{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fc1bca25-0a56-4a01-a111-c9dcb3130a41",
          "code": "534-42-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=534-42-9",
          "code_system": "CAS",
          "references": [
            "d54c5e44-43b5-48df-b8d3-76742317ce11",
            "8bafe3a5-71b5-4eb0-893a-c96a73e1dda1"
          ]
        },
        {
          "uuid": "7aa7eec1-7e5a-4908-ba24-db42b559473e",
          "code": "3036723",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3036723",
          "code_system": "PUBCHEM",
          "references": [
            "d54c5e44-43b5-48df-b8d3-76742317ce11"
          ]
        },
        {
          "uuid": "e6015689-356c-4496-8a19-ecbd3c4ac515",
          "code": "47RDD4XT2O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "98149fa2-e8a5-9c6f-55dd-7e0243dd3c32",
          "code": "77021",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:77021",
          "code_system": "CHEBI",
          "references": [
            "f2d72093-8060-fdb1-c7cc-ff0d7e00eeaf"
          ]
        },
        {
          "uuid": "d99ac6f7-0b33-d40d-ddc7-f84a0fcf72f0",
          "code": "2605590",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2605590/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "53c02ef6-7bfc-ad47-b68d-e7e819f5ac9b"
          ]
        },
        {
          "uuid": "7f58e00d-33cd-f909-f67e-146057633215",
          "code": "47RDD4XT2O",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=47RDD4XT2O",
          "code_system": "DAILYMED",
          "references": [
            "cd76a643-841f-13c5-e642-5f1a34391df3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c98500ab-d6c8-44b7-b563-a6f097d62a38",
          "name": "4-O-.ALPHA.-D-GLUCOPYRANOSYL-D-GLUCONIC ACID",
          "stdName": "4-O-.ALPHA.-D-GLUCOPYRANOSYL-D-GLUCONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a36d65f-bee3-4268-8e9d-3c5f07840564",
            "542f2c40-bfc3-4671-8567-b5ae57602879"
          ],
          "display_name": false
        },
        {
          "uuid": "9566d9b9-da57-4e9c-8484-9ce251857457",
          "name": "D-GLUCONIC ACID, 4-O-.ALPHA.-D-GLUCOPYRANOSYL-",
          "stdName": "D-GLUCONIC ACID, 4-O-.ALPHA.-D-GLUCOPYRANOSYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "542f2c40-bfc3-4671-8567-b5ae57602879",
            "4ffe8676-1ec0-4ee2-8fdd-dfcff9242150"
          ],
          "display_name": false
        },
        {
          "uuid": "53a22acb-d9fe-499e-afa4-7293102c21ac",
          "name": "MALTOBIONIC ACID",
          "stdName": "MALTOBIONIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a36d65f-bee3-4268-8e9d-3c5f07840564",
            "542f2c40-bfc3-4671-8567-b5ae57602879",
            "1666499c-323e-4703-bfac-7305ffad2524"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "043cb587-7786-427c-8f4c-ccd201cbdb8c",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "5a36d65f-bee3-4268-8e9d-3c5f07840564",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "542f2c40-bfc3-4671-8567-b5ae57602879",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ffe8676-1ec0-4ee2-8fdd-dfcff9242150",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d54c5e44-43b5-48df-b8d3-76742317ce11",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393379000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10770828-2479-44a2-82d0-0f0730ca5c29",
          "citation": "SRS import [47RDD4XT2O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=47RDD4XT2O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393379000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1666499c-323e-4703-bfac-7305ffad2524",
          "citation": "MALTOBIONIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "53c02ef6-7bfc-ad47-b68d-e7e819f5ac9b",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "f2d72093-8060-fdb1-c7cc-ff0d7e00eeaf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cd76a643-841f-13c5-e642-5f1a34391df3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8bafe3a5-71b5-4eb0-893a-c96a73e1dda1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "49ade8db-6b2b-4b0c-b1c2-90cbae7f61ac",
          "id": "49ade8db-6b2b-4b0c-b1c2-90cbae7f61ac",
          "molfile": "\n  Marvin  01132103512D          \n\n 24 24  0  0  1  0            999 V2000\n    4.1959   -5.7722    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.1959   -6.5973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9103   -5.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6248   -5.7722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4814   -5.3598    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.7669   -5.7722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7669   -6.5973    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.4814   -7.0098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4814   -7.8348    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.1959   -8.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9103   -7.8348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7669   -8.2473    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.7669   -9.0723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0524   -7.8348    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.3379   -8.2473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0524   -7.0098    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.3379   -6.5973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4814   -4.5347    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.1959   -4.1222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7669   -4.1222    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.7669   -3.2971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0524   -4.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0524   -5.3598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3379   -4.1222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 18  5  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n 16  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  6  0  0  0\n 12  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 19  1  1  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  6  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\nM  END",
          "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O",
          "formula": "C12H22O12",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "57cb7a46-064a-4058-ac79-548143c31422"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "358.2964",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "446de235-524d-4feb-a78f-e6626e66d5e6",
      "version": "6",
      "structure": {
        "id": "8de0aa13-00fc-41a4-8b1b-fe5b36818062",
        "molfile": "\n  Marvin  01132107222D          \n\n 25 25  0  0  1  0            999 V2000\n    3.4814   -5.3598    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.1959   -5.7722    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.4814   -4.5347    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.7669   -4.1222    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.7669   -6.5973    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.0524   -7.0098    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.0524   -7.8348    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7669   -8.2473    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.4814   -7.8348    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.7669   -4.9472    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1959   -6.5973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9103   -5.3598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6248   -5.7722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1959   -4.1222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7669   -3.2971    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0524   -4.5347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0524   -5.3598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3379   -4.1222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7669   -5.7722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3379   -6.5973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3379   -8.2473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7669   -9.0723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1959   -8.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9103   -7.8348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4814   -7.0098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  1 10  1  6  0  0  0\n  2 11  1  1  0  0  0\n  2 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  3 14  1  1  0  0  0\n  4 15  1  6  0  0  0\n  4 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n  5 19  1  1  0  0  0\n  1 19  1  0  0  0  0\n  6 20  1  1  0  0  0\n  7 21  1  6  0  0  0\n  8 22  1  1  0  0  0\n  9 23  1  6  0  0  0\n 23 24  1  0  0  0  0\n 25  9  1  0  0  0  0\n  5 25  1  0  0  0  0\nM  END",
        "smiles": "C([C@H]([C@]([H])([C@@H]([C@H](C(=O)O)O)O)O[C@@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O",
        "formula": "C12H22O12",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "358.2964",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "10770828-2479-44a2-82d0-0f0730ca5c29",
          "4ffe8676-1ec0-4ee2-8fdd-dfcff9242150"
        ],
        "stereo_centers": 9
      },
      "unii": "47RDD4XT2O"
    }
  ]
}