{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bbc94a4f-ea8a-437e-bb50-8014e09b2a9a",
          "code": "138-52-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=138-52-3",
          "code_system": "CAS",
          "references": [
            "bd859ed5-a744-4e45-8068-3344b13cdeee",
            "7bb6721c-adab-4ed0-8190-61b490d7bcb9"
          ]
        },
        {
          "uuid": "da1e2a97-e15e-41e0-9305-1c44571d633b",
          "code": "C90648",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C90648",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bd859ed5-a744-4e45-8068-3344b13cdeee"
          ]
        },
        {
          "uuid": "f67675b9-8450-4d92-b045-64502502cfb2",
          "code": "C005696",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005696",
          "code_system": "MESH",
          "references": [
            "bd859ed5-a744-4e45-8068-3344b13cdeee"
          ]
        },
        {
          "uuid": "925acee6-9715-4d7c-a2d8-62456c65b448",
          "code": "SALICIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Salicin",
          "code_system": "WIKIPEDIA",
          "references": [
            "bd859ed5-a744-4e45-8068-3344b13cdeee"
          ]
        },
        {
          "uuid": "46b0b92b-01e4-45d4-a286-e7cee98c469a",
          "code": "205-331-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.847",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bd859ed5-a744-4e45-8068-3344b13cdeee"
          ]
        },
        {
          "uuid": "30939c32-53ba-4bcd-8ab6-9993597b0e12",
          "code": "36100",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/36100/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bd859ed5-a744-4e45-8068-3344b13cdeee"
          ]
        },
        {
          "uuid": "92671936-f218-4e83-a836-2d4e05f4d0c0",
          "code": "m9730",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9730?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bd859ed5-a744-4e45-8068-3344b13cdeee"
          ]
        },
        {
          "uuid": "fe063293-1184-49db-9991-e043c1482096",
          "code": "SUB15176MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bd859ed5-a744-4e45-8068-3344b13cdeee"
          ]
        },
        {
          "uuid": "28b71f53-a3af-4883-89f6-5a702b58bcfb",
          "code": "CHEMBL462997",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL462997",
          "code_system": "ChEMBL",
          "references": [
            "bd859ed5-a744-4e45-8068-3344b13cdeee"
          ]
        },
        {
          "uuid": "828c2261-6b70-4ae1-997c-0810617baeb8",
          "code": "439503",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439503",
          "code_system": "PUBCHEM",
          "references": [
            "bd859ed5-a744-4e45-8068-3344b13cdeee"
          ]
        },
        {
          "uuid": "020b060f-5bba-dd88-ee94-28eac818490a",
          "code": "C241",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C241",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c0b35e78-114a-5def-bbd7-6a629cd25423"
          ]
        },
        {
          "uuid": "7765c864-ccb0-32c2-62b8-0fbae7be5dd0",
          "code": "2450 (Number of products:17)",
          "comments": "Dietary Supplement Label Database|chemical|Salicin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2450&item=Salicin",
          "code_system": "DSLD",
          "references": [
            "c0b35e78-114a-5def-bbd7-6a629cd25423"
          ]
        },
        {
          "uuid": "b88199c5-f9f4-42f1-87b9-5efaf9ad882e",
          "code": "4649620TBZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4d59a50d-928d-2aab-ceec-882a780ce409",
          "code": "17814",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17814",
          "code_system": "CHEBI",
          "references": [
            "c0b35e78-114a-5def-bbd7-6a629cd25423"
          ]
        },
        {
          "uuid": "8ff8ee08-e6af-4c54-a0e2-7225b922246f",
          "code": "1607903",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1607903",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "c0b35e78-114a-5def-bbd7-6a629cd25423"
          ]
        },
        {
          "uuid": "2e36a963-01d5-05e2-3dfe-84665d23b045",
          "code": "4649620TBZ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4649620TBZ",
          "code_system": "DAILYMED",
          "references": [
            "dfbbcbe7-1c52-b913-e0e2-6a3b35cdde86"
          ]
        },
        {
          "uuid": "5f8034ef-9461-a3e2-75f6-615c8a7484d5",
          "code": "100000078369",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "86b9b96b-2288-8a5f-ab79-e422ba5e405e"
          ]
        },
        {
          "uuid": "89ba36e8-2191-f9a5-490d-efdadc89599d",
          "code": "DTXSID10883326",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10883326",
          "code_system": "EPA CompTox",
          "references": [
            "c0b35e78-114a-5def-bbd7-6a629cd25423"
          ]
        },
        {
          "uuid": "5e6aae00-15f1-349b-9815-668ce1b3bc5d",
          "code": "5751",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=5751",
          "code_system": "NSC",
          "references": [
            "49d48bba-0a1b-8c67-9a1f-e738c18476fc"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f43c368e-1931-4fdc-9f97-e7bb8982751a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "20157e0e-8809-4066-a5dd-31d808392c44",
            "refuuid": "aefcf5de-f685-41b8-92ff-0698d3eb08fe",
            "name": "SALICIN",
            "unii": "4649620TBZ",
            "linking_id": "4649620TBZ",
            "ref_pname": "SALICIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c1576fbd-9e3d-4424-a936-d643d0b161f2",
