{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "966a627b-5cf3-4ccc-9c4e-efccd6936aa3",
          "code": "72909-34-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=72909-34-3",
          "code_system": "CAS",
          "references": [
            "5ff50228-eb57-4b1e-880c-e293fb786be9",
            "2d1a5137-57fc-4525-93ed-b2cad1bc6ae3"
          ]
        },
        {
          "uuid": "8781c5ba-1836-4e2e-852e-b3980b852192",
          "code": "PYRROLOQUINOLINE QUINONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pyrroloquinoline_quinone",
          "code_system": "WIKIPEDIA",
          "references": [
            "5ff50228-eb57-4b1e-880c-e293fb786be9"
          ]
        },
        {
          "uuid": "725eaba3-f736-4e08-8c95-be9024aecd04",
          "code": "1024",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1024",
          "code_system": "PUBCHEM",
          "references": [
            "5ff50228-eb57-4b1e-880c-e293fb786be9"
          ]
        },
        {
          "uuid": "8212704c-e44a-cbfc-e7a4-0eab87ad9050",
          "code": "DTXSID3041162",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3041162",
          "code_system": "EPA CompTox",
          "references": [
            "02edb216-d70c-e29c-7ef7-62362130d80d"
          ]
        },
        {
          "uuid": "ab9f74d6-4a21-4631-8cc4-e7e042ec8a33",
          "code": "SUB126234",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bb6d0d57-4ab8-a7de-85c2-a5e3c5e672bf"
          ]
        },
        {
          "uuid": "d344a6bd-46e8-b27d-c094-f7462b395cd3",
          "code": "1750 (Number of products:70)",
          "comments": "Dietary Supplement Label Database|Chemical|Pyrroloquinoline Quinone",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1750&item=Pyrroloquinoline Quinone",
          "code_system": "DSLD",
          "references": [
            "9e04ee31-ccfe-17b7-fb33-e627e0525ca9"
          ]
        },
        {
          "uuid": "a4219c44-2f31-e61f-276e-c3287e126d2a",
          "code": "DB03205",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03205",
          "code_system": "DRUG BANK",
          "references": [
            "9e04ee31-ccfe-17b7-fb33-e627e0525ca9"
          ]
        },
        {
          "uuid": "1c9e83db-e069-4ea3-b932-620b7123837b",
          "code": "47819QGH5L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9445e41e-ab91-f8d6-541b-1d492c6a2037",
          "code": "2471086",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2471086/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "995cbbb5-129c-20e1-6283-7b314b2c5edc"
          ]
        },
        {
          "uuid": "48ae5868-bc85-aa69-eff2-dced28912d86",
          "code": "58442",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58442",
          "code_system": "CHEBI",
          "references": [
            "9e04ee31-ccfe-17b7-fb33-e627e0525ca9"
          ]
        },
        {
          "uuid": "9bdf714d-f95c-bfc5-934d-97df7c6b76d7",
          "code": "18315",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18315",
          "code_system": "CHEBI",
          "references": [
            "9e04ee31-ccfe-17b7-fb33-e627e0525ca9"
          ]
        },
        {
          "uuid": "9c74531b-c705-ee65-4b50-0d686afb3c41",
          "code": "47819QGH5L",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=47819QGH5L",
          "code_system": "DAILYMED",
          "references": [
            "4c799acb-5d7c-a73a-516e-7acec30fb129"
          ]
        },
        {
          "uuid": "9d003427-8a07-47c6-56e8-53a7ef714587",
          "code": "100000151811",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8d15bfd3-4657-c77e-dd59-3794b6e0c9c6"
          ]
        },
        {
          "uuid": "099e352f-cd41-b009-9599-cd14f3ae9acb",
          "code": "590",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=590",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "9e04ee31-ccfe-17b7-fb33-e627e0525ca9"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "31030cb1-5654-4d2a-88cd-aefba7e878ed",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "43a55a3e-3e8e-4b85-92d2-3515050f5f94",
            "refuuid": "60f36e84-de0f-4403-aa01-c96acc52a34a",
            "name": "DISODIUM PYRROLOQUINOLINEDIONE TRICARBOXYLATE",
            "unii": "8WX58ADB2E",
            "linking_id": "8WX58ADB2E",
            "ref_pname": "DISODIUM PYRROLOQUINOLINEDIONE TRICARBOXYLATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a6e204d3-dcea-46a8-902f-0e87044d145c",
          "name": "1H-PYRROLO(2,3-F)QUINOLINE-2,7,9-TRICARBOXYLIC ACID, 4,5-DIHYDRO-4,5-DIOXO-",
          "stdName": "1H-PYRROLO(2,3-F)QUINOLINE-2,7,9-TRICARBOXYLIC ACID, 4,5-DIHYDRO-4,5-DIOXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0655014-745e-4ea1-a8f0-e857f9c2c027",
            "7e993ab3-0154-457d-a563-03c87c084247"
          ],
          "display_name": false
        },
        {
          "uuid": "215f5ab0-1e04-406f-a081-7736b2d768a6",
          "name": "2,7,9-TRICARBOXY-4,5-DIHYDRO-4,5-DIOXO-1H-PYRROLO(2,3-F)QUINOLINE",
