{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d3a0c62c-8906-6cf4-8386-3506c6e9a090", "code": "DTXSID10331554", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10331554", "code_system": "EPA CompTox", "references": [ "655bf392-a961-299b-5f6b-93f608373245" ] }, { "uuid": "d0e366a5-8e06-f179-42d9-871151dbd47a", "code": "Lacto-N-tetraose", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Lacto-N-tetraose", "code_system": "WIKIPEDIA", "references": [ "c7e10792-8125-7687-6592-698c62544924" ] }, { "uuid": "d51c7c8e-57d9-4aa4-a768-03a986025b13", "code": "1017", "type": "PRIMARY", "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=1017", "code_system": "GRAS Notification (GRN No.)" }, { "uuid": "ea6f8849-f5fe-47c8-8d40-a030be3e14bc", "code": "46XNQ2LX59", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "67e8ccc4-234a-c3bf-eb58-851452645a24", "code": "923", "type": "PRIMARY", "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=923", "code_system": "GRAS Notification (GRN No.)", "references": [ "655bf392-a961-299b-5f6b-93f608373245" ] }, { "uuid": "ee823268-2eba-7026-91bd-0f5f9a01e779", "code": "833", "type": "PRIMARY", "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=833", "code_system": "GRAS Notification (GRN No.)", "references": [ "655bf392-a961-299b-5f6b-93f608373245" ] }, { "uuid": "d5731fe2-db75-24d5-627a-60b130423518", "code": "9896511", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9896511", "code_system": "PUBCHEM", "references": [ "fa52bc8d-83c7-9990-8f7c-43dab448dc4f" ] }, { "uuid": "62018976-d19c-4494-b07a-f379dc248b53", "code": "14116-68-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=14116-68-8", "code_system": "CAS", "references": [ "aa874474-0f0f-4f58-9501-b433af74dcd0" ] } ], "substance_class": "chemical", "references": [ { "uuid": "04be2ec2-165b-4146-b73b-fb7ecf8c6f1a", "citation": "Zhang, Wenyuan, et al. \"Comparison of twelve human milk oligosaccharides in mature milk from different areas in China in the Chinese Human Milk Project (CHMP) study.\" Food Chemistry 395 (2022): 133554.", "url": "https://www.sciencedirect.com/science/article/pii/S0308814622015163", "doc_type": "JA", "public_domain": true }, { "uuid": "c7e10792-8125-7687-6592-698c62544924", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "aa874474-0f0f-4f58-9501-b433af74dcd0", "citation": "stn", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "655bf392-a961-299b-5f6b-93f608373245", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "fa52bc8d-83c7-9990-8f7c-43dab448dc4f", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "1af337d4-43a9-f4ac-3ba9-756bfa05d855", "citation": "STARI", "doc_type": "CFSAN", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "09978875-383c-464b-8aa9-463ea29534ee", "id": "09978875-383c-464b-8aa9-463ea29534ee", "molfile": "\n Marvin 01102200102D \n\n 51 53 0 0 1 0 999 V2000\n 14.8787 -6.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1642 -7.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1642 -7.8374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4497 -6.5999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4497 -5.7749 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.1642 -5.3624 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.1642 -4.5375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4497 -4.1250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.4497 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1642 -2.8876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7353 -4.5375 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.0208 -4.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7353 -5.3624 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.0208 -5.7749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3064 -5.3623 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.3064 -4.5374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5919 -4.1249 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.5919 -3.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3064 -2.8876 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8775 -4.5374 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.1630 -4.1249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8775 -5.3623 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.1630 -5.7748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5919 -5.7748 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.5919 -6.5998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8787 -5.7749 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5930 -5.3624 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.3075 -5.7749 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.3075 -6.5999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0220 -5.3623 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 17.7364 -5.