{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "55dec2d5-c414-43e4-ac01-7272d55104ee", "code": "88949-33-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=88949-33-1", "code_system": "CAS", "references": [ "13f1a362-ea54-4162-a8e6-548b8f2e679e", "07469c2b-e8b7-4e7d-9eab-d156a01fb7d2" ] }, { "uuid": "9d8c4060-0d98-4a76-8964-32f52caf08a3", "code": "FCN NO. 892", "comments": "FCN|COLORANT|POLYMERS", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=892", "code_system": "Food Contact Sustance Notif, (FCN No.)", "references": [ "13f1a362-ea54-4162-a8e6-548b8f2e679e" ] }, { "uuid": "f2df3d10-7ae3-49cb-bdc3-418afb983741", "code": "15883807", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15883807", "code_system": "PUBCHEM", "references": [ "13f1a362-ea54-4162-a8e6-548b8f2e679e" ] }, { "uuid": "07a29af8-c3f0-4c38-9136-51c01dc80fd0", "code": "4951S6W1JX", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "a09364d8-f96d-273c-3491-83fb4bf8d376", "code": "DTXSID20893830", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20893830", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "4f1f4a8f-b61e-415e-97fe-27cf1a237e90", "name": "1,4-DIKETO-3,6-BIS(4-BIPHENYLYL)PYRROLO(3,4-C)PYRROLE", "stdName": "1,4-DIKETO-3,6-BIS(4-BIPHENYLYL)PYRROLO(3,4-C)PYRROLE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ad51b05d-3c24-44a4-bc0a-71ec6311fb99", "765739ee-c8d2-47ea-9eed-cb2adce14468" ], "display_name": false }, { "uuid": "0bda9926-5cda-4f2c-8951-a2400b19c0e4", "name": "3,6-BIS(4-BIPHENYLYL)-1,4-DIKETOPYRROLO(3,4-C)PYRROLE", "stdName": "3,6-BIS(4-BIPHENYLYL)-1,4-DIKETOPYRROLO(3,4-C)PYRROLE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ad51b05d-3c24-44a4-bc0a-71ec6311fb99", "765739ee-c8d2-47ea-9eed-cb2adce14468" ], "display_name": false }, { "uuid": "d519eabd-adee-4452-9f4a-da7f9120fb03", "name": "3,6-BIS(4-BIPHENYLYL)-2,5-DIHYDROPYRROLO(3,4-C)PYRROLE-1,4-DIONE", "stdName": "3,6-BIS(4-BIPHENYLYL)-2,5-DIHYDROPYRROLO(3,4-C)PYRROLE-1,4-DIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ad51b05d-3c24-44a4-bc0a-71ec6311fb99", "765739ee-c8d2-47ea-9eed-cb2adce14468" ], "display_name": false }, { "uuid": "46c64004-62ff-458d-bfd9-d171db8ffe77", "name": "C.I. 561300", "stdName": "C.I. 561300", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ad51b05d-3c24-44a4-bc0a-71ec6311fb99", "765739ee-c8d2-47ea-9eed-cb2adce14468" ], "display_name": false }, { "uuid": "140653c6-94cc-4c17-af7b-dca3f1c6660d", "name": "C.I. PIGMENT RED 264", "stdName": "C.I. PIGMENT RED 264", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ad51b05d-3c24-44a4-bc0a-71ec6311fb99", "765739ee-c8d2-47ea-9eed-cb2adce14468" ], "display_name": false }, { "uuid": "c2f1711c-8308-4899-97ea-0de03368d092", "name": "PIGMENT RED 264", "stdName": "PIGMENT RED 264", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ad51b05d-3c24-44a4-bc0a-71ec6311fb99", "765739ee-c8d2-47ea-9eed-cb2adce14468" ], "display_name": true }, { "uuid": "a821f8f5-615d-4abd-8e0c-30dba28fd067", "name": "PYRROLO(3,4-C)PYRROLE-1,4-DIONE, 3,6-BIS((1,1'-BIPHENYL)-4-YL)-2,5-DIHYDRO-", "stdName": "PYRROLO(3,4-C)PYRROLE-1,4-DIONE, 3,6-BIS((1,1'-BIPHENYL)-4-YL)-2,5-DIHYDRO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ad51b05d-3c24-44a4-bc0a-71ec6311fb99", "765739ee-c8d2-47ea-9eed-cb2adce14468" ], "display_name": false } ], "references": [ { "uuid": "765739ee-c8d2-47ea-9eed-cb2adce14468", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ad51b05d-3c24-44a4-bc0a-71ec6311fb99", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "13f1a362-ea54-4162-a8e6-548b8f2e679e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391959000, "tags": [ "NOMEN" ] }, { "uuid": "d5991eb0-055b-4b2d-9337-f400208b0b8d", "citation": "SRS import [4951S6W1JX]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4951S6W1JX", "doc_type": "SRS", "public_domain": true, "document_date": 1493391959000, "tags": [ "NOMEN" ] }, { "uuid": "07469c2b-e8b7-4e7d-9eab-d156a01fb7d2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f942c8f3-6b0c-4b29-9d1a-1940c1018027", "id": "f942c8f3-6b0c-4b29-9d1a-1940c1018027", "molfile": "\n Marvin 01132112552D \n\n 34 39 0 0 0 0 999 V2000\n -0.9677 1.5009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3319 0.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4671 1.1805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9093 0.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3836 -0.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3319 -0.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9677 -1.5009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4671 -1.1805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9093 -0.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3836 0.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7327 -0.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0997 0.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9231 0.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3795 -0.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0125 -1.0680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1891 -1.