          "stdName": "2,7,9-TRICARBOXY-4,5-DIHYDRO-4,5-DIOXO-1H-PYRROLO(2,3-F)QUINOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0655014-745e-4ea1-a8f0-e857f9c2c027",
            "7e993ab3-0154-457d-a563-03c87c084247"
          ],
          "display_name": false
        },
        {
          "uuid": "b28090e1-cebe-4ffd-ab5d-bbd0d6f3892e",
          "name": "4,5-DIHYDRO-4,5-DIOXO-1H-PYRROLO(2,3-F)QUINOLINE-2,7,9-TRICARBOXYLIC ACID",
          "stdName": "4,5-DIHYDRO-4,5-DIOXO-1H-PYRROLO(2,3-F)QUINOLINE-2,7,9-TRICARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0655014-745e-4ea1-a8f0-e857f9c2c027",
            "7e993ab3-0154-457d-a563-03c87c084247"
          ],
          "display_name": false
        },
        {
          "uuid": "83860563-a92b-4644-84bb-b18ab164c772",
          "name": "COENZYME PQQ",
          "stdName": "COENZYME PQQ",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0655014-745e-4ea1-a8f0-e857f9c2c027",
            "7e993ab3-0154-457d-a563-03c87c084247"
          ],
          "display_name": false
        },
        {
          "uuid": "b3d23d8e-5ea1-4bd0-b67d-bd7397d86343",
          "name": "METHOXATIN",
          "stdName": "METHOXATIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e993ab3-0154-457d-a563-03c87c084247"
          ],
          "display_name": false
        },
        {
          "uuid": "d2585aac-08d2-4bbb-9f5f-759fad8d79fc",
          "name": "METHOXATINE",
          "stdName": "METHOXATINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0655014-745e-4ea1-a8f0-e857f9c2c027",
            "7e993ab3-0154-457d-a563-03c87c084247"
          ],
          "display_name": false
        },
        {
          "uuid": "d13521c5-c0e6-4ccc-98eb-4074d1e8a7e8",
          "name": "PQQ",
          "stdName": "PQQ",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0655014-745e-4ea1-a8f0-e857f9c2c027",
            "7e993ab3-0154-457d-a563-03c87c084247"
          ],
          "display_name": false
        },
        {
          "uuid": "a497be1d-09c4-429b-bbb0-5e3c981ad6d9",
          "name": "PYRROLOQUINOLINE QUINONE",
          "stdName": "PYRROLOQUINOLINE QUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0655014-745e-4ea1-a8f0-e857f9c2c027",
            "7e993ab3-0154-457d-a563-03c87c084247",
            "49d93b06-5af3-4f18-9aad-dc393dbd46fa",
            "71a70fa5-2630-41f8-ab54-e29bbce6325b"
          ],
          "display_name": false
        },
        {
          "uuid": "14c6d353-fe47-442c-bdaa-ee7bf48c3fce",
          "name": "PYRROLOQUINOLINEDIONE TRICARBOXYLATE",
          "stdName": "PYRROLOQUINOLINEDIONE TRICARBOXYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0655014-745e-4ea1-a8f0-e857f9c2c027",
            "e3ef1a5a-1109-4ccb-8f73-1b803ae1789a"
          ],
          "display_name": false
        },
        {
          "uuid": "d01f42e7-108c-4d9c-b38e-a978dd8d2810",
          "name": "PYRROLOQUINOLINEDIONE TRICARBOXYLIC ACID",
          "stdName": "PYRROLOQUINOLINEDIONE TRICARBOXYLIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0655014-745e-4ea1-a8f0-e857f9c2c027",
            "e3ef1a5a-1109-4ccb-8f73-1b803ae1789a"
          ],
          "display_name": true
        },
        {
          "uuid": "1bd35edb-4bb4-e25f-a7aa-c71102d778d5",
          "name": "Pyrroloquinoline quinone [WHO-DD]",
          "stdName": "PYRROLOQUINOLINE QUINONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7f98987-6541-00f0-1dec-0e1eb9c6acf5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7e993ab3-0154-457d-a563-03c87c084247",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e0655014-745e-4ea1-a8f0-e857f9c2c027",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3ef1a5a-1109-4ccb-8f73-1b803ae1789a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49d93b06-5af3-4f18-9aad-dc393dbd46fa",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ff50228-eb57-4b1e-880c-e293fb786be9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393314000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75688a78-e79f-4a30-97e6-9f18555371f4",
          "citation": "SRS import [47819QGH5L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=47819QGH5L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393314000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36aa4e26-b198-41b6-83ea-8eb35fcad446",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71a70fa5-2630-41f8-ab54-e29bbce6325b",
          "citation": "PYRROLOQUINOLINE QUINONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "02edb216-d70c-e29c-7ef7-62362130d80d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=72909-34-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d15bfd3-4657-c77e-dd59-3794b6e0c9c6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "bb6d0d57-4ab8-a7de-85c2-a5e3c5e672bf",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2d1a5137-57fc-4525-93ed-b2cad1bc6ae3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f236d4a3-d943-5446-2868-8cdc88df7590",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "9e04ee31-ccfe-17b7-fb33-e627e0525ca9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "995cbbb5-129c-20e1-6283-7b314b2c5edc",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "4c799acb-5d7c-a73a-516e-7acec30fb129",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "a7f98987-6541-00f0-1dec-0e1eb9c6acf5",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1c786fb6-92b8-472d-958b-bcc4ad56fa7b",
