{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7d004d74-d39f-4860-86ee-b8b451d7dd9b",
          "code": "19793-20-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=19793-20-5",
          "code_system": "CAS",
          "references": [
            "72de0463-b880-4a81-b50e-d2fe8c6fb37e",
            "d3a5e584-6779-426a-9d5d-a96774646c1c"
          ]
        },
        {
          "uuid": "a12c33fc-b482-4569-91ad-74164f263dc7",
          "code": "C547640",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67547640",
          "code_system": "MESH",
          "references": [
            "72de0463-b880-4a81-b50e-d2fe8c6fb37e"
          ]
        },
        {
          "uuid": "5b6ae4b9-f305-4a4a-b02c-ce2eb543a70d",
          "code": "BOLANDIOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bolandiol",
          "code_system": "WIKIPEDIA",
          "references": [
            "72de0463-b880-4a81-b50e-d2fe8c6fb37e"
          ]
        },
        {
          "uuid": "e7a5b8a9-0d95-41ed-a57e-f6a3ffa04512",
          "code": "2094",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2094",
          "code_system": "INN",
          "references": [
            "72de0463-b880-4a81-b50e-d2fe8c6fb37e"
          ]
        },
        {
          "uuid": "09a12517-14a9-4292-865a-91f89179d29d",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "72de0463-b880-4a81-b50e-d2fe8c6fb37e"
          ]
        },
        {
          "uuid": "07470f2f-1ac1-4d27-9115-3be91279a1cb",
          "code": "m2595",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2595?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "72de0463-b880-4a81-b50e-d2fe8c6fb37e"
          ]
        },
        {
          "uuid": "0fa24f3f-60f5-4d67-b556-8fdc6918c4e9",
          "code": "SUB05866MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "72de0463-b880-4a81-b50e-d2fe8c6fb37e"
          ]
        },
        {
          "uuid": "b5459553-e0e3-465b-875f-2972c4863525",
          "code": "CHEMBL2106664",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106664",
          "code_system": "ChEMBL",
          "references": [
            "72de0463-b880-4a81-b50e-d2fe8c6fb37e"
          ]
        },
        {
          "uuid": "b3604e6e-4551-4446-b787-4ad271e4359e",
          "code": "9835303",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9835303",
          "code_system": "PUBCHEM",
          "references": [
            "72de0463-b880-4a81-b50e-d2fe8c6fb37e"
          ]
        },
        {
          "uuid": "d21b8861-2147-4478-e87f-4dd8ce5b7ef8",
          "code": "DTXSID9041027",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9041027",
          "code_system": "EPA CompTox",
          "references": [
            "53e0c9ba-59f6-eab0-d0c0-488746ff558a"
          ]
        },
        {
          "uuid": "250bd5d2-ae22-2fee-e3ad-ef257e967fd2",
          "code": "C166743",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C166743",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4e12d053-649c-3620-b251-fcca1f323dd7"
          ]
        },
        {
          "uuid": "a96a580f-057c-4426-958b-50145dd39d8b",
          "code": "49SD6G16U5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0dd28e34-2131-b2c5-a8f9-90b4c19c919c",
          "code": "DB01554",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01554",
          "code_system": "DRUG BANK",
          "references": [
            "19e4b7bc-17c8-cd8d-a46f-e15eecf6bfc1"
          ]
        },
        {
          "uuid": "acc9bbec-05aa-9e3b-b50e-5ebc5b3a230b",
          "code": "145661",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:145661",
          "code_system": "CHEBI",
          "references": [
            "19e4b7bc-17c8-cd8d-a46f-e15eecf6bfc1"
          ]
        },
        {
          "uuid": "e7e25967-6167-5df4-664e-491479f6940f",
          "code": "100000086326",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "991a2097-4361-33be-54fd-bc9331a4eefd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "fa3b44a9-cd2f-4f44-9007-7ac963d0c69f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c6e32bbb-def5-4c6e-a213-10145bb596d4",
            "refuuid": "437c03e6-9f48-4db0-a2bd-2672174444ca",
            "name": "BOLANDIOL",
            "unii": "49SD6G16U5",
            "linking_id": "49SD6G16U5",
            "ref_pname": "BOLANDIOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4d22470c-3f29-4733-a218-0cac3c0d0911",
          "name": "(3.BETA.,17.BETA.)-ESTR-4-ENE-3,17-DIOL",
          "stdName": "(3.BETA.,17.BETA.)-ESTR-4-ENE-3,17-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb0b577b-7b91-41a2-a707-3ead217e2c1d",
            "3f2d8251-4347-41f6-b252-d696bfbfc761"
          ],
          "display_name": false
        },
        {
          "uuid": "25b06a1a-1636-4f12-96c0-d2a3c5133315",
          "name": "19-NOR-4-ANDROSTENE-3.BETA.0,17.BETA.-DIOL",
          "stdName": "19-NOR-4-ANDROSTENE-3.BETA.0,17.BETA.-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f2d8251-4347-41f6-b252-d696bfbfc761",
            "75b107fc-4ff9-4c2e-ab2a-7cad3099472c"
          ],
          "display_name": false
        },
        {
          "uuid": "52c295c2-9d44-464a-856e-c05fdc3369fe",
          "name": "19-NOR-4-ANDROSTENEDIOL",
          "stdName": "19-NOR-4-ANDROSTENEDIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f2d8251-4347-41f6-b252-d696bfbfc761",
