{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a9a4a8cc-730f-438d-937b-d9356338882d",
          "code": "N02CA01",
          "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|ANTIMIGRAINE PREPARATIONS|Ergot alkaloids|dihydroergotamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N02CA01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "a8ee998b-752b-43a3-a954-f94f47409ea8",
          "code": "N0000007621",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Heterocyclic Compounds with 4 or More Rings [Chemical/Ingredient]|Ergotamines [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007621",
          "code_system": "NDF-RT",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "f6e3ba2d-25b7-482f-a39e-a336586e0dd2",
          "code": "N0000007621",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Heterocyclic Compounds [Chemical/Ingredient]|Alkaloids [Chemical/Ingredient]|Ergot Alkaloids [Chemical/Ingredient]|Ergotamines [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007621",
          "code_system": "NDF-RT",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "c36ca516-04f3-4eed-be4b-1ead13459d2c",
          "code": "N0000175766",
          "comments": "Established Pharmacologic Class [EPC]|Ergotamine Derivative [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175766",
          "code_system": "NDF-RT",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "cd7230a9-8e8f-4b82-93c0-068e132d944d",
          "code": "QN02CA51",
          "comments": "VATC|ANALGESICS|ANTIMIGRAINE PREPARATIONS|Ergot alkaloids|dihydroergotamine, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02CA51&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "3f6d60f2-11e7-4f61-baa3-bf34514d508b",
          "code": "QN02CA01",
          "comments": "VATC|ANALGESICS|ANTIMIGRAINE PREPARATIONS|Ergot alkaloids|dihydroergotamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02CA01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "f38f8989-4e54-4e68-96d7-2d9798e63dbb",
          "code": "511-12-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=511-12-6",
          "code_system": "CAS",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195",
            "fd80695a-3d1e-409d-878d-e946c5516859"
          ]
        },
        {
          "uuid": "13628932-0794-4508-a07b-463be18df926",
          "code": "C65387",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65387",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "5a92f8cf-7adc-4111-94a0-daec3168f4ad",
          "code": "309",
          "comments": "LiverTox|CNS|Migraine|Ergot",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Dihydroergotamine.htm",
          "code_system": "LIVERTOX",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "6fee4f1c-8316-45a7-834a-33f0d4890a00",
          "code": "D004087",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68004087",
          "code_system": "MESH",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "9d1770a5-de0b-4840-bb09-23c8ada3a305",
          "code": "DIHYDROERGOTAMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dihydroergotamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "cac76d97-78a8-4bb1-84a6-b260c4a6531f",
          "code": "N02CA51",
          "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|ANTIMIGRAINE PREPARATIONS|Ergot alkaloids|dihydroergotamine, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N02CA51&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "43319ea0-5b1b-456b-8d9d-00ead4bbf290",
          "code": "SUB07139MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "80e2cd39-89a4-4de9-9c79-901b0ea5f5ef",
          "code": "2022",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2022",
          "code_system": "INN",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "faec256c-6de9-417e-ac7b-2145b9d98a9d",
          "code": "208-123-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.386",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "3b7b4de0-f54b-438a-9f6b-5a1aff4a85e7",
          "code": "121",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=121",
          "code_system": "IUPHAR",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "1aa675f8-fd89-4f19-8eed-e70a205b34d8",
          "code": "3418",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/3418/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "9b338c71-8745-48e9-a3a1-efa65710b7f0",
