{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d76555b2-a811-430a-a350-4337bca93004",
          "code": "56-37-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=56-37-1",
          "code_system": "CAS",
          "references": [
            "02f33aab-7205-481f-8244-3828fedb05a4",
            "c655a3bf-3b83-4d91-80b9-0fdc9755ab0c"
          ]
        },
        {
          "uuid": "cc043ee8-d8f7-43c4-9933-5565370b897e",
          "code": "200-270-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.246",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "02f33aab-7205-481f-8244-3828fedb05a4"
          ]
        },
        {
          "uuid": "c769e588-d0b0-48b7-9157-18561b706c2a",
          "code": "66133",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66133",
          "code_system": "PUBCHEM",
          "references": [
            "02f33aab-7205-481f-8244-3828fedb05a4"
          ]
        },
        {
          "uuid": "e4574079-31a6-c514-3cd4-b29205094c6f",
          "code": "DTXSID9021710",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9021710",
          "code_system": "EPA CompTox",
          "references": [
            "608b207a-fe67-264c-2f3b-d06977bd8435"
          ]
        },
        {
          "uuid": "732cb824-c8ab-47d7-a1f7-96b01d42551a",
          "code": "46WDQ3ADML",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c43d1350-7e13-a64a-edcc-349731250470",
          "code": "152923",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=152923",
          "code_system": "NSC",
          "references": [
            "a486b5a4-e56f-c060-692b-172766451ac3"
          ]
        },
        {
          "uuid": "55ed54c8-487b-4c53-c22b-2a4a64fcaf06",
          "code": "100000155809",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ad0187e5-b3a8-939f-7353-d2b50b029f31"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "54a165b8-bc26-480b-8afd-a5abc5dc7e6e",
          "amount": {
            "uuid": "5712593b-f812-4b36-8532-8050b46d58ef"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "0c070ffc-a957-4279-9e75-3c2cdfba7b24",
            "refuuid": "40248fdd-ebc5-4cda-80fd-237fa3c509be",
            "name": "BENZYLTRIETHYLAMMONIUM",
            "unii": "QS1AQC1A39",
            "linking_id": "QS1AQC1A39",
            "ref_pname": "BENZYLTRIETHYLAMMONIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e6c24bdc-1675-48f0-ae11-0a706ea24193",
          "name": "AMMONIUM, BENZYLTRIETHYL-, CHLORIDE",
          "stdName": "AMMONIUM, BENZYLTRIETHYL-, CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5a02cc8-91a3-442e-84d2-04a222971d29",
            "e6f8f862-b7ac-4f32-b63b-4ae8cbc974e6"
          ],
          "display_name": false
        },
        {
          "uuid": "d463aa93-fb47-40fe-88bb-6fa6f164bbfe",
          "name": "BAC-TE",
          "stdName": "BAC-TE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5a02cc8-91a3-442e-84d2-04a222971d29",
            "e6f8f862-b7ac-4f32-b63b-4ae8cbc974e6"
          ],
          "display_name": false
        },
        {
          "uuid": "094b054d-8245-4080-b6f8-a579c36ee85b",
          "name": "BENZENEMETHANAMINIUM, N,N,N-TRIETHYL-, CHLORIDE",
          "stdName": "BENZENEMETHANAMINIUM, N,N,N-TRIETHYL-, CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5a02cc8-91a3-442e-84d2-04a222971d29",
            "e6f8f862-b7ac-4f32-b63b-4ae8cbc974e6"
          ],
          "display_name": false
        },
        {
          "uuid": "5a9b74e3-697e-4e92-9c7e-a16f46650793",
          "name": "BENZENEMETHANAMINIUM, N,N,N-TRIETHYL-, CHLORIDE (1:1)",
          "stdName": "BENZENEMETHANAMINIUM, N,N,N-TRIETHYL-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5a02cc8-91a3-442e-84d2-04a222971d29",
            "e6f8f862-b7ac-4f32-b63b-4ae8cbc974e6"
          ],
          "display_name": false
        },
        {
          "uuid": "91d06269-0430-4612-a16b-bdab370f8c00",
          "name": "BENZYL TRIETHYL AMMONIUM CHLORIDE",
          "stdName": "BENZYL TRIETHYL AMMONIUM CHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "e600b397-edd5-47a1-806c-ff755247e636",
            "e5a02cc8-91a3-442e-84d2-04a222971d29",
            "9d2822ac-d950-42cc-a9b3-68b194baa8a0"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c6522c3c-3b93-47f4-950e-c72b9ad30021",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "367104e0-29fb-458d-acdc-c352c8a27790",
          "name": "BENZYLTRIETHYLAMMONIUM CHLORIDE",
          "stdName": "BENZYLTRIETHYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5a02cc8-91a3-442e-84d2-04a222971d29",
            "e6f8f862-b7ac-4f32-b63b-4ae8cbc974e6"
          ],
          "display_name": true
        },
        {
          "uuid": "cb000657-f0b7-40d5-a161-9de402e25c89",
          "name": "N,N,N-TRIETHYL-N-BENZYLAMMONIUM CHLORIDE",
          "stdName": "N,N,N-TRIETHYL-N-BENZYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5a02cc8-91a3-442e-84d2-04a222971d29",
            "e6f8f862-b7ac-4f32-b63b-4ae8cbc974e6"
          ],
          "display_name": false
        },
        {
          "uuid": "d8666b60-1a86-6a87-80b3-0c5becc962e7",
          "name": "NSC-152923",
          "stdName": "NSC-152923",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a486b5a4-e56f-c060-692b-172766451ac3"
          ],
          "display_name": false
        },
        {
          "uuid": "92de5acc-5dab-45c9-8bc0-ced358290744",
          "name": "SUMQUAT 2355",
          "stdName": "SUMQUAT 2355",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e600b397-edd5-47a1-806c-ff755247e636",
            "e5a02cc8-91a3-442e-84d2-04a222971d29"
          ],
          "display_name": false
