{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c32bf0d0-6185-4f92-8472-b53a14044f52", "code": "469MKT9U5Q", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "9a06eb01-bf5f-6ab8-8d81-218c90bdb426", "code": "DTXSID201108518", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201108518", "code_system": "EPA CompTox", "references": [ "653d1e14-83a8-1b1c-7eea-b0b0868ebb1a" ] }, { "uuid": "dfff03df-8d00-f0eb-a53d-92caa5df31cb", "code": "11582593", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11582593", "code_system": "PUBCHEM", "references": [ "161bd807-03b2-300b-9cff-850b4f1010cb" ] }, { "uuid": "d6093b04-a9ce-49c4-b0fd-192548cef8fb", "code": "69861-02-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=69861-02-5", "code_system": "CAS", "references": [ "df129f2b-fc82-4c1a-8345-5471f1198e9d" ] } ], "substance_class": "chemical", "names": [ { "uuid": "49d16211-d31c-4d99-b7e0-008b7c54206b", "name": "(3-METHACRYLOXY-2-HYDROXYPROPOXY)PROPYLBIS(TRIMETHYLSILOXY)METHYLSILANE", "stdName": "(3-METHACRYLOXY-2-HYDROXYPROPOXY)PROPYLBIS(TRIMETHYLSILOXY)METHYLSILANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "df129f2b-fc82-4c1a-8345-5471f1198e9d" ], "display_name": true }, { "uuid": "681c3756-4d69-453b-9587-b6dfc5ef183f", "name": "2-PROPENOIC ACID, 2-METHYL-, 2-HYDROXY-3-(3-(1,3,3,3-TETRAMETHYL-1-((TRIMETHYLSILYL)OXY)-1-DISILOXANYL)PROPOXY)PROPYL ESTER", "stdName": "2-PROPENOIC ACID, 2-METHYL-, 2-HYDROXY-3-(3-(1,3,3,3-TETRAMETHYL-1-((TRIMETHYLSILYL)OXY)-1-DISILOXANYL)PROPOXY)PROPYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "df129f2b-fc82-4c1a-8345-5471f1198e9d" ], "display_name": false }, { "uuid": "fe643fd7-69a1-4834-b7b8-6b6c84872e5f", "name": "BIS(TRIMETHYLSILYLOXY)METHYLSILYLPROPYLGLYCEROL METHACRYLATE", "stdName": "BIS(TRIMETHYLSILYLOXY)METHYLSILYLPROPYLGLYCEROL METHACRYLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "df129f2b-fc82-4c1a-8345-5471f1198e9d" ], "display_name": false }, { "uuid": "6c8ce2eb-7da4-4853-91d9-7503812c6240", "name": "METHYLBIS(TRIMETHYLSILOXY)SILYLPROPYLGLYCERYL METHACRYLATE", "stdName": "METHYLBIS(TRIMETHYLSILOXY)SILYLPROPYLGLYCERYL METHACRYLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "df129f2b-fc82-4c1a-8345-5471f1198e9d" ], "display_name": false } ], "references": [ { "uuid": "161bd807-03b2-300b-9cff-850b4f1010cb", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "df129f2b-fc82-4c1a-8345-5471f1198e9d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "653d1e14-83a8-1b1c-7eea-b0b0868ebb1a", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3f2f453f-88ba-4978-8f6f-3a5043b6734e", "id": "3f2f453f-88ba-4978-8f6f-3a5043b6734e", "molfile": "\n Marvin 02182211152D \n\n 26 25 0 0 0 0 999 V2000\n 4.2203 1.4055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2203 0.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5058 0.1680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7913 0.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0768 0.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0768 -0.6570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3624 0.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6479 0.1680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0666 0.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7810 0.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4955 0.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2100 0.1680 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7975 -0.5465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2100 -1.2610 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4955 -1.6735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9245 -0.8485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6225 -1.9754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9245 -0.2445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6389 0.1680 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0514 -0.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2264 0.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3534 0.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6225 0.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9347 0.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9347 -0.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6492 0.5805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 2 24 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 18 1 0 0 0 0\n 12 23 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 24 25 2 0 0 0 0\n 24 26 1 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OCC(COCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)O", "formula": "C17H38O6Si3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "136aa190-01da-4408-a156-6b8cd08d079a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "422.7368", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "72214f3e-9fed-486f-8737-e9eed05c843b", "version": "4", "structure": { "id": "dd90fa16-2585-4f3a-a8fc-9e3b76df8be5", "molfile": "\n JSDraw202182211152D\n\n 26 25 0 0 0 0 0 V2000\n 32.9871 -7.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.9834 -8.6291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.3325 -9.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6306 -9.4058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.6269 -10.9659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2815 -8.6227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.9286 -9.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5794 -8.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.5831 -7.0563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2266 -9.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8774 -8.6101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5246 -9.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.1754 -8.6038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8226 -9.3805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.4735 -8.5974 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 18.6903 -9.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2566 -7.2482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8165 -7.2518 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 21.8201 -5.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0333 -8.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.3766 -7.2555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1243 -7.8142 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1279 -6.2543 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5678 -6.2507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6878 -6.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1316 -4.6943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 18 21 1 0 0 0 0\n 15 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 23 26 1 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OCC(COCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)O", "formula": "C17H38O6Si3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "422.7368", "optical_activity": "( + / - )", "references": [ "df129f2b-fc82-4c1a-8345-5471f1198e9d" ], "stereo_centers": 1 }, "unii": "469MKT9U5Q" } ] }