{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1556d220-ce2a-4c2e-8673-de1167b8ac0b", "code": "4-D_(psychedelic)", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/4-D_(psychedelic)", "code_system": "WIKIPEDIA" }, { "uuid": "f5b78f47-a0c5-4383-af6f-31968d38c9ff", "code": "1020518-87-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1020518-87-9", "code_system": "CAS", "references": [ "4505c5f0-f232-4f84-8265-1b1bcca3c894" ] }, { "uuid": "a8daa958-2ed5-649f-fdc6-9e8dffba1353", "code": "44719545", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44719545", "code_system": "PUBCHEM", "references": [ "97ee2d29-0209-d409-2f20-2881d7177dee" ] }, { "uuid": "9fc39b3c-f84b-4f4b-90ca-1fb8d92d5995", "code": "46N9S93HNE", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "59fbb52c-5fd9-41df-9791-04c0176a0dff", "code": "PiHKAL", "comments": "Wikipedia|PiHKAL|Phenethylamines", "type": "CONCEPT", "url": "https://en.wikipedia.org/wiki/PiHKAL", "code_system": "WIKIPEDIA" } ], "relationships": [ { "uuid": "e1c46ac3-d231-45c1-b513-2b818a39b73b", "amount": { "uuid": "103a74de-c06a-4309-8731-8b9c9e5fd574" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "30837d09-8790-4a1a-882e-c810c1ae60c4", "refuuid": "673f684a-7d8f-4f50-8323-5ea723da1759", "name": "4-D (PSYCHEDELIC)", "unii": "46N9S93HNE", "linking_id": "46N9S93HNE", "ref_pname": "4-D (PSYCHEDELIC)", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "b8f24278-996c-4a05-ba40-5efa3319be7d", "name": "3,5-METHOXY-4-TRIDEUTEROMETHOXYPHENETHYLAMINE", "stdName": "3,5-METHOXY-4-TRIDEUTEROMETHOXYPHENETHYLAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1f744c75-58c6-411b-9a29-9d46c4221d10" ], "display_name": false }, { "uuid": "e74cfbd9-42f3-464f-ad52-7917b9a04c65", "name": "4-D (PSYCHEDELIC)", "stdName": "4-D (PSYCHEDELIC)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1f744c75-58c6-411b-9a29-9d46c4221d10" ], "display_name": true }, { "uuid": "0a550129-3922-4a5d-b956-b9536c3bc291", "name": "4-D MESCALINE", "stdName": "4-D MESCALINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1f744c75-58c6-411b-9a29-9d46c4221d10" ], "display_name": false }, { "uuid": "5acc3d1c-71aa-4643-ad92-8d1426850552", "name": "MESCALINE, 4-TRIDEUTEROMETHOXY", "stdName": "MESCALINE, 4-TRIDEUTEROMETHOXY", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "06335b0f-5c29-43c9-b113-f7a65ead97bf" ], "display_name": false } ], "references": [ { "uuid": "1f744c75-58c6-411b-9a29-9d46c4221d10", "citation": "https://en.wikipedia.org/wiki/4-D_(psychedelic)", "doc_type": "WIKI", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4505c5f0-f232-4f84-8265-1b1bcca3c894", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "06335b0f-5c29-43c9-b113-f7a65ead97bf", "citation": "SRS", "doc_type": "SRS", "public_domain": true }, { "uuid": "97ee2d29-0209-d409-2f20-2881d7177dee", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2d6ef08d-135e-411e-81d4-e904cc7714c2", "id": "2d6ef08d-135e-411e-81d4-e904cc7714c2", "molfile": "\n Marvin 01132102272D \n\n 18 18 0 0 0 0 999 V2000\n -0.1829 -2.4332 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5954 -1.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0079 -1.0043 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3099 -2.1312 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1191 -1.3063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1191 -0.4813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8335 -0.0688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5480 -0.4813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2625 -0.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8335 0.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1191 1.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1191 1.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8335 2.4062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8335 3.2312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5954 0.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5954 -0.0688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3099 -0.4812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0243 -0.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 16 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 10 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 15 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\nM ISO 3 1 2 3 2 4 2\nM END", "smiles": "COc1cc(CCN)cc(c1OC([2H])([2H])[2H])OC", "formula": "C11H17NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f8496514-9d7a-488c-8591-c0c027e0be8e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "214.2765", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "673f684a-7d8f-4f50-8323-5ea723da1759", "version": "10", "structure": { "id": "679e5d71-0500-4736-ae61-f81742905f9e", "molfile": "\n Marvin 01132105232D \n\n 18 18 0 0 0 0 999 V2000\n 13.0080 -6.9022 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5955 -6.1877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1830 -5.4733 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8810 -6.6002 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3100 -5.7753 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3100 -4.9503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0244 -4.5378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7389 -4.9503 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4534 -4.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0244 -3.7128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3100 -3.3003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3100 -2.4753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0244 -2.0628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0244 -1.2378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5955 -3.7128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5955 -4.5378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8810 -4.9502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1666 -4.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 11 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 6 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\nM ISO 3 1 2 3 2 4 2\nM END", "smiles": "COc1cc(CCN)cc(c1OC([2H])([2H])[2H])OC", "formula": "C11H17NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "214.2765", "optical_activity": "NONE", "references": [ "1f744c75-58c6-411b-9a29-9d46c4221d10", "4505c5f0-f232-4f84-8265-1b1bcca3c894" ], "stereo_centers": 0 }, "unii": "46N9S93HNE" } ] }