{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "977dde97-caee-4b71-a63d-55112856da67",
          "code": "997-55-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=997-55-7",
          "code_system": "CAS",
          "references": [
            "61af0737-3111-46df-83f7-01337c495adb",
            "c7f78ea1-a544-429f-aad6-2f94a6c91c53"
          ]
        },
        {
          "uuid": "d8fbe3f5-000c-45e8-bbf5-17b4766a51f4",
          "code": "C000179",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67000179",
          "code_system": "MESH",
          "references": [
            "61af0737-3111-46df-83f7-01337c495adb"
          ]
        },
        {
          "uuid": "58986621-f631-4169-bc7c-5bb039c3694c",
          "code": "N-ACETYLASPARTIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/N-Acetylaspartic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "61af0737-3111-46df-83f7-01337c495adb"
          ]
        },
        {
          "uuid": "1fc4bf3c-4959-4e9a-9fa9-ce243e2e3b20",
          "code": "m2100",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2100?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "61af0737-3111-46df-83f7-01337c495adb"
          ]
        },
        {
          "uuid": "7d0fd272-5edd-4b0b-a74a-7e0bb91f3bf1",
          "code": "SUB12714MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "61af0737-3111-46df-83f7-01337c495adb"
          ]
        },
        {
          "uuid": "3cccd40d-f38c-4cd0-b700-70bb54744256",
          "code": "65065",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65065",
          "code_system": "PUBCHEM",
          "references": [
            "61af0737-3111-46df-83f7-01337c495adb"
          ]
        },
        {
          "uuid": "809057e2-dd35-4c60-9e5e-8b0a7d077bc0",
          "code": "213-643-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.403",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "61af0737-3111-46df-83f7-01337c495adb"
          ]
        },
        {
          "uuid": "4b11bd0a-fff4-1ea5-e9f3-355fd401b30f",
          "code": "1872378",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1872378/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "e43c71d3-9621-c690-66cf-f972a5f3b8e8",
          "code": "C73539",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Amino Acid, Peptide, or Protein[C232]|Amino Acid Derivative",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C73539",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cfc446ef-dabd-dfcd-f76a-6addb9f7fce3"
          ]
        },
        {
          "uuid": "45df93f5-51a2-3814-aa92-db57e573aaf9",
          "code": "29631-9",
          "comments": "LOINC|DEPRECATED|CHEM|Urine|Deprecated N-acetylaspartate [Presence] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/29631-9/",
          "code_system": "LOINC",
          "references": [
            "cfc446ef-dabd-dfcd-f76a-6addb9f7fce3"
          ]
        },
        {
          "uuid": "55cc030f-dae0-de8b-a0e5-1ecb5afa189e",
          "code": "47710-9",
          "comments": "LOINC|DEPRECATED|CHEM|Urine|Deprecated N-acetylaspartate/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/47710-9/",
          "code_system": "LOINC",
          "references": [
            "cfc446ef-dabd-dfcd-f76a-6addb9f7fce3"
          ]
        },
        {
          "uuid": "075f5dd8-e2a7-6234-61be-d315304ed0c4",
          "code": "34610-6",
          "comments": "LOINC|DEPRECATED|CHEM|Urine|Deprecated N-acetylaspartate/Creatinine [Mass Ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/34610-6/",
          "code_system": "LOINC",
          "references": [
            "cfc446ef-dabd-dfcd-f76a-6addb9f7fce3"
          ]
        },
        {
          "uuid": "228d2dce-d7e2-6517-1021-4f0df8f38c30",
          "code": "C118887",
          "comments": "NCIT",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C118887",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7396bbaa-e110-2500-54f2-7e46893cbcda"
          ]
        },
        {
          "uuid": "fd5d0759-4b3c-40cb-aa47-3b2428e9e8a0",
          "code": "445Y04YIWR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1937660a-665d-19fd-e0e3-2596f3fbba7f",
          "code": "21547",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:21547",
          "code_system": "CHEBI",
          "references": [
            "cfc446ef-dabd-dfcd-f76a-6addb9f7fce3"
          ]
        },
        {
          "uuid": "06a8f1c3-271e-ebb4-cf90-074356552ba9",
          "code": "128610",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=128610",
          "code_system": "NSC",
          "references": [
            "658d70da-5007-5869-67c8-0742c450e671"
          ]
        },
        {
          "uuid": "de440847-8605-8aa8-b81e-6d3cb1fce168",
          "code": "100000077929",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "884916dd-573e-d60a-d79a-d8dfcfa4e659"
          ]
        },
        {
          "uuid": "00f5da00-7bd4-74ab-37ea-170c7136426a",
          "code": "DTXSID40897219",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40897219",
          "code_system": "EPA CompTox",
          "references": [
            "cfc446ef-dabd-dfcd-f76a-6addb9f7fce3"
          ]
        },
        {
          "uuid": "bd4f2e12-563b-aa68-0c55-5945559376ed",
