{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a6921f53-1e3f-4fca-bacc-d17cc004fb3b",
          "code": "67704-50-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=67704-50-1",
          "code_system": "CAS",
          "references": [
            "582a67f9-5237-45fb-a977-49c514319c81",
            "6594b5af-4405-41a3-895f-d2cb2a137d02"
          ]
        },
        {
          "uuid": "66c3a95c-eff9-41f2-9305-66215ab6cbc1",
          "code": "SUB35870",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "582a67f9-5237-45fb-a977-49c514319c81"
          ]
        },
        {
          "uuid": "85895761-a0a1-43de-960c-89251df50e6d",
          "code": "3051696",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3051696",
          "code_system": "PUBCHEM",
          "references": [
            "582a67f9-5237-45fb-a977-49c514319c81"
          ]
        },
        {
          "uuid": "24d12e26-5ac1-434c-b958-29710bbe49be",
          "code": "47X845AK0J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8d9fd48b-0874-4022-6e2a-ebc4af379c09",
          "code": "100000128606",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1c0d78f4-b23a-f380-7acb-8ee1a6dd96ca"
          ]
        },
        {
          "uuid": "b7e923fb-1834-aa03-9c41-a784e4f48225",
          "code": "DTXSID10987050",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10987050",
          "code_system": "EPA CompTox",
          "references": [
            "e896727b-20ab-958c-81ca-30428621727e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9c3f9326-fe84-466a-b772-765f6e4120ab",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7e57e383-6c11-41b6-9dec-07f661d0ab2b",
            "refuuid": "bec028df-ea44-41c1-9cdf-93568b6d8a8e",
            "name": "FEPRADINOL",
            "unii": "860MHI4WBA",
            "linking_id": "860MHI4WBA",
            "ref_pname": "FEPRADINOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8ae8d76f-253b-4038-b0ee-3f9095b012aa",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "317403c9-79f0-4e6a-9aad-6c6741cdcf7b",
            "refuuid": "bec028df-ea44-41c1-9cdf-93568b6d8a8e",
            "name": "FEPRADINOL",
            "unii": "860MHI4WBA",
            "linking_id": "860MHI4WBA",
            "ref_pname": "FEPRADINOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bc893b81-7852-43b4-bb10-a06cf8c46664",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "1c73f19b-efa7-4751-b5b1-9670f6ce586f",
            "refuuid": "acfe5052-239f-4b05-b639-2ac7460da739",
            "name": "FEPRADINOL HYDROCHLORIDE, (S)-",
            "unii": "91967VS6WL",
            "linking_id": "91967VS6WL",
            "ref_pname": "FEPRADINOL HYDROCHLORIDE, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "749dbe7a-a33f-4fa1-95d8-86348ef585f5",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "64c410cb-d8f7-4a9b-a941-85306fcacc5f",
            "refuuid": "2af17709-f192-484b-a3fe-026336f3e7e3",
            "name": "FEPRADINOL HYDROCHLORIDE, (R)-",
            "unii": "U8M3973TEH",
            "linking_id": "U8M3973TEH",
            "ref_pname": "FEPRADINOL HYDROCHLORIDE, (R)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6a65720d-e672-4926-aea1-9903caef5e02",
          "name": "BENZENEMETHANOL, .ALPHA.-(((2-HYDROXY-1,1-DIMETHYLETHYL)AMINO)METHYL)-, HYDROCHLORIDE",
          "stdName": "BENZENEMETHANOL, .ALPHA.-(((2-HYDROXY-1,1-DIMETHYLETHYL)AMINO)METHYL)-, HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3d1b5c3-4499-48f2-a180-3683965326a3",
            "710fa356-5661-4651-9a64-d4cdbe263129"
          ],
          "display_name": false
        },
        {
          "uuid": "7c46aeef-43c2-481a-82d2-5b3720c9581c",
          "name": "BENZENEMETHANOL, .ALPHA.-(((2-HYDROXY-1,1-DIMETHYLETHYL)AMINO)METHYL)-, HYDROCHLORIDE (1:1)",
          "stdName": "BENZENEMETHANOL, .ALPHA.-(((2-HYDROXY-1,1-DIMETHYLETHYL)AMINO)METHYL)-, HYDROCHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3d1b5c3-4499-48f2-a180-3683965326a3",
            "710fa356-5661-4651-9a64-d4cdbe263129"
          ],
          "display_name": false
        },
        {
          "uuid": "ce1a4147-4993-48f0-ba90-42ded4d8baf8",
          "name": "FEPRADINOL HYDROCHLORIDE",
          "stdName": "FEPRADINOL HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "710fa356-5661-4651-9a64-d4cdbe263129",
            "d80aea36-90eb-41e5-93c2-81047e329c77",
            "3fba83d7-4545-4fe4-bff3-ba7bab347086"
          ],
          "display_name": true
        },
        {
          "uuid": "e9fad51a-6c45-d187-8daa-cdd421748651",
          "name": "Fepradinol hydrochloride [WHO-DD]",
