRODUCTS|Centrally acting antiobesity products|clobenzorex",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A08AA08&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "6a974bda-4377-4d5f-917d-a7ce7f5f1d68",
          "code": "QA08AA08",
          "comments": "VATC|ANTIOBESITY PREPARATIONS, EXCL. DIET PRODUCTS|ANTIOBESITY PREPARATIONS, EXCL. DIET PRODUCTS|Centrally acting antiobesity products|clobenzorex",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA08AA08&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "de4bcfab-a989-47e7-8909-a712e36f6da0",
          "code": "13364-32-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13364-32-4",
          "code_system": "CAS",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c",
            "e332b598-afbe-44a0-acaf-609cb090916f"
          ]
        },
        {
          "uuid": "2260c823-b158-4d58-bdcc-cf4ab15f10be",
          "code": "C77327",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77327",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "f8062b73-8e24-4258-8484-afc31a4d4a76",
          "code": "C000490",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67000490",
          "code_system": "MESH",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "0edb516b-033d-43bb-8359-0b9d33670dad",
          "code": "CLOBENZOREX",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Clobenzorex",
          "code_system": "WIKIPEDIA",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "4f3c0eba-6fde-436c-b8b9-f7037d250169",
          "code": "SUB06676MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "f0d74fb4-081c-4d8c-bffb-881c8de7390f",
          "code": "2363",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2363",
          "code_system": "INN",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "0251885a-27e7-4ca8-93cc-4a21f66cf373",
          "code": "236-434-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.033.108",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "978582c7-511a-45ee-8355-876ca220a739",
          "code": "21244",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/21244/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "e23e757a-0e6c-46d4-9eb2-2bbc18c0ac76",
          "code": "m3627",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3627?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "7c9f3442-c803-425b-80f5-c8b323392a82",
          "code": "CHEMBL1213251",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1213251",
          "code_system": "ChEMBL",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "c807f775-4199-41c0-8003-9c8346852167",
          "code": "735998",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/735998",
          "code_system": "PUBCHEM",
          "references": [
            "1d6f7430-526f-40fe-a15d-970b91e3323c"
          ]
        },
        {
          "uuid": "ee089f7a-00ce-792b-0bd8-f210e36c6f0e",
          "code": "DTXSID7048409",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7048409",
          "code_system": "EPA CompTox",
          "references": [
            "8bd37727-3f8e-c15f-0acf-730f78cadf05"
          ]
        },
        {
          "uuid": "b0a26eed-7bc2-d4a0-4b0c-17e1686ae5f5",
          "code": "C29728",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anorexiant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29728",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b2a82f1b-3c3b-3c2f-4ad3-06c4b259ccb6"
          ]
        },
        {
          "uuid": "62aee1d2-b3bd-45d6-a6f9-060a99a93ec1",
          "code": "4A5352XI2A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1070c493-89ee-4d67-6e09-7a4ecff10a95",
          "code": "684",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/684",
          "code_system": "DRUG CENTRAL",
          "references": [
            "b2a82f1b-3c3b-3c2f-4ad3-06c4b259ccb6"
          ]
        },
        {
          "uuid": "3db77a20-d9f1-a71c-dc53-2e5ccb52b872",
          "code": "DB13561",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB13561",
          "code_system": "DRUG BANK",
          "references": [
            "b2a82f1b-3c3b-3c2f-4ad3-06c4b259ccb6"
          ]
        },
        {
          "uuid": "144894d0-eebd-06ee-0ef3-fcef5cb6c689",
          "code": "100000084281",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9931c362-1b64-be17-0138-d19ca27448a7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4cfd198b-5399-4401-8f01-a8598a4570aa",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "15256863-293c-4bab-aeda-da747b67b578",
            "refuuid": "55e8136a-17c7-43e5-82b1-a8f9b28b53ec",
            "name": "CLOBENZOREX",
            "unii": "4A5352XI2A",
            "linking_id": "4A5352XI2A",
            "ref_pname": "CLOBENZOREX",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d685b702-2496-4a8e-85d0-ad9fed87ad64",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "29e32aa9-f769-4a5f-898b-ae76ead84375",
