{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "055408a8-11b3-459a-838e-720e3dca0428",
          "code": "8003-22-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=8003-22-3",
          "code_system": "CAS",
          "references": [
            "ea2be2dd-db9b-41d5-85fe-e9d1933320d9",
            "33b42375-0578-419a-8116-ca8b26a2a7de"
          ]
        },
        {
          "uuid": "05e4b75e-20b4-471f-9585-fcb215a7fa6d",
          "code": "C71670",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71670",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ea2be2dd-db9b-41d5-85fe-e9d1933320d9"
          ]
        },
        {
          "uuid": "fcace6f0-d4af-49c1-8e37-6f151a58b0c9",
          "code": "QUINOLINE YELLOW SS",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Quinoline_Yellow_SS",
          "code_system": "WIKIPEDIA",
          "references": [
            "ea2be2dd-db9b-41d5-85fe-e9d1933320d9"
          ]
        },
        {
          "uuid": "15189c61-6d88-4b53-b33d-6fdf4ef6ed6e",
          "code": "232-318-2",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ea2be2dd-db9b-41d5-85fe-e9d1933320d9"
          ]
        },
        {
          "uuid": "278a0a8f-7d88-4861-aff4-e512d9ed9c09",
          "code": "1305581",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1305581/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ea2be2dd-db9b-41d5-85fe-e9d1933320d9"
          ]
        },
        {
          "uuid": "4cf836de-815e-40c0-8e77-47cc6e34afd8",
          "code": "m9459",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9459?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ea2be2dd-db9b-41d5-85fe-e9d1933320d9"
          ]
        },
        {
          "uuid": "7523c9b2-8dd1-4f50-9611-9cf4cc69eeb0",
          "code": "6731",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6731",
          "code_system": "PUBCHEM",
          "references": [
            "ea2be2dd-db9b-41d5-85fe-e9d1933320d9"
          ]
        },
        {
          "uuid": "589f3435-665e-35dd-d871-35f0eaab222e",
          "code": "8052",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8052",
          "code_system": "HSDB",
          "references": [
            "c50d0373-edc5-b416-ff59-9734168a44dc"
          ]
        },
        {
          "uuid": "bdf19a29-87ce-ff14-f267-39ae587ba314",
          "code": "DTXSID7024906",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7024906",
          "code_system": "EPA CompTox",
          "references": [
            "a86448e7-1828-96c2-d8dd-3826030ce51e"
          ]
        },
        {
          "uuid": "7130e79a-d121-0783-9403-ca9e51a45843",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "12fc824f-fb17-b573-7dc5-48ec44fc2560"
          ]
        },
        {
          "uuid": "169733f4-f569-472d-a7a7-e25a14d01c1c",
          "code": "44F3HYL954",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "aa762a7a-740e-e7a8-6b49-36ef0dcf368a",
          "code": "53700",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:53700",
          "code_system": "CHEBI",
          "references": [
            "12fc824f-fb17-b573-7dc5-48ec44fc2560"
          ]
        },
        {
          "uuid": "2d3a6548-f80c-5055-9473-ef6aec64d389",
          "code": "44F3HYL954",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=44F3HYL954",
          "code_system": "DAILYMED",
          "references": [
            "3a063cab-8704-e20b-8c10-bf1c34c80c79"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f012c1c3-6939-469a-9cbc-1daa317653d3",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "67a655df-0519-4075-9144-94b2b645ef3b",
            "refuuid": "995a1c77-cc08-4d3a-8314-1e54ced3179a",
            "name": "D&C YELLOW NO. 11",
            "unii": "44F3HYL954",
            "linking_id": "44F3HYL954",
            "ref_pname": "D&C YELLOW NO. 11",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b9cc5af4-889a-4615-8060-9f0aa06f9d6a",
          "name": "C.I. 47000",
          "stdName": "C.I. 47000",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fed226c-04c5-4ca2-a5af-41f436d017c0"
          ],
          "display_name": false
        },
        {
          "uuid": "126a689a-3d7a-4720-82d9-175c85adf65b",
          "name": "CI 47000",
          "stdName": "CI 47000",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "0306f901-216b-4c72-916d-1d4598f8cf03",
            "0e6d388b-9aad-409c-8e9b-fc03b4290a3c",
            "c51d9005-afb1-4b20-b00f-069fe5e17f82"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ba237bf2-7220-49d5-8015-9f711aeb8130",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "bfd89341-bc46-4d23-9b32-a69ae242eac5",
          "name": "D&C YELLOW NO. 11",
          "stdName": "D&C YELLOW NO. 11",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c595f0b-db24-4e36-b1d4-32b56c7fc4d6"
          ],
          "display_name": true
        },
        {
          "uuid": "f0b14b24-471a-4768-a35a-5de7c2f9e817",
          "name": "DC YELLOW NO. 11",
          "stdName": "DC YELLOW NO. 11",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "768de2dd-ebd7-4116-9538-a8b0afdc450a"
          ],
          "display_name": false
        },
        {
          "uuid": "551ba0b6-ef93-464d-a06f-ea43b2c85802",
          "name": "KI204",
          "stdName": "KI204",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "21f2ea14-cd65-4b31-9369-f4eb87e79e13",
            "79a1bb78-eb5b-4f8a-b60d-428a6b31b141"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "53c99cb5-f9f0-4519-9d8b-1ae88d8c80c4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "3aa89617-1511-4848-a23a-c3475db0d477",
          "name": "QUINOLINE YELLOW SPIRIT SOLUBLE [MI]",
          "stdName": "QUINOLINE YELLOW SPIRIT SOLUBLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f4b360f-bc34-480c-b216-34d9d22186a3"
          ],
          "display_name": false
        },
        {
          "uuid": "e993cdf7-22ea-4035-a83f-2a7008ef3ed9",
          "name": "QUINOLINE YELLOW SS",
          "stdName": "QUINOLINE YELLOW SS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39b44e5f-5aac-40b0-abcb-f0048ca2908a"
          ],
          "display_name": false
        },
        {
          "uuid": "4d9fb590-1557-4b0f-92ea-d9eccbf3ee97",
          "name": "SOLVENT YELLOW 33",
          "stdName": "SOLVENT YELLOW 33",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "21f2ea14-cd65-4b31-9369-f4eb87e79e13",
            "b9c57216-8aa4-4c80-80a9-06ebb4333ef1"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "bd808c8d-1c33-424a-bb22-e3ab64ee37b2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b87ed61c-7e53-4a9a-a450-4c6a452ec261",
          "name": "YELLOW 11",
          "stdName": "YELLOW 11",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "0306f901-216b-4c72-916d-1d4598f8cf03",
            "0e6d388b-9aad-409c-8e9b-fc03b4290a3c",
