{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f76084dc-5ab9-484a-b453-8c55fc613992", "code": "82919-37-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=82919-37-7", "code_system": "CAS", "references": [ "9d8c3a4a-f2e9-48ec-82b9-ce11b3cd5296", "83bf3743-348f-406f-ab29-91cc11147354" ] }, { "uuid": "6616f80f-af63-46b1-99f3-7c7c4d6417ef", "code": "280-060-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.072.761", "code_system": "ECHA (EC/EINECS)", "references": [ "9d8c3a4a-f2e9-48ec-82b9-ce11b3cd5296" ] }, { "uuid": "bbdeddb7-dfc3-485e-a743-c472974b6575", "code": "157881", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/157881", "code_system": "PUBCHEM", "references": [ "9d8c3a4a-f2e9-48ec-82b9-ce11b3cd5296" ] }, { "uuid": "1bae447c-30ca-2e66-1fca-d8b9312baa56", "code": "DTXSID7041831", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7041831", "code_system": "EPA CompTox", "references": [ "b00b2d26-e4c6-8136-8c09-92308795d7db" ] }, { "uuid": "a79a9f6a-00a1-44da-8fe6-a319f9d076e5", "code": "47W9ZU9G0Y", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "3fd4668c-7968-4a85-9db3-657c7c3f3ad0", "name": "DECANEDIOIC ACID, METHYL 1,2,2,6,6-PENTAMETHYL-4-PIPERIDINYL ESTER", "stdName": "DECANEDIOIC ACID, METHYL 1,2,2,6,6-PENTAMETHYL-4-PIPERIDINYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "80c399df-0048-479e-9f08-beec6a5c792d", "785f080b-6527-467f-90e2-c1edc379d5a7" ], "display_name": false }, { "uuid": "1d2f0658-a4f4-4563-a078-f0f2e3db448e", "name": "METHYL 1,2,2,6,6-PENTAMETHYL-4-PIPERIDINYL SEBACATE", "stdName": "METHYL 1,2,2,6,6-PENTAMETHYL-4-PIPERIDINYL SEBACATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ccf22800-656d-44a2-9202-4655947c5128", "785f080b-6527-467f-90e2-c1edc379d5a7" ], "display_name": false }, { "uuid": "499ee92b-a8ab-431d-b3a5-c52c5f434394", "name": "METHYL 1,2,2,6,6-PENTAMETHYL-4-PIPERIDIYL SEBACATE", "stdName": "METHYL 1,2,2,6,6-PENTAMETHYL-4-PIPERIDIYL SEBACATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ccf22800-656d-44a2-9202-4655947c5128", "785f080b-6527-467f-90e2-c1edc379d5a7" ], "display_name": false }, { "uuid": "33182ca8-99a1-431d-b9df-199f990c7a01", "name": "METHYL 1,2,2,6,6-PENTAMETHYL-4-PIPERIDYL SEBACATE", "stdName": "METHYL 1,2,2,6,6-PENTAMETHYL-4-PIPERIDYL SEBACATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ccf22800-656d-44a2-9202-4655947c5128", "785f080b-6527-467f-90e2-c1edc379d5a7" ], "display_name": true } ], "references": [ { "uuid": "ccf22800-656d-44a2-9202-4655947c5128", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "785f080b-6527-467f-90e2-c1edc379d5a7", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "80c399df-0048-479e-9f08-beec6a5c792d", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9d8c3a4a-f2e9-48ec-82b9-ce11b3cd5296", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392019000, "tags": [ "NOMEN" ] }, { "uuid": "39842f7b-c486-4c4b-908f-e6cd8ba8b786", "citation": "SRS import [47W9ZU9G0Y]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=47W9ZU9G0Y", "doc_type": "SRS", "public_domain": true, "document_date": 1493392019000, "tags": [ "NOMEN" ] }, { "uuid": "b00b2d26-e4c6-8136-8c09-92308795d7db", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=82919-37-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "83bf3743-348f-406f-ab29-91cc11147354", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9a69e514-adb2-41c1-9315-dc5501861e5b", "id": "9a69e514-adb2-41c1-9315-dc5501861e5b", "molfile": "\n Marvin 01132108012D \n\n 26 26 0 0 0 0 999 V2000\n 11.4266 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7181 -1.9197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0097 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0097 -3.1537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3012 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5928 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8843 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1759 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4674 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7704 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0619 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3535 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6451 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6451 -1.1084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9366 -2.3425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2282 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2282 -1.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5197 -0.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1198 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9425 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8113 -1.1084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1143 -0.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8113 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4114 -2.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5197 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 2 0 0 0 0\n 5 3 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 26 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 21 18 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 23 26 1 0 0 0 0\nM END", "smiles": "CC1(C)CC(CC(C)(C)N1C)OC(=O)CCCCCCCCC(=O)OC", "formula": "C21H39NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "626efd32-be9c-4021-8e5d-6cda1664a242" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "369.5395", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "457946ee-e288-4e8c-a8d4-a36193c9e694", "version": "3", "structure": { "id": "b74c16ac-f192-42e0-bf36-a771a7106533", "molfile": "\n Marvin 01132109292D \n\n 26 26 0 0 0 0 999 V2000\n 3.6451 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3535 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0619 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7704 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4674 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1759 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8843 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5928 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3012 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0097 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6451 -1.1084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9366 -2.3425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0097 -3.1537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7181 -1.9197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8113 -1.1084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5197 -0.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8113 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2282 -1.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5197 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2282 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1143 -0.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1198 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9425 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4114 -2.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4266 -2.3425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 12 1 0 0 0 0\n 1 11 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 14 1 0 0 0 0\n 10 13 2 0 0 0 0\n 12 20 1 0 0 0 0\n 14 26 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 15 21 1 0 0 0 0\n 16 18 1 0 0 0 0\n 16 22 1 0 0 0 0\n 16 23 1 0 0 0 0\n 17 19 1 0 0 0 0\n 17 24 1 0 0 0 0\n 17 25 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 20 1 0 0 0 0\nM END", "smiles": "CC1(C)CC(CC(C)(C)N1C)OC(=O)CCCCCCCCC(=O)OC", "formula": "C21H39NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "369.5395", "optical_activity": "NONE", "references": [ "80c399df-0048-479e-9f08-beec6a5c792d", "39842f7b-c486-4c4b-908f-e6cd8ba8b786" ], "stereo_centers": 0 }, "unii": "47W9ZU9G0Y" } ] }