          "code": "m4461",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4461?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "1aacf0ed-0844-4849-ab1f-22e312b89abd",
          "code": "CHEMBL1732",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1732",
          "code_system": "ChEMBL",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "18c385cb-895c-411e-bd55-75da4f99f88a",
          "code": "10531",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10531",
          "code_system": "PUBCHEM",
          "references": [
            "2d88e45a-7624-452d-9451-7863cfe3b195"
          ]
        },
        {
          "uuid": "b997caca-d2ed-2df8-42f7-1becb3571865",
          "code": "DTXSID6045614",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6045614",
          "code_system": "EPA CompTox",
          "references": [
            "889f5166-4ccf-7bdc-75d2-8d0317a15acd"
          ]
        },
        {
          "uuid": "7c7da50d-596a-93b7-5a70-bf17e628f5d9",
          "code": "C66884",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Dopamine Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66884",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4b1ecc09-9179-534f-7728-bedf81b5df60"
          ]
        },
        {
          "uuid": "8672a417-2111-cbb3-8063-22e7aaebccfe",
          "code": "C2198",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2198",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4b1ecc09-9179-534f-7728-bedf81b5df60"
          ]
        },
        {
          "uuid": "43d4f1ed-76ac-4953-a748-8a219337681c",
          "code": "436O5HM03C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "15eaa79f-2d72-7ddb-5f94-49c251d1d405",
          "code": "888",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/888",
          "code_system": "DRUG CENTRAL",
          "references": [
            "4b1ecc09-9179-534f-7728-bedf81b5df60"
          ]
        },
        {
          "uuid": "f6d57a13-940f-b584-b61b-7ad50bf5eb26",
          "code": "DB00320",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB00320",
          "code_system": "DRUG BANK",
          "references": [
            "4b1ecc09-9179-534f-7728-bedf81b5df60"
          ]
        },
        {
          "uuid": "8f1caa8e-99f0-6a2c-d558-8e0dd4c20b9c",
          "code": "4562",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4562",
          "code_system": "CHEBI",
          "references": [
            "4b1ecc09-9179-534f-7728-bedf81b5df60"
          ]
        },
        {
          "uuid": "6e2858cf-991b-dc50-54c3-45938041ffa1",
          "code": "100000082606",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d1df3477-566b-12a4-7161-76dec5bacf12"
          ]
        },
        {
          "uuid": "711f6f4d-1378-f015-cbe5-43e27b2ca7da",
          "code": "436O5HM03C",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=436O5HM03C",
          "code_system": "DAILYMED",
          "references": [
            "a2b7d7ce-68b1-4448-3789-a8b261e324ff"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "878fbc8c-40cd-4f38-b45e-61dc09bd0380",
          "amount": {
            "uuid": "71624e05-35c2-4c6d-9b18-82e184dd0532"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0c7afe0a-0f0a-4f3d-8191-86cd255789d4",
            "refuuid": "eb8bcc06-bd66-4079-b92b-07e7f3515949",
            "name": "DIHYDROERGOTAMINE",
            "unii": "436O5HM03C",
            "linking_id": "436O5HM03C",
            "ref_pname": "DIHYDROERGOTAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b9efae10-84f2-4be1-8017-9e2b2820e601",
          "amount": {
            "uuid": "87c3ef19-4ff4-4a31-a74a-92e3bc340303"
          },
          "qualification": "PLASMA",
          "type": "METABOLITE ACTIVE->PARENT",
          "interaction_type": "MAJOR",
          "related_substance": {
            "uuid": "4b431fc8-d3d4-4b84-a947-5bcc7b4380f7",
            "refuuid": "9f2a8c8c-260a-47a2-b325-1f1e432a2e38",
            "name": "8'-HYDROXYDIHYDROERGOTAMINE",
            "unii": "2T3XF8853Y",
            "linking_id": "2T3XF8853Y",
            "ref_pname": "8'-HYDROXYDIHYDROERGOTAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fb7cf21e-17f6-4de8-9e46-10f5858e51af",
          "amount": {
            "uuid": "655eacfc-d32c-49c7-b66c-cd3b6edc3933"
          },
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MINOR",
