{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "304f8c13-149b-4f77-969a-cc11cc17f77c",
          "code": "J01CF05",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIBACTERIALS FOR SYSTEMIC USE|BETA-LACTAM ANTIBACTERIALS, PENICILLINS|Beta-lactamase resistant penicillins|flucloxacillin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J01CF05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "73270bdc-d375-4ede-96e5-e6bf1ac78f2c",
          "code": "QJ01CF05",
          "comments": "VATC|ANTIBACTERIALS FOR SYSTEMIC USE|BETA-LACTAM ANTIBACTERIALS, PENICILLINS|Beta-lactamase resistant penicillins|flucloxacillin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ01CF05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "2127a254-dd53-4572-bfa5-f3c4fd96cd43",
          "code": "QJ51CF05",
          "comments": "VATC|ANTIBACTERIALS FOR INTRAMAMMARY USE|BETA-LACTAM ANTIBACTERIALS, PENICILLINS, FOR INTRAMAMMARY USE|Beta-lactamase resistant penicillins|flucloxacillin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ51CF05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "54524186-7429-40e9-864b-215d546e088a",
          "code": "5250-39-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5250-39-5",
          "code_system": "CAS",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8",
            "b5b1045e-3b11-4814-b4b4-271b76c6d6d5"
          ]
        },
        {
          "uuid": "b72d445d-5f2c-424b-9d5f-3b184f5a0607",
          "code": "C80591",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80591",
          "code_system": "NCI_THESAURUS",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "ad8e19ca-b6ea-4880-92c7-aec66fadcf34",
          "code": "D005436",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005436",
          "code_system": "MESH",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "a4957b8b-b170-4f9e-a8e5-511ae8a4dcd9",
          "code": "419",
          "comments": "LiverTox|Antimicrobial|Antibacterial|Fluoroquinolone",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Flucoxacillin.htm",
          "code_system": "LIVERTOX",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "d2bdaca7-6db0-4bc4-98ad-56005d328612",
          "code": "FLUCLOXACILLIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Flucloxacillin",
          "code_system": "WIKIPEDIA",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "ee3961a3-0d27-4b3b-90ef-093ae844c881",
          "code": "SUB07673MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "89e41deb-dd7d-4079-9e72-1240f7f94a21",
          "code": "2308",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2308",
          "code_system": "INN",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "afaace10-a3c0-41d9-b994-af9a8e7e27dc",
          "code": "226-051-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.683",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "260b1167-3c6d-4e11-9823-b5cff1504463",
          "code": "4448",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/4448/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "a8d62d49-ca4a-4233-9b00-9ae4d6e1975b",
          "code": "m5413",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5413?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "d410eab8-57e8-4ee7-9ec4-c4000e1e3f11",
          "code": "DB00301",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00301",
          "code_system": "DRUG BANK",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "78b4f82b-6d39-4826-9bb6-78455e365215",
          "code": "CHEMBL222645",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL222645",
          "code_system": "ChEMBL",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "1775d252-e85f-4e1a-bbfb-05e75326cfcf",
          "code": "21319",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21319",
          "code_system": "PUBCHEM",
          "references": [
            "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8"
          ]
        },
        {
          "uuid": "5647f34f-a49c-7612-6a09-ba1473b83615",
          "code": "DTXSID8023056",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8023056",
          "code_system": "EPA CompTox",
          "references": [
            "1fff64b5-fb01-a4bb-5dcd-017795fe1d7f"
          ]
        },
        {
          "uuid": "86f647d8-b102-4ec6-4535-61c1b205a4b1",
          "code": "C1500",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibiotic[C258]|Beta-Lactam Antibiotic[C260]|Penicillin Antibiotic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1500",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d62e309c-0b41-bfd9-95b9-e4125b4ad38e"
          ]
        },
        {
          "uuid": "0aae79e5-e3de-4a2e-95d8-9a278d8afca6",
          "code": "43B2M34G2V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7daf7541-c6e9-3e41-9d63-e4e6828ef85f",
          "code": "Floxacillin",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM1083/",
          "code_system": "LACTMED",
          "references": [
            "d62e309c-0b41-bfd9-95b9-e4125b4ad38e"
          ]
        },
        {
          "uuid": "21de6537-81cb-c0d0-797f-81451cb25abf",
          "code": "1183",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1183",
          "code_system": "DRUG CENTRAL",
          "references": [
            "d62e309c-0b41-bfd9-95b9-e4125b4ad38e"
          ]
        },
        {
          "uuid": "d6281e1e-c036-f6fa-08f8-2bc38a444e2b",