          "id": "1c786fb6-92b8-472d-958b-bcc4ad56fa7b",
          "molfile": "\n  Marvin  01132101392D          \n\n 24 26  0  0  0  0            999 V2000\n    7.6149   -5.4630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7945   -5.3767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4589   -4.6231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3095   -6.0441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5645   -6.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8970   -7.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2296   -6.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4845   -6.0441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4760   -7.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8085   -6.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0548   -7.0150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9686   -7.8354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6360   -8.3204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3897   -7.9848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0571   -8.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9709   -9.2902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8108   -8.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4783   -8.6191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2149   -8.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5474   -7.6861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1287   -8.9915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8947   -5.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2273   -5.3740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6484   -5.5234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  8  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n 17  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 10 22  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 19  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\nM  END",
          "smiles": "c1c(c2-c3c(cc(C(=O)O)[nH]3)C(=O)C(=O)c2nc1C(=O)O)C(=O)O",
          "formula": "C14H6N2O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "33a26ae1-acc7-4dab-9d1c-9f6e6354e694"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "330.2066",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5a92cd89-beb3-4148-a01d-68f99fa85597",
      "version": "17",
      "structure": {
        "id": "11d5b01f-1b9e-4ee3-8dc4-c8b88eaa87cb",
        "molfile": "\n  Marvin  01132101092D          \n\n 24 26  0  0  0  0            999 V2000\n    6.5645   -6.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8970   -7.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8108   -8.1342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0571   -8.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3897   -7.9848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6360   -8.3204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9686   -7.8354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0548   -7.0150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8085   -6.6794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4760   -7.1643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2296   -6.8288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4845   -6.0441    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3095   -6.0441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7945   -5.3767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6149   -5.4630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4589   -4.6231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8947   -5.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2273   -5.3740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6484   -5.5234    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2149   -8.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5474   -7.6861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1287   -8.9915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9709   -9.2902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4783   -8.6191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n  1 13  2  0  0  0  0\n 11  2  2  0  0  0  0\n 10  5  1  0  0  0  0\n  9 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n  7 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n  4 23  2  0  0  0  0\n  3 24  2  0  0  0  0\nM  END",
        "smiles": "c1c(c2-c3c(cc(C(=O)O)[nH]3)C(=O)C(=O)c2nc1C(=O)O)C(=O)O",
        "formula": "C14H6N2O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "330.2066",
        "optical_activity": "NONE",
        "references": [
          "75688a78-e79f-4a30-97e6-9f18555371f4",
          "36aa4e26-b198-41b6-83ea-8eb35fcad446"
        ],
        "stereo_centers": 0
      },
      "unii": "47819QGH5L"
    }
  ]
}