          "related_substance": {
            "uuid": "e73b05f5-9dff-4748-834c-39796d61e982",
            "refuuid": "a7f7abf6-04f1-4f63-a70b-0514a135fd8d",
            "name": "DIHYDROLYSERGAMIDE",
            "unii": "08K6N5500V",
            "linking_id": "08K6N5500V",
            "ref_pname": "DIHYDROLYSERGAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8f387dbc-28db-4c10-845f-62491ec09ffc",
          "amount": {
            "uuid": "6e80d77c-d81f-453f-856a-62de13e7c693"
          },
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MINOR",
          "related_substance": {
            "uuid": "6fe049a9-7f7b-4fd0-afb5-be758718a4fa",
            "refuuid": "47d699e7-c4d8-4cfb-b60f-eae0413be7ed",
            "name": "9,10-DIHYDROLYSERGIC ACID",
            "unii": "CT5L8OXT9Q",
            "linking_id": "CT5L8OXT9Q",
            "ref_pname": "9,10-DIHYDROLYSERGIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "677e0cae-25b3-4698-ae56-fe46c7777538",
          "amount": {
            "uuid": "a572eaad-bf8c-4a74-9e64-3da519100e03"
          },
          "qualification": "PLASMA",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MINOR",
          "related_substance": {
            "uuid": "b7e21c69-042b-4c8b-bc09-e684882306dd",
            "refuuid": "1a99fe17-2d75-4142-abb7-3ea5378cd5fb",
            "name": "8'-HYDROXYDIHYDROERGOTAMINE RING-OPENED ACID",
            "unii": "BM3KC3UY3U",
            "linking_id": "BM3KC3UY3U",
            "ref_pname": "8'-HYDROXYDIHYDROERGOTAMINE RING-OPENED ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "81c44066-aac1-42ff-825b-a367939857f3",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "57ab9146-010e-4d29-b96c-12b7beb95db9",
            "refuuid": "60211f3b-b3e6-4fcf-a85c-5a59521592f1",
            "name": "DIHYDROERGOTAMINE MESYLATE",
            "unii": "81AXN7R2QT",
            "linking_id": "81AXN7R2QT",
            "ref_pname": "DIHYDROERGOTAMINE MESYLATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0058eb3d-3327-4ab4-b137-61bc36a9d416",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "68b912e3-8c35-4e2b-aeb0-1800681711cb",
            "refuuid": "dbb565ee-313b-41dc-bd03-cb0834886444",
            "name": "Dihydroergotamine tartrate",
            "unii": "76F2R89O7X",
            "linking_id": "76F2R89O7X",
            "ref_pname": "Dihydroergotamine tartrate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f77f251a-d132-4c3a-9d10-0071556882eb",
          "amount": {
            "uuid": "3e01e9a7-3929-42f7-891f-fa14ba130fbf"
          },
          "type": "PARENT->IMPURITY",
          "references": [
            "b200e368-c533-43e7-b91f-a14814f4f7a2"
          ],
          "related_substance": {
            "uuid": "33314f97-6bab-4e70-b435-302b3186bff5",
            "refuuid": "06da2b25-21a0-440d-9fb3-b45216e2add3",
            "name": "ERGOLOID MESYLATES",
            "unii": "X3S33EX3KW",
            "linking_id": "X3S33EX3KW",
            "ref_pname": "ERGOLOID MESYLATES",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "400c3616-6873-4c14-9434-516035827595",
          "name": "(10α)-5′α-benzyl-12′-hydroxy-2′-methyl-3′,6′,18-trioxo-9,10-dihydroergotaman",
          "stdName": "(10.ALPHA.)-5'.ALPHA.-BENZYL-12'-HYDROXY-2'-METHYL-3',6',18-TRIOXO-9,10-DIHYDROERGOTAMAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b200e368-c533-43e7-b91f-a14814f4f7a2"
          ],
          "display_name": false
        },
        {
          "uuid": "e53629a5-630a-4396-a799-5cab53022939",
          "name": "(5′α,10α)-9,10-Dihydro-12′-hydroxy-2′-methyl-5′-(phenylmethyl)ergotaman-3′,6′,18-trione",
          "stdName": "(5'.ALPHA.,10.ALPHA.)-9,10-DIHYDRO-12'-HYDROXY-2'-METHYL-5'-(PHENYLMETHYL)ERGOTAMAN-3',6',18-TRIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4aa0c9eb-d526-41cc-b024-faabbdf12c18"
          ],
          "display_name": false
        },
        {
          "uuid": "6e161311-e553-4bac-a166-61fa924574e7",
          "name": "9,10-DIHYDROERGOTAMINE",
          "stdName": "9,10-DIHYDROERGOTAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e1e7155-60aa-4d9f-94cf-d07af9ad6162",
            "9fbe8f91-2344-4d13-b698-232e095365cb"
          ],
          "display_name": false
        },
        {
          "uuid": "8b2c6c98-1daf-48bd-bf12-2e2a8e471a87",
          "name": "CODERGOCRINE MESILATE IMPURITY D [EP IMPURITY]",
