{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fdb717cf-3b56-444d-99df-24728baee7b1",
          "code": "241-203-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.442",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b1b61b10-6ac4-464b-955d-25585bebb96c"
          ]
        },
        {
          "uuid": "17c5c295-47e0-4743-9e45-dcbd0fa82997",
          "code": "m5761",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5761?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b1b61b10-6ac4-464b-955d-25585bebb96c"
          ]
        },
        {
          "uuid": "96ad8066-3362-41f0-adb1-d37d839e74b6",
          "code": "17140-60-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17140-60-2",
          "code_system": "CAS",
          "references": [
            "b1b61b10-6ac4-464b-955d-25585bebb96c",
            "530062d0-e094-4536-932e-c74eab0221ce"
          ]
        },
        {
          "uuid": "29f3d159-8fde-68f8-93a4-76088a38591d",
          "code": "28327",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/28327",
          "code_system": "PUBCHEM",
          "references": [
            "59a275af-a553-bb4a-a390-699d29806976"
          ]
        },
        {
          "uuid": "04de4cb9-9f39-4a4c-8c89-20a32a569567",
          "code": "45E26F1TPT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9d217807-cc6d-479f-9a8f-7a61eae4f11b",
          "code": "42196",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=42196",
          "code_system": "NSC",
          "references": [
            "1836a5a5-113e-a1c1-1022-f595a3d29570"
          ]
        },
        {
          "uuid": "713c5d77-7299-18b6-1308-36e33141c600",
          "code": "DTXSID80889390",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80889390",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "5f574158-51b4-4d3c-95b3-26961a71637c",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "51542942-405f-41e2-9789-e02cd6aab32c",
            "refuuid": "dd7d8b09-3b98-435a-a944-79908cc4fd86",
            "name": "GLUCOHEPTONIC ACID",
            "unii": "B1F50160Z2",
            "linking_id": "B1F50160Z2",
            "ref_pname": "GLUCOHEPTONIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "55c031fc-d9b8-4628-7868-d506385d2333",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "530062d0-e094-4536-932e-c74eab0221ce"
          ],
          "related_substance": {
            "uuid": "466f977c-88f9-490d-9029-0db46cbaf9f7",
            "refuuid": "da32fde8-3806-4374-a32c-adae909d4e0f",
            "name": "CALCIUM D-GLYCERO-D-GULO-HEPTONATE HEPTAHYDRATE",
            "unii": "U6QG33Y32F",
            "linking_id": "U6QG33Y32F",
            "ref_pname": "CALCIUM D-GLYCERO-D-GULO-HEPTONATE HEPTAHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c1ab4813-df1e-43cb-ae6d-0ec26e431ba2",
          "name": "CALCIUM D-GLYCERO-D-GULO-HEPTONATE",
          "stdName": "CALCIUM D-GLYCERO-D-GULO-HEPTONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0a00ce6-1de8-45cd-b2e2-d84465e7f711",
            "1f4f1a09-e512-4211-b7c6-c6ec1d02319b"
          ],
          "display_name": true
        },
        {
          "uuid": "d97ceb36-3da0-43f6-8f17-63c58c8a9157",
          "name": "D-GLYCERO-D-GULO-HEPTONIC ACID, CALCIUM SALT (2:1)",
          "stdName": "D-GLYCERO-D-GULO-HEPTONIC ACID, CALCIUM SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f4f1a09-e512-4211-b7c6-c6ec1d02319b"
          ],
          "display_name": false
        },
        {
          "uuid": "eb3a1bcd-dbee-4166-955a-b2010b4148e9",
          "name": "GLUCOHEPTONIC ACID CALCIUM SALT [MI]",
          "stdName": "GLUCOHEPTONIC ACID CALCIUM SALT [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0a00ce6-1de8-45cd-b2e2-d84465e7f711",
            "ca63ba31-45e3-45d4-97a7-4d6f13207f37"
          ],
          "display_name": false
        },
        {
          "uuid": "0c654e37-d23a-483a-8efd-411b02f91b2a",
          "name": "NSC-42196",
          "stdName": "NSC-42196",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0a00ce6-1de8-45cd-b2e2-d84465e7f711",
            "17789a83-5e04-434f-b3be-b95466ac6784"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1f4f1a09-e512-4211-b7c6-c6ec1d02319b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "17789a83-5e04-434f-b3be-b95466ac6784",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0a00ce6-1de8-45cd-b2e2-d84465e7f711",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca63ba31-45e3-45d4-97a7-4d6f13207f37",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1b61b10-6ac4-464b-955d-25585bebb96c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390629000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dfb79f6-e0eb-44ba-89ef-82bf3058b7d6",
          "citation": "SRS import [45E26F1TPT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=45E26F1TPT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390629000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59a275af-a553-bb4a-a390-699d29806976",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "530062d0-e094-4536-932e-c74eab0221ce",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1836a5a5-113e-a1c1-1022-f595a3d29570",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "44d57aa0-7103-47b0-99cd-d62b3d2839ec",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b3faa560-1051-45a8-bc1c-846dbdc1f05f",
          "id": "b3faa560-1051-45a8-bc1c-846dbdc1f05f",