          "name": "2-(HYDROXYMETHYL)PHENYL-.BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "2-(HYDROXYMETHYL)PHENYL-.BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a94cc4fc-f04f-4340-b768-eaef95f6257d",
            "79f8aeba-0f6e-4748-8215-3b9053147a84"
          ],
          "display_name": false
        },
        {
          "uuid": "2cd0de78-c9f8-4c26-b3b7-6e9df96b0c0d",
          "name": "D(-)-SALICIN",
          "stdName": "D(-)-SALICIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0a81da4-f008-4004-8e9c-32bd46d21dcf",
            "79f8aeba-0f6e-4748-8215-3b9053147a84"
          ],
          "display_name": false
        },
        {
          "uuid": "bb18b188-fbf1-4571-bced-2ddbb5b87230",
          "name": "D-(-)-SALICIN",
          "stdName": "D-(-)-SALICIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "893eeb1e-4075-4d04-934d-fe3a6079b8c0",
            "79f8aeba-0f6e-4748-8215-3b9053147a84"
          ],
          "display_name": false
        },
        {
          "uuid": "da125d50-1413-fa8a-d5d1-6d24da6d5ca1",
          "name": "D-SALICIN [USP-RS]",
          "stdName": "D-SALICIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ac54245-2136-fa2a-b82c-c5d0b37c23ff"
          ],
          "display_name": false
        },
        {
          "uuid": "4db24298-2599-4c38-9c80-8eba7229314a",
          "name": "NSC-5751",
          "stdName": "NSC-5751",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a906814-cebe-4f15-8952-39a1ae0aa33d",
            "79f8aeba-0f6e-4748-8215-3b9053147a84"
          ],
          "display_name": false
        },
        {
          "uuid": "9e194d32-7c60-4f65-9a5d-33016f573686",
          "name": "SALICIN",
          "stdName": "SALICIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c09ecb7e-da88-4393-8041-9b954ab2dfe4",
            "c1697132-9683-4c08-ad4f-220d342c384f",
            "0e056b09-9461-440f-9229-46496319b1cb",
            "4a89d762-eb10-4b1c-9a31-01fbe635db08",
            "190596e1-5297-40ab-b084-609669961901",
            "1e285193-b011-4c6d-a328-b0d89a4f6340",
            "15a0a3e9-1d77-4171-a505-8d6290b0b242",
            "d21235f4-d007-464f-b0f6-dabdc5f74bf4",
            "79f8aeba-0f6e-4748-8215-3b9053147a84"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "35c1c470-a3a6-4f6a-a09b-3d752e28c976",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f3b2ab87-6c90-4dff-afef-e5988cced4ae",
          "name": "SALICIN [MI]",
          "stdName": "SALICIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d21235f4-d007-464f-b0f6-dabdc5f74bf4",
            "79f8aeba-0f6e-4748-8215-3b9053147a84"
          ],
          "display_name": false
        },
        {
          "uuid": "c8897ea2-7d82-4dc6-94d8-813d449f64f8",
          "name": "SALICINUM",
          "stdName": "SALICINUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5df5a84-2f79-4ae9-b90d-6c52ef8a37b1",
            "c9558133-bcf8-4601-b616-737761c13fba",
            "79f8aeba-0f6e-4748-8215-3b9053147a84",
            "e9eca7c9-5721-45dc-949a-8098f0c7baae"
          ],
          "display_name": false
        },
        {
          "uuid": "d32bc7e7-f2b3-462e-b062-8a21f3f824a9",
          "name": "SALICINUM [HPUS]",
          "stdName": "SALICINUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9558133-bcf8-4601-b616-737761c13fba",
            "e9eca7c9-5721-45dc-949a-8098f0c7baae"
          ],
          "display_name": false
        },
        {
          "uuid": "3c22d4b6-7f70-45c9-91fe-46b205ddc165",
          "name": "SALICOSIDE",
          "stdName": "SALICOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a89d762-eb10-4b1c-9a31-01fbe635db08",
            "79f8aeba-0f6e-4748-8215-3b9053147a84"
          ],
          "display_name": false
        },
        {
          "uuid": "175d19fe-dfaa-457a-8bb4-94a3b9c6aad7",
          "name": "SALICYL ALCOHOL GLUCOSIDE",
          "stdName": "SALICYL ALCOHOL GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a89d762-eb10-4b1c-9a31-01fbe635db08",
            "79f8aeba-0f6e-4748-8215-3b9053147a84"
          ],
          "display_name": false
        },
        {
          "uuid": "e29c9d93-8a2f-4885-602e-0ecf98206988",
          "name": "Salicyl alcohol glucoside [WHO-DD]",
          "stdName": "SALICYL ALCOHOL GLUCOSIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "535c0506-9959-39df-32df-b6f4d515be43"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4a89d762-eb10-4b1c-9a31-01fbe635db08",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "15a0a3e9-1d77-4171-a505-8d6290b0b242",
          "citation": "USP OTC",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9eca7c9-5721-45dc-949a-8098f0c7baae",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79f8aeba-0f6e-4748-8215-3b9053147a84",
          "citation": "HOMEOPATHIC PHARMACOPOEIA US",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a94cc4fc-f04f-4340-b768-eaef95f6257d",
          "citation": "MERCK 14.4",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0a81da4-f008-4004-8e9c-32bd46d21dcf",
          "citation": "http://www.chemindustry.com/chemicals/461401.html",
          "url": "http://www.chemindustry.com/chemicals/461401.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "893eeb1e-4075-4d04-934d-fe3a6079b8c0",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9558133-bcf8-4601-b616-737761c13fba",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d21235f4-d007-464f-b0f6-dabdc5f74bf4",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c09ecb7e-da88-4393-8041-9b954ab2dfe4",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e056b09-9461-440f-9229-46496319b1cb",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a906814-cebe-4f15-8952-39a1ae0aa33d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd859ed5-a744-4e45-8068-3344b13cdeee",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390740000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a29578a-fa1f-4f84-b9c1-8ecb37e7f2d3",