          "stdName": "CODERGOCRINE MESILATE IMPURITY D [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b200e368-c533-43e7-b91f-a14814f4f7a2"
          ],
          "display_name": false
        },
        {
          "uuid": "03debfe3-b1f7-45c9-ad90-ab5011ca8c1b",
          "name": "DHE",
          "stdName": "DHE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11eff362-4fb7-4898-89e4-6f13c910c854",
            "8e1e7155-60aa-4d9f-94cf-d07af9ad6162"
          ],
          "display_name": false
        },
        {
          "uuid": "92e6768e-d8fd-494a-8b45-f1263350b058",
          "name": "DIHYDROERGOTAMINE",
          "stdName": "DIHYDROERGOTAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0332fdb5-c2a3-4e04-9a9c-89e6f218f112",
            "23b474b8-90b6-4175-841c-a733c455f9ed",
            "efdd8040-6d25-447d-8506-c10f9df0f6e6",
            "9f3a3662-1ada-4f6c-9a54-882ce666d4c3",
            "f02844a1-fbaf-4643-bf0d-bbceab8ea384",
            "cb377d65-8ff1-402c-93c8-a832878a7522",
            "5bbf135e-a885-4a93-ae0d-81d8573d6bf1",
            "a89d0064-2fbd-4c2b-9263-772cd84a2166",
            "a4483b60-bdc4-4c6c-9c33-12813a7e282c",
            "8e1e7155-60aa-4d9f-94cf-d07af9ad6162",
            "40a05642-aea5-434a-bf69-f15c3a3e093c",
            "4f6130c5-1a3a-483d-b3ea-439c1f29d342"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "77690f71-b537-46c9-aedb-9e3a7a0dc073",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "3cf29d53-3dd4-490c-91e1-3b8c90a80c97",
          "name": "DIHYDROERGOTAMINE [MART.]",
          "stdName": "DIHYDROERGOTAMINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4483b60-bdc4-4c6c-9c33-12813a7e282c"
          ],
          "display_name": false
        },
        {
          "uuid": "728d6597-b1cb-47b4-b8ce-747f8c2f5ad6",
          "name": "DIHYDROERGOTAMINE [MI]",
          "stdName": "DIHYDROERGOTAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f3a3662-1ada-4f6c-9a54-882ce666d4c3",
            "8e1e7155-60aa-4d9f-94cf-d07af9ad6162"
          ],
          "display_name": false
        },
        {
          "uuid": "4a963a62-b731-44d4-9353-625ce97818cb",
          "name": "DIHYDROERGOTAMINE [VANDF]",
          "stdName": "DIHYDROERGOTAMINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23b474b8-90b6-4175-841c-a733c455f9ed",
            "8e1e7155-60aa-4d9f-94cf-d07af9ad6162"
          ],
          "display_name": false
        },
        {
          "uuid": "f86db89e-9ac4-b280-429f-43924c17a796",
          "name": "Dihydroergotamine [WHO-DD]",
          "stdName": "DIHYDROERGOTAMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "068637e1-fcbc-d12d-2258-145f770a0e16"
          ],
          "display_name": false
        },
        {
          "uuid": "2ebcff86-2993-46d4-88b5-6ab351640e35",
          "name": "MAP-0004",
          "stdName": "MAP-0004",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8a2615a-f55d-4d9c-980c-30b8fc8f6ff8",
            "8e1e7155-60aa-4d9f-94cf-d07af9ad6162"
          ],
          "display_name": false
        },
        {
          "uuid": "48964989-20db-48e1-a040-584d98d2aec2",
          "name": "MAP0004",
          "stdName": "MAP0004",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8021d878-e9a1-4d6a-84a0-b9bfc0ed52ce",
            "8e1e7155-60aa-4d9f-94cf-d07af9ad6162"
          ],
          "display_name": false
        },
        {
          "uuid": "27296330-ae2f-4deb-9782-21f8f631aecf",
          "name": "NEOMIGRAN",
          "stdName": "NEOMIGRAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d9677a2-2768-4c1a-a5bd-15914de4abb9",
            "3760bea3-91a8-44fc-9ec4-4d78574b579f"
          ],
          "display_name": false
        },
        {
          "uuid": "84b2996b-095b-4ae4-be62-3f8a988e08fa",
          "name": "dihydroergotamine [INN]",
          "stdName": "DIHYDROERGOTAMINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f02844a1-fbaf-4643-bf0d-bbceab8ea384"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cb377d65-8ff1-402c-93c8-a832878a7522",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f02844a1-fbaf-4643-bf0d-bbceab8ea384",