            "67b83106-0680-46bf-9625-a370d789ee67"
          ],
          "display_name": false
        },
        {
          "uuid": "f8bcf562-125b-4e36-ac72-35fb052d4154",
          "name": "3.BETA.,17.BETA.-DIHYDROXYESTR-4-ENE",
          "stdName": "3.BETA.,17.BETA.-DIHYDROXYESTR-4-ENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb0b577b-7b91-41a2-a707-3ead217e2c1d",
            "3f2d8251-4347-41f6-b252-d696bfbfc761"
          ],
          "display_name": false
        },
        {
          "uuid": "99ea184f-103e-41de-82a8-1aa368e74b53",
          "name": "3BETA,17BETA-DIHYDROXYESTR-4-ENE",
          "stdName": "3BETA,17BETA-DIHYDROXYESTR-4-ENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f2d8251-4347-41f6-b252-d696bfbfc761",
            "1762ca10-d892-49f2-8e39-2809273d07a2"
          ],
          "display_name": false
        },
        {
          "uuid": "2fded20b-45af-4950-8bc4-6087883ce31f",
          "name": "4-NORENDIOL",
          "stdName": "4-NORENDIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f2d8251-4347-41f6-b252-d696bfbfc761",
            "c5256ecd-07b8-433e-aa67-0cdcd19d404a"
          ],
          "display_name": false
        },
        {
          "uuid": "46ef00db-86a1-43b2-80d7-672f305fe248",
          "name": "BOLANDIOL",
          "stdName": "BOLANDIOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "405aa001-98e0-4500-8143-5524ca78ef78",
            "89cf1ebe-3e70-41f9-b833-a9177a342221",
            "6af9ec16-b475-4aef-957e-9b95184143bf",
            "cb0b577b-7b91-41a2-a707-3ead217e2c1d",
            "7a71a738-7285-43ca-9904-ea49db60d875",
            "3f2d8251-4347-41f6-b252-d696bfbfc761",
            "a0dec6d3-c596-48ff-aa3d-c627a465157a",
            "2356b4cb-b0e2-4afe-ac94-4c8c6217c20c"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "6db1a32a-c845-4262-b425-884aebe7d014",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "c3e3b535-4358-4675-b44c-79e21bbfd056",
          "name": "BOLANDIOL [MART.]",
          "stdName": "BOLANDIOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "405aa001-98e0-4500-8143-5524ca78ef78"
          ],
          "display_name": false
        },
        {
          "uuid": "402b8939-812b-4917-b721-06ca89f41124",
          "name": "BOLANDIOL [MI]",
          "stdName": "BOLANDIOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a71a738-7285-43ca-9904-ea49db60d875",
            "3f2d8251-4347-41f6-b252-d696bfbfc761"
          ],
          "display_name": false
        },
        {
          "uuid": "24eedbc7-78ed-4447-bab7-d492fb1d935a",
          "name": "ESTR-4-ENE-3,17-DIOL, (3.BETA.,17.BETA.)-",
          "stdName": "ESTR-4-ENE-3,17-DIOL, (3.BETA.,17.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "818ee9c0-e45e-457a-adda-70d435d7624e",
            "3f2d8251-4347-41f6-b252-d696bfbfc761"
          ],
          "display_name": false
        },
        {
          "uuid": "512d7037-0a50-40f1-af0d-b5a143d40e25",
          "name": "bolandiol [INN]",
          "stdName": "BOLANDIOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6af9ec16-b475-4aef-957e-9b95184143bf",
            "3f2d8251-4347-41f6-b252-d696bfbfc761",
            "1cbe5768-1f09-44c3-a308-fe23b9f7746a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cb0b577b-7b91-41a2-a707-3ead217e2c1d",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3f2d8251-4347-41f6-b252-d696bfbfc761",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "818ee9c0-e45e-457a-adda-70d435d7624e",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "405aa001-98e0-4500-8143-5524ca78ef78",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a71a738-7285-43ca-9904-ea49db60d875",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6af9ec16-b475-4aef-957e-9b95184143bf",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67b83106-0680-46bf-9625-a370d789ee67",
          "citation": "cfr",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1762ca10-d892-49f2-8e39-2809273d07a2",
          "citation": "dea list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75b107fc-4ff9-4c2e-ab2a-7cad3099472c",
          "citation": "Int J Sports Med 2004; 25: 124-129",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5256ecd-07b8-433e-aa67-0cdcd19d404a",
          "citation": "http://www.koelnerliste.com/fileadmin/user_upload/medien/pdf/ioc_studie_2004.pdf",
          "url": "http://www.koelnerliste.com/fileadmin/user_upload/medien/pdf/ioc_studie_2004.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72de0463-b880-4a81-b50e-d2fe8c6fb37e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393361000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e987c36-cfc4-4de8-bbe7-79d9dd1851a2",
          "citation": "SRS import [49SD6G16U5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=49SD6G16U5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393361000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0dec6d3-c596-48ff-aa3d-c627a465157a",
          "citation": "BOLANDIOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "89cf1ebe-3e70-41f9-b833-a9177a342221",
          "citation": "BOLANDIOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2356b4cb-b0e2-4afe-ac94-4c8c6217c20c",