          "code": "5098",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:5098",
          "code_system": "CHEBI",
          "references": [
            "d62e309c-0b41-bfd9-95b9-e4125b4ad38e"
          ]
        },
        {
          "uuid": "d95f04a7-99ee-4283-b111-78cf1769b865",
          "code": "100000092666",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "13209e46-aa35-8132-a2b3-58804cff86d4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ead8fb97-b8a1-473e-bdcc-2095116acc5b",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a9aa7d5d-3c62-4226-a93e-03ba79a0e5ca",
            "refuuid": "7943566b-276c-4aaa-af6a-eb55e05c7582",
            "name": "FLUCLOXACILLIN",
            "unii": "43B2M34G2V",
            "linking_id": "43B2M34G2V",
            "ref_pname": "FLUCLOXACILLIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "732efa3b-9491-4ca3-926d-c5880faa27a7",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "6333e67b-a7b1-4636-9bb9-d8f86df7a31a",
            "refuuid": "a5dc17ec-19fe-4207-8829-230210326066",
            "name": "FLUCLOXACILLIN MAGNESIUM ANHYDROUS",
            "unii": "1L80I8UP9C",
            "linking_id": "1L80I8UP9C",
            "ref_pname": "FLUCLOXACILLIN MAGNESIUM ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d8d45e77-74e0-4466-adc2-5eca216f4be6",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "66bdea4e-b4ba-4785-ba5d-2047842df836",
            "refuuid": "970fa3dc-06c6-4dd4-bc65-a5943a2e9fa3",
            "name": "FLUCLOXACILLIN MAGNESIUM OCTAHYDRATE",
            "unii": "4Z8782KMVT",
            "linking_id": "4Z8782KMVT",
            "ref_pname": "FLUCLOXACILLIN MAGNESIUM OCTAHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c2bf5b86-4d9a-408f-ad63-850788eaf9f1",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "762fde74-cda6-440a-b358-230ee606848e",
            "refuuid": "a713eae9-d14a-4d05-81bc-e155b5013df7",
            "name": "FLUCLOXACILLIN SODIUM ANHYDROUS",
            "unii": "05F65O42VK",
            "linking_id": "05F65O42VK",
            "ref_pname": "FLUCLOXACILLIN SODIUM ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7aac6387-a173-43b1-9aae-9e1f15fcbb0f",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "9aa092d3-a5b9-45b3-89a7-f00f5bd11f5b",
            "refuuid": "9fb384b5-b8f8-4b70-a160-c9d856a7a013",
            "name": "FLUCLOXACILLIN SODIUM MONOHYDRATE",
            "unii": "LMG7C674WJ",
            "linking_id": "LMG7C674WJ",
            "ref_pname": "FLUCLOXACILLIN SODIUM MONOHYDRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c47c2fa1-98a1-44d9-84a9-5cbc769e67dd",
          "name": "3-(2-CHLORO-6-FLUOROPHENYL)-5-METHYL-4-ISOXAZOLYLPENICILLIN",
          "stdName": "3-(2-CHLORO-6-FLUOROPHENYL)-5-METHYL-4-ISOXAZOLYLPENICILLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cf6a909-9984-4441-9e83-86d41ab8fa1c"
          ],
          "display_name": false
        },
        {
          "uuid": "396da9c3-83e4-40d5-a57a-99d33b5d3462",
          "name": "4-THIA-1-AZABICYCLO(3.2.0)HEPTANE-2-CARBOXYLIC ACID, 6-(((3-(2-CHLORO-6-FLUOROPHENYL)-5-METHYL-4-ISOXAZOLYL)CARBONYL)AMINO)-3,3-DIMETHYL-7-OXO-, (2S(2.ALPHA.,5.ALPHA.,6.BETA.))",
          "stdName": "4-THIA-1-AZABICYCLO(3.2.0)HEPTANE-2-CARBOXYLIC ACID, 6-(((3-(2-CHLORO-6-FLUOROPHENYL)-5-METHYL-4-ISOXAZOLYL)CARBONYL)AMINO)-3,3-DIMETHYL-7-OXO-, (2S(2.ALPHA.,5.ALPHA.,6.BETA.))",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cf6a909-9984-4441-9e83-86d41ab8fa1c"
          ],
          "display_name": false
        },
        {
          "uuid": "7e110097-a82b-4075-87b4-f7746fd62885",
          "name": "6-[3-(2-Chloro-6-fluorophenyl)-5-methyl-4-isoxazolecarboxamido]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid",
          "stdName": "6-(3-(2-CHLORO-6-FLUOROPHENYL)-5-METHYL-4-ISOXAZOLECARBOXAMIDO)-3,3-DIMETHYL-7-OXO-4-THIA-1-AZABICYCLO(3.2.0)HEPTANE-2-CARBOXYLIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cf6a909-9984-4441-9e83-86d41ab8fa1c"
          ],
          "display_name": false
        },
        {
          "uuid": "19e66fe3-d528-4168-9592-31c68c0a0068",
          "name": "BRL 2039",
          "stdName": "BRL 2039",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cf6a909-9984-4441-9e83-86d41ab8fa1c"
          ],
          "display_name": false
        },
        {
          "uuid": "4e238327-868f-4d64-ae26-66401730062d",
          "name": "BRL-2039",
          "stdName": "BRL-2039",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "887eaf7a-7c51-41a8-b06b-c78078e672a0"
          ],
          "display_name": false
        },
        {
          "uuid": "5dfd141c-9ef2-41c9-830a-846fde733335",
          "name": "FLOXACILLIN",
          "stdName": "FLOXACILLIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3cf6a909-9984-4441-9e83-86d41ab8fa1c",
            "371ea097-9927-488c-bc25-92830ed73aa7",
            "bad90f4f-bc46-4276-87cb-c2736eff6d40",
            "721d18bc-a462-46c6-899d-45b6e6ce53fb",
            "18f2e34e-cb09-4e8f-9128-9a008ed61373"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "3616897b-2e88-4d98-9498-41395ddc2877",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "6958d6a8-ba88-407c-8b8b-472a123e53e0",
          "name": "FLOXACILLIN [MI]",
          "stdName": "FLOXACILLIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "371ea097-9927-488c-bc25-92830ed73aa7"
          ],
          "display_name": false
        },
        {