          "code": "445Y04YIWR",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=445Y04YIWR",
          "code_system": "DAILYMED",
          "references": [
            "f39cb574-b800-b388-43c3-2e7ec682d22c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ca36d5fb-55ef-432f-a4b5-ee6ca1941830",
          "amount": {
            "uuid": "6843c246-421e-434e-b0ea-a9cf2d2d6017"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "96ebd492-ee83-43f3-bf32-6fae271ec65e",
            "refuuid": "c2c3f369-33d1-4f59-9d9e-19ce88244fb3",
            "name": "DIPOTASSIUM N-ACETYLASPARTATE",
            "unii": "ZSN99LF747",
            "linking_id": "ZSN99LF747",
            "ref_pname": "DIPOTASSIUM N-ACETYLASPARTATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3e3be99c-12af-497c-9813-f08385d0a8eb",
          "name": "ACETYL ASPARTIC ACID",
          "stdName": "ACETYL ASPARTIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9339ca97-7dc4-4f8f-bea1-eff06c3cde12",
            "2303d120-cf1b-4862-896c-5b8a15d93e32",
            "7e20ebed-0f23-4567-921e-89aed695cac8",
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
            "86984214-c8f0-45bd-af30-d0eec3b18d80",
            "8f9d28d3-389c-41e9-90cf-03ac38d3eeb2"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "789ac62c-9de0-4c26-8411-0a5d296ddd02",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "68245f43-f553-4c8b-8a6a-85c881057ad0",
          "name": "ACETYL-L-ASPARTIC ACID",
          "stdName": "ACETYL-L-ASPARTIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
            "51600926-a401-40e2-82ab-0231f0319666"
          ],
          "display_name": false
        },
        {
          "uuid": "640a61af-c0aa-4a5c-b3b9-a7e164aa2912",
          "name": "ACETYLASPARTIC ACID",
          "stdName": "ACETYLASPARTIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
            "51600926-a401-40e2-82ab-0231f0319666"
          ],
          "display_name": false
        },
        {
          "uuid": "1aa5a0fc-9c52-4503-8381-d481105c33c5",
          "name": "ASPARTIC ACID, N-ACETYL-, L-",
          "stdName": "ASPARTIC ACID, N-ACETYL-, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
            "51600926-a401-40e2-82ab-0231f0319666"
          ],
          "display_name": false
        },
        {
          "uuid": "dcb78f79-45bb-a4a7-ce8e-dae269f6b4de",
          "name": "Acetyl aspartic acid [WHO-DD]",
          "stdName": "ACETYL ASPARTIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa7953ae-8afa-af9c-006e-cf5cf60d6da2"
          ],
          "display_name": false
        },
        {
          "uuid": "dc98358d-c245-4cb9-86f3-8b74c81fc3a4",
          "name": "L-ASPARTIC ACID, N-ACETYL-",
          "stdName": "L-ASPARTIC ACID, N-ACETYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
            "51600926-a401-40e2-82ab-0231f0319666"
          ],
          "display_name": false
        },
        {
          "uuid": "1160139b-2bae-459c-8eee-b925a469fb05",
          "name": "L-N-ACETYLASPARTIC ACID",
          "stdName": "L-N-ACETYLASPARTIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
            "51600926-a401-40e2-82ab-0231f0319666"
          ],
          "display_name": false
        },
        {
          "uuid": "8abcde4e-3cc4-435b-adad-d5f4e0cfbf6f",
          "name": "N-ACETYL-L-ASPARTIC ACID",
          "stdName": "N-ACETYL-L-ASPARTIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a9e6aef-f192-4053-b871-bf9cc891acb0",
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
            "46c1243c-efbb-458f-a784-830597e91c5f",
            "3bb0058c-d587-4f77-a13d-e671cf901bee"
          ],
          "display_name": false
        },
        {
          "uuid": "42690ee8-b5f7-4fda-8261-04b01c7b0b98",
          "name": "N-ACETYL-L-ASPARTIC ACID [MI]",
          "stdName": "N-ACETYL-L-ASPARTIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a9e6aef-f192-4053-b871-bf9cc891acb0",
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a"
          ],
          "display_name": false
        },
        {
          "uuid": "f28d8fb9-356a-435c-9775-ff60cdbb55c9",
          "name": "N-ACETYL-S-ASPARTIC ACID",
          "stdName": "N-ACETYL-S-ASPARTIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
            "51600926-a401-40e2-82ab-0231f0319666"
          ],
          "display_name": false
        },
        {
          "uuid": "6d4ecd19-6e49-4a3a-aabc-68d46a5a264b",
          "name": "N-ACETYLASPARTATE",
          "stdName": "N-ACETYLASPARTATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
            "7bea2317-c365-4e34-b9bb-71f87ce6be8b"
          ],
          "display_name": false
        },
        {
          "uuid": "3fceb13d-02ab-470e-872b-3a3e14a80f69",
          "name": "N-ACETYLASPARTIC ACID",
          "stdName": "N-ACETYLASPARTIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
            "51600926-a401-40e2-82ab-0231f0319666"
          ],
          "display_name": false
        },
        {
          "uuid": "a7f7c4d6-914c-4336-ab08-a12471918fb5",
          "name": "NSC-128610",
          "stdName": "NSC-128610",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