          "citation": "BOLANDIOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "53e0c9ba-59f6-eab0-d0c0-488746ff558a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=19793-20-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "991a2097-4361-33be-54fd-bc9331a4eefd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "1cbe5768-1f09-44c3-a308-fe23b9f7746a",
          "citation": "INN Proposed List 16",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL16.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4e12d053-649c-3620-b251-fcca1f323dd7",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "d3a5e584-6779-426a-9d5d-a96774646c1c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "19e4b7bc-17c8-cd8d-a46f-e15eecf6bfc1",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9653fe38-c8cb-40ab-a28a-9d36555c6cc8",
          "id": "9653fe38-c8cb-40ab-a28a-9d36555c6cc8",
          "molfile": "\n  Marvin  01132107482D          \n\n 20 23  0  0  1  0            999 V2000\n    7.9592   -1.0703    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.2136   -0.2831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4443   -1.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9589   -2.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1744   -2.1516    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.4584   -2.5651    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.4584   -3.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7489   -3.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0366   -3.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3242   -3.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6047   -3.3912    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.8822   -3.8142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6047   -2.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3242   -2.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0366   -2.5653    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7489   -2.1516    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.7489   -1.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4584   -0.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1744   -1.3266    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.1744   -0.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 19  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  5 19  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 16  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 15  9  1  6  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  1  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  1  0  0  0\nM  END",
          "smiles": "C[C@@]12CC[C@@H]3[C@H]4CC[C@@H](C=C4CC[C@H]3[C@@H]2CC[C@@H]1O)O",
          "formula": "C18H28O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "779e208f-35fc-49d2-9e51-738984e5ab7d"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "276.4144",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "437c03e6-9f48-4db0-a2bd-2672174444ca",
      "version": "10",
      "structure": {
        "id": "c51321fa-89d4-430a-82b7-c88c560270d5",
        "molfile": "\n  Marvin  01132110112D          \n\n 24 27  0  0  1  0            999 V2000\n    5.0279   -1.7396    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0366   -2.5653    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3242   -2.1516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6047   -2.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6047   -3.3912    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.8822   -3.8142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3242   -3.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0366   -3.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7489   -3.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4584   -3.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4584   -2.5651    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4524   -1.7396    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1744   -2.1516    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9589   -2.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4443   -1.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9592   -1.0703    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2136   -0.2831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1744   -1.3266    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1744   -0.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4584   -0.9156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7489   -1.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7489   -2.1516    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7401   -2.9744    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1691   -2.9744    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 16  1  0  0  0  0\n 13 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  6  0  0  0\n 22  2  1  0  0  0  0\n 11 22  1  0  0  0  0\n 13 24  1  6  0  0  0\n  2  8  1  0  0  0  0\nM  END",
        "smiles": "C[C@@]12CC[C@]3([H])[C@@]4([H])CC[C@@H](C=C4CC[C@@]3([H])[C@]2([H])CC[C@@H]1O)O",
        "formula": "C18H28O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "276.4144",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4e987c36-cfc4-4de8-bbe7-79d9dd1851a2",
          "cb0b577b-7b91-41a2-a707-3ead217e2c1d",
          "1cbe5768-1f09-44c3-a308-fe23b9f7746a"
        ],
        "stereo_centers": 7
      },
      "unii": "49SD6G16U5"
    }
  ]
}