{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5e9c6498-c20d-4478-8a13-10b989a35445", "code": "621-90-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=621-90-9", "code_system": "CAS", "references": [ "1aa97cd9-99e4-41cd-9e35-1ff0af86c0b4", "9375247e-0b02-44d2-99ad-50b197b13128" ] }, { "uuid": "6e076905-8d1a-491b-82f4-1a559d8fab2e", "code": "12137", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12137", "code_system": "PUBCHEM", "references": [ "1aa97cd9-99e4-41cd-9e35-1ff0af86c0b4" ] }, { "uuid": "3abfd316-14e8-482c-9904-7f7cbf37c21a", "code": "44N974BFDI", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "1210f57a-1284-4be9-4e22-773fe4dd4470", "code": "DTXSID201023342", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201023342", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "acbd37e4-b30e-4d08-90db-c61fcb8a431b", "name": "4-(METHYLAMINO)AZOBENZENE", "stdName": "4-(METHYLAMINO)AZOBENZENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dbdabe3f-118a-4444-a974-05c5d6a33425" ], "display_name": true }, { "uuid": "46c841a3-1d5f-4926-8add-8dd5871890cd", "name": "4-MONOMETHYLAMINOAZOBENZENE", "stdName": "4-MONOMETHYLAMINOAZOBENZENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ca357e19-3d52-46a5-9cca-3f8629ec41dd" ], "display_name": false }, { "uuid": "87200492-576d-45e6-922c-d89b15d25770", "name": "MONOMETHYLAMINOAZOBENZENE, 4-", "stdName": "MONOMETHYLAMINOAZOBENZENE, 4-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b5b43790-33d4-4a02-8d85-7f3a2bfc07da" ], "display_name": false }, { "uuid": "b9e0a3bc-31d0-4458-8417-a896c07af7fe", "name": "N-METHYL-4-AMINOAZOBENZENE", "stdName": "N-METHYL-4-AMINOAZOBENZENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ca357e19-3d52-46a5-9cca-3f8629ec41dd" ], "display_name": false } ], "references": [ { "uuid": "b5b43790-33d4-4a02-8d85-7f3a2bfc07da", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "dbdabe3f-118a-4444-a974-05c5d6a33425", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ca357e19-3d52-46a5-9cca-3f8629ec41dd", "citation": "https://chem.nlm.nih.gov/chemidplus/rn/621-90-9", "url": "https://chem.nlm.nih.gov/chemidplus/rn/621-90-9", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1aa97cd9-99e4-41cd-9e35-1ff0af86c0b4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390898000, "tags": [ "NOMEN" ] }, { "uuid": "d4acc8d5-732d-48e4-8632-79aaf1c2ae49", "citation": "SRS import [44N974BFDI]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=44N974BFDI", "doc_type": "SRS", "public_domain": true, "document_date": 1493390898000, "tags": [ "NOMEN" ] }, { "uuid": "66338e79-62f9-4889-8698-e7b51db6ca98", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9375247e-0b02-44d2-99ad-50b197b13128", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "538bafbe-13d7-45a1-b645-e0e9eaabec50", "id": "538bafbe-13d7-45a1-b645-e0e9eaabec50", "molfile": "\n Marvin 01132104212D \n\n 16 17 0 0 0 0 999 V2000\n 2.8563 -5.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2688 -4.7261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0937 -4.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5062 -4.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3312 -4.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7437 -4.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3312 -5.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5062 -5.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5687 -4.7261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9812 -5.4406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8062 -5.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2186 -6.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0437 -6.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4562 -5.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0437 -4.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2186 -4.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 8 3 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 9 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 16 2 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\nM END", "smiles": "CNc1ccc(cc1)/N=N/c2ccccc2", "formula": "C13H13N3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6b3687ab-480c-480b-83ff-700eb061da7d" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "211.2629", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c2358d7a-090b-429a-96ce-fac73971e226", "version": "4", "structure": { "id": "b9046e5e-41c8-4754-9ebc-6a513162d150", "molfile": "\n Marvin 01132109342D \n\n 16 17 0 0 0 0 999 V2000\n 5.7437 -4.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5687 -4.7261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9812 -5.4406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8062 -5.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2186 -6.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0437 -6.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4562 -5.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0437 -4.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2186 -4.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3312 -4.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5062 -4.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0937 -4.7261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2688 -4.7261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8563 -5.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5062 -5.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3312 -5.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 4 9 2 0 0 0 0\n 1 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 12 2 0 0 0 0\n 16 15 1 0 0 0 0\n 1 16 2 0 0 0 0\nM END", "smiles": "CNc1ccc(cc1)/N=N/c2ccccc2", "formula": "C13H13N3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "211.2629", "optical_activity": "NONE", "references": [ "66338e79-62f9-4889-8698-e7b51db6ca98", "d4acc8d5-732d-48e4-8632-79aaf1c2ae49" ], "stereo_centers": 0 }, "unii": "44N974BFDI" } ] }