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2028 -0.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6592 -0.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4826 -0.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.8496 -0.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3932 0.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5698 0.4614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7327 0.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0997 -0.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9231 -0.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3795 0.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0125 1.0680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1891 1.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2028 0.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6592 0.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4826 0.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8496 0.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3932 -0.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5698 -0.4614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 10 2 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 23 1 0 0 0 0\n 6 5 1 0 0 0 0\n 10 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 6 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 16 2 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 17 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 22 2 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 23 28 2 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 29 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 34 2 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2ccc(cc2)-c3c4c(C(=NC4=O)c5ccc(cc5)-c6ccccc6)c([nH]3)O", "formula": "C30H20N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "3c86a29f-e6ed-410e-b089-1a159d69f827" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "440.4931", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "49fea305-3d42-41e3-a4fa-40eae64af436", "version": "3", "structure": { "id": "f67974d8-4f86-4548-9120-f92664c94585", "molfile": "\n Marvin 01132112472D \n\n 34 39 0 0 0 0 999 V2000\n 0.4671 1.1805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3319 0.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3836 0.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3836 -0.1518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9093 0.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4671 -1.1805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9093 -0.4840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3319 -0.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9677 1.5009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9677 -1.5009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3795 -0.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9231 0.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0997 0.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7327 -0.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1891 -1.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0125 -1.0680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2028 -0.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6592 -0.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.4826 -0.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.8496 -0.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3932 0.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5698 0.4614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3795 0.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9231 -0.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0997 -0.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7327 0.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1891 1.1197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0125 1.0680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2028 0.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6592 0.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4826 0.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8496 0.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3932 -0.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5698 -0.4614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 1 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 7 3 2 0 0 0 0\n 8 4 1 0 0 0 0\n 2 9 2 0 0 0 0\n 8 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 11 16 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 17 22 2 0 0 0 0\n 11 17 1 0 0 0 0\n 7 14 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 23 28 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 29 34 2 0 0 0 0\n 23 29 1 0 0 0 0\n 5 26 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2ccc(cc2)C3=C4C(=C(c5ccc(cc5)-c6ccccc6)NC4=O)C(=O)N3", "formula": "C30H20N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "440.4931", "optical_activity": "NONE", "references": [ "765739ee-c8d2-47ea-9eed-cb2adce14468", "d5991eb0-055b-4b2d-9337-f400208b0b8d" ], "stereo_centers": 0 }, "unii": "4951S6W1JX" } ] }