          "stdName": "FEPRADINOL HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dde0f97-b3b6-34e8-27f4-df1e996acbb1"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3fba83d7-4545-4fe4-bff3-ba7bab347086",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "710fa356-5661-4651-9a64-d4cdbe263129",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3d1b5c3-4499-48f2-a180-3683965326a3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "582a67f9-5237-45fb-a977-49c514319c81",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392622000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b99e71c-220b-4b4a-b997-c5ae9beb0de4",
          "citation": "SRS import [47X845AK0J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=47X845AK0J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392622000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d80aea36-90eb-41e5-93c2-81047e329c77",
          "citation": "FEPRADINOL HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c0d78f4-b23a-f380-7acb-8ee1a6dd96ca",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d01ee6c4-3229-2bc3-c4d2-b160f7f79ccb",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6594b5af-4405-41a3-895f-d2cb2a137d02",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2dde0f97-b3b6-34e8-27f4-df1e996acbb1",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e896727b-20ab-958c-81ca-30428621727e",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7407b4de-c4d2-4ac8-9704-83fd8145ccc8",
          "id": "7407b4de-c4d2-4ac8-9704-83fd8145ccc8",
          "molfile": "\n  Marvin  01132106012D          \n\n  1  0  0  0  0  0            999 V2000\n    2.7697   -5.1311    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "92aba90c-9f48-4efd-9455-c79794acd7a5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "7ef1ed86-8636-482e-969e-915c79f3d182",
          "id": "7ef1ed86-8636-482e-969e-915c79f3d182",
          "molfile": "\n  Marvin  01132106352D          \n\n 15 15  0  0  0  0            999 V2000\n    8.3489   -5.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0610   -5.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0610   -6.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7731   -5.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4851   -5.2320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0610   -4.4091    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7639   -3.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7639   -3.1699    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.4758   -2.7538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0472   -2.7626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3410   -3.1820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6168   -2.7744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6168   -1.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3297   -1.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0472   -1.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  6  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 15  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(CO)NCC(c1ccccc1)O",
          "formula": "C12H19NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b2362d65-1a03-4531-b7f3-f89f736729a8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "209.2852",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5f337bdf-b96a-4a0c-acfa-b2f36268d764",
      "version": "12",
      "structure": {
        "id": "7b7b57a1-1509-454e-bd79-23f939d90b1d",
        "molfile": "\n  Marvin  01132106252D          \n\n 16 15  0  0  0  0            999 V2000\n    8.3489   -5.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0610   -5.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0610   -6.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7731   -5.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4851   -5.2320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0610   -4.4091    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7639   -3.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7639   -3.1699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4758   -2.7538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0472   -2.7626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0472   -1.9427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3297   -1.5308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6168   -1.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6168   -2.7744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3410   -3.1820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7697   -5.1311    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 10  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(CO)NCC(c1ccccc1)O.Cl",
        "formula": "C12H19NO2.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "245.7461",
        "optical_activity": "( + / - )",
        "references": [
          "d3d1b5c3-4499-48f2-a180-3683965326a3",
          "1b99e71c-220b-4b4a-b997-c5ae9beb0de4"
        ],
        "stereo_centers": 1
      },
      "unii": "47X845AK0J"
    }
  ]
}