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7364 -6.5998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0220 -4.5374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3075 -4.1249 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.3075 -3.2999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0220 -2.8874 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 17.7364 -3.2999 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 17.7364 -4.1249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4509 -2.8874 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 19.1653 -3.2999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4509 -2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.1653 -1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7364 -1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0220 -2.0624 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.3075 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3075 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5930 -4.5374 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.8787 -4.1249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3064 -6.1873 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1642 -6.1874 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0220 -3.7124 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 5 4 1 6 0 0 0\n 5 6 1 0 0 0 0\n 5 13 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 26 1 0 0 0 0\n 6 50 1 6 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 1 0 0 0\n 8 11 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 6 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 1 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 24 1 0 0 0 0\n 15 49 1 6 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 1 0 0 0\n 17 20 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 1 1 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 1 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 6 0 0 0\n 27 26 1 6 0 0 0\n 27 28 1 0 0 0 0\n 27 47 1 0 0 0 0\n 28 29 1 6 0 0 0\n 28 30 1 0 0 0 0\n 30 31 1 6 0 0 0\n 30 33 1 0 0 0 0\n 31 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 34 47 1 0 0 0 0\n 34 51 1 1 0 0 0\n 36 35 1 6 0 0 0\n 36 37 1 0 0 0 0\n 36 44 1 0 0 0 0\n 37 38 1 1 0 0 0\n 37 39 1 0 0 0 0\n 39 40 1 6 0 0 0\n 39 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 1 0 0 0\n 45 46 1 0 0 0 0\n 47 48 1 1 0 0 0\nM END", "smiles": "CC(=O)N[C@@H]1[C@H]([C@@H]([C@@H](CO)O[C@@]1([H])O[C@H]2[C@H]([C@@H](CO)O[C@]([H])([C@@H]2O)O[C@H]([C@@H](CO)O)[C@@H]([C@H](C=O)O)O)O)O)O[C@@]3([H])[C@@H]([C@H]([C@H]([C@@H](CO)O3)O)O)O", "formula": "C26H45NO21", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f5029f96-4727-49e8-85fb-c85694ca84b3" }, "defined_stereo": 19, "ez_centers": 0, "molecular_weight": "707.6307", "optical_activity": "UNSPECIFIED", "stereo_centers": 19 } ], "definition_level": "COMPLETE", "uuid": "929525a2-7718-41e3-86bd-768c5b24ec9a", "version": "13", "structure": { "id": "5cdebeae-c33f-4947-b0c2-b3cade2e45f5", "molfile": "\n JSDraw201102200102D\n\n 51 53 0 0 1 0 0 V2000\n 28.1342 -12.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7832 -13.2598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7832 -14.8198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4321 -12.4799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4321 -10.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7832 -10.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7832 -8.5800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4321 -7.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4321 -6.2400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7832 -5.4601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0813 -8.5800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7303 -7.8000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.0813 -10.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.7303 -10.9199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3793 -10.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3793 -8.5798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0283 -7.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0283 -6.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3793 -5.4601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6775 -8.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3264 -7.7998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6775 -10.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3264 -10.9197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0283 -10.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0283 -12.4797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1342 -10.9199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4850 -10.1399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8360 -10.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8360 -12.4799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1870 -10.