{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0511de70-aa70-4d11-8a5b-f002bf7ee8cc", "code": "1182-66-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1182-66-7", "code_system": "CAS", "references": [ "99b37975-28f9-4b39-8713-25489bafd83a", "10743dc6-2a84-4cc7-92e5-6beb43ea2127" ] }, { "uuid": "d7e6a62d-c043-4c1c-b868-d16f68feee3a", "code": "C012836", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67012836", "code_system": "MESH", "references": [ "99b37975-28f9-4b39-8713-25489bafd83a" ] }, { "uuid": "c02ff944-259c-47b0-9a7d-fb76975c9e03", "code": "CHOLESTERYL NONANOATE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Cholesteryl_nonanoate", "code_system": "WIKIPEDIA", "references": [ "99b37975-28f9-4b39-8713-25489bafd83a" ] }, { "uuid": "d9cef434-b757-4bd2-9e3b-ddd57cc308e1", "code": "1362887", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1362887/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "99b37975-28f9-4b39-8713-25489bafd83a" ] }, { "uuid": "1ba87956-cdd5-43c9-9f0d-dcb1b996dc52", "code": "214-658-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.013.326", "code_system": "ECHA (EC/EINECS)", "references": [ "99b37975-28f9-4b39-8713-25489bafd83a" ] }, { "uuid": "e311f1f5-c421-4b4b-bc0e-64bb1bf49bd7", "code": "2723614", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2723614", "code_system": "PUBCHEM", "references": [ "99b37975-28f9-4b39-8713-25489bafd83a" ] }, { "uuid": "9a99265c-8036-4e9e-99c7-5afa3d469e32", "code": "4313O7P4XW", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b80b4496-068e-804f-bac9-cdc502495fb5", "code": "DTXSID70889364", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70889364", "code_system": "EPA CompTox" }, { "uuid": "a7e743c8-59c9-b004-e115-19e251861d06", "code": "4313O7P4XW", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=4313O7P4XW", "code_system": "DAILYMED", "references": [ "4e374652-c72d-47ab-d3eb-ed02ee18733f" ] } ], "substance_class": "chemical", "names": [ { "uuid": "c9e7613a-5b4f-465c-b0a0-f0511e93e9f6", "name": "CHOLESTERIN PELARGONATE", "stdName": "CHOLESTERIN PELARGONATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e50f4986-ceff-49eb-a76f-12bbabdeb5d7", "09dd2775-00af-42fb-8983-8b3dfd2cf595" ], "display_name": false }, { "uuid": "6d6c374f-7015-42e0-9370-16edb833a96d", "name": "CHOLESTERYL NONANOATE", "stdName": "CHOLESTERYL NONANOATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "5762edaf-0901-43db-92a7-41707ba3a4f1", "3bbd1bd6-1c6c-46d7-a35a-943612e6e523", "e50f4986-ceff-49eb-a76f-12bbabdeb5d7", "09dd2775-00af-42fb-8983-8b3dfd2cf595" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "2b9245f2-76c6-4c9c-8493-89aa607d3722", "name_org": "INCI" } ] }, { "uuid": "5e483b50-5cf8-4899-aa20-1b3c25ec4220", "name": "CHOLESTERYL NONYLATE", "stdName": "CHOLESTERYL NONYLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e50f4986-ceff-49eb-a76f-12bbabdeb5d7", "09dd2775-00af-42fb-8983-8b3dfd2cf595" ], "display_name": false }, { "uuid": "84c75d68-d46b-42c1-8fb9-09a4d9f2037e", "name": "CHOLESTERYL PELARGONATE", "stdName": "CHOLESTERYL PELARGONATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e50f4986-ceff-49eb-a76f-12bbabdeb5d7", "09dd2775-00af-42fb-8983-8b3dfd2cf595" ], "display_name": false }, { "uuid": "49ef0867-8c25-4c59-9384-0f2ba4db57aa", "name": "YOFCO LC-CN", "stdName": "YOFCO LC-CN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e50f4986-ceff-49eb-a76f-12bbabdeb5d7", "09dd2775-00af-42fb-8983-8b3dfd2cf595" ], "display_name": false } ], "references": [ { "uuid": "e50f4986-ceff-49eb-a76f-12bbabdeb5d7", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "09dd2775-00af-42fb-8983-8b3dfd2cf595", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5762edaf-0901-43db-92a7-41707ba3a4f1", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "99b37975-28f9-4b39-8713-25489bafd83a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389678000, "tags": [ "NOMEN" ] }, { "uuid": "07265efd-844c-42b1-8f29-b9f6cf09b08d", "citation": "SRS import [4313O7P4XW]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=4313O7P4XW", "doc_type": "SRS", "public_domain": true, "document_date": 1493389678000, "tags": [ "NOMEN" ] }, { "uuid": "3bbd1bd6-1c6c-46d7-a35a-943612e6e523", "citation": "CHOLESTERYL NONANOATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "10743dc6-2a84-4cc7-92e5-6beb43ea2127", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "4e374652-c72d-47ab-d3eb-ed02ee18733f", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c6c9afc0-fee4-46f0-8625-514408ae8380", "id": "c6c9afc0-fee4-46f0-8625-514408ae8380", "molfile": "\n Marvin 01132110162D \n\n 38 41 0 0 1 0 999 V2000\n 5.2696 -0.5490 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 4.5551 -0.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9843 -0.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6989 -0.5462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4077 -0.1307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1224 -0.5433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1136 -1.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8312 -0.1278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2726 -1.3683 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.7490 -2.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2493 -2.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4679 -2.4402 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 3.7474 -2.8440 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 3.7474 -3.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0328 -4.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3182 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6064 -4.0670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9006 -3.6574 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 0.9006 -2.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6064 -2.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3210 -2.8324 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 2.3153 -2.