            "refuuid": "12afaa6c-47f1-4238-a098-2f86eae98706",
            "name": "CLOBENZOREX HYDROCHLORIDE",
            "unii": "BC6X5MB664",
            "linking_id": "BC6X5MB664",
            "ref_pname": "CLOBENZOREX HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ff3c4262-3e0c-458c-a78e-17ff0accbf36",
          "name": "(+)-N-(O-CHLOROBENZYL)-.ALPHA.-METHYLPHENETHYLAMINE",
          "stdName": "(+)-N-(O-CHLOROBENZYL)-.ALPHA.-METHYLPHENETHYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a017e11-927d-4ddb-83ff-d2f9f3bd6360"
          ],
          "display_name": false
        },
        {
          "uuid": "a57b3e02-28cb-4b8a-bcf5-6a513cca9084",
          "name": "BENZENEETHANAMINE, N-((2-CHLOROPHENYL)METHYL)-.ALPHA.-METHYL-, (.ALPHA.S)-",
          "stdName": "BENZENEETHANAMINE, N-((2-CHLOROPHENYL)METHYL)-.ALPHA.-METHYL-, (.ALPHA.S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15e12b51-def7-43b7-a293-8900c96d2c42"
          ],
          "display_name": false
        },
        {
          "uuid": "001f7000-14af-4b95-90f0-21edd96c1a17",
          "name": "BENZENEETHANAMINE, N-((2-CHLOROPHENYL)METHYL)-.ALPHA.-METHYL-, (S)-",
          "stdName": "BENZENEETHANAMINE, N-((2-CHLOROPHENYL)METHYL)-.ALPHA.-METHYL-, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9beafa69-39e0-4e97-abd2-81be35e95990"
          ],
          "display_name": false
        },
        {
          "uuid": "f81e9f9a-e6c7-4223-b735-7a41449b1cd5",
          "name": "CLOBENZOREX",
          "stdName": "CLOBENZOREX",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4e7d83d-7d21-4937-a000-30afe65865ea",
            "3a017e11-927d-4ddb-83ff-d2f9f3bd6360",
            "e4d394d4-ff42-4691-a627-edb31e88c7a9",
            "ef7e3288-fa66-4666-8613-e6a367b33429",
            "3f19d743-924a-4ee9-8ae3-9ccf0d708870",
            "68b7fc73-1ccc-4474-8112-dba759e6127c",
            "f307a0d5-2ec5-44db-9f96-bbeb6415c329"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "92cf74ab-aeba-44f5-ad93-f5e449ed2d7e",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "e0b215d4-bedf-4b82-9e5b-5b27922f1811",
          "name": "CLOBENZOREX [MI]",
          "stdName": "CLOBENZOREX [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f307a0d5-2ec5-44db-9f96-bbeb6415c329"
          ],
          "display_name": false
        },
        {
          "uuid": "114a5167-8ac2-0097-b54d-4957099afbc1",
          "name": "Clobenzorex [WHO-DD]",
          "stdName": "CLOBENZOREX [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b8b6c7e-6b59-de37-ee2f-2be61ad14284"
          ],
          "display_name": false
        },
        {
          "uuid": "719cca89-6b61-42a3-88ca-02568139ea64",
          "name": "SD 271-12",
          "stdName": "SD 271-12",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a017e11-927d-4ddb-83ff-d2f9f3bd6360"
          ],
          "display_name": false
        },
        {
          "uuid": "354a6821-ed40-44e5-9bc8-82ff16cc7a69",
          "name": "SD-271-12",
          "stdName": "SD-271-12",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bcd0dd68-5842-43f0-bb09-30ec850e84f7"
          ],
          "display_name": false
        },
        {
          "uuid": "610ec593-0255-48ba-b1d1-3646790b3148",
          "name": "SD-27112",
          "stdName": "SD-27112",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1022735-dc47-42a9-a078-6686f0eeacde"
          ],
          "display_name": false
        },
        {
          "uuid": "4877a7b3-5203-4f4a-8eb7-c051dec80654",
          "name": "clobenzorex [INN]",
          "stdName": "CLOBENZOREX [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4d394d4-ff42-4691-a627-edb31e88c7a9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3a017e11-927d-4ddb-83ff-d2f9f3bd6360",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9beafa69-39e0-4e97-abd2-81be35e95990",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15e12b51-def7-43b7-a293-8900c96d2c42",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4d394d4-ff42-4691-a627-edb31e88c7a9",
          "citation": "INN Proposed List 18",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL18.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f307a0d5-2ec5-44db-9f96-bbeb6415c329",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68b7fc73-1ccc-4474-8112-dba759e6127c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bcd0dd68-5842-43f0-bb09-30ec850e84f7",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1022735-dc47-42a9-a078-6686f0eeacde",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d6f7430-526f-40fe-a15d-970b91e3323c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cfa17708-623e-4d3d-bb7e-bc7e55ea1259",
          "citation": "SRS import [4A5352XI2A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4A5352XI2A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4e7d83d-7d21-4937-a000-30afe65865ea",
