{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1ca59428-62b7-491d-bd16-7a77fb17a21f", "code": "6424-77-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6424-77-7", "code_system": "CAS", "references": [ "26e218ce-e441-4049-8290-01bd3b1ddc68", "547606a6-4d60-4c65-8a7f-b5ba15098f0e" ] }, { "uuid": "bf7f23ec-1959-43cb-9eea-9f4a27855156", "code": "229-187-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.534", "code_system": "ECHA (EC/EINECS)", "references": [ "26e218ce-e441-4049-8290-01bd3b1ddc68" ] }, { "uuid": "c62a1475-84d0-4ccf-b159-049ba992353d", "code": "80898", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/80898", "code_system": "PUBCHEM", "references": [ "26e218ce-e441-4049-8290-01bd3b1ddc68" ] }, { "uuid": "119f562a-4bbd-aa86-0c0f-19ca7498528b", "code": "DTXSID3064352", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3064352", "code_system": "EPA CompTox", "references": [ "4780e303-7243-ec77-41bd-8bcda35aa701" ] }, { "uuid": "39161ce4-4ad4-75df-ace1-06ef4de25ad7", "code": "Pigment Red 190", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Pigment_Red_190", "code_system": "WIKIPEDIA", "references": [ "351f05d4-99c1-69b7-1341-e5a57c38dd75" ] }, { "uuid": "3050b4bd-3c55-45b4-8ca1-0f3b33505b1c", "code": "489VV3O90B", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "7b1bf871-a10e-4e32-ab5b-38a0f97d7ac6", "name": "2,9-BIS(4-METHOXYPHENYL)ANTHRA(2,1,9-DEF:6,5,10-D'E'F')DIISOQUINOLINE-1,3,8,10(2H,9H-TETRONE", "stdName": "2,9-BIS(4-METHOXYPHENYL)ANTHRA(2,1,9-DEF:6,5,10-D'E'F')DIISOQUINOLINE-1,3,8,10(2H,9H-TETRONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c51cd4ac-807a-4e1f-b617-ff222fdc27f9", "951dfe8c-72b4-4931-b692-c28e94e70fa4" ], "display_name": false }, { "uuid": "be42346f-61bd-4b7b-b398-8187f19f1ffe", "name": "3,4,9,10-PERYLENETETRACARBOXYLIC 3,4:9,10-DIIMIDE, N,N'-BIS(P-METHOXYPHENYL)-", "stdName": "3,4,9,10-PERYLENETETRACARBOXYLIC 3,4:9,10-DIIMIDE, N,N'-BIS(P-METHOXYPHENYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c51cd4ac-807a-4e1f-b617-ff222fdc27f9", "951dfe8c-72b4-4931-b692-c28e94e70fa4" ], "display_name": false }, { "uuid": "2f3fbbd1-2fdb-429a-96bb-57c4d46217a6", "name": "ANTHRA(2,1,9-DEF:6,5,10-D'E'F')DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRONE, 2,9-BIS(4-METHOXYPHENYL)-", "stdName": "ANTHRA(2,1,9-DEF:6,5,10-D'E'F')DIISOQUINOLINE-1,3,8,10(2H,9H)-TETRONE, 2,9-BIS(4-METHOXYPHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c51cd4ac-807a-4e1f-b617-ff222fdc27f9", "951dfe8c-72b4-4931-b692-c28e94e70fa4" ], "display_name": false }, { "uuid": "479a3482-773e-4c03-bafc-d9402daa3997", "name": "C.I. 71140", "stdName": "C.I. 71140", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "c51cd4ac-807a-4e1f-b617-ff222fdc27f9", "951dfe8c-72b4-4931-b692-c28e94e70fa4" ], "display_name": false }, { "uuid": "829139ec-47ce-467a-a37f-5af39dbc4d23", "name": "C.I. PIGMENT RED 190", "stdName": "C.I. PIGMENT RED 190", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7f6411c9-dbc3-4906-9753-9fd4292ba6e1" ], "display_name": false }, { "uuid": "6f2ff117-0b78-432d-b440-a84e6e2122fb", "name": "INDANTHREN SCARLET R", "stdName": "INDANTHREN SCARLET R", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "c51cd4ac-807a-4e1f-b617-ff222fdc27f9", "951dfe8c-72b4-4931-b692-c28e94e70fa4" ], "display_name": false }, { "uuid": "5a275c24-62e3-4ad2-9477-9ff347df506a", "name": "N,N'-BIS(P-METHOXYPHENYL)PERYLENE-3,4,9,10-TETRACARBOXYLIC DIIMIDE", "stdName": "N,N'-BIS(P-METHOXYPHENYL)PERYLENE-3,4,9,10-TETRACARBOXYLIC DIIMIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c51cd4ac-807a-4e1f-b617-ff222fdc27f9", "951dfe8c-72b4-4931-b692-c28e94e70fa4" ], "display_name": false }, { "uuid": "2376e4ce-4ac4-4fa8-a3ef-98273efdc263", "name": "PERYLENETETRACARBOXYLIC ACID DI-P-ANISIDIDE", "stdName": "PERYLENETETRACARBOXYLIC ACID DI-P-ANISIDIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c51cd4ac-807a-4e1f-b617-ff222fdc27f9", "951dfe8c-72b4-4931-b692-c28e94e70fa4" ], "display_name": false }, { "uuid": "4af8d5e9-bcec-43cc-bf90-949ca4cdeed2", "name": "PIGMENT RED 190", "stdName": "PIGMENT RED 190", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "0fc07358-1002-4228-a046-5906741e1ea9", "951dfe8c-72b4-4931-b692-c28e94e70fa4", "7d678807-10e5-46bb-896f-1cdca929a6e9" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "505e3626-417d-42d1-86f1-760dc40318d8", "name_org": "INCI" } ] }, { "uuid": "9788913e-5bb2-404d-b115-a0dd46386281", "name": "SILIGLIT ALUMINIUM GLITTER EPOXY", "stdName": "SILIGLIT ALUMINIUM GLITTER EPOXY", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "0fc07358-1002-4228-a046-5906741e1ea9", "951dfe8c-72b4-4931-b692-c28e94e70fa4" ], "display_name": false }, { "uuid": "79ff4812-28d3-49a7-802a-333842062031", "name": "SILIGLIT POLYESTER GLITTER", "stdName": "SILIGLIT POLYESTER