{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "105b355d-df4a-489c-9b80-68bbe9e8b4de",
          "code": "122931-48-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=122931-48-0",
          "code_system": "CAS",
          "references": [
            "f4bd6b2d-7b1e-419f-8146-4abdfe6ff561",
            "c5e5c466-d421-40bb-ab63-f90f31ebfbab"
          ]
        },
        {
          "uuid": "b1600928-04d2-40b7-9381-803e034dae5e",
          "code": "129009",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3716",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "f4bd6b2d-7b1e-419f-8146-4abdfe6ff561"
          ]
        },
        {
          "uuid": "1fa6aa34-e767-49ac-af18-8deeb8815b5c",
          "code": "m9626",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9626?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f4bd6b2d-7b1e-419f-8146-4abdfe6ff561"
          ]
        },
        {
          "uuid": "23b78c33-f4d1-4321-b1ab-5585a812dd04",
          "code": "91779",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91779",
          "code_system": "PUBCHEM",
          "references": [
            "f4bd6b2d-7b1e-419f-8146-4abdfe6ff561"
          ]
        },
        {
          "uuid": "a97d9a3a-dd72-6bee-12b3-d00b6c275d86",
          "code": "7947",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7947",
          "code_system": "HSDB",
          "references": [
            "743b6f7c-aa99-ba7f-b89d-c2c9a5795044"
          ]
        },
        {
          "uuid": "f9eae81c-9b63-932a-e588-ae5f08a44391",
          "code": "DTXSID1032642",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1032642",
          "code_system": "EPA CompTox",
          "references": [
            "e4c7cf3d-3353-19cb-fc60-426f3deac7d3"
          ]
        },
        {
          "uuid": "d4941a75-bdc4-4535-ad43-08c183111e86",
          "code": "462J071RD7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bcc9f159-f477-9765-fc01-4438e8218881",
          "code": "rimsulfuron",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/rimsulfuron.html",
          "code_system": "ALANWOOD",
          "references": [
            "5a9568e2-2966-d870-c7a2-5f289b5314ba"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c698ce0b-1a77-4073-8eab-664a13db3a57",
          "name": "1-(4,6-DIMETHOXYPYRIMIDIN-2-YL)-3-(3-ETHYLSULFONYL-2-PYRIDYLSULFONYL)UREA",
          "stdName": "1-(4,6-DIMETHOXYPYRIMIDIN-2-YL)-3-(3-ETHYLSULFONYL-2-PYRIDYLSULFONYL)UREA",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5db7e346-b457-41df-aa4d-8065fbcfc78a",
            "c3e339c9-ff78-4940-9bb0-2576fe39390c"
          ],
          "display_name": false
        },
        {
          "uuid": "24aea517-8def-4065-99b3-cd815a5b983c",
          "name": "DPX-E9636",
          "stdName": "DPX-E9636",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2965572-74f8-438c-b777-a55a86a6786b"
          ],
          "display_name": false
        },
        {
          "uuid": "f55e18fe-9070-4e6e-af10-8a523f35f4cc",
          "name": "N-(((4,6-DIMETHOXY-2-PYRIMIDINYL)AMINO)CARBONYL)-3-(ETHYLSULFONYL)-2-PYRIDINESULFONAMIDE",
          "stdName": "N-(((4,6-DIMETHOXY-2-PYRIMIDINYL)AMINO)CARBONYL)-3-(ETHYLSULFONYL)-2-PYRIDINESULFONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3e339c9-ff78-4940-9bb0-2576fe39390c",
            "b9bf0c7f-2d87-4aa2-b814-b3d8cda8a56b"
          ],
          "display_name": false
        },
        {
          "uuid": "25e97f12-0c20-46a9-bcd4-1da11c980dd6",
          "name": "RIMSULFURON",
          "stdName": "RIMSULFURON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37523b95-b39b-423e-afb9-c6e8b924e80d",
            "c00ddf1e-d458-4c87-a4df-d5daecb11987",
            "41d5454f-f926-4a0b-914f-8eedd70b2415",
            "83ba7948-9425-4a5c-9e82-8215585bd0fd",
            "eaccc30d-0599-4ba2-8d6f-5174828661cd"
          ],
          "display_name": true
        },
        {
          "uuid": "6413ca08-93dd-4963-838d-566298495f35",
          "name": "RIMSULFURON [ISO]",
          "stdName": "RIMSULFURON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c00ddf1e-d458-4c87-a4df-d5daecb11987"
          ],
          "display_name": false
        },
        {
          "uuid": "6ef86453-d0e8-4baf-8428-54d6fb996d20",
          "name": "RIMSULFURON [MI]",
          "stdName": "RIMSULFURON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37523b95-b39b-423e-afb9-c6e8b924e80d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "83ba7948-9425-4a5c-9e82-8215585bd0fd",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c3e339c9-ff78-4940-9bb0-2576fe39390c",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5db7e346-b457-41df-aa4d-8065fbcfc78a",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9bf0c7f-2d87-4aa2-b814-b3d8cda8a56b",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2965572-74f8-438c-b777-a55a86a6786b",
          "citation": "http://www2.dupont.com/Production_Agriculture/en_US/assets/downloads/pdfs/K-14710.pdf",
          "url": "http://www2.dupont.com/Production_Agriculture/en_US/assets/downloads/pdfs/K-14710.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37523b95-b39b-423e-afb9-c6e8b924e80d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c00ddf1e-d458-4c87-a4df-d5daecb11987",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4bd6b2d-7b1e-419f-8146-4abdfe6ff561",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0b9c64e-980a-4f39-923e-ddd55920eaca",
          "citation": "SRS import [462J071RD7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=462J071RD7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd538e26-52a5-4157-9deb-06625308f4f4",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eaccc30d-0599-4ba2-8d6f-5174828661cd",
          "citation": "RIMSULFURON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "41d5454f-f926-4a0b-914f-8eedd70b2415",
