{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1bd8cf9c-792f-453a-b7f2-07550a3c15df",
          "code": "m5291",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5291?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9ba3031c-30cd-463e-9e88-d03a7d073f55"
          ]
        },
        {
          "uuid": "bbe621fc-ceb2-4619-a236-aa1ff58ef5cd",
          "code": "266-639-4",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.060.563",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9ba3031c-30cd-463e-9e88-d03a7d073f55"
          ]
        },
        {
          "uuid": "b918dc87-03b9-451e-8e7a-9888fecb43cc",
          "code": "93365",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/93365",
          "code_system": "PUBCHEM",
          "references": [
            "9ba3031c-30cd-463e-9e88-d03a7d073f55"
          ]
        },
        {
          "uuid": "668ae079-f173-4236-8348-fac97cc1db06",
          "code": "67306-03-0",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=67306-03-0",
          "code_system": "CAS",
          "references": [
            "9ba3031c-30cd-463e-9e88-d03a7d073f55",
            "8afb0d25-044c-4866-9f26-b4f13b3af7f1"
          ]
        },
        {
          "uuid": "a62cd038-41ef-4224-a918-2de4041d18ab",
          "code": "67564-91-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=67564-91-4",
          "code_system": "CAS",
          "references": [
            "9ba3031c-30cd-463e-9e88-d03a7d073f55",
            "04cc8755-2aed-4623-ba38-b1c21757c295"
          ]
        },
        {
          "uuid": "85c4949f-019e-43d7-886f-8834fd5628f9",
          "code": "121402",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2361",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "9ba3031c-30cd-463e-9e88-d03a7d073f55"
          ]
        },
        {
          "uuid": "45160503-c03d-44dd-bee4-662aad576514",
          "code": "266-719-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.060.636",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9ba3031c-30cd-463e-9e88-d03a7d073f55"
          ]
        },
        {
          "uuid": "0a3c8a3d-4a22-44ba-8d94-1fb61de1d850",
          "code": "4548UM725F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e5508baf-be85-393a-9902-1061a487d16b",
          "code": "50145",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:50145",
          "code_system": "CHEBI",
          "references": [
            "39b736a4-eea2-9ffc-3028-8ea472f2a1bf"
          ]
        },
        {
          "uuid": "d9f652c1-1566-093f-c194-5ff851fb29f9",
          "code": "Fenpropimorph",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fenpropimorph",
          "code_system": "WIKIPEDIA",
          "references": [
            "2fa49d40-2450-9e56-433c-4f86b5f3b040"
          ]
        },
        {
          "uuid": "a48119d2-3d4c-7a43-0515-ac7165311b4f",
          "code": "fenpropimorph",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenpropimorph.html",
          "code_system": "ALANWOOD",
          "references": [
            "4757de8c-6603-d3cf-be8a-ec8ec20df1e3"
          ]
        },
        {
          "uuid": "fb63fa71-e6a4-d07e-62d9-a3c5d3a675ee",
          "code": "DTXSID4034601",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4034601",
          "code_system": "EPA CompTox",
          "references": [
            "526244e4-1e91-4f7e-1080-9498c230ee58"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "12416ce7-0505-41f9-892d-fdc9c2b93641",
          "name": "(2R,6S)-FENPROPIMORPH",
          "stdName": "(2R,6S)-FENPROPIMORPH",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22367ef8-6624-4b92-8305-5b4dd588c8e8",
            "723eed25-8699-4cf6-af0b-f12babb9ed29"
          ],
          "display_name": false
        },
        {
          "uuid": "70ae1860-22df-43c4-a0d0-5a403dfc9fe4",
          "name": "4-(3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2-METHYLPROPYL)-2,6- DIMETHYLMORPHOLINE",
          "stdName": "4-(3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2-METHYLPROPYL)-2,6- DIMETHYLMORPHOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "723eed25-8699-4cf6-af0b-f12babb9ed29",
            "debb37c3-5ac9-4d1d-9c4f-3508e88cbad7"
          ],
          "display_name": false
        },
        {
          "uuid": "92ef7aaf-7d57-46a7-8467-77e9e891ed18",
          "name": "BAS-42100F",
          "stdName": "BAS-42100F",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "723eed25-8699-4cf6-af0b-f12babb9ed29",
            "20fc5942-17db-45e8-87e0-f166c0d560ba"
          ],
          "display_name": false
        },
        {
          "uuid": "1c70c4b8-7885-4ca0-81fa-44521cc8e710",
          "name": "CIS-4-(3-(4-TERT-BUTYLPHENYL)-2-METHYLPROPYL)-2,6-DIMETHYLMORPHOLINE",
          "stdName": "CIS-4-(3-(4-TERT-BUTYLPHENYL)-2-METHYLPROPYL)-2,6-DIMETHYLMORPHOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "874066cd-990c-43d6-9696-53eba999b293",
