{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "21cf6769-58e1-4fed-9bf2-ec5b7830f667",
          "code": "830-89-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=830-89-7",
          "code_system": "CAS",
          "references": [
            "6bdc18c6-2261-4aa9-acbf-11f0c01a4e15",
            "7a31b7c6-090e-461f-9edb-a38c61cde5c8"
          ]
        },
        {
          "uuid": "630035b4-e059-41ea-8db6-7bf124032d29",
          "code": "C90706",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C90706",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6bdc18c6-2261-4aa9-acbf-11f0c01a4e15"
          ]
        },
        {
          "uuid": "9b022cf3-5617-4026-865f-d6cdb9cf9a9e",
          "code": "C006443",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67006443",
          "code_system": "MESH",
          "references": [
            "6bdc18c6-2261-4aa9-acbf-11f0c01a4e15"
          ]
        },
        {
          "uuid": "2f2059d9-7bc9-418e-a866-7a69c70b2b47",
          "code": "SUB05298MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6bdc18c6-2261-4aa9-acbf-11f0c01a4e15"
          ]
        },
        {
          "uuid": "32672705-5d65-4c3b-82a9-1fd807518449",
          "code": "1449",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1449",
          "code_system": "INN",
          "references": [
            "6bdc18c6-2261-4aa9-acbf-11f0c01a4e15"
          ]
        },
        {
          "uuid": "373067ac-bf76-448d-9c67-28f0b5cfad2f",
          "code": "m1481",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1481?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6bdc18c6-2261-4aa9-acbf-11f0c01a4e15"
          ]
        },
        {
          "uuid": "043cd0c9-ea64-465d-b26f-e00ac33958b6",
          "code": "CHEMBL327235",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL327235",
          "code_system": "ChEMBL",
          "references": [
            "6bdc18c6-2261-4aa9-acbf-11f0c01a4e15"
          ]
        },
        {
          "uuid": "149c3591-397c-4fdb-b62a-345780ab8ebd",
          "code": "3032361",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3032361",
          "code_system": "PUBCHEM",
          "references": [
            "6bdc18c6-2261-4aa9-acbf-11f0c01a4e15"
          ]
        },
        {
          "uuid": "3f341d94-434b-700c-916f-92aa8057dbf7",
          "code": "DTXSID0022565",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0022565",
          "code_system": "EPA CompTox",
          "references": [
            "6309f858-a078-8131-2640-bba341e761b9"
          ]
        },
        {
          "uuid": "527f8489-c6ba-b581-0955-fa390dc67681",
          "code": "C264",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticonvulsant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C264",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ac9ff8a9-c049-7ba8-eb3f-c910cf5d2e10"
          ]
        },
        {
          "uuid": "677f6a6a-0fc1-4bbc-be06-baae64bf74f9",
          "code": "475NGR2DC1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3d12953a-64be-5fbb-bf4a-059aae464880",
          "code": "106",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/106",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ac9ff8a9-c049-7ba8-eb3f-c910cf5d2e10"
          ]
        },
        {
          "uuid": "f7c97e65-55c7-85d1-0361-4de3ba25889f",
          "code": "Albutoin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Albutoin",
          "code_system": "WIKIPEDIA",
          "references": [
            "93c9d5a6-7787-63b8-8844-2d4c0c51be1a"
          ]
        },
        {
          "uuid": "f62283e0-eb16-dc43-9d91-81bef8ac1e96",
          "code": "100000087716",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b882896a-38d7-b930-b156-45f16d2dec13"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "70b04033-fa42-4fc1-a2b9-95f134d36a4d",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "08e30d86-21e7-4e54-a51c-c5e8c9c7b562",
            "refuuid": "55e9c2f0-49d0-42f0-b137-184547c633a1",
            "name": "ALBUTOIN",
            "unii": "475NGR2DC1",
            "linking_id": "475NGR2DC1",
            "ref_pname": "ALBUTOIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e4d018cf-6606-4570-b7c4-bb5a1f245f7a",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "cb293ad4-45c8-416a-8c08-63b70e0a37fe",
            "refuuid": "c7e1dfe4-aa1c-4574-8061-a101ae86b59d",
            "name": "ALBUTOIN, (S)-",
            "unii": "102NOL7028",
            "linking_id": "102NOL7028",
            "ref_pname": "ALBUTOIN, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7d1d3166-4027-4d47-82a3-67cc1f199f37",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "00d43119-20ba-400a-89fb-5dac94370410",
            "refuuid": "5061a3d3-3abe-433f-8840-15d97281a365",
            "name": "ALBUTOIN, (R)-",
            "unii": "11GB4258ZB",
            "linking_id": "11GB4258ZB",
            "ref_pname": "ALBUTOIN, (R)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "aaad91af-d4b7-4362-8fb4-db45a42d9f85",
          "name": "(±)-3-ALLYL-5-ISOBUTYL-2-THIOHYDANTOIN",
          "stdName": "(+/-)-3-ALLYL-5-ISOBUTYL-2-THIOHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96783f24-957a-4605-a3f7-a5ab00ceaefd",
            "38490b3f-5391-42c7-9689-619bbad53079"
          ],
          "display_name": false
        },
        {
          "uuid": "1425d9f4-2914-473c-a10b-e5bc55d03a06",