          "citation": "INN Proposed List 16",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL16.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a4483b60-bdc4-4c6c-9c33-12813a7e282c",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f3a3662-1ada-4f6c-9a54-882ce666d4c3",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e1e7155-60aa-4d9f-94cf-d07af9ad6162",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d9677a2-2768-4c1a-a5bd-15914de4abb9",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3760bea3-91a8-44fc-9ec4-4d78574b579f",
          "citation": "D07837",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efdd8040-6d25-447d-8506-c10f9df0f6e6",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9fbe8f91-2344-4d13-b698-232e095365cb",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8021d878-e9a1-4d6a-84a0-b9bfc0ed52ce",
          "citation": "http://www.ncbi.nlm.nih.gov/pubmed/21964172",
          "url": "http://www.ncbi.nlm.nih.gov/pubmed/21964172",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8a2615a-f55d-4d9c-980c-30b8fc8f6ff8",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23b474b8-90b6-4175-841c-a733c455f9ed",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11eff362-4fb7-4898-89e4-6f13c910c854",
          "citation": "http://www.medscape.com/viewarticle/561217_3",
          "url": "http://www.medscape.com/viewarticle/561217_3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d88e45a-7624-452d-9451-7863cfe3b195",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390316000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38613a32-be80-4639-835e-8a8f2800b755",
          "citation": "EUROPEAN JOURNAL OF CLINICAL PHARMACOLOGY, 1984, VOLUME 26, ISSUE 4, PP 463-470",
          "url": "http://www.accessdata.fda.gov/spl/data/fc7ecab9-7fef-4201-bea7-f8ce6783f840/fc7ecab9-7fef-4201-bea7-f8ce6783f840.xml",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc922f21-d291-4ddf-8d82-a7e77748b119",
          "citation": "EUROPEAN JOURNAL OF CLINICAL PHARMACOLOGY, 1984, VOLUME 26, ISSUE 4, PP 463-470",
          "url": "http://link.springer.com/article/10.1007/BF00542142",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fbe0132-f27a-4be8-ad6e-9321419d67d5",
          "citation": "EUROPEAN JOURNAL OF CLINICAL PHARMACOLOGY, 1984, VOLUME 26, ISSUE 4, PP 463-470",
          "url": "http://link.springer.com/article/10.1007/BF00542142#page-1",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab19d2f3-472e-4b3a-835b-d4c27a77d3e1",
          "citation": "SRS import [436O5HM03C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=436O5HM03C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390316000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0332fdb5-c2a3-4e04-9a9c-89e6f218f112",
          "citation": "DIHYDROERGOTAMINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "40a05642-aea5-434a-bf69-f15c3a3e093c",
          "citation": "DIHYDROERGOTAMINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4f6130c5-1a3a-483d-b3ea-439c1f29d342",
          "citation": "DIHYDROERGOTAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5bbf135e-a885-4a93-ae0d-81d8573d6bf1",
          "citation": "DIHYDROERGOTAMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a89d0064-2fbd-4c2b-9263-772cd84a2166",
          "citation": "DIHYDROERGOTAMINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "889f5166-4ccf-7bdc-75d2-8d0317a15acd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=511-12-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d1df3477-566b-12a4-7161-76dec5bacf12",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "4b1ecc09-9179-534f-7728-bedf81b5df60",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fd80695a-3d1e-409d-878d-e946c5516859",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "068637e1-fcbc-d12d-2258-145f770a0e16",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4aa0c9eb-d526-41cc-b024-faabbdf12c18",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b200e368-c533-43e7-b91f-a14814f4f7a2",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a2b7d7ce-68b1-4448-3789-a8b261e324ff",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a161a765-345d-4913-8a73-70598787c446",
          "id": "a161a765-345d-4913-8a73-70598787c446",