            "723eed25-8699-4cf6-af0b-f12babb9ed29"
          ],
          "display_name": false
        },
        {
          "uuid": "67495674-d6e6-45b1-9e2d-15df0b515f77",
          "name": "CORBEL",
          "stdName": "CORBEL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "723eed25-8699-4cf6-af0b-f12babb9ed29",
            "debb37c3-5ac9-4d1d-9c4f-3508e88cbad7"
          ],
          "display_name": false
        },
        {
          "uuid": "13fad0f3-7e67-4c78-b197-69ea3f2866ec",
          "name": "FENPROPIMORPH",
          "stdName": "FENPROPIMORPH",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4f8f6e7-5317-4b6e-b8f6-688d16dbec4f",
            "723eed25-8699-4cf6-af0b-f12babb9ed29",
            "8e55ebcd-0803-4781-a1fc-6c6431ce4eb1",
            "20fc5942-17db-45e8-87e0-f166c0d560ba",
            "debb37c3-5ac9-4d1d-9c4f-3508e88cbad7"
          ],
          "display_name": true
        },
        {
          "uuid": "8d1d9d98-53e4-44df-ac9e-fddb194cd349",
          "name": "FENPROPIMORPH [ISO]",
          "stdName": "FENPROPIMORPH [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "723eed25-8699-4cf6-af0b-f12babb9ed29",
            "debb37c3-5ac9-4d1d-9c4f-3508e88cbad7"
          ],
          "display_name": false
        },
        {
          "uuid": "790ed28a-fb1a-47d8-afb9-97b1dc79496a",
          "name": "FENPROPIMORPH [MI]",
          "stdName": "FENPROPIMORPH [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "723eed25-8699-4cf6-af0b-f12babb9ed29",
            "20fc5942-17db-45e8-87e0-f166c0d560ba"
          ],
          "display_name": false
        },
        {
          "uuid": "e70b1286-a73f-4ea3-9484-717ca9bd51fd",
          "name": "MISTRAL",
          "stdName": "MISTRAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "723eed25-8699-4cf6-af0b-f12babb9ed29",
            "debb37c3-5ac9-4d1d-9c4f-3508e88cbad7"
          ],
          "display_name": false
        },
        {
          "uuid": "403cca62-cc7b-4ca9-b0d5-6688e9f4d491",
          "name": "MORPHOLINE, 4-(3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2- METHYLPROPYL)-2,6-DIMETHYL-",
          "stdName": "MORPHOLINE, 4-(3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2- METHYLPROPYL)-2,6-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "723eed25-8699-4cf6-af0b-f12babb9ed29",
            "debb37c3-5ac9-4d1d-9c4f-3508e88cbad7"
          ],
          "display_name": false
        },
        {
          "uuid": "bd5d92e5-8697-4ea2-b73a-56d2a1f5000b",
          "name": "MORPHOLINE, 4-(3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2-METHYLPROPYL)-2,6-DIMETHYL-, (2R,6S)-REL-",
          "stdName": "MORPHOLINE, 4-(3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2-METHYLPROPYL)-2,6-DIMETHYL-, (2R,6S)-REL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "874066cd-990c-43d6-9696-53eba999b293",
            "723eed25-8699-4cf6-af0b-f12babb9ed29"
          ],
          "display_name": false
        },
        {
          "uuid": "b27bedd4-1427-4fa8-815d-fdadc82fce4a",
          "name": "MORPHOLINE, 4-(3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2-METHYLPROPYL)-2,6-DIMETHYL-, CIS-",
          "stdName": "MORPHOLINE, 4-(3-(4-(1,1-DIMETHYLETHYL)PHENYL)-2-METHYLPROPYL)-2,6-DIMETHYL-, CIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "874066cd-990c-43d6-9696-53eba999b293",
            "723eed25-8699-4cf6-af0b-f12babb9ed29"
          ],
          "display_name": false
        },
        {
          "uuid": "1ebc7982-0a2f-4097-8487-95436c7ee82a",
          "name": "RO-14-3169/000",
          "stdName": "RO-14-3169/000",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "723eed25-8699-4cf6-af0b-f12babb9ed29",
            "20fc5942-17db-45e8-87e0-f166c0d560ba"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "debb37c3-5ac9-4d1d-9c4f-3508e88cbad7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "723eed25-8699-4cf6-af0b-f12babb9ed29",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20fc5942-17db-45e8-87e0-f166c0d560ba",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "874066cd-990c-43d6-9696-53eba999b293",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22367ef8-6624-4b92-8305-5b4dd588c8e8",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ba3031c-30cd-463e-9e88-d03a7d073f55",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391985000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf68d431-4901-4f4f-ab46-bc586404aafe",
          "citation": "SRS import [4548UM725F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4548UM725F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391985000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4f8f6e7-5317-4b6e-b8f6-688d16dbec4f",
          "citation": "FENPROPIMORPH [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8e55ebcd-0803-4781-a1fc-6c6431ce4eb1",
