{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "63870631-0247-458d-b5f5-8e4aef6d9052",
          "code": "631-71-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=631-71-0",
          "code_system": "CAS",
          "references": [
            "32165bdb-d6de-477d-b54a-865aced5933a",
            "0eb281a4-5f2b-4f3b-a5de-7e8294cb356d"
          ]
        },
        {
          "uuid": "3b9a05ac-1d0b-4451-ba74-b4b8b3ef0b9b",
          "code": "211-166-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.152",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "32165bdb-d6de-477d-b54a-865aced5933a"
          ]
        },
        {
          "uuid": "2e55bb67-b3cd-447a-a2cd-3d4dec0eb4e0",
          "code": "61182",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61182",
          "code_system": "PUBCHEM",
          "references": [
            "32165bdb-d6de-477d-b54a-865aced5933a"
          ]
        },
        {
          "uuid": "c63507d2-1fac-dbf8-e1fb-21a0aa44f8e8",
          "code": "DTXSID50212434",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50212434",
          "code_system": "EPA CompTox",
          "references": [
            "7bdb20f4-d770-4322-18b9-8547da69b3be"
          ]
        },
        {
          "uuid": "7ce62518-6917-41fc-908c-fd13defef130",
          "code": "46YCT42ESP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "114bb451-11e6-4271-a972-a07c2dfa1cbe",
          "name": "1-PHENANTHRENECARBOXYLIC ACID, 1,2,3,4,4A,4B,5,6,10,10A-DECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, ETHYL ESTER, (1R,4AR,4BR,10AR)-",
          "stdName": "1-PHENANTHRENECARBOXYLIC ACID, 1,2,3,4,4A,4B,5,6,10,10A-DECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, ETHYL ESTER, (1R,4AR,4BR,10AR)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03f209e6-6872-4492-b4c2-bade8464e06c",
            "5b229022-9e55-4457-be1e-a893bcffe380"
          ],
          "display_name": false
        },
        {
          "uuid": "10a964ce-d442-4f26-983a-26ad0b5edbab",
          "name": "ABIETIC ACID, ETHYL ESTER",
          "stdName": "ABIETIC ACID, ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03f209e6-6872-4492-b4c2-bade8464e06c",
            "5b229022-9e55-4457-be1e-a893bcffe380"
          ],
          "display_name": false
        },
        {
          "uuid": "ed612e43-a9fb-4c4f-9bf3-9f5932eb4663",
          "name": "ETHYL ABIETATE",
          "stdName": "ETHYL ABIETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20e2a2cf-5e87-40c5-a1cf-b2ac85024e50"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "20e2a2cf-5e87-40c5-a1cf-b2ac85024e50",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "03f209e6-6872-4492-b4c2-bade8464e06c",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b229022-9e55-4457-be1e-a893bcffe380",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32165bdb-d6de-477d-b54a-865aced5933a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391116000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "040e4d25-6c9b-4582-a795-191b9ac45eb2",
          "citation": "SRS import [46YCT42ESP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=46YCT42ESP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391116000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1351b798-c549-43c1-aa13-dbc6134df03f",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7bdb20f4-d770-4322-18b9-8547da69b3be",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=631-71-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0eb281a4-5f2b-4f3b-a5de-7e8294cb356d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dc92cf1f-c035-49df-9f29-62d82e741fd0",
          "id": "dc92cf1f-c035-49df-9f29-62d82e741fd0",
          "molfile": "\n  Marvin  01132111262D          \n\n 24 26  0  0  1  0            999 V2000\n    7.4099   -2.8782    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.4099   -2.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1259   -1.6416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8414   -2.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8414   -2.8782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1259   -3.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1259   -4.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4099   -4.5291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6982   -4.1180    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.9825   -4.5291    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.4009   -5.1103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2757   -4.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2757   -3.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9825   -2.8782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6982   -3.2929    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.6982   -2.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9825   -5.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6982   -5.7606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2757   -5.7606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2757   -6.5773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5519   -6.9803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5524   -1.6416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5524   -0.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2637   -2.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  1  0  0  0\n 15  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4 22  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n  9 15  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 12  1  0  0  0  0\n 10 17  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  1  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)[C@]1(C)CCC[C@]2(C)[C@H]3CCC(=CC3=CC[C@H]21)C(C)C",
          "formula": "C22H34O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "751ddc82-ebd0-437e-99af-cd2975f5c883"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "330.505",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "db9b0499-1b6b-47b4-a192-2434e008963d",
      "version": "3",
      "structure": {
        "id": "253d2252-8c73-4678-8910-9c45647d751a",
        "molfile": "\n  Marvin  01132102042D          \n\n 26 28  0  0  1  0            999 V2000\n    6.7079   -4.1240    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7079   -3.2977    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4207   -2.8824    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1377   -3.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8543   -2.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8543   -2.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5663   -1.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5663   -0.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2786   -2.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1377   -1.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4207   -2.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1377   -4.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4207   -4.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4207   -3.7003    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9912   -2.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2834   -3.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2834   -4.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9912   -4.5357    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.9912   -5.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2834   -5.7690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2834   -6.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5585   -6.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7079   -5.7690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4088   -5.1177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7079   -2.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7079   -4.9425    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11 10  1  0  0  0  0\n  3 11  1  0  0  0  0\n 12  4  2  0  0  0  0\n 13 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n  3 14  1  6  0  0  0\n  2 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n  1 18  1  0  0  0  0\n 18 19  1  6  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 19 23  2  0  0  0  0\n 18 24  1  1  0  0  0\n  2 25  1  1  0  0  0\n  1 26  1  6  0  0  0\nM  END",
        "smiles": "CCOC(=O)[C@]1(C)CCC[C@]2(C)[C@@]3([H])CCC(=CC3=CC[C@]21[H])C(C)C",
        "formula": "C22H34O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "330.505",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "040e4d25-6c9b-4582-a795-191b9ac45eb2",
          "1351b798-c549-43c1-aa13-dbc6134df03f"
        ],
        "stereo_centers": 4
      },
      "unii": "46YCT42ESP"
    }
  ]
}