        },
        {
          "uuid": "89f84dcf-33ce-4ce9-bd1a-5a864618fba9",
          "name": "TEBAC",
          "stdName": "TEBAC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5a02cc8-91a3-442e-84d2-04a222971d29",
            "e6f8f862-b7ac-4f32-b63b-4ae8cbc974e6"
          ],
          "display_name": false
        },
        {
          "uuid": "f7edde24-ed01-4599-947a-6d72e86c5fd9",
          "name": "TRIETHYLBENZYLAMMONIUM CHLORIDE",
          "stdName": "TRIETHYLBENZYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5a02cc8-91a3-442e-84d2-04a222971d29",
            "e6f8f862-b7ac-4f32-b63b-4ae8cbc974e6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e6f8f862-b7ac-4f32-b63b-4ae8cbc974e6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e5a02cc8-91a3-442e-84d2-04a222971d29",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e600b397-edd5-47a1-806c-ff755247e636",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02f33aab-7205-481f-8244-3828fedb05a4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391416000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3c115ce-541e-4afd-9d09-5f30eeb4da54",
          "citation": "SRS import [46WDQ3ADML]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=46WDQ3ADML",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391416000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d2822ac-d950-42cc-a9b3-68b194baa8a0",
          "citation": "BENZYL TRIETHYL AMMONIUM CHLORIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "608b207a-fe67-264c-2f3b-d06977bd8435",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=56-37-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ad0187e5-b3a8-939f-7353-d2b50b029f31",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "a486b5a4-e56f-c060-692b-172766451ac3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c655a3bf-3b83-4d91-80b9-0fdc9755ab0c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5aad99fc-f309-4107-a5cb-cc1f1a62d4fd",
          "id": "5aad99fc-f309-4107-a5cb-cc1f1a62d4fd",
          "molfile": "\n  Marvin  01132104422D          \n\n  1  0  0  0  0  0            999 V2000\n   14.0521   -4.8781    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1013cbf1-4b47-4ad2-af18-e583244372da"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "f23f1497-2803-4960-b792-7bbe4812b9d5",
          "id": "f23f1497-2803-4960-b792-7bbe4812b9d5",
          "molfile": "\n  Marvin  01132112342D          \n\n 14 14  0  0  0  0            999 V2000\n   11.8906   -3.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1743   -3.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1743   -4.2599    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n   11.9971   -4.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4065   -4.9761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3514   -4.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9421   -3.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1743   -5.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4581   -5.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4581   -6.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7443   -6.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0305   -6.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0305   -5.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7443   -5.0742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  6  3  1  0  0  0  0\n  8  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\nM  CHG  1   3   1\nM  END",
          "smiles": "CC[N+](CC)(CC)Cc1ccccc1",
          "formula": "C13H22N",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ccf71b3b-d5da-4974-a786-4828af8b906c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "192.321",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4b40873d-bb4a-4c96-ba90-069683e4e53a",
      "version": "12",
      "structure": {
        "id": "0a1e84f7-7b36-4026-b6af-30f5d03d85ca",
        "molfile": "\n  Marvin  01132100472D          \n\n 15 14  0  0  0  0            999 V2000\n   14.0521   -4.8781    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n   11.1743   -4.2599    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   11.8906   -3.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1743   -3.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4065   -4.9761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9971   -4.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9421   -3.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3514   -4.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1743   -5.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7443   -5.0742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0305   -5.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0305   -6.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7443   -6.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4581   -6.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4581   -5.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  9  2  1  0  0  0  0\n  8  2  1  0  0  0  0\n  6  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n 15  9  1  0  0  0  0\n 15 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\nM  CHG  2   1  -1   2   1\nM  END",
        "smiles": "CC[N+](CC)(CC)Cc1ccccc1.[Cl-]",
        "formula": "C13H22N.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "227.7739",
        "optical_activity": "NONE",
        "references": [
          "b3c115ce-541e-4afd-9d09-5f30eeb4da54",
          "e6f8f862-b7ac-4f32-b63b-4ae8cbc974e6"
        ],
        "stereo_centers": 0
      },
      "unii": "46WDQ3ADML"
    }
  ]
}