{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8237385f-c944-419e-b83b-586596e98b5a", "code": "91865104", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91865104", "code_system": "PUBCHEM", "references": [ "0b6d02ab-2ee7-4d45-b48a-c68b7a056505" ] }, { "uuid": "18dffa10-e999-4dbf-ad5c-0c8739b57f25", "code": "470F49S7VX", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "cdde247a-cc13-4c95-bb6e-e4fb23d9a671", "name": "2-AMINO-5-(2-AMINOPROPIONYLAMINO) PENTANOIC ACID", "stdName": "2-AMINO-5-(2-AMINOPROPIONYLAMINO) PENTANOIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bd2eb96d-52a8-40fe-8b2b-2db223c13b98", "7e0fc12b-747c-4140-810d-95b8dd1e60a4" ], "display_name": false }, { "uuid": "8ad172a6-2477-499c-9f7c-f9d782f0996d", "name": "ALANINAMIDO ORNITHINE", "stdName": "ALANINAMIDO ORNITHINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "bd2eb96d-52a8-40fe-8b2b-2db223c13b98", "7e0fc12b-747c-4140-810d-95b8dd1e60a4", "9cd2f83d-f320-4380-88cc-7bbd6ae78827" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "8b58eb4f-59ac-46d9-a862-03169ede1bcd", "name_org": "INCI" } ] }, { "uuid": "9561b6a9-cc59-496f-a61a-678c9bc97844", "name": "DIPEPTIDE AO-D", "stdName": "DIPEPTIDE AO-D", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "bd2eb96d-52a8-40fe-8b2b-2db223c13b98", "7e0fc12b-747c-4140-810d-95b8dd1e60a4" ], "display_name": false } ], "references": [ { "uuid": "bd2eb96d-52a8-40fe-8b2b-2db223c13b98", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "7e0fc12b-747c-4140-810d-95b8dd1e60a4", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0b6d02ab-2ee7-4d45-b48a-c68b7a056505", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393307000, "tags": [ "NOMEN" ] }, { "uuid": "342ca1e6-49a1-4137-a059-f99d0328ebc4", "citation": "SRS import [470F49S7VX]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=470F49S7VX", "doc_type": "SRS", "public_domain": true, "document_date": 1493393307000, "tags": [ "NOMEN" ] }, { "uuid": "9cd2f83d-f320-4380-88cc-7bbd6ae78827", "citation": "ALANINAMIDO ORNITHINE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4db46e87-1085-41b0-8d37-4d98dbac74ca", "id": "4db46e87-1085-41b0-8d37-4d98dbac74ca", "molfile": "\n Marvin 01132104032D \n\n 14 13 0 0 1 0 999 V2000\n 5.2167 -4.0486 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.5021 -3.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2167 -4.8732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9314 -3.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9314 -2.8118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6460 -4.0486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3606 -3.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0752 -4.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7898 -3.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5044 -4.0486 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.5044 -4.8732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2191 -3.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2191 -2.8118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9337 -4.0486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 1 0 0 0\n 4 1 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 1 0 0 0\n 12 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\nM END", "smiles": "C[C@@H](C(=O)NCCC[C@@H](C(=O)O)N)N", "formula": "C8H17N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2915bfe5-438e-4aa2-93fd-423b9d39a29d" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "203.2392", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "80dcd2d6-6756-4889-98a1-ec8283c733e7", "version": "4", "structure": { "id": "86700a02-7d79-4a9e-b75a-a51f30bf10d4", "molfile": "\n Marvin 01132106592D \n\n 14 13 0 0 1 0 999 V2000\n 10.2191 -3.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5044 -4.0486 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.7898 -3.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0752 -4.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3606 -3.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6460 -4.0486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5044 -4.8732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2191 -2.8118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9337 -4.0486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2167 -4.8732 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5021 -3.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2167 -4.0486 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.9314 -2.8118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9314 -3.6363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 2 7 1 1 0 0 0\n 1 8 2 0 0 0 0\n 1 9 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 10 1 1 0 0 0\n 14 13 2 0 0 0 0\n 14 12 1 0 0 0 0\n 6 14 1 0 0 0 0\nM END", "smiles": "C[C@@H](C(=O)NCCC[C@@H](C(=O)O)N)N", "formula": "C8H17N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "203.2392", "optical_activity": "UNSPECIFIED", "references": [ "bd2eb96d-52a8-40fe-8b2b-2db223c13b98", "342ca1e6-49a1-4137-a059-f99d0328ebc4" ], "stereo_centers": 2 }, "unii": "470F49S7VX" } ] }