          "citation": "FENPROPIMORPH [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "80c240b0-a861-cb92-ca54-8988abe9568c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=67564-91-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2fa49d40-2450-9e56-433c-4f86b5f3b040",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "4757de8c-6603-d3cf-be8a-ec8ec20df1e3",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "39b736a4-eea2-9ffc-3028-8ea472f2a1bf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8afb0d25-044c-4866-9f26-b4f13b3af7f1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "04cc8755-2aed-4623-ba38-b1c21757c295",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "526244e4-1e91-4f7e-1080-9498c230ee58",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "75f6f7b6-9c18-4f6b-a879-2584bafb32a7",
          "id": "75f6f7b6-9c18-4f6b-a879-2584bafb32a7",
          "molfile": "\n  Marvin  01132106072D          \n\n 22 23  0  0  0  0            999 V2000\n    6.4357   -0.2034    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1510   -0.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7195   -0.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0052   -0.2055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2901   -0.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2888   -1.4419    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.9987   -1.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5715   -1.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8575   -1.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8575   -0.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1397   -0.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -0.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -1.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1397   -1.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7151   -0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3037   -0.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1265    0.5096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0072    0.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7195    1.0302    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.7211    1.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4337    0.6173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 22  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 19  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 14  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 15  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\nM  END",
          "smiles": "CC(Cc1ccc(cc1)C(C)(C)C)CN2C[C@H](C)O[C@H](C)C2",
          "formula": "C20H33NO",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6b740eff-dcef-4862-8051-343334b5f125"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "303.4829",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "d50de94f-af72-407b-b9f5-be08d0b7571e",
      "version": "10",
      "structure": {
        "id": "c70e7ce3-909a-4cb1-9db3-2fc3c6e6b99d",
        "molfile": "\n  Marvin  01132110172D          \n\n 22 23  0  0  0  0            999 V2000\n    2.8575   -0.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1397   -0.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -0.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7151   -0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3037   -0.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1265    0.5096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -1.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1397   -1.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8575   -1.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5715   -1.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2888   -1.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9987   -1.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2901   -0.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0052   -0.2055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0072    0.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7195    1.0302    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7211    1.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4337    0.6173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4357   -0.2034    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1510   -0.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7195   -0.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10  1  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  1  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\n 22 15  1  0  0  0  0\nM  END",
        "smiles": "CC(Cc1ccc(cc1)C(C)(C)C)CN2C[C@H](C)O[C@H](C)C2",
        "formula": "C20H33NO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "303.4829",
        "optical_activity": "( + / - )",
        "references": [
          "cf68d431-4901-4f4f-ab46-bc586404aafe",
          "debb37c3-5ac9-4d1d-9c4f-3508e88cbad7"
        ],
        "stereo_centers": 3
      },
      "unii": "4548UM725F"
    }
  ]
}