{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "76b037c9-a685-4528-887e-c668989af1da",
          "code": "C021294",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67021294",
          "code_system": "MESH",
          "references": [
            "3c59e047-8448-42dc-a6d8-f0b7481b8e8a"
          ]
        },
        {
          "uuid": "8f7560d0-eb4a-456a-9437-a5e9c9e24286",
          "code": "SUB06272MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3c59e047-8448-42dc-a6d8-f0b7481b8e8a"
          ]
        },
        {
          "uuid": "b5635642-8ce7-4a1e-9739-a145893bd5a4",
          "code": "4676",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4676",
          "code_system": "INN",
          "references": [
            "3c59e047-8448-42dc-a6d8-f0b7481b8e8a"
          ]
        },
        {
          "uuid": "7f560959-7883-43ce-9e14-9069a7ddeac6",
          "code": "CHEMBL34431",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL34431",
          "code_system": "ChEMBL",
          "references": [
            "3c59e047-8448-42dc-a6d8-f0b7481b8e8a"
          ]
        },
        {
          "uuid": "a18e7dba-ef30-42cc-ba56-f553a94b4f04",
          "code": "2753",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2753",
          "code_system": "PUBCHEM",
          "references": [
            "3c59e047-8448-42dc-a6d8-f0b7481b8e8a"
          ]
        },
        {
          "uuid": "9fd911a8-e022-4903-9234-cf666367871d",
          "code": "68550-75-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68550-75-4",
          "code_system": "CAS",
          "references": [
            "3c59e047-8448-42dc-a6d8-f0b7481b8e8a",
            "d3dd04f2-eadd-4d65-be76-80e0507d9a2b"
          ]
        },
        {
          "uuid": "902c9401-7fa8-46fe-849c-c984dc1d283b",
          "code": "C76315",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76315",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3c59e047-8448-42dc-a6d8-f0b7481b8e8a"
          ]
        },
        {
          "uuid": "cbbc7488-ec5f-02e2-df07-e95c413115f3",
          "code": "DTXSID3045140",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3045140",
          "code_system": "EPA CompTox",
          "references": [
            "0a488e7d-df92-f2c1-6b29-f828e19160e3"
          ]
        },
        {
          "uuid": "0540dcaa-fa7e-a276-5f8e-b959722d35dd",
          "code": "C744",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Phosphodiesterase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C744",
          "code_system": "NCI_THESAURUS",
          "references": [
            "db638ef6-787c-340d-d28e-bbb6a8e43e80"
          ]
        },
        {
          "uuid": "5e8a81a4-9007-4013-8af7-7ee30f9e99f7",
          "code": "45S5605Q18",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ddaf6ed4-7964-0b06-3244-fdaddf5e9e2c",
          "code": "Cilostamide",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cilostamide",
          "code_system": "WIKIPEDIA",
          "references": [
            "3097defd-e488-8b85-da86-b9ef62d87296"
          ]
        },
        {
          "uuid": "aea1a12e-1849-af05-33b2-03710f36fdb1",
          "code": "100000081034",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "54120d05-cc93-4d34-0071-a8e867ec3e2e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "444df578-4be3-4c63-975e-23747abe22a1",
          "amount": {
            "uuid": "b20e89d5-ee8e-4f02-a319-c707fedf254d"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "1880bef4-ee3e-46b4-bbc0-7b770a9fa5c4",
            "refuuid": "370775dd-0056-4002-b8e8-2dc8d6c24eb3",
            "name": "CILOSTAMIDE",
            "unii": "45S5605Q18",
            "linking_id": "45S5605Q18",
            "ref_pname": "CILOSTAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e910ff71-1b34-4ca1-aebd-2898c1d15c4e",
          "amount": {
            "uuid": "acce546e-4fc1-42e8-b416-042937f699e6",
            "average": 83,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "1a8486bd-11c1-49e6-890b-75b34536146a"
          ],
          "related_substance": {
            "uuid": "e2d66a0f-b7ee-4dee-8786-2818075fcbbf",
            "refuuid": "ca731da8-8121-4f36-a982-3df89e890256",
            "name": "CGMP-INHIBITED 3',5'-CYCLIC PHOSPHODIESTERASE A",
            "unii": "JOC85XIO65",
            "linking_id": "JOC85XIO65",
            "ref_pname": "CGMP-INHIBITED 3',5'-CYCLIC PHOSPHODIESTERASE A",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "899bce26-c328-4aa4-b25f-fa443a8b0dd4",
          "name": "CILOSTAMIDE",
          "stdName": "CILOSTAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff48586f-ea53-4880-9126-6db8e8e9ada4",
            "def14557-7267-43ea-9aea-7a02bb8d496c",
            "6b9d1f0f-2bfa-4cb1-be59-5075255e9dff"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7e8bde2e-437a-446a-a2c6-d5d76580e5eb",
              "name_org": "INN"
            },
            {
              "uuid": "f29e458a-4d4e-4b9d-be17-59f87c42cd1a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "86e0563c-33ed-4010-b726-c8ca166706d4",
          "name": "CILOSTAMIDE [JAN]",
          "stdName": "CILOSTAMIDE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "193235b8-e1b4-13ba-04ed-79e64c466bce"
          ],
          "display_name": false
        },
        {
          "uuid": "46ba66a5-c314-454c-892a-cb11de8530e7",
          "name": "N-CYCLOHEXYL-4-((1,2-DIHYDRO-2-OXO-6-QUINOLYL)OXY)-N-METHYLBUTYRAMIDE",
          "stdName": "N-CYCLOHEXYL-4-((1,2-DIHYDRO-2-OXO-6-QUINOLYL)OXY)-N-METHYLBUTYRAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "340795f1-4067-45b0-bf4f-6c8aac0cde67"
          ],
          "display_name": false
        },
        {
          "uuid": "8e4a3da2-74c5-42e7-a142-2894a20570ef",
          "name": "OPC-3689",
          "stdName": "OPC-3689",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2155492f-04de-41cf-b4e7-85f7ecd05355",
            "85214178-b9ba-4f73-b35a-7598d96e6de8"
          ],
          "display_name": false
        },
        {
          "uuid": "523d2fb8-1f08-4ae6-b388-f4bfca9f14d9",
          "name": "cilostamide [INN]",
          "stdName": "CILOSTAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def14557-7267-43ea-9aea-7a02bb8d496c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ff48586f-ea53-4880-9126-6db8e8e9ada4",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "340795f1-4067-45b0-bf4f-6c8aac0cde67",
          "citation": "USP DICTIONARY 2014",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "def14557-7267-43ea-9aea-7a02bb8d496c",