          "molfile": "\n  Marvin  01132108232D          \n\n 43 50  0  0  1  0            999 V2000\n    2.3228    0.4541    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.3228    1.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6269    1.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6269    0.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0389    0.0931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0506   -0.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7375   -1.2458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4626   -1.1294    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.8672   -1.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4626   -2.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6446   -2.5848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2342   -3.3154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6330   -4.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4684   -4.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8905   -3.2863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6242   -0.7393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8471   -0.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3930   -1.6475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3522   -0.2824    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.3493    0.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4279   -0.0117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1556   -0.4017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8862   -0.0145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1556   -1.2255    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -0.4599   -1.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4366   -2.4480    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    0.2794   -2.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1556   -2.8526    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -1.1847   -3.7520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9386   -4.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2064   -4.8960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1146   -4.8669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3009   -4.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0199   -3.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0199   -2.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3009   -2.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5993   -2.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5993   -3.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8804   -2.4480    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -1.8804   -1.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8471    0.3202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6242    0.0524    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.6242    0.8762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  5  1  1  0  0  0  0\n  1 42  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 16  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 16 42  1  0  0  0  0\n 18 17  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 21  1  0  0  0  0\n 19 41  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 22  1  1  0  0  0\n 25 24  1  0  0  0  0\n 40 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 26  1  6  0  0  0\n 28 29  1  0  0  0  0\n 28 39  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  2  0  0  0  0\n 30 38  1  0  0  0  0\n 32 31  1  0  0  0  0\n 32 33  1  0  0  0  0\n 34 33  1  0  0  0  0\n 33 38  2  0  0  0  0\n 35 34  2  0  0  0  0\n 35 36  1  0  0  0  0\n 36 37  2  0  0  0  0\n 38 37  1  0  0  0  0\n 39 37  1  0  0  0  0\n 39 40  1  1  0  0  0\n 42 41  1  0  0  0  0\n 42 43  1  6  0  0  0\nM  END",
          "smiles": "C[C@@]1(C(=O)N2[C@@H](Cc3ccccc3)C(=O)N4CCC[C@H]4[C@]2(O)O1)NC(=O)[C@@H]5C[C@@H]6c7cccc8c7c(C[C@H]6N(C)C5)c[nH]8",
          "formula": "C33H37N5O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d615362d-9642-4254-8666-e3f106125766"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "583.6786",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "eb8bcc06-bd66-4079-b92b-07e7f3515949",
      "version": "21",
      "structure": {
        "id": "502026db-be9e-4beb-8ae7-00e2c43b41bf",