          "citation": "SRS import [4649620TBZ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4649620TBZ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390740000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5df5a84-2f79-4ae9-b90d-6c52ef8a37b1",
          "citation": "SALICINUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "190596e1-5297-40ab-b084-609669961901",
          "citation": "SALICIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c1697132-9683-4c08-ad4f-220d342c384f",
          "citation": "SALICIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e285193-b011-4c6d-a328-b0d89a4f6340",
          "citation": "SALICIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "86b9b96b-2288-8a5f-ab79-e422ba5e405e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c0b35e78-114a-5def-bbd7-6a629cd25423",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7bb6721c-adab-4ed0-8190-61b490d7bcb9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9ac54245-2136-fa2a-b82c-c5d0b37c23ff",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "49d48bba-0a1b-8c67-9a1f-e738c18476fc",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "dfbbcbe7-1c52-b913-e0e2-6a3b35cdde86",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "535c0506-9959-39df-32df-b6f4d515be43",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4085222f-a811-42e1-96a4-3d316468a75c",
          "id": "4085222f-a811-42e1-96a4-3d316468a75c",
          "molfile": "\n  Marvin  01132103252D          \n\n 20 21  0  0  1  0            999 V2000\n    8.3084   -5.7356    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.3084   -6.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0269   -6.9802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5945   -5.3224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5945   -4.5002    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.8805   -4.0870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1664   -4.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4479   -4.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7340   -4.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7340   -5.3222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4479   -5.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1664   -5.3222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8805   -5.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8805   -6.5622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3084   -4.0871    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.3084   -3.2603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0269   -4.5003    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.7410   -4.0871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0269   -5.3224    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.7410   -5.7356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 19  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n 15  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  6  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  1  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  6  0  0  0\nM  END",
          "smiles": "c1ccc(c(c1)CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
          "formula": "C13H18O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d61d67d2-b770-4762-8c64-132813a48716"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "286.2783",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "aefcf5de-f685-41b8-92ff-0698d3eb08fe",
      "version": "23",
      "structure": {
        "id": "15c12f9b-9447-4a27-8ced-31ba54c5a52d",
        "molfile": "\n  Marvin  01132101202D          \n\n 20 21  0  0  1  0            999 V2000\n    8.3084   -3.2603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3084   -4.0871    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.5945   -4.5002    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8805   -4.0870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1664   -4.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4479   -4.0870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7340   -4.5002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7340   -5.3222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4479   -5.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1664   -5.3222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8805   -5.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8805   -6.5622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5945   -5.3224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3084   -5.7356    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.0269   -5.3224    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.7410   -5.7356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0269   -4.5003    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.7410   -4.0871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3084   -6.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0269   -6.9802    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 10  5  2  0  0  0  0\n 13  3  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  6  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  1  0  0  0\n 17  2  1  0  0  0  0\n 14 19  1  1  0  0  0\n 20 19  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(c(c1)CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O",
        "formula": "C13H18O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "286.2783",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4a29578a-fa1f-4f84-b9c1-8ecb37e7f2d3",
          "4a89d762-eb10-4b1c-9a31-01fbe635db08"
        ],
        "stereo_centers": 5
      },
      "unii": "4649620TBZ"
    }
  ]
}