            "1ad07d1f-6cff-4ee7-bacc-8b5ccb5e5273"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "2f59c2f4-d0dc-44b6-8f1e-1c7661d4e577",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "4c595f0b-db24-4e36-b1d4-32b56c7fc4d6",
          "citation": "21CFR 74.1711",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c8e84f2-7bd5-4f3b-aba8-fe52105d0573",
          "citation": "ACD8.0(21CFR 74.1711",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0306f901-216b-4c72-916d-1d4598f8cf03",
          "citation": "CTFA 2006",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "39b44e5f-5aac-40b0-abcb-f0048ca2908a",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f4b360f-bc34-480c-b216-34d9d22186a3",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e6d388b-9aad-409c-8e9b-fc03b4290a3c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "768de2dd-ebd7-4116-9538-a8b0afdc450a",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21f2ea14-cd65-4b31-9369-f4eb87e79e13",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fed226c-04c5-4ca2-a5af-41f436d017c0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea2be2dd-db9b-41d5-85fe-e9d1933320d9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b372d27a-5aeb-45dd-936f-a15ddbff8ced",
          "citation": "SRS import [44F3HYL954]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=44F3HYL954",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04036977-b445-492c-9ff4-88b295d1cc76",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ad07d1f-6cff-4ee7-bacc-8b5ccb5e5273",
          "citation": "YELLOW 11 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c51d9005-afb1-4b20-b00f-069fe5e17f82",
          "citation": "CI 47000 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "79a1bb78-eb5b-4f8a-b60d-428a6b31b141",
          "citation": "KI204 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b9c57216-8aa4-4c80-80a9-06ebb4333ef1",
          "citation": "SOLVENT YELLOW 33 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c50d0373-edc5-b416-ff59-9734168a44dc",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+8003-22-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a86448e7-1828-96c2-d8dd-3826030ce51e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=8003-22-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "12fc824f-fb17-b573-7dc5-48ec44fc2560",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3a063cab-8704-e20b-8c10-bf1c34c80c79",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "33b42375-0578-419a-8116-ca8b26a2a7de",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8538e405-33d9-46df-8e0d-3ec5083c1def",
          "id": "8538e405-33d9-46df-8e0d-3ec5083c1def",
          "molfile": "\n  Marvin  01132106552D          \n\n 21 24  0  0  0  0            999 V2000\n    4.6083   -5.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6125   -4.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9458   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6750   -3.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6708   -2.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6542   -3.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3662   -2.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0782   -3.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0782   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3662   -4.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6542   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1211   -3.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1246   -2.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4113   -2.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6990   -2.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9870   -2.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2750   -2.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2750   -3.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9870   -4.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6955   -3.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4043   -4.1591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  2 11  1  0  0  0  0\n  4  3  1  0  0  0  0\n 12  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 21 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  2  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)ccc(C3C(=O)c4ccccc4C3=O)n2",
          "formula": "C18H11NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b54e2f8c-57c1-4dce-9446-cac6dfe85a9d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "273.2861",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "995a1c77-cc08-4d3a-8314-1e54ced3179a",
      "version": "11",
      "structure": {
        "id": "2d682820-5c95-4a1b-8cbb-b5316dd07983",
        "molfile": "\n  Marvin  01132102272D          \n\n 21 24  0  0  0  0            999 V2000\n    5.6542   -3.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3662   -4.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0782   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0782   -3.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3662   -2.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2750   -2.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2750   -3.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9870   -4.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9870   -2.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6990   -2.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6955   -3.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4043   -4.1591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1211   -3.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1246   -2.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4113   -2.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9458   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6125   -4.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6083   -5.3583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6750   -3.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6708   -2.0292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6542   -4.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 10 11  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  1 21  2  0  0  0  0\n 10 15  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n  1  5  1  0  0  0  0\n 13 16  1  0  0  0  0\n 21  2  1  0  0  0  0\n 16 17  1  0  0  0  0\n  6  9  1  0  0  0  0\n 17 18  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8 11  2  0  0  0  0\n 19 20  2  0  0  0  0\n 19  1  1  0  0  0  0\n 10  9  2  0  0  0  0\n 17 21  1  0  0  0  0\n 19 16  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)ccc(C3C(=O)c4ccccc4C3=O)n2",
        "formula": "C18H11NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "273.2861",
        "optical_activity": "NONE",
        "references": [
          "04036977-b445-492c-9ff4-88b295d1cc76",
          "b372d27a-5aeb-45dd-936f-a15ddbff8ced"
        ],
        "stereo_centers": 0
      },
      "unii": "44F3HYL954"
    }
  ]
}