          "name": "(±)-4-IMIDAZOLIDINONE, 5-(2-METHYLPROPYL)-3-(2-PROPENYL)-2-THIOXO-",
          "stdName": "(+/-)-4-IMIDAZOLIDINONE, 5-(2-METHYLPROPYL)-3-(2-PROPENYL)-2-THIOXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96783f24-957a-4605-a3f7-a5ab00ceaefd",
            "38490b3f-5391-42c7-9689-619bbad53079"
          ],
          "display_name": false
        },
        {
          "uuid": "8faf9d50-8b7a-47fb-a4ec-ae4b08877ee1",
          "name": "3-Allyl-5-isobutyl-2-thiohydantoin",
          "stdName": "3-ALLYL-5-ISOBUTYL-2-THIOHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "812050bd-ce14-4121-acf2-a1ef47a78b48",
            "38490b3f-5391-42c7-9689-619bbad53079"
          ],
          "display_name": false
        },
        {
          "uuid": "3eb94c87-0139-4523-9241-9f42778da41e",
          "name": "4-IMIDAZOLIDINONE, 5-(2-METHYLPROPYL)-3-(2-PROPENYL)-2-THIOXO-",
          "stdName": "4-IMIDAZOLIDINONE, 5-(2-METHYLPROPYL)-3-(2-PROPENYL)-2-THIOXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "812050bd-ce14-4121-acf2-a1ef47a78b48",
            "38490b3f-5391-42c7-9689-619bbad53079"
          ],
          "display_name": false
        },
        {
          "uuid": "51201b41-aa30-4b35-82f7-c178f52a3843",
          "name": "ALBUTOIN",
          "stdName": "ALBUTOIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d329ed5-08fb-4241-bed5-a13c50eaf477",
            "812050bd-ce14-4121-acf2-a1ef47a78b48",
            "dfcaaea0-cb60-45fb-aa06-c202ab039dd3",
            "92fbee6c-3666-400c-9857-c33d517aa213",
            "fc1a74ac-b7da-4cb2-9d50-c7e718b71a00",
            "6f050d92-5fda-4d4e-912b-180bdcb665ba",
            "730e30c6-fa52-435a-a30d-0493d8f62e39",
            "bf54e841-3459-430d-999e-c0fd8131e11d",
            "cd4adcd3-6f26-4f5e-b382-33813569d9a2",
            "fb36c6a0-58c9-4158-ae27-7fb7f6bd9705",
            "38490b3f-5391-42c7-9689-619bbad53079",
            "2064d764-b278-4397-87e1-3487e5bbbe4b"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "033e0341-e91d-4f7b-b47c-d41942bca203",
              "name_org": "INN"
            },
            {
              "uuid": "7edabc10-0e2b-4325-8f58-ec63620c88bb",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "12ee4717-ea8a-4ea2-b9f9-654d2ee9af63",
          "name": "ALBUTOIN [MART.]",
          "stdName": "ALBUTOIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc1a74ac-b7da-4cb2-9d50-c7e718b71a00"
          ],
          "display_name": false
        },
        {
          "uuid": "7f932073-46d7-4b9c-b258-7fba51cb1610",
          "name": "ALBUTOIN [MI]",
          "stdName": "ALBUTOIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf54e841-3459-430d-999e-c0fd8131e11d",
            "38490b3f-5391-42c7-9689-619bbad53079"
          ],
          "display_name": false
        },
        {
          "uuid": "8c4920e2-c327-4061-87ed-106d632286a4",
          "name": "ALBUTOIN [USAN]",
          "stdName": "ALBUTOIN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3d329ed5-08fb-4241-bed5-a13c50eaf477"
          ],
          "display_name": false
        },
        {
          "uuid": "7718b228-57e9-b8b9-9e75-64f96910014a",
          "name": "Albutoin [WHO-DD]",
          "stdName": "ALBUTOIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b19424b-6132-ea12-bf9e-e3173be12145"
          ],
          "display_name": false
        },
        {
          "uuid": "b137ee00-728f-4f21-9e6d-97c03d02f34d",
          "name": "BAX 422Z",
          "stdName": "BAX 422Z",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55d3dace-2cc7-4745-8774-6fa6552dfa5a"
          ],
          "display_name": false
        },
        {
          "uuid": "86419dcb-99cc-4e44-b32b-5db6a67f0309",
          "name": "BAX-422Z",
          "stdName": "BAX-422Z",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e385e42-c277-44f3-8246-4c66351bd391",
            "38490b3f-5391-42c7-9689-619bbad53079"
          ],
          "display_name": false
        },
        {
          "uuid": "a0772962-c80f-4f51-af64-ae5c219338b3",
          "name": "EUPRAX",
          "stdName": "EUPRAX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2f41a71-d7d8-4587-9b57-14251eb5bd0b",
            "9ba2caf2-9d0e-415d-ab2d-987565aad867"
          ],
          "display_name": false
        },
        {
          "uuid": "a3fb941d-b366-43b1-8ba6-0f522ee7d885",
          "name": "albutoin [INN]",
          "stdName": "ALBUTOIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92fbee6c-3666-400c-9857-c33d517aa213",
            "6e176bea-d18c-43c6-817d-7595e1d834cf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "812050bd-ce14-4121-acf2-a1ef47a78b48",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "38490b3f-5391-42c7-9689-619bbad53079",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e385e42-c277-44f3-8246-4c66351bd391",
          "citation": "FDA_SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96783f24-957a-4605-a3f7-a5ab00ceaefd",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55d3dace-2cc7-4745-8774-6fa6552dfa5a",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92fbee6c-3666-400c-9857-c33d517aa213",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d329ed5-08fb-4241-bed5-a13c50eaf477",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc1a74ac-b7da-4cb2-9d50-c7e718b71a00",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf54e841-3459-430d-999e-c0fd8131e11d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2f41a71-d7d8-4587-9b57-14251eb5bd0b",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ba2caf2-9d0e-415d-ab2d-987565aad867",
