{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "fab9e6a2-ab7e-4ad0-95cf-d50ef81373ac", "code": "29611-03-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=29611-03-8", "code_system": "CAS", "references": [ "ecff767d-78ed-4b8a-b03d-c2924b1c4c17", "55e15122-cbdf-45c2-8520-929eb84188c1" ] }, { "uuid": "e164e83f-c7f1-4ca8-a9c8-07d7a4931f94", "code": "C012170", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67012170", "code_system": "MESH", "references": [ "ecff767d-78ed-4b8a-b03d-c2924b1c4c17" ] }, { "uuid": "1b95e1e9-bb17-4a98-91d9-72c07ac55f39", "code": "249-727-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.045.192", "code_system": "ECHA (EC/EINECS)", "references": [ "ecff767d-78ed-4b8a-b03d-c2924b1c4c17" ] }, { "uuid": "d4a11756-49d0-4abb-92a4-a9711cf1e445", "code": "104744", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/104744", "code_system": "PUBCHEM", "references": [ "ecff767d-78ed-4b8a-b03d-c2924b1c4c17" ] }, { "uuid": "421999e6-e932-8f7e-90a5-29ca91c585bd", "code": "DTXSID4020034", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4020034", "code_system": "EPA CompTox", "references": [ "352fccfd-3ec6-9abf-cc78-082d7f0c3f95" ] }, { "uuid": "b0884879-f564-406b-87b5-1479b6c9a553", "code": "45I1K5482V", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "0e176612-83ba-89dc-92b7-a073723cb5fe", "code": "300000053028", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "0c9fc9ff-8a80-52f3-c1c4-c5dd950aacd1" ] } ], "substance_class": "chemical", "names": [ { "uuid": "d3aeb290-eb39-4c62-993d-b0a608fb93ce", "name": "AFLATOXICOL", "stdName": "AFLATOXICOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "36067d6f-2533-4bd9-8272-385fe040b062" ], "display_name": true }, { "uuid": "744f2e57-b3c8-497c-9c61-b9c2b1427965", "name": "AFLATOXIN R0", "stdName": "AFLATOXIN R0", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "308f19b5-2338-4111-8cc0-918221e0cb4e", "36067d6f-2533-4bd9-8272-385fe040b062" ], "display_name": false }, { "uuid": "1b9ef35e-3c63-4c78-b7c9-f2e670cd70cc", "name": "CYCLOPENTA(C)FURO(3',2':4,5)FURO(2,3-H)(1)BENZOPYRAN-11(1H)-ONE, 2,3,6A,9A-TETRAHYDRO-1-HYDROXY-4-METHOXY-, (1S,6AR,9AS)-", "stdName": "CYCLOPENTA(C)FURO(3',2':4,5)FURO(2,3-H)(1)BENZOPYRAN-11(1H)-ONE, 2,3,6A,9A-TETRAHYDRO-1-HYDROXY-4-METHOXY-, (1S,6AR,9AS)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "308f19b5-2338-4111-8cc0-918221e0cb4e", "36067d6f-2533-4bd9-8272-385fe040b062" ], "display_name": false } ], "references": [ { "uuid": "36067d6f-2533-4bd9-8272-385fe040b062", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "308f19b5-2338-4111-8cc0-918221e0cb4e", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ecff767d-78ed-4b8a-b03d-c2924b1c4c17", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390999000, "tags": [ "NOMEN" ] }, { "uuid": "a73635b6-82ee-408f-8763-d9e025b5f3b4", "citation": "SRS import [45I1K5482V]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=45I1K5482V", "doc_type": "SRS", "public_domain": true, "document_date": 1493390999000, "tags": [ "NOMEN" ] }, { "uuid": "805f8c12-b911-4bdf-bb05-9a7e89b430cf", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "352fccfd-3ec6-9abf-cc78-082d7f0c3f95", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=29611-03-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "55e15122-cbdf-45c2-8520-929eb84188c1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0c9fc9ff-8a80-52f3-c1c4-c5dd950aacd1", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "07bfff82-43c7-456c-bf43-25651e40b844", "id": "07bfff82-43c7-456c-bf43-25651e40b844", "molfile": "\n Marvin 01132100412D \n\n 23 27 0 0 1 0 999 V2000\n 11.6187 0.2695 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 11.6187 1.0946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3241 -0.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3241 -0.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9077 -0.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9077 -0.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1955 0.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1955 1.0947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4808 -0.1460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4808 -0.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7676 -1.3672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7676 -2.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0604 -2.6137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3409 -2.1921 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.9149 -2.1921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9149 -1.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6277 -0.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3409 -1.3672 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.4741 -2.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1937 -2.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9099 -2.6144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9099 -3.4393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1937 -1.3672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 3 1 1 0 0 0 0\n 1 6 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 23 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 23 2 0 0 0 0\n 11 12 2 0 0 0 0\n 18 11 1 1 0 0 0\n 13 12 1 0 0 0 0\n 12 19 1 0 0 0 0\n 14 13 1 1 0 0 0\n 15 14 1 0 0 0 0\n 18 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 20 23 1 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "COc1cc2c([C@@H]3C=CO[C@@H]3O2)c4c1c5CC[C@@H](c5c(=O)o4)O", "formula": "C17H14O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2c6d2e9a-32f5-4d45-8aa9-82ce448282e7" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "314.2901", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "472ab59a-abe9-41f7-8583-582fabb9ecfe", "version": "4", "structure": { "id": "6803be6a-beea-4d58-a1c0-f708fb4d52a2", "molfile": "\n Marvin 01132105252D \n\n 25 29 0 0 1 0 999 V2000\n 7.3409 -1.3672 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.3409 -2.1921 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.0604 -2.6137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7676 -2.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7676 -1.3672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4808 -0.9578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4808 -0.1460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1955 0.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9077 -0.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9077 -0.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1937 -1.3672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1937 -2.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9099 -2.6144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9099 -3.4393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4741 -2.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3241 -0.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3241 -0.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6187 0.2695 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.6187 1.0946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1955 1.0947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9149 -2.1921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9149 -1.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6277 -0.9468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3409 -3.0143 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3409 -0.5341 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 2 0 0 0 0\n 5 1 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 12 2 0 0 0 0\n 4 15 1 0 0 0 0\n 6 11 2 0 0 0 0\n 10 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 9 1 0 0 0 0\n 18 19 1 1 0 0 0\n 8 20 2 0 0 0 0\n 21 2 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 1 23 1 0 0 0 0\n 2 24 1 6 0 0 0\n 1 25 1 6 0 0 0\nM END", "smiles": "COc1cc2c([C@]3([H])C=CO[C@]3([H])O2)c4c1c5CC[C@@H](c5c(=O)o4)O", "formula": "C17H14O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "314.2901", "optical_activity": "UNSPECIFIED", "references": [ "a73635b6-82ee-408f-8763-d9e025b5f3b4", "805f8c12-b911-4bdf-bb05-9a7e89b430cf" ], "stereo_centers": 3 }, "unii": "45I1K5482V" } ] }