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0357 -2.4228 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 3.0445 -1.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7649 -1.1881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4854 -1.6094 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 4.4824 -0.7873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1830 -4.0640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5316 -3.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5316 -2.8266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2462 -4.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9609 -3.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6784 -4.0525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3931 -3.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1077 -4.0525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8223 -3.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5369 -4.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2516 -3.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 9 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 26 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 1 0 0 0\n 12 13 1 0 0 0 0\n 26 12 1 0 0 0 0\n 13 14 1 6 0 0 0\n 13 23 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 16 1 0 0 0 0\n 21 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 28 1 1 0 0 0\n 19 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 1 0 0 0\n 23 21 1 0 0 0 0\n 23 24 1 1 0 0 0\n 24 25 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 1 0 0 0\n 29 28 1 0 0 0 0\n 30 29 2 0 0 0 0\n 31 29 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1", "formula": "C36H62O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a34cd7bd-cabb-42e1-b621-1f3c72abdcec" }, "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "526.8776", "optical_activity": "UNSPECIFIED", "stereo_centers": 8 } ], "definition_level": "COMPLETE", "uuid": "57366571-f47c-42ec-923e-5a1583992471", "version": "5", "structure": { "id": "eb57ce68-9337-4047-8ccf-7754ed19c285", "molfile": "\n Marvin 01132112102D \n\n 42 45 0 0 1 0 999 V2000\n 4.4854 -1.6094 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.3210 -2.8324 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.3182 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4679 -2.4402 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.0357 -2.4228 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.7474 -2.8440 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.2726 -1.3683 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.0328 -4.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7649 -1.1881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7474 -3.6661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0445 -1.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2493 -2.7074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6064 -2.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7490 -2.0422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6064 -4.0670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5316 -3.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1830 -4.0640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9006 -3.6574 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -0.5316 -2.8266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2696 -0.5490 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.9006 -2.8324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4824 -0.7873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3153 -2.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6989 -0.5462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.2462 -4.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9843 -0.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5551 -0.1394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4077 -0.1307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1224 -0.5433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.9609 -3.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.5369 -4.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8223 -3.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1077 -4.0525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6784 -4.0525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.3931 -3.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1136 -1.3653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8312 -0.1278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.2516 -3.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7417 -2.0247 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9814 -0.9471 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0299 -3.2449 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4592 -3.2594 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 5 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 1 1 0 0 0 0\n 8 10 1 0 0 0 0\n 9 1 1 0 0 0 0\n 10 6 1 0 0 0 0\n 11 9 1 0 0 0 0\n 12 4 1 0 0 0 0\n 13 2 1 0 0 0 0\n 14 7 1 0 0 0 0\n 15 3 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 1 0 0 0\n 18 21 1 0 0 0 0\n 19 16 2 0 0 0 0\n 20 7 1 0 0 0 0\n 21 13 1 0 0 0 0\n 1 22 1 1 0 0 0\n 2 23 1 1 0 0 0\n 24 26 1 0 0 0 0\n 25 16 1 0 0 0 0\n 26 20 1 0 0 0 0\n 20 27 1 6 0 0 0\n 28 24 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 25 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 35 1 0 0 0 0\n 34 30 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 29 1 0 0 0 0\n 37 29 1 0 0 0 0\n 38 31 1 0 0 0 0\n 6 39 1 1 0 0 0\n 7 40 1 6 0 0 0\n 5 41 1 6 0 0 0\n 4 42 1 6 0 0 0\n 14 12 1 0 0 0 0\n 11 5 1 0 0 0 0\n 8 3 2 0 0 0 0\n 15 18 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@]32[H])C1", "formula": "C36H62O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "526.8776", "optical_activity": "UNSPECIFIED", "references": [ "e50f4986-ceff-49eb-a76f-12bbabdeb5d7", "07265efd-844c-42b1-8f29-b9f6cf09b08d" ], "stereo_centers": 8 }, "unii": "4313O7P4XW" } ] }