          "molfile": "\n  Marvin  01132109192D          \n\n  1  0  0  0  1  0            999 V2000\n    5.3486   -1.6744    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "49231846-9155-4885-8b7a-bc72741fc03c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "31cd0df5-5f4e-4952-a10f-e324d260b655",
          "id": "31cd0df5-5f4e-4952-a10f-e324d260b655",
          "molfile": "\n  Marvin  01132102402D          \n\n 15 14  0  0  1  0            999 V2000\n   -0.8267   -1.6868    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -0.8309   -2.5135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5407   -1.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2547   -1.6910    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.1127   -1.2734    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -0.1169   -0.4467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6012   -1.6827    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    0.5970   -2.5094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3152   -1.2693    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.3110   -0.4426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0292   -1.6785    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.0250   -2.5052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7432   -1.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4572   -1.6743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7390   -0.4384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  1  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  6  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)O)O)O)O)O)O)[O-]",
          "formula": "C7H13O8",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "5ee97ba4-bf64-48c2-b8ba-9554403e3caa"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "225.1736",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "20c7b6fd-19a0-4718-a4cc-67974b3becb7",
      "version": "8",
      "structure": {
        "id": "8878459a-cdf5-4f00-9061-fe4a915fc957",
        "molfile": "\n  Marvin  01132107052D          \n\n 31 28  0  0  1  0            999 V2000\n    5.3486   -1.6744    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n   -2.2547   -1.6910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5407   -1.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8267   -1.6868    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.1127   -1.2734    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.6012   -1.6827    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.3152   -1.2693    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.0292   -1.6785    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7432   -1.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4572   -1.6743    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7390   -0.4384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0250   -2.5052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3110   -0.4426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5970   -2.5094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1169   -0.4467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8309   -2.5135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2547   -1.6910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5407   -1.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8267   -1.6868    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.1127   -1.2734    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.6012   -1.6827    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.3152   -1.2693    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.0292   -1.6785    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.7432   -1.2651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4572   -1.6743    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7390   -0.4384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0250   -2.5052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3110   -0.4426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5970   -2.5094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1169   -0.4467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8309   -2.5135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  9 10  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9 11  2  0  0  0  0\n  8 12  1  6  0  0  0\n  5  6  1  0  0  0  0\n  7 13  1  1  0  0  0\n  2  3  1  0  0  0  0\n  6 14  1  1  0  0  0\n  6  7  1  0  0  0  0\n  5 15  1  1  0  0  0\n  4 16  1  6  0  0  0\n  7  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  9  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 31  1  6  0  0  0\n 20 21  1  0  0  0  0\n 20 30  1  1  0  0  0\n 21 29  1  1  0  0  0\n 21 22  1  0  0  0  0\n 22 28  1  1  0  0  0\n 22 23  1  0  0  0  0\n 23 27  1  6  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\nM  CHG  3   1   2  10  -1  25  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1 15  17  18  19  20  21  22  23  24  25  26  27  28  29  30  31\nM  SPA   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SDI   1  4   -2.6747   -2.9335   -2.6747   -0.0184\nM  SDI   1  4    3.8772   -0.0184    3.8772   -2.9335\nM  SMT   1 2\nM  END",
        "smiles": "C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O)O.[Ca+2]",
        "formula": "2C7H13O8.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 0,
        "molecular_weight": "490.4253",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "17789a83-5e04-434f-b3be-b95466ac6784",
          "9dfb79f6-e0eb-44ba-89ef-82bf3058b7d6"
        ],
        "stereo_centers": 10
      },
      "unii": "45E26F1TPT"
    }
  ]
}