{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f6d9c83b-b106-417f-a317-8bcdbabf08f9", "code": "174533-99-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=174533-99-4", "code_system": "CAS", "references": [ "d7fd4da9-7237-4787-89be-bd29b50922b3", "2f7576a2-3004-4593-bf02-83a794646885" ] }, { "uuid": "3c0dcd42-8465-be0f-203d-064f34171867", "code": "DTXSID30425666", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30425666", "code_system": "EPA CompTox", "references": [ "b9136009-34f7-da1f-22eb-18b70691df81" ] }, { "uuid": "7f4f7cbe-042a-de6c-cdff-f24016406545", "code": "4915666", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4915666", "code_system": "PUBCHEM", "references": [ "9187a88b-1f69-18fb-2c03-a27f14928bb4" ] }, { "uuid": "a5e64e7a-2a17-40c9-b965-9d613ec5daae", "code": "4344168F5E", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "9cdb7e71-88cc-4222-8a60-87f6d2680f24", "name": "1H-BENZIMIDAZOLE-6-CARBOXYLIC ACID, 2-(3,4-DIHYDROXYPHENYL)-", "stdName": "1H-BENZIMIDAZOLE-6-CARBOXYLIC ACID, 2-(3,4-DIHYDROXYPHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f63a531c-0f2e-40d9-ad16-93b9ae4aaa0c", "c0c7795a-8fdd-4767-aa24-df2bad491e38" ], "display_name": false }, { "uuid": "530baf2f-4da5-4280-b04c-60ecb40bc151", "name": "3,4-DIHYDROXY-2-PHENYL-1H-BENZIMIDAZOLE-5-CARBOXYLIC ACID", "stdName": "3,4-DIHYDROXY-2-PHENYL-1H-BENZIMIDAZOLE-5-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d938c455-f325-4b29-aa22-8ee37e2d237b", "f63a531c-0f2e-40d9-ad16-93b9ae4aaa0c" ], "display_name": true } ], "references": [ { "uuid": "d938c455-f325-4b29-aa22-8ee37e2d237b", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "f63a531c-0f2e-40d9-ad16-93b9ae4aaa0c", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c0c7795a-8fdd-4767-aa24-df2bad491e38", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d7fd4da9-7237-4787-89be-bd29b50922b3", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393363000, "tags": [ "NOMEN" ] }, { "uuid": "83f65d3f-45ac-440c-9828-966b0e7b541f", "citation": "SRS import [4344168F5E]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4344168F5E", "doc_type": "SRS", "public_domain": true, "document_date": 1493393363000, "tags": [ "NOMEN" ] }, { "uuid": "b9136009-34f7-da1f-22eb-18b70691df81", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=174533-99-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9187a88b-1f69-18fb-2c03-a27f14928bb4", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "2f7576a2-3004-4593-bf02-83a794646885", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e5a3ce35-dce2-4649-8efa-a1b08c291c2d", "id": "e5a3ce35-dce2-4649-8efa-a1b08c291c2d", "molfile": "\n Marvin 01132111532D \n\n 20 22 0 0 0 0 999 V2000\n 10.6766 -9.0470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6767 -8.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9624 -7.8093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3914 -7.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3915 -6.9846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1062 -6.5723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8205 -6.9850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6053 -6.7302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0900 -7.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6050 -8.0651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8204 -7.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1057 -8.2223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9151 -7.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3274 -8.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1523 -8.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5650 -7.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3900 -7.3987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1527 -6.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5654 -5.9695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3277 -6.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 12 4 2 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 11 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 13 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 20 13 2 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 16 2 0 0 0 0\n 19 18 1 0 0 0 0\n 18 20 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1C(=O)O)nc(-c3ccc(c(c3)O)O)[nH]2", "formula": "C14H10N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "42872610-5421-4dbc-8328-ba60460697cf" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "270.2407", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e903bc1f-0066-44e1-9bd4-58af5f7f6d05", "version": "5", "structure": { "id": "a43eea59-46a0-46f4-bfb6-428ee5f5a4c2", "molfile": "\n Marvin 01132108322D \n\n 20 22 0 0 0 0 999 V2000\n 16.5654 -5.9695 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1527 -6.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5650 -7.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.3900 -7.3987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1523 -8.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3274 -8.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9151 -7.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0900 -7.3978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6053 -6.7302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8205 -6.9850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1062 -6.5723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3915 -6.9846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3914 -7.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6767 -8.2220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6766 -9.0470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9624 -7.8093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1057 -8.2223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8204 -7.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6050 -8.0651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3277 -6.6837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 1 0 0 0 0\n 17 13 2 0 0 0 0\n 18 17 1 0 0 0 0\n 18 10 2 0 0 0 0\n 19 18 1 0 0 0 0\n 8 19 2 0 0 0 0\n 20 7 2 0 0 0 0\n 2 20 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1C(=O)O)nc(-c3ccc(c(c3)O)O)[nH]2", "formula": "C14H10N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "270.2407", "optical_activity": "NONE", "references": [ "c0c7795a-8fdd-4767-aa24-df2bad491e38", "83f65d3f-45ac-440c-9828-966b0e7b541f" ], "stereo_centers": 0 }, "unii": "4344168F5E" } ] }