GLITTER", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "0fc07358-1002-4228-a046-5906741e1ea9", "951dfe8c-72b4-4931-b692-c28e94e70fa4" ], "display_name": false } ], "references": [ { "uuid": "7f6411c9-dbc3-4906-9753-9fd4292ba6e1", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "0fc07358-1002-4228-a046-5906741e1ea9", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "951dfe8c-72b4-4931-b692-c28e94e70fa4", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c51cd4ac-807a-4e1f-b617-ff222fdc27f9", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "26e218ce-e441-4049-8290-01bd3b1ddc68", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390999000, "tags": [ "NOMEN" ] }, { "uuid": "5077ad79-cc3f-41a5-a3f9-c072b633c591", "citation": "SRS import [489VV3O90B]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=489VV3O90B", "doc_type": "SRS", "public_domain": true, "document_date": 1493390999000, "tags": [ "NOMEN" ] }, { "uuid": "e5d1a991-c197-46d0-bd75-4321a9ad2740", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7d678807-10e5-46bb-896f-1cdca929a6e9", "citation": "PIGMENT RED 190 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "4780e303-7243-ec77-41bd-8bcda35aa701", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6424-77-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "351f05d4-99c1-69b7-1341-e5a57c38dd75", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "547606a6-4d60-4c65-8a7f-b5ba15098f0e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "df86a036-aab6-4539-a4a0-f7a080a0c062", "id": "df86a036-aab6-4539-a4a0-f7a080a0c062", "molfile": "\n Marvin 01132111352D \n\n 46 54 0 0 0 0 999 V2000\n 0.2243 -4.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6532 -5.2207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5276 -5.2207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9718 -4.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8357 -4.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2701 -5.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8258 -5.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9523 -5.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1446 -5.2369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5770 -5.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1348 -6.6272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4492 -5.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8885 -6.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7572 -6.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1978 -5.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0715 -5.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5030 -6.6480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3814 -6.6480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8199 -5.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3816 -5.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8177 -4.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3853 -3.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5167 -3.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0753 -4.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2067 -4.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7714 -3.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8921 -3.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4545 -4.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8885 -5.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7655 -5.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5859 -4.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1559 -3.8431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5030 -5.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6875 -4.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1222 -3.8674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1258 -5.2564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9968 -5.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4392 -5.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3056 -5.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7338 -5.2451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6085 -5.2451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0468 -5.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3005 -4.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4345 -4.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6897 -5.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1290 -6.