{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8fa0d6ae-ac13-4238-b7c4-a364fa0cc221", "code": "84477-87-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=84477-87-2", "code_system": "CAS", "references": [ "3cfe8f33-ad00-4acd-9a9c-5e0d8a32bcb8", "200f9dda-cf95-4160-9c8a-aca6496bf484" ] }, { "uuid": "fb733745-da87-4fac-998b-883e2dbab0db", "code": "3542", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3542", "code_system": "PUBCHEM", "references": [ "3cfe8f33-ad00-4acd-9a9c-5e0d8a32bcb8" ] }, { "uuid": "459bff60-e671-3eae-6229-1e53d4caa03a", "code": "DB07996", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB07996", "code_system": "DRUG BANK", "references": [ "c230e4c6-e7a6-e60a-1ff9-8e0914b3868a" ] }, { "uuid": "522bdb3a-8fb8-4560-8748-3a0b64dfa2a6", "code": "487H9Q0F9N", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "9136e9d4-f479-7b6f-a30f-30c80ddfeafb", "code": "43385", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:43385", "code_system": "CHEBI", "references": [ "c230e4c6-e7a6-e60a-1ff9-8e0914b3868a" ] }, { "uuid": "21a2796f-323e-1d38-4ffe-6252f2fa4c84", "code": "DTXSID401004756", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401004756", "code_system": "EPA CompTox", "references": [ "c230e4c6-e7a6-e60a-1ff9-8e0914b3868a" ] } ], "substance_class": "chemical", "names": [ { "uuid": "ea0d86bb-5ac5-4950-a29f-e47aa193e32a", "name": "(±)-1-(5-ISOQUINOLINESULFONYL)-2-METHYLPIPERAZINE", "stdName": "(+/-)-1-(5-ISOQUINOLINESULFONYL)-2-METHYLPIPERAZINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d626a5fa-1c72-4bdf-aa5f-6a0226b727a5", "be01072d-e421-4da6-b992-766026484578" ], "display_name": false }, { "uuid": "e3c906e7-8314-4780-bb14-dc61c56d6738", "name": "1-(5-ISOQUINOLINESULFONYL)-2-METHYLPIPERAZINE", "stdName": "1-(5-ISOQUINOLINESULFONYL)-2-METHYLPIPERAZINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d626a5fa-1c72-4bdf-aa5f-6a0226b727a5", "be01072d-e421-4da6-b992-766026484578" ], "display_name": true }, { "uuid": "9727855d-0b76-4992-89d9-83e9d7460d00", "name": "PIPERAZINE, 1-(5-ISOQUINOLINYLSULFONYL)-2-METHYL-", "stdName": "PIPERAZINE, 1-(5-ISOQUINOLINYLSULFONYL)-2-METHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "0f4ef9ba-ea33-42d7-b144-61ab528cb7da", "be01072d-e421-4da6-b992-766026484578" ], "display_name": false } ], "references": [ { "uuid": "d626a5fa-1c72-4bdf-aa5f-6a0226b727a5", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "be01072d-e421-4da6-b992-766026484578", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0f4ef9ba-ea33-42d7-b144-61ab528cb7da", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3cfe8f33-ad00-4acd-9a9c-5e0d8a32bcb8", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390697000, "tags": [ "NOMEN" ] }, { "uuid": "ecd89f32-2c3d-4b06-85bc-8d2dc6463efa", "citation": "SRS import [487H9Q0F9N]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=487H9Q0F9N", "doc_type": "SRS", "public_domain": true, "document_date": 1493390697000, "tags": [ "NOMEN" ] }, { "uuid": "c230e4c6-e7a6-e60a-1ff9-8e0914b3868a", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "200f9dda-cf95-4160-9c8a-aca6496bf484", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "41e8a933-5e88-43ea-814f-46a3680398fa", "id": "41e8a933-5e88-43ea-814f-46a3680398fa", "molfile": "\n Marvin 01132103292D \n\n 20 22 0 0 0 0 999 V2000\n 0.7697 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 0.0553 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6592 -2.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3737 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3737 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6592 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6592 0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4842 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1658 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6592 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3737 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3737 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6592 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7697 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4842 2.0625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4842 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7697 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 2 0 0 0 0\n 8 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 20 11 2 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 16 15 1 0 0 0 0\n 20 15 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\nM END", "smiles": "CC1CNCCN1S(=O)(=O)c2cccc3cnccc32", "formula": "C14H17N3O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0f32c099-38df-4e0c-8dd2-d7bfe8ad74ad" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "291.3703", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "f49d0439-9529-4539-924b-405144f8fddf", "version": "5", "structure": { "id": "00d58aee-ab2c-4565-92ed-e25978b94c38", "molfile": "\n Marvin 01132100212D \n\n 20 22 0 0 0 0 999 V2000\n -0.6592 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6592 -2.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3737 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3737 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7697 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6592 0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4842 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1658 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7697 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4842 2.0625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4842 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7697 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6592 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3737 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3737 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6592 2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0553 2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 1 0 0 0 0\n 2 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 11 20 1 0 0 0 0\n 15 20 2 0 0 0 0\n 8 16 1 0 0 0 0\n 1 8 1 0 0 0 0\nM END", "smiles": "CC1CNCCN1S(=O)(=O)c2cccc3cnccc32", "formula": "C14H17N3O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "291.3703", "optical_activity": "( + / - )", "references": [ "ecd89f32-2c3d-4b06-85bc-8d2dc6463efa", "d626a5fa-1c72-4bdf-aa5f-6a0226b727a5" ], "stereo_centers": 1 }, "unii": "487H9Q0F9N" } ] }