{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1eee9928-9d45-4dde-97c8-84e3ef4de72f",
          "code": "7757-85-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7757-85-9",
          "code_system": "CAS",
          "references": [
            "5c4c7034-c171-495b-a992-4b64e2329063",
            "a8cff225-8ac5-440f-8c20-c413bfab9366"
          ]
        },
        {
          "uuid": "7a3294fa-83a2-4139-98c1-165d012eb765",
          "code": "76970195",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76970195",
          "code_system": "PUBCHEM",
          "references": [
            "5c4c7034-c171-495b-a992-4b64e2329063"
          ]
        },
        {
          "uuid": "8e6b3727-1531-c030-dac2-b907388e9f1a",
          "code": "DTXSID20228244",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20228244",
          "code_system": "EPA CompTox",
          "references": [
            "879f0787-2173-2ddb-626c-d691e04d2c2b"
          ]
        },
        {
          "uuid": "8675e043-48c1-47b8-8ddf-aeb3c7e0fcfc",
          "code": "444I70G3UE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "9a67d5c2-f222-4d17-8337-1554f5f5b761",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "fda3cbca-3f07-4f10-a17b-564d08f9e393",
            "refuuid": "6acf30b2-7157-4866-8ce3-135d1ed80748",
            "name": "CYCLAMIC ACID",
            "unii": "HN3OFO5036",
            "linking_id": "HN3OFO5036",
            "ref_pname": "CYCLAMIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1963c18e-fdd3-446f-8dcc-a90cfc23772b",
          "name": "MAGNESIUM CYCLAMATE",
          "stdName": "MAGNESIUM CYCLAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f5763c9-9753-451c-87e3-563bf83a02ba",
            "2be159bf-7909-4ad2-a7ad-daeb871cbefb"
          ],
          "display_name": true
        },
        {
          "uuid": "7bded530-f21b-4e77-998e-a977ceb3c39b",
          "name": "MAGNESIUM CYCLOHEXYLSULFAMATE",
          "stdName": "MAGNESIUM CYCLOHEXYLSULFAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2711923-073e-4804-976c-c815c1d193b1",
            "2be159bf-7909-4ad2-a7ad-daeb871cbefb"
          ],
          "display_name": false
        },
        {
          "uuid": "63f5880f-1d7e-42a6-83f6-7abd02fa35ab",
          "name": "SULFAMIC ACID, N-CYCLOHEXYL-, MAGNESIUM SALT (2:1)",
          "stdName": "SULFAMIC ACID, N-CYCLOHEXYL-, MAGNESIUM SALT (2:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b2711923-073e-4804-976c-c815c1d193b1",
            "2be159bf-7909-4ad2-a7ad-daeb871cbefb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2f5763c9-9753-451c-87e3-563bf83a02ba",
          "citation": "21 CFR 189",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2be159bf-7909-4ad2-a7ad-daeb871cbefb",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2711923-073e-4804-976c-c815c1d193b1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c4c7034-c171-495b-a992-4b64e2329063",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389730000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62a716aa-1501-4894-bac2-23bcc55cf4b9",
          "citation": "SRS import [444I70G3UE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=444I70G3UE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389730000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "879f0787-2173-2ddb-626c-d691e04d2c2b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7757-85-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a8cff225-8ac5-440f-8c20-c413bfab9366",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0ff41988-cfa1-447b-83fd-b3621abcc381",
          "id": "0ff41988-cfa1-447b-83fd-b3621abcc381",
          "molfile": "\n  Marvin  01132101032D          \n\n  1  0  0  0  0  0            999 V2000\n    1.9715   -8.2933    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Mg+2]",
          "formula": "Mg",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5140284a-1b15-45fd-b5d7-261f7f0e6e5a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "24.3051",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "aee56e93-92a0-4a5d-8b8c-ae05f3a484dd",
          "id": "aee56e93-92a0-4a5d-8b8c-ae05f3a484dd",
          "molfile": "\n  Marvin  01132109042D          \n\n 11 11  0  0  0  0            999 V2000\n    4.8812   -7.4530    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.7007   -7.4530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5155   -7.3188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6220   -6.6614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9413   -8.2678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7331   -8.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3071   -7.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1266   -8.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3442   -8.8790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7470   -9.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9554   -9.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 11  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "C1CCC(CC1)NS(=O)(=O)[O-]",
          "formula": "C6H12NO3S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "d87e0dfa-a978-4b37-bd10-bed63da30c3a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "178.2307",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "28e90ca4-4e3b-43dc-ac0d-b7aa45f67e7c",
      "version": "3",
      "structure": {
        "id": "c32a5b88-d200-41a4-a901-72f645dee105",
        "molfile": "\n  Marvin  01132110052D          \n\n 23 22  0  0  0  0            999 V2000\n    1.9715   -8.2933    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\n    5.7007   -7.4530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9413   -8.2678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7331   -8.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3071   -7.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1266   -8.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3442   -8.8790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7470   -9.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9554   -9.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5155   -7.3188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6220   -6.6614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8812   -7.4530    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.7007   -7.4530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9413   -8.2678    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7331   -8.4623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3071   -7.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1266   -8.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3442   -8.8790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7470   -9.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9554   -9.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5155   -7.3188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6220   -6.6614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8812   -7.4530    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  2  2  0  0  0  0\n 11  2  2  0  0  0  0\n 12  2  1  0  0  0  0\n 14 13  1  0  0  0  0\n 21 13  2  0  0  0  0\n 22 13  2  0  0  0  0\n 23 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  CHG  3   1   2  12  -1  23  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1  7  17  18  19  20  21  22  23\nM  SPA   1 11   2   3   4   5   6   7   8   9  10  11  12\nM  SDI   1  4    4.4612   -9.8962    4.4612   -6.2414\nM  SDI   1  4    8.7642   -6.2414    8.7642   -9.8962\nM  SMT   1 2\nM  END",
        "smiles": "C1CCC(CC1)NS(=O)(=O)[O-].C1CCC(CC1)NS(=O)(=O)[O-].[Mg+2]",
        "formula": "2C6H12NO3S.Mg",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "380.7665",
        "optical_activity": "NONE",
        "references": [
          "b2711923-073e-4804-976c-c815c1d193b1",
          "62a716aa-1501-4894-bac2-23bcc55cf4b9"
        ],
        "stereo_centers": 0
      },
      "unii": "444I70G3UE"
    }
  ]
}