{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8556abbf-909d-4f09-acbb-8625b1b270a9",
          "code": "22919-56-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=22919-56-8",
          "code_system": "CAS",
          "references": [
            "30ab5284-84cc-490b-ad47-8470e6f001b0",
            "b57f5709-604f-4de0-9a17-275bf5a305f4"
          ]
        },
        {
          "uuid": "43c365b0-cb88-42e9-af56-6319e971d731",
          "code": "101969-72-6",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=101969-72-6",
          "code_system": "CAS",
          "references": [
            "30ab5284-84cc-490b-ad47-8470e6f001b0",
            "cc981de0-eac2-47e4-bb83-7c2017c7729b"
          ]
        },
        {
          "uuid": "b833069f-6ccd-4075-91d0-3d26e374b0da",
          "code": "245-327-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.191",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "30ab5284-84cc-490b-ad47-8470e6f001b0"
          ]
        },
        {
          "uuid": "fb25df9d-60ab-5326-aa81-34bf95b3c7ac",
          "code": "DTXSID8066842",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8066842",
          "code_system": "EPA CompTox",
          "references": [
            "6009ff84-18ac-10fd-49c7-60631bd44f18"
          ]
        },
        {
          "uuid": "5f14b29f-f010-5f26-5458-e2b0a10a2a7d",
          "code": "161405",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/161405",
          "code_system": "PUBCHEM",
          "references": [
            "2910fc60-406f-c49a-fd42-27f7ba3447f9"
          ]
        },
        {
          "uuid": "16f875bd-3767-4cd7-b9ef-49e6dd57415b",
          "code": "44WCC06CKU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "91f8af51-e26c-4784-8be7-aa37f0b0e97f",
          "name": "CAPRYLIC ACID TRIETHANOLAMINE SALT",
          "stdName": "CAPRYLIC ACID TRIETHANOLAMINE SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01c0e992-130a-4863-b7fc-983f04a7d905",
            "84ad3f75-72a8-46c2-8032-9dc0c39d6060"
          ],
          "display_name": false
        },
        {
          "uuid": "0da1c5f1-6f42-4e40-a0bc-1e5d79c81f7a",
          "name": "ETHANOL, 2,2',2''-NITRILOTRI-, OCTANOATE (SALT)",
          "stdName": "ETHANOL, 2,2',2''-NITRILOTRI-, OCTANOATE (SALT)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01c0e992-130a-4863-b7fc-983f04a7d905",
            "84ad3f75-72a8-46c2-8032-9dc0c39d6060"
          ],
          "display_name": false
        },
        {
          "uuid": "23e0c6c4-e08a-4e57-9105-15dd423b21cc",
          "name": "OCTANOIC ACID, COMPD. WITH 2,2',2''-NITRILOTRIS(ETHANOL) (1:1)",
          "stdName": "OCTANOIC ACID, COMPD. WITH 2,2',2''-NITRILOTRIS(ETHANOL) (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01c0e992-130a-4863-b7fc-983f04a7d905",
            "84ad3f75-72a8-46c2-8032-9dc0c39d6060"
          ],
          "display_name": false
        },
        {
          "uuid": "24cf3791-d652-47c7-bbd2-9600dfa8bce6",
          "name": "TRIETHANOLAMINE OCTANOATE",
          "stdName": "TRIETHANOLAMINE OCTANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01c0e992-130a-4863-b7fc-983f04a7d905",
            "ffe6ac6e-4b4c-404e-a325-dfa36977e69a"
          ],
          "display_name": false
        },
        {
          "uuid": "b9a38fc2-67c0-4c3e-ad0c-a0611f858adf",
          "name": "TRIETHANOLAMINE OCTANOIC ACID SALT",
          "stdName": "TRIETHANOLAMINE OCTANOIC ACID SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01c0e992-130a-4863-b7fc-983f04a7d905",
            "84ad3f75-72a8-46c2-8032-9dc0c39d6060"
          ],
          "display_name": false
        },
        {
          "uuid": "d1a0dcda-2cc9-4a0f-828d-763ffe04ee44",
          "name": "TROLAMINE CAPRYLATE",
          "stdName": "TROLAMINE CAPRYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01c0e992-130a-4863-b7fc-983f04a7d905",
            "8d9e6184-ca5e-4901-b254-f28d68134309"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "8d9e6184-ca5e-4901-b254-f28d68134309",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "01c0e992-130a-4863-b7fc-983f04a7d905",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84ad3f75-72a8-46c2-8032-9dc0c39d6060",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ffe6ac6e-4b4c-404e-a325-dfa36977e69a",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30ab5284-84cc-490b-ad47-8470e6f001b0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391967000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3aca135a-df26-4763-9ca4-213c5974d241",
          "citation": "SRS import [44WCC06CKU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=44WCC06CKU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391967000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6009ff84-18ac-10fd-49c7-60631bd44f18",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=22919-56-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2910fc60-406f-c49a-fd42-27f7ba3447f9",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "b57f5709-604f-4de0-9a17-275bf5a305f4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cc981de0-eac2-47e4-bb83-7c2017c7729b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "63fbfa4b-7ed8-47f3-842b-cbe1cd3482e0",
          "id": "63fbfa4b-7ed8-47f3-842b-cbe1cd3482e0",
          "molfile": "\n  Marvin  01132105122D          \n\n 10  9  0  0  0  0            999 V2000\n    3.6314   -7.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3501   -7.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0570   -7.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7756   -7.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4902   -7.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2129   -7.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9235   -7.7976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6304   -7.3853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3804   -7.7663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6304   -6.5528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  END",
          "smiles": "CCCCCCCC(=O)O",
          "formula": "C8H16O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0b46a481-287e-4cf7-b1e2-8fab83b48bfd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "144.2117",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "6e49d617-0de5-494f-92f8-a59b49523219",
          "id": "6e49d617-0de5-494f-92f8-a59b49523219",
          "molfile": "\n  Marvin  01132105442D          \n\n 10  9  0  0  0  0            999 V2000\n   10.1142  -14.6239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3984  -15.0094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6826  -14.5909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9834  -14.9928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9834  -15.7966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2567  -16.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5465  -15.8792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2729  -14.5688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5796  -14.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8747  -14.5524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  8  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\nM  END",
          "smiles": "C(CO)N(CCO)CCO",
          "formula": "C6H15NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "00658041-987d-41ae-aecc-2a2f8ebddafa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "149.1884",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f24d8cda-1764-43da-85fb-b7ab10e09233",
      "version": "5",
      "structure": {
        "id": "50a4f1c8-91e3-45ed-bba2-9865d2791aad",
        "molfile": "\n  Marvin  01132104122D          \n\n 20 18  0  0  0  0            999 V2000\n    6.2430  -10.4913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7577  -10.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2723  -10.5150    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7403  -10.7802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7403  -11.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2177  -11.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7071  -11.4176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2294  -10.4754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7309  -10.7684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2240  -10.4636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6608   -7.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3853   -7.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0978   -7.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8223   -7.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5427   -7.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2711   -7.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9876   -7.8607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7002   -7.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4562   -7.8291    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7002   -6.6058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 10  9  1  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  8  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  2  0  0  0  0\nM  END",
        "smiles": "CCCCCCCC(=O)O.C(CO)N(CCO)CCO",
        "formula": "C8H16O2.C6H15NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "293.4002",
        "optical_activity": "NONE",
        "references": [
          "3aca135a-df26-4763-9ca4-213c5974d241",
          "84ad3f75-72a8-46c2-8032-9dc0c39d6060"
        ],
        "stereo_centers": 0
      },
      "unii": "44WCC06CKU"
    }
  ]
}