        "molfile": "\n  Marvin  01132104112D          \n\n 46 53  0  0  1  0            999 V2000\n    1.6242    0.0524    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.6242   -0.7393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8471    0.3202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3522   -0.2824    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.8471   -0.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0506   -0.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4626   -1.1294    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.0389    0.0931    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8804   -2.4480    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -1.9386   -4.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3228    0.4541    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -1.1556   -2.8526    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.5993   -2.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4279   -0.0117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4366   -2.4480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1556   -1.2255    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.5993   -3.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1556   -0.4017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1847   -3.7520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8804   -1.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2064   -4.8960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1146   -4.8669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4599   -1.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3009   -4.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8672   -1.8513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7375   -1.2458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6242    0.8762    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3930   -1.6475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8862   -0.0145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6269    0.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3493    0.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3009   -2.4480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2794   -2.8643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4626   -2.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3228    1.1760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6269    1.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0199   -2.8526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0199   -3.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6446   -2.5848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8905   -3.2863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2342   -3.3154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4684   -4.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6330   -4.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5993   -2.0347    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5094   -3.3678    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3636   -0.3697    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  8  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8 11  1  0  0  0  0\n  9 20  1  0  0  0  0\n 10 19  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12 15  1  0  0  0  0\n 13  9  1  0  0  0  0\n  4 14  1  6  0  0  0\n 15 23  1  0  0  0  0\n 16 18  1  1  0  0  0\n 17 13  1  0  0  0  0\n 18 14  1  0  0  0  0\n 19 12  1  0  0  0  0\n 20 16  1  0  0  0  0\n 21 10  2  0  0  0  0\n 22 24  1  0  0  0  0\n 23 16  1  0  0  0  0\n 24 17  2  0  0  0  0\n  7 25  1  6  0  0  0\n 26  6  2  0  0  0  0\n  1 27  1  6  0  0  0\n 28  5  2  0  0  0  0\n 29 18  2  0  0  0  0\n 30  8  1  0  0  0  0\n  4 31  1  1  0  0  0\n 32 13  2  0  0  0  0\n 33 15  1  0  0  0  0\n 34 25  1  0  0  0  0\n 35 11  1  0  0  0  0\n 36 35  1  0  0  0  0\n 37 32  1  0  0  0  0\n 38 24  1  0  0  0  0\n 39 34  1  0  0  0  0\n 40 34  2  0  0  0  0\n 41 39  2  0  0  0  0\n 42 40  1  0  0  0  0\n 43 41  1  0  0  0  0\n  9 44  1  6  0  0  0\n 12 45  1  1  0  0  0\n 11 46  1  1  0  0  0\n  7  6  1  0  0  0  0\n  5  4  1  0  0  0  0\n 36 30  1  0  0  0  0\n 42 43  2  0  0  0  0\n 12  9  1  0  0  0  0\n 10 17  1  0  0  0  0\n 22 21  1  0  0  0  0\n 37 38  2  0  0  0  0\nM  END",
        "smiles": "C[C@@]1(C(=O)N2[C@@H](Cc3ccccc3)C(=O)N4CCC[C@@]4([H])[C@]2(O)O1)NC(=O)[C@@H]5C[C@]6([H])c7cccc8c7c(C[C@@]6([H])N(C)C5)c[nH]8",
        "formula": "C33H37N5O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "583.6786",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ab19d2f3-472e-4b3a-835b-d4c27a77d3e1",
          "cb377d65-8ff1-402c-93c8-a832878a7522",
          "f02844a1-fbaf-4643-bf0d-bbceab8ea384"
        ],
        "stereo_centers": 7
      },
      "unii": "436O5HM03C"
    }
  ]
}