          "citation": "D02797",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd4adcd3-6f26-4f5e-b382-33813569d9a2",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6bdc18c6-2261-4aa9-acbf-11f0c01a4e15",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389688000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f3ef096-12f9-467a-b39e-81b24acf316f",
          "citation": "SRS import [475NGR2DC1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=475NGR2DC1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389688000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2064d764-b278-4397-87e1-3487e5bbbe4b",
          "citation": "ALBUTOIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fb36c6a0-58c9-4158-ae27-7fb7f6bd9705",
          "citation": "ALBUTOIN [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "730e30c6-fa52-435a-a30d-0493d8f62e39",
          "citation": "ALBUTOIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dfcaaea0-cb60-45fb-aa06-c202ab039dd3",
          "citation": "ALBUTOIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6f050d92-5fda-4d4e-912b-180bdcb665ba",
          "citation": "ALBUTOIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6309f858-a078-8131-2640-bba341e761b9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=830-89-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b882896a-38d7-b930-b156-45f16d2dec13",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ac9ff8a9-c049-7ba8-eb3f-c910cf5d2e10",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7a31b7c6-090e-461f-9edb-a38c61cde5c8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6e176bea-d18c-43c6-817d-7595e1d834cf",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "93c9d5a6-7787-63b8-8844-2d4c0c51be1a",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "6b19424b-6132-ea12-bf9e-e3173be12145",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "977dd7d3-7017-4ba8-bedf-08c5f6cb9ed0",
          "id": "977dd7d3-7017-4ba8-bedf-08c5f6cb9ed0",
          "molfile": "\n  Marvin  01132107522D          \n\n 14 14  0  0  0  0            999 V2000\n    1.9972   -2.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7088   -2.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7088   -3.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4272   -2.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1388   -2.5437    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.1800   -3.3619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9776   -3.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2525   -4.3725    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4347   -2.9150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2425   -2.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6309   -2.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4697   -2.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9122   -2.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1426   -1.4644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 13  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 13  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 14 13  2  0  0  0  0\nM  END",
          "smiles": "C=CCN1C(=O)C(CC(C)C)NC1=S",
          "formula": "C10H16N2OS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8771bede-fd07-40d6-8a53-bdef31aba14e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "212.3133",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "55e9c2f0-49d0-42f0-b137-184547c633a1",
      "version": "11",
      "structure": {
        "id": "3b40f995-ea99-4cd3-8d38-7debe9e6f9be",
        "molfile": "\n  Marvin  01132103082D          \n\n 14 14  0  0  0  0            999 V2000\n    5.4347   -2.9150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9776   -3.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9122   -2.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1800   -3.3619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1388   -2.5437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2525   -4.3725    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1426   -1.4644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4272   -2.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2425   -2.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6309   -2.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4697   -2.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7088   -2.5403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9972   -2.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7088   -3.3653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  2  2  0  0  0  0\n  7  3  2  0  0  0  0\n  5  8  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12  8  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  1  0  0  0  0\n  4  5  1  0  0  0  0\nM  END",
        "smiles": "C=CCN1C(=O)C(CC(C)C)NC1=S",
        "formula": "C10H16N2OS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "212.3133",
        "optical_activity": "( + / - )",
        "references": [
          "812050bd-ce14-4121-acf2-a1ef47a78b48",
          "7f3ef096-12f9-467a-b39e-81b24acf316f",
          "6e176bea-d18c-43c6-817d-7595e1d834cf"
        ],
        "stereo_centers": 1
      },
      "unii": "475NGR2DC1"
    }
  ]
}