            "7e74bff3-4ea8-4536-946e-d8d710a45c77"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3bb0058c-d587-4f77-a13d-e671cf901bee",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8f9d28d3-389c-41e9-90cf-03ac38d3eeb2",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7b7188e-bcc6-432c-bcf7-0bde52bd599a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51600926-a401-40e2-82ab-0231f0319666",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e74bff3-4ea8-4536-946e-d8d710a45c77",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e20ebed-0f23-4567-921e-89aed695cac8",
          "citation": "who-dd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2303d120-cf1b-4862-896c-5b8a15d93e32",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a9e6aef-f192-4053-b871-bf9cc891acb0",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7bea2317-c365-4e34-b9bb-71f87ce6be8b",
          "citation": "http://www.uniprot.org/uniprot/Q8N9F0",
          "url": "http://www.uniprot.org/uniprot/Q8N9F0",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61af0737-3111-46df-83f7-01337c495adb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391026000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "423f4683-8666-48d6-9b18-c899a977e731",
          "citation": "SRS import [445Y04YIWR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=445Y04YIWR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391026000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9af7f6a-a7b7-4b82-bfee-70cc84ade854",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86984214-c8f0-45bd-af30-d0eec3b18d80",
          "citation": "ACETYL ASPARTIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9339ca97-7dc4-4f8f-bea1-eff06c3cde12",
          "citation": "ACETYL ASPARTIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "46c1243c-efbb-458f-a784-830597e91c5f",
          "citation": "N-ACETYL-L-ASPARTIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "884916dd-573e-d60a-d79a-d8dfcfa4e659",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "cfc446ef-dabd-dfcd-f76a-6addb9f7fce3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c7f78ea1-a544-429f-aad6-2f94a6c91c53",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7396bbaa-e110-2500-54f2-7e46893cbcda",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "f39cb574-b800-b388-43c3-2e7ec682d22c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "658d70da-5007-5869-67c8-0742c450e671",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "fa7953ae-8afa-af9c-006e-cf5cf60d6da2",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a9b966ce-e83d-404e-800b-a672c3939678",
          "citation": "https://www.uniprot.org/uniprotkb/Q8WWT9/entry",
          "url": "https://www.uniprot.org/uniprotkb/Q8WWT9/entry",
          "doc_type": "UNIPROT",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d272399a-f983-42bc-b905-6732672b3e18",
          "id": "d272399a-f983-42bc-b905-6732672b3e18",
          "molfile": "\n  Marvin  01132110532D          \n\n 12 11  0  0  1  0            999 V2000\n    7.1689   -4.8046    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.4523   -4.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7402   -4.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0236   -4.4003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7402   -5.6361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1689   -5.6361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8862   -6.0478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6041   -5.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8862   -6.8747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8810   -4.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8810   -3.5643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5977   -4.8046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  6  1  1  0  0  0\n  1 10  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H](CC(=O)O)C(=O)O",
          "formula": "C6H9NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "69b8b115-af0a-44d9-a019-3862b92f3e5a"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "175.1396",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e6205345-3c8f-418d-bb77-bd1e83e0ba4a",
      "version": "20",
      "structure": {
        "id": "2564317a-06f3-4a5c-a095-3a0e3a690940",
        "molfile": "\n  Marvin  01132102042D          \n\n 12 11  0  0  1  0            999 V2000\n    5.0236   -4.4003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7402   -4.8093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7402   -5.6361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4523   -4.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1689   -4.8046    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1689   -5.6361    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8862   -6.0478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8862   -6.8747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6041   -5.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8810   -4.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8810   -3.5643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5977   -4.8046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H](CC(=O)O)C(=O)O",
        "formula": "C6H9NO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "175.1396",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "423f4683-8666-48d6-9b18-c899a977e731",
          "b9af7f6a-a7b7-4b82-bfee-70cc84ade854"
        ],
        "stereo_centers": 1
      },
      "unii": "445Y04YIWR"
    }
  ]
}