{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ffe5d758-08f4-4f89-b630-0ed98cf04f14",
          "code": "2674-91-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2674-91-1",
          "code_system": "CAS",
          "references": [
            "fcb7bc73-58fe-4894-b683-8428f5f3c4ec",
            "f0abc4c3-15f3-4188-ac05-ef0048863fb3"
          ]
        },
        {
          "uuid": "6c0aa7f7-18af-4778-980b-e1c861045874",
          "code": "58704",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3402",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "fcb7bc73-58fe-4894-b683-8428f5f3c4ec"
          ]
        },
        {
          "uuid": "6e7003fc-23ee-4cda-b37a-db439cd0a5b6",
          "code": "220-221-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.383",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "fcb7bc73-58fe-4894-b683-8428f5f3c4ec"
          ]
        },
        {
          "uuid": "de153385-03ed-48ee-9f22-3bcc7d74abfc",
          "code": "91523",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91523",
          "code_system": "PUBCHEM",
          "references": [
            "fcb7bc73-58fe-4894-b683-8428f5f3c4ec"
          ]
        },
        {
          "uuid": "4b7f7cf2-187c-d0c2-e7be-1d460e860463",
          "code": "DTXSID4042250",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4042250",
          "code_system": "EPA CompTox",
          "references": [
            "c04a9434-12a7-a142-3ad0-4e4c5bfd8705"
          ]
        },
        {
          "uuid": "89d36683-8650-4816-b661-16dda155d2b0",
          "code": "48XI86F84W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c3d1a80a-6a2b-851c-bb78-25fd7cfea15d",
          "code": "oxydeprofos",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/oxydeprofos.html",
          "code_system": "ALANWOOD",
          "references": [
            "0ff9a3c5-b4f0-ff86-8ab5-b71a243b1550"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "04a2f634-ad6e-417e-b403-ad7a9f4ce79f",
          "name": "BAY-23655",
          "stdName": "BAY-23655",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee4edc32-3e65-47d0-ab3f-08284f5c0f8f",
            "35bb94e3-07f1-494b-8295-ae6953007a40"
          ],
          "display_name": false
        },
        {
          "uuid": "455e370e-9dc0-47b5-bd87-21d427911f66",
          "name": "ENT-25674",
          "stdName": "ENT-25674",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee4edc32-3e65-47d0-ab3f-08284f5c0f8f",
            "35bb94e3-07f1-494b-8295-ae6953007a40"
          ],
          "display_name": false
        },
        {
          "uuid": "0ed2a2d9-5ffe-4fd2-ab09-f80f1cab8cd3",
          "name": "ESP",
          "stdName": "ESP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee4edc32-3e65-47d0-ab3f-08284f5c0f8f",
            "35bb94e3-07f1-494b-8295-ae6953007a40"
          ],
          "display_name": false
        },
        {
          "uuid": "d58a66c4-81fb-4265-9760-68808304a68f",
          "name": "OXYDEPROFOS",
          "stdName": "OXYDEPROFOS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46a43ba9-2b12-4fe8-962c-9b13fbebe2be",
            "19567d61-5e85-4e32-b20a-ff476fb38d3b",
            "f0cb012d-a806-4579-af60-026edccfdf96",
            "35bb94e3-07f1-494b-8295-ae6953007a40"
          ],
          "display_name": true
        },
        {
          "uuid": "c9027fc2-6646-48ef-8c47-345859a4befe",
          "name": "OXYDEPROFOS [ISO]",
          "stdName": "OXYDEPROFOS [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46a43ba9-2b12-4fe8-962c-9b13fbebe2be",
            "35bb94e3-07f1-494b-8295-ae6953007a40"
          ],
          "display_name": false
        },
        {
          "uuid": "7aa78296-e277-4c5c-bf9e-c76521d8895b",
          "name": "PHOSPHOROTHIOIC ACID, S-(2-(ETHYLSULFINYL)-1-METHYLETHYL) O,O-DIMETHYL ESTER",
          "stdName": "PHOSPHOROTHIOIC ACID, S-(2-(ETHYLSULFINYL)-1-METHYLETHYL) O,O-DIMETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee4edc32-3e65-47d0-ab3f-08284f5c0f8f",
            "35bb94e3-07f1-494b-8295-ae6953007a40"
          ],
          "display_name": false
        },
        {
          "uuid": "efbead29-e4ea-4e89-ab57-f1f1ef58fe3d",
          "name": "S-410",
          "stdName": "S-410",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ee4edc32-3e65-47d0-ab3f-08284f5c0f8f",
            "35bb94e3-07f1-494b-8295-ae6953007a40"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "46a43ba9-2b12-4fe8-962c-9b13fbebe2be",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "35bb94e3-07f1-494b-8295-ae6953007a40",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0cb012d-a806-4579-af60-026edccfdf96",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee4edc32-3e65-47d0-ab3f-08284f5c0f8f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fcb7bc73-58fe-4894-b683-8428f5f3c4ec",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392321000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28cb5f4a-2a22-4251-ae47-fb411f52c993",
          "citation": "SRS import [48XI86F84W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=48XI86F84W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392321000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19567d61-5e85-4e32-b20a-ff476fb38d3b",
          "citation": "OXYDEPROFOS [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c04a9434-12a7-a142-3ad0-4e4c5bfd8705",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2674-91-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0ff9a3c5-b4f0-ff86-8ab5-b71a243b1550",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "f0abc4c3-15f3-4188-ac05-ef0048863fb3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6220f951-574b-4f47-90db-e995add2cbf6",
          "id": "6220f951-574b-4f47-90db-e995add2cbf6",
          "molfile": "\n  Marvin  01132105052D          \n\n 14 13  0  0  0  0            999 V2000\n    3.6538   -5.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3663   -5.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0843   -5.1687    0.0000 S   0  0  0  0  0  0  0  0  0  3  0  0\n    5.0729   -4.3537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7967   -5.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5034   -5.1800    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.5034   -4.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2158   -5.5847    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9225   -5.1800    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5178   -4.4620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3385   -5.8925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9225   -6.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6406   -4.7641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3529   -5.1800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n  9 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "CCS(=O)CC(C)SP(=O)(OC)OC",
          "formula": "C7H17O4PS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c0225303-8885-477a-95c0-18d65c07c0ad"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "260.3137",
          "optical_activity": "( + / - )",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6928c21e-330e-43bd-8300-a8512e1e4a8b",
      "version": "4",
      "structure": {
        "id": "02cacc27-1737-4fd5-a6f2-a9b5a16825aa",
        "molfile": "\n  Marvin  01132100272D          \n\n 14 13  0  0  0  0            999 V2000\n    7.9225   -5.1800    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5178   -4.4620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3385   -5.8925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9225   -6.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6406   -4.7641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3529   -5.1800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2158   -5.5847    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5034   -5.1800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7967   -5.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0843   -5.1687    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    5.0729   -4.3537    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.3663   -5.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6538   -5.1687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5034   -4.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  8 14  1  0  0  0  0\nM  CHG  2  10   1  11  -1\nM  END",
        "smiles": "CC[S+](CC(C)SP(=O)(OC)OC)[O-]",
        "formula": "C7H17O4PS2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "260.3137",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "28cb5f4a-2a22-4251-ae47-fb411f52c993",
          "f0cb012d-a806-4579-af60-026edccfdf96"
        ],
        "stereo_centers": 2
      },
      "unii": "48XI86F84W"
    }
  ]
}