{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ec4ec7b2-a4f8-4976-a311-9dadd7db6da6",
          "code": "149579-07-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=149579-07-7",
          "code_system": "CAS",
          "references": [
            "5856dd28-1e0e-4ef2-bdde-e5627f9d40bc",
            "7c43fa58-e5ca-47b4-825f-fc75651d6559"
          ]
        },
        {
          "uuid": "cfea538b-c122-4190-8fe6-fec33e7bf29e",
          "code": "1376154",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1376154/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5856dd28-1e0e-4ef2-bdde-e5627f9d40bc"
          ]
        },
        {
          "uuid": "cf85238c-d0f9-4035-b620-f9bc9d7d13af",
          "code": "9906039",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9906039",
          "code_system": "PUBCHEM",
          "references": [
            "5856dd28-1e0e-4ef2-bdde-e5627f9d40bc"
          ]
        },
        {
          "uuid": "6fa53d4b-0a31-5225-2369-4d2ad35823cd",
          "code": "DTXSID30164341",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30164341",
          "code_system": "EPA CompTox",
          "references": [
            "535262cf-7c16-d149-a188-2efb278c09b4"
          ]
        },
        {
          "uuid": "e7c75bab-8bb2-457a-b30c-ea3b6b26b511",
          "code": "44D8X9U00T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1d70cefc-7131-8e3f-3dee-cd318ae7d3ad",
          "code": "44D8X9U00T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=44D8X9U00T",
          "code_system": "DAILYMED",
          "references": [
            "f9290e86-1d5f-df31-4c8e-04cf4a041b51"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ce810b94-540b-4230-9b1d-5d812265d86c",
          "name": "3,5-HEPTANEDIONE, 1-(4-HYDROXY-3-METHOXYPHENYL)-7-(4-HYDROXYPHENYL)-",
          "stdName": "3,5-HEPTANEDIONE, 1-(4-HYDROXY-3-METHOXYPHENYL)-7-(4-HYDROXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efc0741d-823b-4ef8-bbc7-2b703f2f59b8",
            "8c691f5c-208c-4a81-ab17-ee45f3139f0f"
          ],
          "display_name": false
        },
        {
          "uuid": "f7a30fcd-9c11-414e-97ef-626491b181a2",
          "name": "DEMETHOXYTETRAHYDROCURCUMIN",
          "stdName": "DEMETHOXYTETRAHYDROCURCUMIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efc0741d-823b-4ef8-bbc7-2b703f2f59b8",
            "8c691f5c-208c-4a81-ab17-ee45f3139f0f"
          ],
          "display_name": false
        },
        {
          "uuid": "c994bf6d-f1d2-4f97-94f6-83b39918db84",
          "name": "TETRAHYDRODEMETHOXYCURCUMIN",
          "stdName": "TETRAHYDRODEMETHOXYCURCUMIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6077a62-3d71-439d-b31e-06cdb6fe41c5",
            "efc0741d-823b-4ef8-bbc7-2b703f2f59b8"
          ],
          "display_name": false
        },
        {
          "uuid": "8efcfc5a-35f3-4d0e-b27d-33e55d84cdd2",
          "name": "TETRAHYDRODEMETHOXYDIFERULOYLMETHANE",
          "stdName": "TETRAHYDRODEMETHOXYDIFERULOYLMETHANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6077a62-3d71-439d-b31e-06cdb6fe41c5",
            "dec5ef54-e5fa-4d42-b364-f1cce7449316",
            "efc0741d-823b-4ef8-bbc7-2b703f2f59b8"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a23786e3-cc6a-44e0-b8ee-b3954aea4069",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "f6077a62-3d71-439d-b31e-06cdb6fe41c5",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "efc0741d-823b-4ef8-bbc7-2b703f2f59b8",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c691f5c-208c-4a81-ab17-ee45f3139f0f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5856dd28-1e0e-4ef2-bdde-e5627f9d40bc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391466000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f76fee30-fc6b-4e08-8721-579e9854f143",
          "citation": "SRS import [44D8X9U00T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=44D8X9U00T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391466000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dec5ef54-e5fa-4d42-b364-f1cce7449316",
          "citation": "TETRAHYDRODEMETHOXYDIFERULOYLMETHANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "535262cf-7c16-d149-a188-2efb278c09b4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=149579-07-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f9290e86-1d5f-df31-4c8e-04cf4a041b51",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7c43fa58-e5ca-47b4-825f-fc75651d6559",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0303f7da-6888-4c80-8012-d386b1ff0cc2",
          "id": "0303f7da-6888-4c80-8012-d386b1ff0cc2",
          "molfile": "\n  Marvin  01132100282D          \n\n 25 26  0  0  0  0            999 V2000\n   13.5379   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2945   -8.7095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9972   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6997   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4023   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1589   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8616   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5642   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5642   -7.8988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3208   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0235   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0235   -7.8988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.7260   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.4287   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1853   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1853   -9.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8879  -10.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5906   -9.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.2931  -10.3850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5906   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8879   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4023   -9.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6997  -10.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9972   -9.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2945  -10.3850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 24  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  5 22  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 21  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  2  0  0  0  0\n 21 20  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "COc1cc(CCC(=O)CC(=O)CCc2ccc(cc2)O)ccc1O",
          "formula": "C20H22O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d39b7411-47d3-46b3-ae71-e23a980f0a5f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "342.3864",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a6cb42cb-c7ef-4a84-adbe-3842c89159f6",
      "version": "6",
      "structure": {
        "id": "f91629d8-1583-45d2-8b16-fa9e63208d2a",
        "molfile": "\n  Marvin  01132112542D          \n\n 25 26  0  0  0  0            999 V2000\n   14.2945  -10.3850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4023   -9.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6997  -10.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9972   -9.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9972   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6997   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4023   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.2931  -10.3850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1853   -9.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8879  -10.3850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5906   -9.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5906   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.8879   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.1853   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0235   -7.8988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5642   -7.8988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.4287   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.7260   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0235   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3208   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5642   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8616   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1589   -8.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2945   -8.7095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5379   -9.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 23  7  1  0  0  0  0\n  4  1  1  0  0  0  0\n  7  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n 17 14  1  0  0  0  0\n 11  8  1  0  0  0  0\n 14  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 19 15  2  0  0  0  0\n 21 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 25  1  0  0  0  0\n  5 24  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(CCC(=O)CC(=O)CCc2ccc(cc2)O)ccc1O",
        "formula": "C20H22O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "342.3864",
        "optical_activity": "NONE",
        "references": [
          "f76fee30-fc6b-4e08-8721-579e9854f143",
          "8c691f5c-208c-4a81-ab17-ee45f3139f0f"
        ],
        "stereo_centers": 0
      },
      "unii": "44D8X9U00T"
    }
  ]
}