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5380 -10.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5380 -12.4797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1870 -8.5798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8360 -7.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8360 -6.2399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1870 -5.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5380 -6.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5380 -7.7998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8889 -5.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.2399 -6.2399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8889 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.2399 -3.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5380 -3.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1870 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8360 -3.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8360 -1.5600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29.4850 -8.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.1342 -7.7998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.3793 -11.6997 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7832 -11.6999 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 32.1870 -7.0198 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 5 4 1 6 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 1 0 0 0\n 9 10 1 0 0 0 0\n 8 11 1 0 0 0 0\n 11 12 1 6 0 0 0\n 11 13 1 0 0 0 0\n 5 13 1 0 0 0 0\n 13 14 1 1 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 1 0 0 0\n 18 19 1 0 0 0 0\n 17 20 1 0 0 0 0\n 20 21 1 1 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 1 0 0 0\n 22 24 1 0 0 0 0\n 15 24 1 0 0 0 0\n 24 25 1 6 0 0 0\n 6 26 1 0 0 0 0\n 27 26 1 6 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 6 0 0 0\n 28 30 1 0 0 0 0\n 30 31 1 6 0 0 0\n 31 32 1 0 0 0 0\n 30 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 35 1 6 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 1 0 0 0\n 37 39 1 0 0 0 0\n 39 40 1 6 0 0 0\n 39 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 43 44 1 0 0 0 0\n 36 44 1 0 0 0 0\n 44 45 1 1 0 0 0\n 45 46 1 0 0 0 0\n 34 47 1 0 0 0 0\n 27 47 1 0 0 0 0\n 47 48 1 1 0 0 0\n 15 49 1 6 0 0 0\n 6 50 1 6 0 0 0\n 34 51 1 1 0 0 0\nM END", "smiles": "CC(=O)N[C@@H]1[C@H]([C@@H]([C@@H](CO)O[C@@]1([H])O[C@H]2[C@H]([C@@H](CO)O[C@]([H])([C@@H]2O)O[C@H]([C@@H](CO)O)[C@@H]([C@H](C=O)O)O)O)O)O[C@@]3([H])[C@@H]([C@H]([C@H]([C@@H](CO)O3)O)O)O", "formula": "C26H45NO21", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 19, "ez_centers": 0, "molecular_weight": "707.6307", "optical_activity": "UNSPECIFIED", "references": [ "aa874474-0f0f-4f58-9501-b433af74dcd0" ], "stereo_centers": 19 }, "unii": "46XNQ2LX59", "relationships": [ { "uuid": "de902611-d527-4434-ab2c-3dc34dad9dbc", "amount": { "uuid": "8e94a686-5245-4827-9513-0a17c22a997d" }, "type": "PARENT->CONSTITUENT ALWAYS PRESENT", "references": [ "04be2ec2-165b-4146-b73b-fb7ecf8c6f1a" ], "related_substance": { "uuid": "00ef59ab-ff57-487a-9606-da3fa9328064", "refuuid": "27e0342b-6aff-4f50-a0c4-20d774b4a7c3", "name": "HUMAN MILK OLIGOSACCHARIDES", "unii": "5M7GRZ07LW", "linking_id": "5M7GRZ07LW", "ref_pname": "HUMAN MILK OLIGOSACCHARIDES", "substance_class": "reference" } } ], "names": [ { "uuid": "ab5d0978-479e-4518-a96f-cfd91ec41d69", "name": "D-GLUCOSE, O-.BETA.-D-GALACTOPYRANOSYL-(1->3)-O-2-(ACETYLAMINO)-2-DEOXY-.BETA.-D-GLUCOPYRANOSYL-(1->3)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-", "stdName": "D-GLUCOSE, O-.BETA.-D-GALACTOPYRANOSYL-(1->3)-O-2-(ACETYLAMINO)-2-DEOXY-.BETA.-D-GLUCOPYRANOSYL-(1->3)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "aa874474-0f0f-4f58-9501-b433af74dcd0" ], "display_name": false }, { "uuid": "81422669-2b2c-46c5-87bc-fb6ab65b10c7", "name": "LACTO-N-TETRAOSE", "stdName": "LACTO-N-TETRAOSE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "aa874474-0f0f-4f58-9501-b433af74dcd0" ], "display_name": true }, { "uuid": "a48ad349-799c-4d82-95ed-6e3f0f4a00a1", "name": "LNT (OLIGOSACCHARIDE)", "stdName": "LNT (OLIGOSACCHARIDE)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "aa874474-0f0f-4f58-9501-b433af74dcd0" ], "display_name": false }, { "uuid": "6509e37c-cf3e-4691-8e5c-1d487ea90afd", "name": "O-.BETA.-D-GALACTOPYRANOSYL-(1->3)-O-2-(ACETYLAMINO)-2-DEOXY-.BETA.-D-GLUCOPYRANOSYL-(1->3)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-D-GLUCOSE", "stdName": "O-.BETA.-D-GALACTOPYRANOSYL-(1->3)-O-2-(ACETYLAMINO)-2-DEOXY-.BETA.-D-GLUCOPYRANOSYL-(1->3)-O-.BETA.-D-GALACTOPYRANOSYL-(1->4)-D-GLUCOSE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "aa874474-0f0f-4f58-9501-b433af74dcd0" ], "display_name": false } ], "modifications": { "uuid": "3f208c10-fe4c-48aa-8ce3-6db19aef731c" } } ] }