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 8 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 9 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 31 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 29 12 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 30 2 0 0 0 0\n 16 17 1 0 0 0 0\n 33 16 2 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 45 1 0 0 0 0\n 21 20 1 0 0 0 0\n 20 33 1 0 0 0 0\n 22 21 2 0 0 0 0\n 34 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 24 33 1 0 0 0 0\n 26 25 2 0 0 0 0\n 25 30 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 28 29 1 0 0 0 0\n 31 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 32 2 0 0 0 0\n 34 35 2 0 0 0 0\n 36 34 1 0 0 0 0\n 36 37 1 0 0 0 0\n 45 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 44 37 2 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 40 43 2 0 0 0 0\n 41 42 1 0 0 0 0\n 43 44 1 0 0 0 0\n 46 45 2 0 0 0 0\nM END", "smiles": "COc1ccc(cc1)N2C(=O)c3ccc4c5ccc6c7c(ccc(c8ccc(c3c48)C2=O)c57)C(=O)N(c9ccc(cc9)OC)C6=O", "formula": "C38H22N2O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1e66ca39-4627-418f-90c8-8f094e1fe8b0" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "602.5925", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c2b2725d-a62a-430c-96f9-014bc2ca1967", "version": "5", "structure": { "id": "c8fabc9f-efa9-4235-8320-cbad15aa2aa4", "molfile": "\n Marvin 01132110232D \n\n 46 54 0 0 0 0 999 V2000\n 11.1290 -6.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6897 -5.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1258 -5.2564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6875 -4.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1222 -3.8674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8177 -4.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3816 -5.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5030 -5.2592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0715 -5.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1978 -5.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7655 -5.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8885 -5.2437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4492 -5.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5770 -5.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1348 -6.6272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1446 -5.2369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5859 -4.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1559 -3.8431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4545 -4.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8921 -3.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7714 -3.8495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2067 -4.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0753 -4.5490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5167 -3.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3853 -3.8586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2701 -5.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8357 -4.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9718 -4.5338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5276 -5.2207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6532 -5.2207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2243 -4.5162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9523 -5.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8258 -5.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8885 -6.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7572 -6.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5030 -6.6480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3814 -6.6480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8199 -5.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9968 -5.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4392 -5.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3056 -5.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7338 -5.2451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6085 -5.2451 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0468 -5.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3005 -4.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4345 -4.5501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 19 12 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 11 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 8 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 6 1 0 0 0 0\n 16 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 29 32 2 0 0 0 0\n 32 33 1 0 0 0 0\n 33 26 2 0 0 0 0\n 13 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 10 1 0 0 0 0\n 9 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 2 0 0 0 0\n 38 2 1 0 0 0 0\n 38 7 1 0 0 0 0\n 3 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 42 45 2 0 0 0 0\n 45 46 1 0 0 0 0\n 46 39 2 0 0 0 0\nM END", "smiles": "COc1ccc(cc1)N2C(=O)c3ccc4c5ccc6c7c(ccc(c8ccc(c3c48)C2=O)c57)C(=O)N(c9ccc(cc9)OC)C6=O", "formula": "C38H22N2O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "602.5925", "optical_activity": "NONE", "references": [ "e5d1a991-c197-46d0-bd75-4321a9ad2740", "5077ad79-cc3f-41a5-a3f9-c072b633c591" ], "stereo_centers": 0 }, "unii": "489VV3O90B" } ] }