          "citation": "CLOBENZOREX [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ef7e3288-fa66-4666-8613-e6a367b33429",
          "citation": "CLOBENZOREX [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3f19d743-924a-4ee9-8ae3-9ccf0d708870",
          "citation": "CLOBENZOREX [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8bd37727-3f8e-c15f-0acf-730f78cadf05",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13364-32-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9931c362-1b64-be17-0138-d19ca27448a7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "b2a82f1b-3c3b-3c2f-4ad3-06c4b259ccb6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e332b598-afbe-44a0-acaf-609cb090916f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3b8b6c7e-6b59-de37-ee2f-2be61ad14284",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ff715609-6c07-4e9d-9d56-9771daaa056f",
          "id": "ff715609-6c07-4e9d-9d56-9771daaa056f",
          "molfile": "\n  Marvin  01132113132D          \n\n 18 19  0  0  1  0            999 V2000\n    5.4697   -2.3966    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.4655   -1.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1837   -2.8058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8977   -2.3924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6121   -2.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3256   -2.3944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3251   -1.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6051   -1.1570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8946   -1.5721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7557   -2.8099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0418   -2.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3278   -2.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6132   -2.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8997   -2.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9003   -3.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6203   -4.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3308   -3.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0486   -4.0448    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 10  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 17 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "C[C@@H](Cc1ccccc1)NCc2ccccc2Cl",
          "formula": "C16H18ClN",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "59b7b2d5-e1bf-4aa7-b00a-0b7bc86cf470"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "259.7743",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "55e8136a-17c7-43e5-82b1-a8f9b28b53ec",
      "version": "10",
      "structure": {
        "id": "32169208-0645-4118-98fe-810f92522b89",
        "molfile": "\n  Marvin  01132102412D          \n\n 18 19  0  0  1  0            999 V2000\n    3.3278   -2.8141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0418   -2.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7557   -2.8099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4697   -2.3966    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.1837   -2.8058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8977   -2.3924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6132   -2.3996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8997   -2.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9003   -3.6381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6203   -4.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3308   -3.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6121   -2.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3256   -2.3944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3251   -1.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6051   -1.1570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8946   -1.5721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0486   -4.0448    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.4655   -1.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  4  5  1  0  0  0  0\n  9 10  1  0  0  0  0\n  2  3  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11  1  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6 12  2  0  0  0  0\n  1  2  1  0  0  0  0\n 12 13  1  0  0  0  0\n  1  7  2  0  0  0  0\n 13 14  2  0  0  0  0\n  3  4  1  0  0  0  0\n 14 15  1  0  0  0  0\n  7  8  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16  6  1  0  0  0  0\n 11 17  1  0  0  0  0\n  8  9  2  0  0  0  0\n  4 18  1  1  0  0  0\nM  END",
        "smiles": "C[C@@H](Cc1ccccc1)NCc2ccccc2Cl",
        "formula": "C16H18ClN",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "259.7743",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3a017e11-927d-4ddb-83ff-d2f9f3bd6360",
          "cfa17708-623e-4d3d-bb7e-bc7e55ea1259",
          "e4d394d4-ff42-4691-a627-edb31e88c7a9"
        ],
        "stereo_centers": 1
      },
      "unii": "4A5352XI2A"
    }
  ]
}