{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d219fda3-b0e3-454b-9769-1c17a4898a22",
          "code": "7425-14-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7425-14-1",
          "code_system": "CAS",
          "references": [
            "3a942c02-d241-4a72-b618-d65e8c259dad",
            "d87d4781-5b54-44a1-9fbb-b4cb83c945fd"
          ]
        },
        {
          "uuid": "e8e99998-ea8d-4f0c-bdeb-14bdb9461937",
          "code": "231-057-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.234",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3a942c02-d241-4a72-b618-d65e8c259dad"
          ]
        },
        {
          "uuid": "8e9becc0-ddbc-4c68-9e87-308163950dc3",
          "code": "1313265",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1313265/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3a942c02-d241-4a72-b618-d65e8c259dad"
          ]
        },
        {
          "uuid": "b3f70188-af56-4139-af00-caebfeba1c5e",
          "code": "23906",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23906",
          "code_system": "PUBCHEM",
          "references": [
            "3a942c02-d241-4a72-b618-d65e8c259dad"
          ]
        },
        {
          "uuid": "1d7fd267-a199-9cfb-316c-927e483bb94d",
          "code": "DTXSID9052478",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9052478",
          "code_system": "EPA CompTox",
          "references": [
            "64129c7d-3d0e-2d7f-13b4-f7843ae5df2c"
          ]
        },
        {
          "uuid": "01b42670-2e4c-4f60-a622-62bccab3fe65",
          "code": "SUB96259",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e252058e-49d4-9f4c-c46a-0ccfe396eadd"
          ]
        },
        {
          "uuid": "7c60232b-7e9b-431a-b637-dd85462a2c31",
          "code": "430RJA6715",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0ba2a722-1502-e833-cbbe-d3efe2fa96db",
          "code": "100000141702",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c481a58f-dd7e-82b8-a1de-56e4fd31126c"
          ]
        },
        {
          "uuid": "cb2e57c7-595b-3c7d-2b96-97574c83fd78",
          "code": "430RJA6715",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=430RJA6715",
          "code_system": "DAILYMED",
          "references": [
            "c9c92f2f-b0fd-0da9-58c4-b3f235d759fd"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e6065dd3-a41d-495c-8196-4b2f3c268671",
          "name": "2-ETHYLHEXYL 2-ETHYLHEXANOATE",
          "stdName": "2-ETHYLHEXYL 2-ETHYLHEXANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "747cee3e-2f75-4670-82c1-327652a4b429"
          ],
          "display_name": false
        },
        {
          "uuid": "f57726aa-2e80-4baa-9b49-59d8a9611d95",
          "name": "ETHYLHEXYL ETHYLHEXANOATE",
          "stdName": "ETHYLHEXYL ETHYLHEXANOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af98086b-86f9-4c17-9e47-dee23fdc261a",
            "26335d44-136a-4a37-83bf-68ecf115f2d8",
            "747cee3e-2f75-4670-82c1-327652a4b429",
            "7068e4d8-ad6b-4efd-83aa-9f5eb091d885"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "55df2fd7-e370-4f33-be98-1d873aa08618",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5103b9a2-c1de-485d-8690-d1ab5815b997",
          "name": "HEXANOIC ACID, 2-ETHYL, 2-ETHYLHEXYL ESTER",
          "stdName": "HEXANOIC ACID, 2-ETHYL, 2-ETHYLHEXYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af98086b-86f9-4c17-9e47-dee23fdc261a",
            "26335d44-136a-4a37-83bf-68ecf115f2d8"
          ],
          "display_name": false
        },
        {
          "uuid": "4ed9671a-6459-4fb8-98ca-ef54be81f864",
          "name": "OCTYL OCTANOATE (RIFM)",
          "stdName": "OCTYL OCTANOATE (RIFM)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af98086b-86f9-4c17-9e47-dee23fdc261a",
            "26335d44-136a-4a37-83bf-68ecf115f2d8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "747cee3e-2f75-4670-82c1-327652a4b429",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "af98086b-86f9-4c17-9e47-dee23fdc261a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26335d44-136a-4a37-83bf-68ecf115f2d8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a942c02-d241-4a72-b618-d65e8c259dad",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390169000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c50e6dd8-57d0-4191-b34d-61a2d37c1d71",
          "citation": "SRS import [430RJA6715]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=430RJA6715",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390169000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7068e4d8-ad6b-4efd-83aa-9f5eb091d885",
          "citation": "ETHYLHEXYL ETHYLHEXANOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "64129c7d-3d0e-2d7f-13b4-f7843ae5df2c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7425-14-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c481a58f-dd7e-82b8-a1de-56e4fd31126c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e252058e-49d4-9f4c-c46a-0ccfe396eadd",
          "citation": "EVMPD",
          "doc_type": "EVMPD",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "d87d4781-5b54-44a1-9fbb-b4cb83c945fd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c9c92f2f-b0fd-0da9-58c4-b3f235d759fd",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e79df72c-ce35-4746-bbcc-a1316d9c0601",
          "id": "e79df72c-ce35-4746-bbcc-a1316d9c0601",
          "molfile": "\n  Marvin  01132111592D          \n\n 18 17  0  0  0  0            999 V2000\n    0.0000   -1.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7138   -0.8017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -1.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1439   -0.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8577   -1.2258    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.8499   -2.0508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1362   -2.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5766   -0.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2827   -1.2336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0068   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0068    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7128   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.7128   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9913   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4343   -0.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1455   -1.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8619   -0.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5757   -1.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 15 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)C(CC)CCCC",
          "formula": "C16H32O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dd5bd395-9e72-4875-9c41-ca21500ec121"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "256.4247",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9d0963f6-1e5c-4d0d-a9f4-c4bfb9eb3e8a",
      "version": "7",
      "structure": {
        "id": "ecafaadf-5408-4077-a054-bdbe63ce7853",
        "molfile": "\n  Marvin  01132112142D          \n\n 18 17  0  0  0  0            999 V2000\n    5.0068   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2827   -1.2336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0068    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7128   -1.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5766   -0.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8577   -1.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7128   -2.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4343   -0.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8499   -2.0508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1439   -0.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1455   -1.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8619   -0.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7138   -0.8017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4302   -1.2181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9913   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1362   -2.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5757   -1.2646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  6  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15  7  1  0  0  0  0\n 16  9  1  0  0  0  0\n 17 12  1  0  0  0  0\n 18 13  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)C(CC)CCCC",
        "formula": "C16H32O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "256.4247",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "747cee3e-2f75-4670-82c1-327652a4b429",
          "c50e6dd8-57d0-4191-b34d-61a2d37c1d71"
        ],
        "stereo_centers": 2
      },
      "unii": "430RJA6715"
    }
  ]
}