{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f7d7626c-88d6-4dc7-9d72-cf1f073b635d",
          "code": "169283-82-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=169283-82-3",
          "code_system": "CAS",
          "references": [
            "9a8618f3-21bc-46b7-a1b9-05c88679e4f3",
            "fff1dd6c-b295-442b-84e5-5dfd25ee76a3"
          ]
        },
        {
          "uuid": "4f1dfdef-d835-4a6e-8529-23de99caa268",
          "code": "1362142",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1362142/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9a8618f3-21bc-46b7-a1b9-05c88679e4f3"
          ]
        },
        {
          "uuid": "07fc19a8-a0c2-4f4b-b8a8-2ecaa8e79d66",
          "code": "15296546",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15296546",
          "code_system": "PUBCHEM",
          "references": [
            "9a8618f3-21bc-46b7-a1b9-05c88679e4f3"
          ]
        },
        {
          "uuid": "41d2c738-a9de-dc31-06ed-e99ce31cd105",
          "code": "DTXSID70168686",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70168686",
          "code_system": "EPA CompTox",
          "references": [
            "880ef813-13ad-4b64-0c4c-08646e822093"
          ]
        },
        {
          "uuid": "771a97e6-3ce2-4f37-b213-858dcd1b92a5",
          "code": "44U29L6P0T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "eb0a7266-1d70-46f0-a661-95441132f3a4",
          "name": "2-PYRROLIDINECARBOXAMIDE, N-(2-(1H-IMIDAZOL-4-YL)ETHYL)-, (2S)-",
          "stdName": "2-PYRROLIDINECARBOXAMIDE, N-(2-(1H-IMIDAZOL-4-YL)ETHYL)-, (2S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc8e7420-76a4-4474-937c-bc62e125644d",
            "a91c8985-cd45-4026-a326-19673d8dbe78"
          ],
          "display_name": false
        },
        {
          "uuid": "6a744db5-e357-4b60-92ae-f964af6da4bb",
          "name": "2-PYRROLIDINECARBOXAMIDE, N-(2-(1H-IMIDAZOL-4-YL)ETHYL)-, (S)-",
          "stdName": "2-PYRROLIDINECARBOXAMIDE, N-(2-(1H-IMIDAZOL-4-YL)ETHYL)-, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc8e7420-76a4-4474-937c-bc62e125644d",
            "a91c8985-cd45-4026-a326-19673d8dbe78"
          ],
          "display_name": false
        },
        {
          "uuid": "03552968-ea18-4fe9-b627-faed1b5d3693",
          "name": "N-(2-(3H-IMIDAZOL-4-YL)ETHYL)-2-PYRROLIDINECARBOXAMIDE",
          "stdName": "N-(2-(3H-IMIDAZOL-4-YL)ETHYL)-2-PYRROLIDINECARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a91c8985-cd45-4026-a326-19673d8dbe78",
            "b5093a38-f8b9-4b1d-a038-4a48b9e13be4"
          ],
          "display_name": false
        },
        {
          "uuid": "a9559cc2-3d79-4b8e-b374-715614e31c27",
          "name": "PROLINAMIDOETHYL IMIDAZOLE",
          "stdName": "PROLINAMIDOETHYL IMIDAZOLE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "490e9118-159f-43be-aba2-827d7e42c1ca",
            "a91c8985-cd45-4026-a326-19673d8dbe78",
            "4cf38943-d9aa-43e9-87fc-6bcbf22071cb"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0f616c43-307a-4aaa-b5ed-b08f88a7d245",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "490e9118-159f-43be-aba2-827d7e42c1ca",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a91c8985-cd45-4026-a326-19673d8dbe78",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5093a38-f8b9-4b1d-a038-4a48b9e13be4",
          "citation": "http://www.specialchem4cosmetics.com/services/inci/ingredient.aspx?id=11386",
          "url": "http://www.specialchem4cosmetics.com/services/inci/ingredient.aspx?id=11386",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc8e7420-76a4-4474-937c-bc62e125644d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a8618f3-21bc-46b7-a1b9-05c88679e4f3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391541000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7ba3fe3-eff5-4a77-8ec9-cb64b5299583",
          "citation": "SRS import [44U29L6P0T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=44U29L6P0T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391541000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cf38943-d9aa-43e9-87fc-6bcbf22071cb",
          "citation": "PROLINAMIDOETHYL IMIDAZOLE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "880ef813-13ad-4b64-0c4c-08646e822093",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=169283-82-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fff1dd6c-b295-442b-84e5-5dfd25ee76a3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f2b014cf-34ee-d66c-7108-eb26e93e7d06",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a7d71dfd-1429-4236-851a-d198aeaff7ba",
          "id": "a7d71dfd-1429-4236-851a-d198aeaff7ba",
          "molfile": "\n  Marvin  01132108432D          \n\n 15 16  0  0  1  0            999 V2000\n    3.8764   -4.3008    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.7902   -5.1213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9833   -5.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5707   -4.5783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1227   -3.9653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5909   -3.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5909   -3.0633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3053   -4.3008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0198   -3.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7343   -4.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4488   -3.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5350   -3.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3419   -2.8963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7545   -3.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2025   -4.2238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  5  1  0  0  0  0\n  1  6  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 15 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\nM  END",
          "smiles": "C1C[C@@H](C(=O)NCCc2c[nH]cn2)NC1",
          "formula": "C10H16N4O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e32d052f-6782-4486-aaf8-43c361fcd6cf"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "208.2606",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "44b6073e-1b7f-4f9c-b91a-49fa4c2c8c76",
      "version": "6",
      "structure": {
        "id": "70fe1d21-1b74-4d36-aaea-7e43869981b1",
        "molfile": "\n  Marvin  01132105522D          \n\n 15 16  0  0  1  0            999 V2000\n    8.2025   -4.2238    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4488   -3.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7343   -4.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0198   -3.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3053   -4.3008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5909   -3.8883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8764   -4.3008    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.1227   -3.9653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5707   -4.5783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9833   -5.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7902   -5.1213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5909   -3.0633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5350   -3.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3419   -2.8963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7545   -3.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  6  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n  7 11  1  0  0  0  0\n  6 12  2  0  0  0  0\n  2 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n  1 15  2  0  0  0  0\nM  END",
        "smiles": "C1C[C@@H](C(=O)NCCc2c[nH]cn2)NC1",
        "formula": "C10H16N4O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "208.2606",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "fc8e7420-76a4-4474-937c-bc62e125644d",
          "d7ba3fe3-eff5-4a77-8ec9-cb64b5299583"
        ],
        "stereo_centers": 1
      },
      "unii": "44U29L6P0T"
    }
  ]
}