          "citation": "INN Proposed List 42",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL42.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "85214178-b9ba-4f73-b35a-7598d96e6de8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2155492f-04de-41cf-b4e7-85f7ecd05355",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c59e047-8448-42dc-a6d8-f0b7481b8e8a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390733000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ffb0049-6abd-4f89-99b1-00dfd75f3534",
          "citation": "SRS import [45S5605Q18]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=45S5605Q18",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390733000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b9d1f0f-2bfa-4cb1-be59-5075255e9dff",
          "citation": "CILOSTAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "193235b8-e1b4-13ba-04ed-79e64c466bce",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0a488e7d-df92-f2c1-6b29-f828e19160e3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68550-75-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "54120d05-cc93-4d34-0071-a8e867ec3e2e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "db638ef6-787c-340d-d28e-bbb6a8e43e80",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d3dd04f2-eadd-4d65-be76-80e0507d9a2b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3097defd-e488-8b85-da86-b9ef62d87296",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "1a8486bd-11c1-49e6-890b-75b34536146a",
          "citation": "https://www.eurofinsdiscovery.com/catalogmanagement/viewItem/4072",
          "url": "https://www.eurofinsdiscovery.com/catalogmanagement/viewItem/4072",
          "doc_type": "ASSAY REFERENCE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ccdf983f-173a-4a36-bf83-1d6cc42dd07c",
          "id": "ccdf983f-173a-4a36-bf83-1d6cc42dd07c",
          "molfile": "\n  Marvin  01132110352D          \n\n 25 27  0  0  0  0            999 V2000\n    0.8943   -5.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8999   -4.2866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1882   -3.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1938   -3.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5179   -2.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2351   -3.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2407   -3.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5290   -4.2771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6171   -3.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6226   -3.0539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3288   -4.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0460   -3.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7577   -4.3057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4749   -3.8980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1866   -4.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1810   -5.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8927   -5.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6099   -5.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3216   -5.5671    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0388   -5.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7505   -5.5767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0444   -4.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3327   -3.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6155   -4.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9038   -3.9076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  9  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 25 15  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 24 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "CN(C1CCCCC1)C(=O)CCCOc2ccc3c(ccc(=O)[nH]3)c2",
          "formula": "C20H26N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "211a9a3f-c759-44e9-85d9-5adfa68b3321"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "342.4328",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "370775dd-0056-4002-b8e8-2dc8d6c24eb3",
      "version": "12",
      "structure": {
        "id": "9abc7da2-9218-4b9c-8a04-ed2b3b893738",
        "molfile": "\n  Marvin  01132108022D          \n\n 25 27  0  0  0  0            999 V2000\n    5.1810   -5.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1866   -4.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4749   -3.8980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7577   -4.3057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0460   -3.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3288   -4.2961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6171   -3.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8999   -4.2866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1882   -3.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1938   -3.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5179   -2.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2351   -3.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2407   -3.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5290   -4.2771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8943   -5.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6226   -3.0539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9038   -3.9076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6155   -4.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3327   -3.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0444   -4.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0388   -5.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7505   -5.5767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3216   -5.5671    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6099   -5.1498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8927   -5.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  9  1  0  0  0  0\n  8 15  1  0  0  0  0\n  7 16  2  0  0  0  0\n 17  2  1  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  2  0  0  0  0\n 23 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 18 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n  1 25  1  0  0  0  0\nM  END",
        "smiles": "CN(C1CCCCC1)C(=O)CCCOc2ccc3c(ccc(=O)[nH]3)c2",
        "formula": "C20H26N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "342.4328",
        "optical_activity": "NONE",
        "references": [
          "ff48586f-ea53-4880-9126-6db8e8e9ada4",
          "1ffb0049-6abd-4f89-99b1-00dfd75f3534",
          "def14557-7267-43ea-9aea-7a02bb8d496c"
        ],
        "stereo_centers": 0
      },
      "unii": "45S5605Q18"
    }
  ]
}