          "uuid": "40e03f57-f975-4b52-92ca-e986ac0083ec",
          "name": "FLOXACILLIN [USAN]",
          "stdName": "FLOXACILLIN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "721d18bc-a462-46c6-899d-45b6e6ce53fb"
          ],
          "display_name": false
        },
        {
          "uuid": "4062c044-5f6c-4eb8-8e16-5a28e37a3ad2",
          "name": "FLUCLOXACILLIN",
          "stdName": "FLUCLOXACILLIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9dd7d9d4-5f02-44db-9b5f-575baed27973",
            "ee47890b-6bac-4097-9c2e-9413c616760a",
            "8e676241-0298-48be-aa55-950f10b3fdac",
            "feac563e-4657-4fc4-820a-9e7506694c16",
            "e603bce3-dc7a-4b7b-9022-692718ae5e22",
            "3a32a017-a46e-4962-94cf-33e1cca53533",
            "fa77ad4c-1174-4a68-be9d-530a90317100",
            "ac364f89-17ce-4450-afaf-33aab88ed962"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "33cd8c16-6809-472e-832a-8238dc44901e",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "c087e2be-9efb-45aa-a700-cfbd433cb3f3",
          "name": "FLUCLOXACILLIN [MART.]",
          "stdName": "FLUCLOXACILLIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac364f89-17ce-4450-afaf-33aab88ed962"
          ],
          "display_name": false
        },
        {
          "uuid": "cba59ebb-d7b1-578f-8900-13e46cc04f4c",
          "name": "Flucloxacillin [WHO-DD]",
          "stdName": "FLUCLOXACILLIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b21216c9-73e1-3d24-4e10-2066e63d7c81"
          ],
          "display_name": false
        },
        {
          "uuid": "549722f7-ed2f-4482-b562-3ecf13a8791f",
          "name": "flucloxacillin [INN]",
          "stdName": "FLUCLOXACILLIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9dd7d9d4-5f02-44db-9b5f-575baed27973",
            "24dce18b-82f2-4319-98b2-63e484e13c8c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3cf6a909-9984-4441-9e83-86d41ab8fa1c",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fa77ad4c-1174-4a68-be9d-530a90317100",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "feac563e-4657-4fc4-820a-9e7506694c16",
          "citation": "USAN INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dd7d9d4-5f02-44db-9b5f-575baed27973",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "721d18bc-a462-46c6-899d-45b6e6ce53fb",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac364f89-17ce-4450-afaf-33aab88ed962",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "371ea097-9927-488c-bc25-92830ed73aa7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee47890b-6bac-4097-9c2e-9413c616760a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "887eaf7a-7c51-41a8-b06b-c78078e672a0",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02c85f7a-0bb8-4a2d-9328-049c99f7b2a8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389678000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28c7689c-5588-46ee-b4fe-086ea4f40e1c",
          "citation": "SRS import [43B2M34G2V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=43B2M34G2V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389678000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e603bce3-dc7a-4b7b-9022-692718ae5e22",
          "citation": "FLUCLOXACILLIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "18f2e34e-cb09-4e8f-9128-9a008ed61373",
          "citation": "FLOXACILLIN [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3a32a017-a46e-4962-94cf-33e1cca53533",
          "citation": "FLUCLOXACILLIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bad90f4f-bc46-4276-87cb-c2736eff6d40",
          "citation": "FLOXACILLIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8e676241-0298-48be-aa55-950f10b3fdac",
          "citation": "FLUCLOXACILLIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1fff64b5-fb01-a4bb-5dcd-017795fe1d7f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5250-39-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6ceb8d0b-0d93-2230-93bc-198ec385359a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+5250-39-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "13209e46-aa35-8132-a2b3-58804cff86d4",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d62e309c-0b41-bfd9-95b9-e4125b4ad38e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b5b1045e-3b11-4814-b4b4-271b76c6d6d5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "24dce18b-82f2-4319-98b2-63e484e13c8c",
          "citation": "INN Proposed List 17",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL17.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "31571b4c-1fa4-f284-a727-6a4575af7e06",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b21216c9-73e1-3d24-4e10-2066e63d7c81",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4354500b-913d-4d29-819b-795a604a82a4",
          "id": "4354500b-913d-4d29-819b-795a604a82a4",