          "citation": "RIMSULFURON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "743b6f7c-aa99-ba7f-b89d-c2c9a5795044",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+122931-48-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e4c7cf3d-3353-19cb-fc60-426f3deac7d3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=122931-48-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5a9568e2-2966-d870-c7a2-5f289b5314ba",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "c5e5c466-d421-40bb-ab63-f90f31ebfbab",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "65b8153d-04b7-4b39-9436-9fb5d3d85a61",
          "id": "65b8153d-04b7-4b39-9436-9fb5d3d85a61",
          "molfile": "\n  Marvin  01132105182D          \n\n 28 29  0  0  0  0            999 V2000\n    3.7838   -6.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4962   -5.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4962   -5.0738    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1935   -5.0738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7761   -5.0738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4962   -4.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7718   -3.8387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7718   -3.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4858   -2.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2034   -3.0047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2034   -3.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9217   -4.2433    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3550   -3.6247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5292   -4.7894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6399   -4.6496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3559   -4.2316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3559   -3.4132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0763   -4.6423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0763   -5.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8016   -5.8755    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8016   -6.6986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5196   -7.1099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2313   -6.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0863   -7.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3709   -6.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6614   -7.1345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9701   -6.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3709   -5.8854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  2  0  0  0  0\n  3  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 11  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 28 19  2  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 24  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 25 28  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "CCS(=O)(=O)c1cccnc1S(=O)(=O)NC(=O)Nc2nc(cc(n2)OC)OC",
          "formula": "C14H17N5O7S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "23f5534a-a85e-4fcc-8565-d2ae930a7034"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "431.4468",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4cb1d6a1-5e87-4ebe-9ec0-617406232b3c",
      "version": "5",
      "structure": {
        "id": "92cb63e7-0959-406f-9469-02b9acf544cd",
        "molfile": "\n  Marvin  01132107372D          \n\n 28 29  0  0  0  0            999 V2000\n    3.7838   -6.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4962   -5.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4962   -5.0738    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1935   -5.0738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7761   -5.0738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4962   -4.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7718   -3.8387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7718   -3.0156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4858   -2.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2034   -3.0047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2034   -3.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9217   -4.2433    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3550   -3.6247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5292   -4.7894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6399   -4.6496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3559   -4.2316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3559   -3.4132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0763   -4.6423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0763   -5.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8016   -5.8755    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8016   -6.6986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5196   -7.1099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2313   -6.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0863   -7.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3709   -6.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6614   -7.1345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9701   -6.8264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3709   -5.8854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  2  0  0  0  0\n  3  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11  6  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 21 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 25 28  1  0  0  0  0\n 28 19  2  0  0  0  0\nM  END",
        "smiles": "CCS(=O)(=O)c1cccnc1S(=O)(=O)NC(=O)Nc2nc(cc(n2)OC)OC",
        "formula": "C14H17N5O7S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "431.4468",
        "optical_activity": "NONE",
        "references": [
          "c0b9c64e-980a-4f39-923e-ddd55920eaca",
          "bd538e26-52a5-4157-9deb-06625308f4f4"
        ],
        "stereo_centers": 0
      },
      "unii": "462J071RD7"
    }
  ]
}