          "molfile": "\n  Marvin  01132103332D          \n\n 30 33  0  0  1  0            999 V2000\n    5.1279   -3.2471    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.9103   -2.9912    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4033   -3.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1098   -3.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1098   -4.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9197   -4.3282    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.1279   -4.0769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3029   -4.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7150   -4.6648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3029   -3.2471    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.4684   -3.2471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7572   -2.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7572   -2.0096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0366   -3.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7852   -4.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1930   -4.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9554   -4.0342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6995   -3.2471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3348   -2.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3348   -1.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0460   -0.8717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7572   -1.2842    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0460   -0.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3348    0.3705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6188   -0.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6188   -0.8764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0971   -1.2842    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.9197   -5.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1943   -5.5656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6215   -5.5704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  7  1  0  0  0  0\n 10  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  3  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 28  1  6  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  2  0  0  0  0\n 19 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 26 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  2  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 28  2  0  0  0  0\nM  END",
          "smiles": "Cc1c(c(-c2c(cccc2F)Cl)no1)C(=O)N[C@@H]3C(=O)N4[C@@H](C(=O)O)C(C)(C)S[C@H]34",
          "formula": "C19H17ClFN3O5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b2696de6-ad62-49bb-9c6e-4123bb8b04b8"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "453.8735",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7943566b-276c-4aaa-af6a-eb55e05c7582",
      "version": "21",
      "structure": {
        "id": "0920d45f-e087-411d-a5fc-080fb4f46f88",
        "molfile": "\n  Marvin  01132100442D          \n\n 31 34  0  0  1  0            999 V2000\n    5.1279   -4.0769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1279   -3.2471    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3029   -3.2471    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.4684   -3.2471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7572   -2.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0366   -3.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3348   -2.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6995   -3.2471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9554   -4.0342    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7852   -4.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1930   -4.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3348   -1.2842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0460   -0.8717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7572   -1.2842    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0460   -0.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3348    0.3705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6188   -0.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6188   -0.8764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0971   -1.2842    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.7572   -2.0096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3029   -4.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7150   -4.6648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9103   -2.9912    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4033   -3.6596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9197   -4.3282    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.9197   -5.1579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1943   -5.5656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6215   -5.5704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1098   -3.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1098   -4.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1279   -2.4221    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  6  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 12  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20  5  2  0  0  0  0\n 21  3  1  0  0  0  0\n 21  1  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23  2  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25  1  1  0  0  0  0\n 25 26  1  6  0  0  0\n 27 26  2  0  0  0  0\n 28 26  1  0  0  0  0\n 29 24  1  0  0  0  0\n 30 24  1  0  0  0  0\n  2 31  1  6  0  0  0\nM  END",
        "smiles": "Cc1c(c(-c2c(cccc2F)Cl)no1)C(=O)N[C@@H]3C(=O)N4[C@@H](C(=O)O)C(C)(C)S[C@]34[H]",
        "formula": "C19H17ClFN3O5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "453.8735",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3cf6a909-9984-4441-9e83-86d41ab8fa1c",
          "28c7689c-5588-46ee-b4fe-086ea4f40e1c",
          "24dce18b-82f2-4319-98b2-63e484e13c8c"
        ],
        "stereo_centers": 3
      },
      "unii": "43B2M34G2V"
    }
  ]
}